diff --git a/.changeset/good-badgers-train.md b/.changeset/good-badgers-train.md deleted file mode 100644 index b47a4aaf081591308332fbf23ed0166960978071..0000000000000000000000000000000000000000 --- a/.changeset/good-badgers-train.md +++ /dev/null @@ -1,5 +0,0 @@ ---- -"llamaindex": patch ---- - -Add HTMLReader (thanks @mtutty) diff --git a/.github/ISSUE_TEMPLATE/sweep-bugfix.yml b/.github/ISSUE_TEMPLATE/bugfix.yml similarity index 90% rename from .github/ISSUE_TEMPLATE/sweep-bugfix.yml rename to .github/ISSUE_TEMPLATE/bugfix.yml index 16dae7ec849ee48880a715365d2f8da9ff33f6ac..bb8c310bae44b3d4fa9b1f4d7e9eecf613b47262 100644 --- a/.github/ISSUE_TEMPLATE/sweep-bugfix.yml +++ b/.github/ISSUE_TEMPLATE/bugfix.yml @@ -1,7 +1,6 @@ name: Bugfix -title: "Sweep: " +title: "" description: Write something like "We notice ... behavior when ... happens instead of ..."" -labels: sweep body: - type: textarea id: description diff --git a/.github/ISSUE_TEMPLATE/sweep-feature.yml b/.github/ISSUE_TEMPLATE/feature.yml similarity index 68% rename from .github/ISSUE_TEMPLATE/sweep-feature.yml rename to .github/ISSUE_TEMPLATE/feature.yml index 2c041b3035a030673a04e2e8cf199852f73f49eb..e40729e93afb3e2c9b07a23da1f2b381fb676f2e 100644 --- a/.github/ISSUE_TEMPLATE/sweep-feature.yml +++ b/.github/ISSUE_TEMPLATE/feature.yml @@ -1,11 +1,10 @@ name: Feature Request -title: "Sweep: " -description: Write something like "Write an api endpoint that does "..." in the "..." file" -labels: sweep +title: "" +description: Write something like "Write an api endpoint that does "..." in the "..." file". If you would like to use sweep.dev prefix with "Sweep:" body: - type: textarea id: description attributes: label: Details - description: More details for Sweep + description: More details placeholder: The new endpoint should use the ... class from ... file because it contains ... logic diff --git a/.github/ISSUE_TEMPLATE/sweep-refactor.yml b/.github/ISSUE_TEMPLATE/refactor.yml similarity index 63% rename from .github/ISSUE_TEMPLATE/sweep-refactor.yml rename to .github/ISSUE_TEMPLATE/refactor.yml index 2fac8ffd314280321228651e7c830fbc3f0575d2..2eeaadaca9e6037e68d72517b2adb05ecf719533 100644 --- a/.github/ISSUE_TEMPLATE/sweep-refactor.yml +++ b/.github/ISSUE_TEMPLATE/refactor.yml @@ -1,11 +1,10 @@ name: Refactor -title: "Sweep: " -description: Write something like "Modify the ... api endpoint to use ... version and ... framework" -labels: sweep +title: "" +description: Write something like "Modify the ... api endpoint to use ... version and ... framework" If you would like to use sweep.dev prefix with "Sweep:" body: - type: textarea id: description attributes: label: Details - description: More details for Sweep + description: More details placeholder: We are migrating this function to ... version because ... diff --git a/.gitignore b/.gitignore index 5e8442ca83d1e14009ac473a4a4aaa04f01abade..2012eca47ffc42825f940fb71786d78f65a47d0e 100644 --- a/.gitignore +++ b/.gitignore @@ -37,3 +37,6 @@ yarn-error.log* .vercel dist/ + +# vs code +.vscode/launch.json diff --git a/.husky/pre-commit b/.husky/pre-commit index 58993aaeefd1e2be0b83d453941fadbd7b74266d..59261299604c88a63a3b910fccd9175bb0f389c7 100755 --- a/.husky/pre-commit +++ b/.husky/pre-commit @@ -2,3 +2,4 @@ . "$(dirname -- "$0")/_/husky.sh" pnpm lint +npx lint-staged diff --git a/.vscode/settings.json b/.vscode/settings.json index d3a0c1169495cca3846695377c90c838b83f5b65..9f6017380e7cfe41a6a08e612b92a9226bb26e7a 100644 --- a/.vscode/settings.json +++ b/.vscode/settings.json @@ -4,5 +4,6 @@ "editor.defaultFormatter": "esbenp.prettier-vscode", "[xml]": { "editor.defaultFormatter": "redhat.vscode-xml" - } -} + }, + "jest.rootPath": "./packages/core" +} \ No newline at end of file diff --git a/README.md b/README.md index c9500c193a6a6a970920fb5ff82e6acea69da4ac..866dfc3f834fecd535a8923bf1656aac73800321 100644 --- a/README.md +++ b/README.md @@ -89,7 +89,7 @@ Check out our NextJS playground at https://llama-playground.vercel.app/. The sou If you're using NextJS App Router, you'll need to use the NodeJS runtime (default) and add the follow config to your next.config.js to have it use imports/exports in the same way Node does. ```js -export const runtime = "nodejs" // default +export const runtime = "nodejs"; // default ``` ```js diff --git a/apps/docs/docs/end_to_end.md b/apps/docs/docs/end_to_end.md index 51671a1be8d1cb07f1269dba4110a9fad4ce971f..bd208b5e5229b1e00f8754eb88ed0b5d669cf6c9 100644 --- a/apps/docs/docs/end_to_end.md +++ b/apps/docs/docs/end_to_end.md @@ -6,6 +6,8 @@ sidebar_position: 4 We include several end-to-end examples using LlamaIndex.TS in the repository +Check out the examples below or try them out and complete them in minutes with interactive Github Codespace tutorials provided by Dev-Docs [here](https://codespaces.new/team-dev-docs/lits-dev-docs-playground?devcontainer_path=.devcontainer%2Fjavascript_ltsquickstart%2Fdevcontainer.json): + ## [Chat Engine](https://github.com/run-llama/LlamaIndexTS/blob/main/apps/simple/chatEngine.ts) Read a file and chat about it with the LLM. diff --git a/apps/docs/docs/environments.md b/apps/docs/docs/environments.md index afdf304af82d0958c40c119dfa1226ff767046ff..3876ddc731833321c8440131f62d8b0902217626 100644 --- a/apps/docs/docs/environments.md +++ b/apps/docs/docs/environments.md @@ -11,7 +11,7 @@ LlamaIndex currently officially supports NodeJS 18 and NodeJS 20. If you're using NextJS App Router route handlers/serverless functions, you'll need to use the NodeJS mode: ```js -export const runtime = "nodejs" // default +export const runtime = "nodejs"; // default ``` and you'll need to add an exception for pdf-parse in your next.config.js diff --git a/apps/mongodb/1_import.ts b/apps/mongodb/1_import.ts new file mode 100644 index 0000000000000000000000000000000000000000..57c9e9bba3f1c4da24ac923c52433279ddc0bd7a --- /dev/null +++ b/apps/mongodb/1_import.ts @@ -0,0 +1,34 @@ +/* eslint-disable turbo/no-undeclared-env-vars */ +import * as dotenv from "dotenv"; +import * as fs from "fs"; +import { MongoClient } from "mongodb"; + +// Load environment variables from local .env file +dotenv.config(); + +const jsonFile = "tinytweets.json"; +const mongoUri = process.env.MONGODB_URI!; +const databaseName = process.env.MONGODB_DATABASE!; +const collectionName = process.env.MONGODB_COLLECTION!; + +async function importJsonToMongo() { + // Load the tweets from a local file + const tweets = JSON.parse(fs.readFileSync(jsonFile, "utf-8")); + + // Create a new client and connect to the server + const client = new MongoClient(mongoUri); + + const db = client.db(databaseName); + const collection = db.collection(collectionName); + + // Insert the tweets into mongo + await collection.insertMany(tweets); + + console.log( + `Data imported successfully to the MongoDB collection ${collectionName}.`, + ); + await client.close(); +} + +// Run the import function +importJsonToMongo(); diff --git a/apps/mongodb/2_load_and_index.ts b/apps/mongodb/2_load_and_index.ts new file mode 100644 index 0000000000000000000000000000000000000000..0d7a3a23f70c45dffb37b1b1feca03a2f27d48ac --- /dev/null +++ b/apps/mongodb/2_load_and_index.ts @@ -0,0 +1,50 @@ +/* eslint-disable turbo/no-undeclared-env-vars */ +import * as dotenv from "dotenv"; +import { + MongoDBAtlasVectorSearch, + SimpleMongoReader, + storageContextFromDefaults, + VectorStoreIndex, +} from "llamaindex"; +import { MongoClient } from "mongodb"; + +// Load environment variables from local .env file +dotenv.config(); + +const mongoUri = process.env.MONGODB_URI!; +const databaseName = process.env.MONGODB_DATABASE!; +const collectionName = process.env.MONGODB_COLLECTION!; +const vectorCollectionName = process.env.MONGODB_VECTORS!; +const indexName = process.env.MONGODB_VECTOR_INDEX!; + +async function loadAndIndex() { + // Create a new client and connect to the server + const client = new MongoClient(mongoUri); + // load objects from mongo and convert them into LlamaIndex Document objects + // llamaindex has a special class that does this for you + // it pulls every object in a given collection + const reader = new SimpleMongoReader(client); + const documents = await reader.loadData(databaseName, collectionName, [ + "full_text", + ]); + + // create Atlas as a vector store + const vectorStore = new MongoDBAtlasVectorSearch({ + mongodbClient: client, + dbName: databaseName, + collectionName: vectorCollectionName, // this is where your embeddings will be stored + indexName: indexName, // this is the name of the index you will need to create + }); + + // now create an index from all the Documents and store them in Atlas + const storageContext = await storageContextFromDefaults({ vectorStore }); + await VectorStoreIndex.fromDocuments(documents, { storageContext }); + console.log( + `Successfully created embeddings in the MongoDB collection ${vectorCollectionName}.`, + ); + await client.close(); +} + +loadAndIndex(); + +// you can't query your index yet because you need to create a vector search index in mongodb's UI now diff --git a/apps/mongodb/3_query.ts b/apps/mongodb/3_query.ts new file mode 100644 index 0000000000000000000000000000000000000000..32a35293942a99230427c2ea19026db6984244dd --- /dev/null +++ b/apps/mongodb/3_query.ts @@ -0,0 +1,34 @@ +/* eslint-disable turbo/no-undeclared-env-vars */ +import * as dotenv from "dotenv"; +import { + MongoDBAtlasVectorSearch, + serviceContextFromDefaults, + VectorStoreIndex, +} from "llamaindex"; +import { MongoClient } from "mongodb"; + +// Load environment variables from local .env file +dotenv.config(); + +async function query() { + const client = new MongoClient(process.env.MONGODB_URI!); + const serviceContext = serviceContextFromDefaults(); + const store = new MongoDBAtlasVectorSearch({ + mongodbClient: client, + dbName: process.env.MONGODB_DATABASE!, + collectionName: process.env.MONGODB_VECTORS!, + indexName: process.env.MONGODB_VECTOR_INDEX!, + }); + + const index = await VectorStoreIndex.fromVectorStore(store, serviceContext); + + const retriever = index.asRetriever({ similarityTopK: 20 }); + const queryEngine = index.asQueryEngine({ retriever }); + const result = await queryEngine.query( + "What does the author think of web frameworks?", + ); + console.log(result.response); + await client.close(); +} + +query(); diff --git a/apps/mongodb/README.md b/apps/mongodb/README.md new file mode 100644 index 0000000000000000000000000000000000000000..5448191d6cdd7fa8af88096d8bcbc512d91ccde0 --- /dev/null +++ b/apps/mongodb/README.md @@ -0,0 +1,127 @@ +# LlamaIndexTS retrieval augmented generation with MongoDB + +### Prepare Environment + +Make sure to run `pnpm install` and set your OpenAI environment variable before running these examples. + +``` +pnpm install +export OPENAI_API_KEY="sk-..." +``` + +### Sign up for MongoDB Atlas + +We'll be using MongoDB's hosted database service, [MongoDB Atlas](https://www.mongodb.com/cloud/atlas/register). You can sign up for free and get a small hosted cluster for free: + + + +The signup process will walk you through the process of creating your cluster and ensuring it's configured for you to access. Once the cluster is created, choose "Connect" and then "Connect to your application". Choose Python, and you'll be presented with a connection string that looks like this: + + + +### Set up environment variables + +Copy the connection string (make sure you include your password) and put it into a file called `.env` in the root of this repo. It should look like this: + +``` +MONGODB_URI=mongodb+srv://seldo:xxxxxxxxxxx@llamaindexdemocluster.xfrdhpz.mongodb.net/?retryWrites=true&w=majority +``` + +You will also need to choose a name for your database, and the collection where we will store the tweets, and also include them in .env. They can be any string, but this is what we used: + +``` +MONGODB_DATABASE=tiny_tweets_db +MONGODB_COLLECTION=tiny_tweets_collection +``` + +### Import tweets into MongoDB + +You are now ready to import our ready-made data set into Mongo. This is the file `tinytweets.json`, a selection of approximately 1000 tweets from @seldo on Twitter in mid-2019. With your environment set up you can do this by running + +``` +pnpm ts-node 1_import.ts +``` + +If you don't want to use tweets, you can replace `json_file` with any other array of JSON objects, but you will need to modify some code later to make sure the correct field gets indexed. There is no LlamaIndex-specific code here; you can load your data into Mongo any way you want to. + +### Load and index your data + +Now we're ready to index our data. To do this, LlamaIndex will pull your text out of Mongo, split it into chunks, and then send those chunks to OpenAI to be turned into [vector embeddings](https://docs.llamaindex.ai/en/stable/understanding/indexing/indexing.html#what-is-an-embedding). The embeddings will then be stored in a new collection in Mongo. This will take a while depending how much text you have, but the good news is that once it's done you will be able to query quickly without needing to re-index. + +We'll be using OpenAI to do the embedding, so now is when you need to [generate an OpenAI API key](https://platform.openai.com/account/api-keys) if you haven't already and add it to your `.env` file like this: + +``` +OPENAI_API_KEY=sk-xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx +``` + +You'll also need to pick a name for the new collection where the embeddings will be stored, and add it to `.env`, along with the name of a vector search index (we'll be creating this in the next step, after you've indexed your data): + +``` +MONGODB_VECTORS=tiny_tweets_vectors +MONGODB_VECTOR_INDEX=tiny_tweets_vector_index +``` + +If the data you're indexing is the tweets we gave you, you're ready to go: + +```bash +pnpm ts-node 2_load_and_index.ts +``` + +> Note: this script is running a couple of minutes and currently doesn't show any progress. + +What you're doing here is creating a Reader which loads the data out of Mongo in the collection and database specified. It looks for text in a set of specific keys in each object. In this case we've given it just one key, "full_text". + +Now you're creating a vector search client for Mongo. In addition to a MongoDB client object, you again tell it what database everything is in. This time you give it the name of the collection where you'll store the vector embeddings, and the name of the vector search index you'll create in the next step. + +### Create a vector search index + +Now if all has gone well you should be able to log in to the Mongo Atlas UI and see two collections in your database: the original data in `tiny_tweets_collection`, and the vector embeddings in `tiny_tweets_vectors`. + + + +Now it's time to create the vector search index so that you can query the data. +It's not yet possible to programmatically create a vector search index using the [`createIndex`](https://www.mongodb.com/docs/manual/reference/method/db.collection.createIndex/) function, therefore we have to create one manually in the UI. +To do so, first, click the Search tab, and then click "Create Search Index": + + + +We have to use the JSON editor, as the Visual Editor does not yet support to create a vector search index: + + + +Now under "database and collection" select `tiny_tweets_db` and within that select `tiny_tweets_vectors`. Then under "Index name" enter `tiny_tweets_vector_index` (or whatever value you put for MONGODB_VECTOR_INDEX in `.env`). Under that, you'll want to enter this JSON object: + +```json +{ + "mappings": { + "dynamic": true, + "fields": { + "embedding": { + "dimensions": 1536, + "similarity": "cosine", + "type": "knnVector" + } + } + } +} +``` + +This tells Mongo that the `embedding` field in each document (in the `tiny_tweets_vectors` collection) is a vector of 1536 dimensions (this is the size of embeddings used by OpenAI), and that we want to use cosine similarity to compare vectors. You don't need to worry too much about these values unless you want to use a different LLM to OpenAI entirely. + +The UI will ask you to review and confirm your choices, then you need to wait a minute or two while it generates the index. If all goes well, you should see something like this screen: + + + +Now you're ready to query your data! + +### Run a test query + +You can do this by running + +```bash +pnpm ts-node 3_query.ts +``` + +This sets up a connection to Atlas just like `2_load_and_index.ts` did, then it creates a [query engine](https://docs.llamaindex.ai/en/stable/understanding/querying/querying.html#getting-started) and runs a query against it. + +If all is well, you should get a nuanced opinion about web frameworks. diff --git a/apps/mongodb/docs/1_signup.png b/apps/mongodb/docs/1_signup.png new file mode 100644 index 0000000000000000000000000000000000000000..a1900a1d41b462997e23a927f1eed2660e62b064 Binary files /dev/null and b/apps/mongodb/docs/1_signup.png differ diff --git a/apps/mongodb/docs/2_connection_string.png b/apps/mongodb/docs/2_connection_string.png new file mode 100644 index 0000000000000000000000000000000000000000..eb55817d12de05663e217109206e66e95acb882d Binary files /dev/null and b/apps/mongodb/docs/2_connection_string.png differ diff --git a/apps/mongodb/docs/3_vectors_in_db.png b/apps/mongodb/docs/3_vectors_in_db.png new file mode 100644 index 0000000000000000000000000000000000000000..b099b2ded4858ec87ce8918ca95c0f3fa1033e09 Binary files /dev/null and b/apps/mongodb/docs/3_vectors_in_db.png differ diff --git a/apps/mongodb/docs/4_search_tab.png b/apps/mongodb/docs/4_search_tab.png new file mode 100644 index 0000000000000000000000000000000000000000..497ade44d5c89fa59bbfb95f48b80749e0819257 Binary files /dev/null and b/apps/mongodb/docs/4_search_tab.png differ diff --git a/apps/mongodb/docs/5_json_editor.png b/apps/mongodb/docs/5_json_editor.png new file mode 100644 index 0000000000000000000000000000000000000000..20ef31a1bb5baabdd01d4cc78403c02ff4872ea5 Binary files /dev/null and b/apps/mongodb/docs/5_json_editor.png differ diff --git a/apps/mongodb/docs/7_index_created.png b/apps/mongodb/docs/7_index_created.png new file mode 100644 index 0000000000000000000000000000000000000000..98480efd5255ff22c90adb7dd29ffb4e83620d00 Binary files /dev/null and b/apps/mongodb/docs/7_index_created.png differ diff --git a/apps/mongodb/package.json b/apps/mongodb/package.json new file mode 100644 index 0000000000000000000000000000000000000000..5791c3200f5b78bc12819c1444cb8e12a482e6b9 --- /dev/null +++ b/apps/mongodb/package.json @@ -0,0 +1,17 @@ +{ + "version": "0.0.1", + "private": true, + "name": "mongodb-llamaindexts", + "dependencies": { + "llamaindex": "workspace:*", + "dotenv": "^16.3.1", + "mongodb": "^6.2.0" + }, + "devDependencies": { + "@types/node": "^18.18.6", + "ts-node": "^10.9.1" + }, + "scripts": { + "lint": "eslint ." + } +} \ No newline at end of file diff --git a/apps/mongodb/tinytweets.json b/apps/mongodb/tinytweets.json new file mode 100644 index 0000000000000000000000000000000000000000..2e3a8e66d405749eb47f76eb8303bba37612cd38 --- /dev/null +++ b/apps/mongodb/tinytweets.json @@ -0,0 +1,57482 @@ +[ + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957472328048197634" + ], + "editableUntil": "2018-01-28T05:36:06.639Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "112" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "957414671979446272", + "id_str": "957472328048197634", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "957472328048197634", + "in_reply_to_status_id": "957414671979446272", + "created_at": "Sun Jan 28 04:36:06 +0000 2018", + "favorited": false, + "full_text": "@nebrius Seeing this made me realize I missed the 20th anniversary of my own coming out, which was 2 months ago.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957464449434005504" + ], + "editableUntil": "2018-01-28T05:04:48.231Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jenn schiffer", + "screen_name": "jennschiffer", + "indices": [ + "0", + "13" + ], + "id_str": "12524622", + "id": "12524622" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "50" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957451774432071680", + "id_str": "957464449434005504", + "in_reply_to_user_id": "12524622", + "truncated": false, + "retweet_count": "0", + "id": "957464449434005504", + "in_reply_to_status_id": "957451774432071680", + "created_at": "Sun Jan 28 04:04:48 +0000 2018", + "favorited": false, + "full_text": "@jennschiffer Oh no, you're sick too? Feel better!", + "lang": "en", + "in_reply_to_screen_name": "jennschiffer", + "in_reply_to_user_id_str": "12524622" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957463872419520513" + ], + "editableUntil": "2018-01-28T05:02:30.660Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ran Reichman", + "screen_name": "ranreichman", + "indices": [ + "0", + "12" + ], + "id_str": "220368940", + "id": "220368940" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "256" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "957462024337833990", + "id_str": "957463872419520513", + "in_reply_to_user_id": "220368940", + "truncated": false, + "retweet_count": "0", + "id": "957463872419520513", + "in_reply_to_status_id": "957462024337833990", + "created_at": "Sun Jan 28 04:02:30 +0000 2018", + "favorited": false, + "full_text": "@ranreichman But that's just it, it's myth building. Bezos kept the company cheap on purpose, with the door desks etc., to create a culture of cutting costs. They could have had nice offices but he chose not to because that made him richer in the long run.", + "lang": "en", + "in_reply_to_screen_name": "ranreichman", + "in_reply_to_user_id_str": "220368940" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957460233311236096" + ], + "editableUntil": "2018-01-28T04:48:03.029Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Gbp9HRPRrM", + "expanded_url": "https://twitter.com/umbyrella/status/957310771989499904", + "display_url": "twitter.com/umbyrella/stat…", + "indices": [ + "185", + "208" + ] + } + ] + }, + "display_text_range": [ + "0", + "208" + ], + "favorite_count": "357", + "id_str": "957460233311236096", + "truncated": false, + "retweet_count": "94", + "id": "957460233311236096", + "possibly_sensitive": false, + "created_at": "Sun Jan 28 03:48:03 +0000 2018", + "favorited": false, + "full_text": "THANK YOU. So tired of this fucking picture. He was already rich when he started. So was Bill Gates. So was Zuck. So was Page (Brin less so). None of these fuckers went rags to riches. https://t.co/Gbp9HRPRrM", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957457999756386304" + ], + "editableUntil": "2018-01-28T04:39:10.508Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "zacharyorr", + "screen_name": "ZacharyOrr", + "indices": [ + "0", + "11" + ], + "id_str": "1108803871109976064", + "id": "1108803871109976064" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "56" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957456917382692864", + "id_str": "957457999756386304", + "in_reply_to_user_id": "100290468", + "truncated": false, + "retweet_count": "0", + "id": "957457999756386304", + "in_reply_to_status_id": "957456917382692864", + "created_at": "Sun Jan 28 03:39:10 +0000 2018", + "favorited": false, + "full_text": "@ZacharyOrr This is the year of, uh, z/os on the desktop", + "lang": "en", + "in_reply_to_user_id_str": "100290468" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957455867867115521" + ], + "editableUntil": "2018-01-28T04:30:42.226Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "psygnisfive", + "screen_name": "psygnisfive", + "indices": [ + "0", + "12" + ], + "id_str": "995543826801410049", + "id": "995543826801410049" + }, + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "13", + "24" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [ + { + "url": "https://t.co/QqVzpWGt2y", + "expanded_url": "http://proporti.onl", + "display_url": "proporti.onl", + "indices": [ + "38", + "61" + ] + } + ] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957455761512185856", + "id_str": "957455867867115521", + "in_reply_to_user_id": "3393781", + "truncated": false, + "retweet_count": "0", + "id": "957455867867115521", + "in_reply_to_status_id": "957455761512185856", + "possibly_sensitive": false, + "created_at": "Sun Jan 28 03:30:42 +0000 2018", + "favorited": false, + "full_text": "@psygnisfive @jackie_cs_ I think it's https://t.co/QqVzpWGt2y", + "lang": "en", + "in_reply_to_screen_name": "beka_valentine", + "in_reply_to_user_id_str": "3393781" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957454722755051520" + ], + "editableUntil": "2018-01-28T04:26:09.210Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "89" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "957454439861882880", + "id_str": "957454722755051520", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "957454722755051520", + "in_reply_to_status_id": "957454439861882880", + "created_at": "Sun Jan 28 03:26:09 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ There are hundreds of you, I can't poll continuously, it's just not scalable.", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957454177533243394" + ], + "editableUntil": "2018-01-28T04:23:59.219Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Ahmed", + "screen_name": "typesthings", + "indices": [ + "0", + "12" + ], + "id_str": "969169406", + "id": "969169406" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "174" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957453417990963200", + "id_str": "957454177533243394", + "in_reply_to_user_id": "969169406", + "truncated": false, + "retweet_count": "0", + "id": "957454177533243394", + "in_reply_to_status_id": "957453417990963200", + "created_at": "Sun Jan 28 03:23:59 +0000 2018", + "favorited": false, + "full_text": "@typesthings I have specific medical advice on most things but also the unhelpfully vague \"listen to your body, eat more complex things gradually\" which is giving me trouble.", + "lang": "en", + "in_reply_to_screen_name": "typesthings", + "in_reply_to_user_id_str": "969169406" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957453532931616768" + ], + "editableUntil": "2018-01-28T04:21:25.534Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "23", + "id_str": "957453532931616768", + "truncated": false, + "retweet_count": "1", + "id": "957453532931616768", + "created_at": "Sun Jan 28 03:21:25 +0000 2018", + "favorited": false, + "full_text": "I need a live, continuously updated feed of the current correct pronouns for my friends. Changes are far more frequent than I ever imagined.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957449092702982145" + ], + "editableUntil": "2018-01-28T04:03:46.901Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/YQzMajq9nU", + "expanded_url": "https://twitter.com/bey_legion/status/957444523856187394", + "display_url": "twitter.com/bey_legion/sta…", + "indices": [ + "53", + "76" + ] + } + ] + }, + "display_text_range": [ + "0", + "76" + ], + "favorite_count": "5", + "id_str": "957449092702982145", + "truncated": false, + "retweet_count": "0", + "id": "957449092702982145", + "possibly_sensitive": false, + "created_at": "Sun Jan 28 03:03:46 +0000 2018", + "favorited": false, + "full_text": "How do two mortal human bodies contain so much cool? https://t.co/YQzMajq9nU", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957447151658782720" + ], + "editableUntil": "2018-01-28T03:56:04.120Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957444511478755333", + "id_str": "957447151658782720", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "957447151658782720", + "in_reply_to_status_id": "957444511478755333", + "created_at": "Sun Jan 28 02:56:04 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ Ah, I didn't understand what you meant. Sean's theory below makes sense.", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957443388252372992" + ], + "editableUntil": "2018-01-28T03:41:06.854Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957443080201932800", + "id_str": "957443388252372992", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "957443388252372992", + "in_reply_to_status_id": "957443080201932800", + "created_at": "Sun Jan 28 02:41:06 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ Is it not simply that the extras are cheaper than a rent increase would be?", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957442722989719552" + ], + "editableUntil": "2018-01-28T03:38:28.243Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Osborn 🏳️🌈", + "screen_name": "john_osborn", + "indices": [ + "0", + "12" + ], + "id_str": "17811991", + "id": "17811991" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957442426024660992", + "id_str": "957442722989719552", + "in_reply_to_user_id": "17811991", + "truncated": false, + "retweet_count": "0", + "id": "957442722989719552", + "in_reply_to_status_id": "957442426024660992", + "created_at": "Sun Jan 28 02:38:28 +0000 2018", + "favorited": false, + "full_text": "@john_osborn This movie was so much more fucked up on the re-watch than I remembered it being.", + "lang": "en", + "in_reply_to_screen_name": "john_osborn", + "in_reply_to_user_id_str": "17811991" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957432517803429888" + ], + "editableUntil": "2018-01-28T02:57:55.137Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "134" + ], + "favorite_count": "6", + "id_str": "957432517803429888", + "truncated": false, + "retweet_count": "0", + "id": "957432517803429888", + "created_at": "Sun Jan 28 01:57:55 +0000 2018", + "favorited": false, + "full_text": "\"What if I eat [x]? Will *that* keep me from dying, or make me want to die?\" has been the only thought I have had for the last 4 days.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957424531311702016" + ], + "editableUntil": "2018-01-28T02:26:11.009Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "146" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957423820981272577", + "id_str": "957424531311702016", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "957424531311702016", + "in_reply_to_status_id": "957423820981272577", + "created_at": "Sun Jan 28 01:26:11 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ Oh! Well they don't really exist anymore, they got bought by Alaska. For that short a trip it really does not matter who you fly with.", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957424304395755520" + ], + "editableUntil": "2018-01-28T02:25:16.908Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Y95y8degbD", + "expanded_url": "https://twitter.com/mariafarrell/status/957201613017485312", + "display_url": "twitter.com/mariafarrell/s…", + "indices": [ + "158", + "181" + ] + } + ] + }, + "display_text_range": [ + "0", + "181" + ], + "favorite_count": "5", + "id_str": "957424304395755520", + "truncated": false, + "retweet_count": "3", + "id": "957424304395755520", + "possibly_sensitive": false, + "created_at": "Sun Jan 28 01:25:16 +0000 2018", + "favorited": false, + "full_text": "This is an important point: abuse of data is a slippery slope. It's easier to climb out at the early stages than waiting until things are obviously terrible. https://t.co/Y95y8degbD", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957423578315603969" + ], + "editableUntil": "2018-01-28T02:22:23.797Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "70" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957422593660907520", + "id_str": "957423578315603969", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "957423578315603969", + "in_reply_to_status_id": "957422593660907520", + "created_at": "Sun Jan 28 01:22:23 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ Atlantic? I liked them but Lufthansa was way better value.", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957423354931175425" + ], + "editableUntil": "2018-01-28T02:21:30.538Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Rey Bango 🇺🇦🌻", + "screen_name": "reybango", + "indices": [ + "3", + "12" + ], + "id_str": "1589691", + "id": "1589691" + }, + { + "name": "Greg Whitworth", + "screen_name": "gregwhitworth", + "indices": [ + "43", + "57" + ], + "id_str": "16238495", + "id": "16238495" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "957423354931175425", + "truncated": false, + "retweet_count": "0", + "id": "957423354931175425", + "created_at": "Sun Jan 28 01:21:30 +0000 2018", + "favorited": false, + "full_text": "RT @reybango: SCREW CANCER! My good friend @gregwhitworth just found out daughter has a cancerous brain tumor. It’ll be a long road to rec…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957389648698916864" + ], + "editableUntil": "2018-01-28T00:07:34.346Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "77" + ], + "favorite_count": "13", + "id_str": "957389648698916864", + "truncated": false, + "retweet_count": "0", + "id": "957389648698916864", + "created_at": "Sat Jan 27 23:07:34 +0000 2018", + "favorited": false, + "full_text": "Okay well I sure have caught up on a lot of television can I be not sick now?", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957386529885716481" + ], + "editableUntil": "2018-01-27T23:55:10.763Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [ + { + "text": "StLouisVigil", + "indices": [ + "115", + "128" + ] + } + ], + "symbols": [], + "user_mentions": [ + { + "name": "St. Louis Manifest", + "screen_name": "Stl_Manifest", + "indices": [ + "3", + "16" + ], + "id_str": "824876295607554050", + "id": "824876295607554050" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "957386529885716481", + "truncated": false, + "retweet_count": "0", + "id": "957386529885716481", + "created_at": "Sat Jan 27 22:55:10 +0000 2018", + "favorited": false, + "full_text": "RT @Stl_Manifest: My name is Joachim Hirsch. The US turned me away 78 years ago today. I was murdered in Auschwitz #StLouisVigil #NeverAgai…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957381963404296192" + ], + "editableUntil": "2018-01-27T23:37:02.029Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "23" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957380737816150017", + "id_str": "957381963404296192", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "957381963404296192", + "in_reply_to_status_id": "957380737816150017", + "created_at": "Sat Jan 27 22:37:02 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu Same to you!", + "lang": "en", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957379195960573952" + ], + "editableUntil": "2018-01-27T23:26:02.219Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "26" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957325807092838402", + "id_str": "957379195960573952", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "957379195960573952", + "in_reply_to_status_id": "957325807092838402", + "created_at": "Sat Jan 27 22:26:02 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu Same but 3 days", + "lang": "en", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957367889228587008" + ], + "editableUntil": "2018-01-27T22:41:06.484Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Khatt", + "screen_name": "SkeptiKhatt", + "indices": [ + "0", + "12" + ], + "id_str": "29169958", + "id": "29169958" + }, + { + "name": "ellen teapot 🇨🇦🇺🇸🏳️⚧️", + "screen_name": "asmallteapot", + "indices": [ + "13", + "26" + ], + "id_str": "14202167", + "id": "14202167" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "120" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957367594608082944", + "id_str": "957367889228587008", + "in_reply_to_user_id": "29169958", + "truncated": false, + "retweet_count": "0", + "id": "957367889228587008", + "in_reply_to_status_id": "957367594608082944", + "created_at": "Sat Jan 27 21:41:06 +0000 2018", + "favorited": false, + "full_text": "@SkeptiKhatt @asmallteapot Seconded: if you have enough battery you can join AAA online and you’ll save on the call out.", + "lang": "en", + "in_reply_to_screen_name": "SkeptiKhatt", + "in_reply_to_user_id_str": "29169958" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957366807467192320" + ], + "editableUntil": "2018-01-27T22:36:48.572Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ellen teapot 🇨🇦🇺🇸🏳️⚧️", + "screen_name": "asmallteapot", + "indices": [ + "0", + "13" + ], + "id_str": "14202167", + "id": "14202167" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "98" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957366262476152832", + "id_str": "957366807467192320", + "in_reply_to_user_id": "14202167", + "truncated": false, + "retweet_count": "0", + "id": "957366807467192320", + "in_reply_to_status_id": "957366262476152832", + "created_at": "Sat Jan 27 21:36:48 +0000 2018", + "favorited": false, + "full_text": "@asmallteapot Do you need any assistance? Clearly you have your phone so you can call... somebody.", + "lang": "en", + "in_reply_to_screen_name": "asmallteapot", + "in_reply_to_user_id_str": "14202167" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957365466984456192" + ], + "editableUntil": "2018-01-27T22:31:28.976Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "insecurity princess @saraislet@infosec.exchange", + "screen_name": "saraislet", + "indices": [ + "0", + "10" + ], + "id_str": "4838355980", + "id": "4838355980" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957365066172477440", + "id_str": "957365466984456192", + "in_reply_to_user_id": "4838355980", + "truncated": false, + "retweet_count": "0", + "id": "957365466984456192", + "in_reply_to_status_id": "957365066172477440", + "created_at": "Sat Jan 27 21:31:28 +0000 2018", + "favorited": false, + "full_text": "@saraislet Hmm, I forgot about that convenient plot device.", + "lang": "en", + "in_reply_to_screen_name": "saraislet", + "in_reply_to_user_id_str": "4838355980" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957364739746623488" + ], + "editableUntil": "2018-01-27T22:28:35.589Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "8", + "id_str": "957364739746623488", + "truncated": false, + "retweet_count": "0", + "id": "957364739746623488", + "created_at": "Sat Jan 27 21:28:35 +0000 2018", + "favorited": false, + "full_text": "Marvel's Runaways, aka This Would All Be Over If Anybody Ever Thought To Call The Police Even One Time.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957361939025309696" + ], + "editableUntil": "2018-01-27T22:17:27.845Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bitchcoin", + "screen_name": "SubMedina", + "indices": [ + "0", + "10" + ], + "id_str": "14514703", + "id": "14514703" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "957361208545464321", + "id_str": "957361939025309696", + "in_reply_to_user_id": "14514703", + "truncated": false, + "retweet_count": "1", + "id": "957361939025309696", + "in_reply_to_status_id": "957361208545464321", + "created_at": "Sat Jan 27 21:17:27 +0000 2018", + "favorited": false, + "full_text": "@SubMedina This seems like an excellent way to die.", + "lang": "en", + "in_reply_to_screen_name": "SubMedina", + "in_reply_to_user_id_str": "14514703" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957361091788484608" + ], + "editableUntil": "2018-01-27T22:14:05.848Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "modest proposal", + "screen_name": "modestproposal1", + "indices": [ + "3", + "19" + ], + "id_str": "355866075", + "id": "355866075" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "957361091788484608", + "truncated": false, + "retweet_count": "0", + "id": "957361091788484608", + "created_at": "Sat Jan 27 21:14:05 +0000 2018", + "favorited": false, + "full_text": "RT @modestproposal1: The reason capitalism wins is because you can buy bot followers wholesale at $1 and resell them to thirsty thinkfluenc…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957323687010512896" + ], + "editableUntil": "2018-01-27T19:45:27.854Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "sweatpants cher🔸", + "screen_name": "House_Feminist", + "indices": [ + "3", + "18" + ], + "id_str": "51752499", + "id": "51752499" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "957323687010512896", + "truncated": false, + "retweet_count": "0", + "id": "957323687010512896", + "created_at": "Sat Jan 27 18:45:27 +0000 2018", + "favorited": false, + "full_text": "RT @House_Feminist: I secretly hope that twitter keeps extending the character limit as a social experiment, slowly conditioning our attent…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957313037865594880" + ], + "editableUntil": "2018-01-27T19:03:08.900Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Osborn 🏳️🌈", + "screen_name": "john_osborn", + "indices": [ + "0", + "12" + ], + "id_str": "17811991", + "id": "17811991" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "52" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957312044679786496", + "id_str": "957313037865594880", + "in_reply_to_user_id": "17811991", + "truncated": false, + "retweet_count": "0", + "id": "957313037865594880", + "in_reply_to_status_id": "957312044679786496", + "created_at": "Sat Jan 27 18:03:08 +0000 2018", + "favorited": false, + "full_text": "@john_osborn Very slowly, yes. Thank you for asking.", + "lang": "en", + "in_reply_to_screen_name": "john_osborn", + "in_reply_to_user_id_str": "17811991" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957312864364056576" + ], + "editableUntil": "2018-01-27T19:02:27.534Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dan", + "screen_name": "spinfire", + "indices": [ + "0", + "9" + ], + "id_str": "14455915", + "id": "14455915" + }, + { + "name": "Liz Fong-Jones (方禮真)", + "screen_name": "lizthegrey", + "indices": [ + "10", + "21" + ], + "id_str": "14534896", + "id": "14534896" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "77" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "957310345827188736", + "id_str": "957312864364056576", + "in_reply_to_user_id": "14455915", + "truncated": false, + "retweet_count": "0", + "id": "957312864364056576", + "in_reply_to_status_id": "957310345827188736", + "created_at": "Sat Jan 27 18:02:27 +0000 2018", + "favorited": false, + "full_text": "@spinfire @lizthegrey \"Intuitive to emacs users\" is a contradiction in terms.", + "lang": "en", + "in_reply_to_screen_name": "spinfire", + "in_reply_to_user_id_str": "14455915" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957309282550145025" + ], + "editableUntil": "2018-01-27T18:48:13.563Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Liz Fong-Jones (方禮真)", + "screen_name": "lizthegrey", + "indices": [ + "0", + "11" + ], + "id_str": "14534896", + "id": "14534896" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "141" + ], + "favorite_count": "22", + "in_reply_to_status_id_str": "957308224092495873", + "id_str": "957309282550145025", + "in_reply_to_user_id": "14534896", + "truncated": false, + "retweet_count": "2", + "id": "957309282550145025", + "in_reply_to_status_id": "957308224092495873", + "created_at": "Sat Jan 27 17:48:13 +0000 2018", + "favorited": false, + "full_text": "@lizthegrey If Linux were not user hostile these shortcuts would be mapped to something guessable like, oh, I don't know, fucking arrow keys.", + "lang": "en", + "in_reply_to_screen_name": "lizthegrey", + "in_reply_to_user_id_str": "14534896" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957302484355006465" + ], + "editableUntil": "2018-01-27T18:21:12.747Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "15" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "957300990398496768", + "id_str": "957302484355006465", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "957302484355006465", + "in_reply_to_status_id": "957300990398496768", + "created_at": "Sat Jan 27 17:21:12 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu ☹️❤️", + "lang": "qme", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957295946919849984" + ], + "editableUntil": "2018-01-27T17:55:14.101Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "Jason Isbell", + "screen_name": "JasonIsbell", + "indices": [ + "0", + "12" + ], + "id_str": "27179932", + "id": "27179932" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/957295946919849984/photo/1", + "indices": [ + "46", + "69" + ], + "url": "https://t.co/DHOE28izu4", + "media_url": "http://pbs.twimg.com/media/DUj_lnUVwAAoeMY.jpg", + "id_str": "957295942490767360", + "id": "957295942490767360", + "media_url_https": "https://pbs.twimg.com/media/DUj_lnUVwAAoeMY.jpg", + "sizes": { + "small": { + "w": "315", + "h": "445", + "resize": "fit" + }, + "medium": { + "w": "315", + "h": "445", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "315", + "h": "445", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/DHOE28izu4" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956951087646412800", + "id_str": "957295946919849984", + "in_reply_to_user_id": "27179932", + "truncated": false, + "retweet_count": "0", + "id": "957295946919849984", + "in_reply_to_status_id": "956951087646412800", + "possibly_sensitive": false, + "created_at": "Sat Jan 27 16:55:14 +0000 2018", + "favorited": false, + "full_text": "@JasonIsbell Good news! This was a real show: https://t.co/DHOE28izu4", + "lang": "en", + "in_reply_to_screen_name": "JasonIsbell", + "in_reply_to_user_id_str": "27179932", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/957295946919849984/photo/1", + "indices": [ + "46", + "69" + ], + "url": "https://t.co/DHOE28izu4", + "media_url": "http://pbs.twimg.com/media/DUj_lnUVwAAoeMY.jpg", + "id_str": "957295942490767360", + "id": "957295942490767360", + "media_url_https": "https://pbs.twimg.com/media/DUj_lnUVwAAoeMY.jpg", + "sizes": { + "small": { + "w": "315", + "h": "445", + "resize": "fit" + }, + "medium": { + "w": "315", + "h": "445", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "315", + "h": "445", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/DHOE28izu4" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957293933490401280" + ], + "editableUntil": "2018-01-27T17:47:14.062Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "86" + ], + "favorite_count": "55", + "id_str": "957293933490401280", + "truncated": false, + "retweet_count": "3", + "id": "957293933490401280", + "created_at": "Sat Jan 27 16:47:14 +0000 2018", + "favorited": false, + "full_text": "Ah, Saturday! Now instead of feeling guilty for being sick I can feel cheated instead!", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957293618724614144" + ], + "editableUntil": "2018-01-27T17:45:59.016Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mastodon: @webuiltthiscity@sutrofan.com", + "screen_name": "TheRealWBTC", + "indices": [ + "0", + "12" + ], + "id_str": "255630558", + "id": "255630558" + }, + { + "name": "Here Comes The Sun", + "screen_name": "SunOfSeldo", + "indices": [ + "23", + "34" + ], + "id_str": "456374925", + "id": "456374925" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957272297018155014", + "id_str": "957293618724614144", + "in_reply_to_user_id": "255630558", + "truncated": false, + "retweet_count": "0", + "id": "957293618724614144", + "in_reply_to_status_id": "957272297018155014", + "created_at": "Sat Jan 27 16:45:59 +0000 2018", + "favorited": false, + "full_text": "@TheRealWBTC See also: @SunOfSeldo", + "lang": "en", + "in_reply_to_screen_name": "TheRealWBTC", + "in_reply_to_user_id_str": "255630558" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957286529029652480" + ], + "editableUntil": "2018-01-27T17:17:48.701Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Saira Hussain", + "screen_name": "sairahussain87", + "indices": [ + "3", + "18" + ], + "id_str": "2803506941", + "id": "2803506941" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "957286529029652480", + "truncated": false, + "retweet_count": "0", + "id": "957286529029652480", + "created_at": "Sat Jan 27 16:17:48 +0000 2018", + "favorited": false, + "full_text": "RT @sairahussain87: FYI \"chain migration\" is not a real term. The actual term, written in the Immigration and Nationality Act, is \"family r…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957136310321389569" + ], + "editableUntil": "2018-01-27T07:20:53.770Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Scott Holden", + "screen_name": "sshconnection", + "indices": [ + "0", + "14" + ], + "id_str": "5909252", + "id": "5909252" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "74" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "957135746481250304", + "id_str": "957136310321389569", + "in_reply_to_user_id": "5909252", + "truncated": false, + "retweet_count": "0", + "id": "957136310321389569", + "in_reply_to_status_id": "957135746481250304", + "created_at": "Sat Jan 27 06:20:53 +0000 2018", + "favorited": false, + "full_text": "@sshconnection No, they think they're doing good, because they're racists.", + "lang": "en", + "in_reply_to_screen_name": "sshconnection", + "in_reply_to_user_id_str": "5909252" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957134269092003846" + ], + "editableUntil": "2018-01-27T07:12:47.103Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Emily Lakdawalla", + "screen_name": "elakdawalla", + "indices": [ + "0", + "12" + ], + "id_str": "14807898", + "id": "14807898" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "187" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "957129448746205184", + "id_str": "957134269092003846", + "in_reply_to_user_id": "14807898", + "truncated": false, + "retweet_count": "0", + "id": "957134269092003846", + "in_reply_to_status_id": "957129448746205184", + "created_at": "Sat Jan 27 06:12:47 +0000 2018", + "favorited": false, + "full_text": "@elakdawalla A very thoughtful family friend gave me a copy of Isaac Asimov's \"Foundation\" for Christmas when I was 11. I was already very interested in sci fi themes thanks to TV though.", + "lang": "en", + "in_reply_to_screen_name": "elakdawalla", + "in_reply_to_user_id_str": "14807898" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957126160709664768" + ], + "editableUntil": "2018-01-27T06:40:33.914Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tom Dale", + "screen_name": "tomdale", + "indices": [ + "0", + "8" + ], + "id_str": "668863", + "id": "668863" + }, + { + "name": "Paul Irish", + "screen_name": "paul_irish", + "indices": [ + "9", + "20" + ], + "id_str": "1671811", + "id": "1671811" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "31" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "957122836899954691", + "id_str": "957126160709664768", + "in_reply_to_user_id": "668863", + "truncated": false, + "retweet_count": "0", + "id": "957126160709664768", + "in_reply_to_status_id": "957122836899954691", + "created_at": "Sat Jan 27 05:40:33 +0000 2018", + "favorited": false, + "full_text": "@tomdale @paul_irish Very neat!", + "lang": "en", + "in_reply_to_screen_name": "tomdale", + "in_reply_to_user_id_str": "668863" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957117175319293953" + ], + "editableUntil": "2018-01-27T06:04:51.630Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tom Dale", + "screen_name": "tomdale", + "indices": [ + "0", + "8" + ], + "id_str": "668863", + "id": "668863" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "95" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "956986845476343808", + "id_str": "957117175319293953", + "in_reply_to_user_id": "668863", + "truncated": false, + "retweet_count": "0", + "id": "957117175319293953", + "in_reply_to_status_id": "956986845476343808", + "created_at": "Sat Jan 27 05:04:51 +0000 2018", + "favorited": false, + "full_text": "@tomdale Have any good links describing your workflow for debugging node with chrome dev tools?", + "lang": "en", + "in_reply_to_screen_name": "tomdale", + "in_reply_to_user_id_str": "668863" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957116910985859072" + ], + "editableUntil": "2018-01-27T06:03:48.608Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/z10OTqTKZU", + "expanded_url": "https://twitter.com/lsarsour/status/957053912070139904", + "display_url": "twitter.com/lsarsour/statu…", + "indices": [ + "17", + "40" + ] + } + ] + }, + "display_text_range": [ + "0", + "40" + ], + "favorite_count": "21", + "id_str": "957116910985859072", + "truncated": false, + "retweet_count": "4", + "id": "957116910985859072", + "possibly_sensitive": false, + "created_at": "Sat Jan 27 05:03:48 +0000 2018", + "favorited": false, + "full_text": "ICE is terrible. https://t.co/z10OTqTKZU", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957094843137777664" + ], + "editableUntil": "2018-01-27T04:36:07.223Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "0", + "11" + ], + "id_str": "622960227", + "id": "622960227" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "957093653150912512", + "id_str": "957094843137777664", + "in_reply_to_user_id": "622960227", + "truncated": false, + "retweet_count": "0", + "id": "957094843137777664", + "in_reply_to_status_id": "957093653150912512", + "created_at": "Sat Jan 27 03:36:07 +0000 2018", + "favorited": false, + "full_text": "@bitandbang \"It's a myth\" immediately followed by \"We do it but they do it more\" kind of undermines the claim that it's a myth.", + "lang": "en", + "in_reply_to_screen_name": "bitandbang", + "in_reply_to_user_id_str": "622960227" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957093363366346752" + ], + "editableUntil": "2018-01-27T04:30:14.418Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "0", + "11" + ], + "id_str": "622960227", + "id": "622960227" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "167" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "957092763727810561", + "id_str": "957093363366346752", + "in_reply_to_user_id": "622960227", + "truncated": false, + "retweet_count": "0", + "id": "957093363366346752", + "in_reply_to_status_id": "957092763727810561", + "created_at": "Sat Jan 27 03:30:14 +0000 2018", + "favorited": false, + "full_text": "@bitandbang I could write a thesis about the economic, social, cultural and historical influences that created this video. I could do a whole PhD about this one video.", + "lang": "en", + "in_reply_to_screen_name": "bitandbang", + "in_reply_to_user_id_str": "622960227" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957087398529085440" + ], + "editableUntil": "2018-01-27T04:06:32.290Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Gabe Ortíz", + "screen_name": "TUSK81", + "indices": [ + "0", + "7" + ], + "id_str": "14526877", + "id": "14526877" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "957086982911356928", + "id_str": "957087398529085440", + "in_reply_to_user_id": "14526877", + "truncated": false, + "retweet_count": "0", + "id": "957087398529085440", + "in_reply_to_status_id": "957086982911356928", + "created_at": "Sat Jan 27 03:06:32 +0000 2018", + "favorited": false, + "full_text": "@TUSK81 Everyone should be born to a room full of people singing happy birthday to you.", + "lang": "en", + "in_reply_to_screen_name": "TUSK81", + "in_reply_to_user_id_str": "14526877" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957086872215339008" + ], + "editableUntil": "2018-01-27T04:04:26.807Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "136" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "957056119599349761", + "id_str": "957086872215339008", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "957086872215339008", + "in_reply_to_status_id": "957056119599349761", + "created_at": "Sat Jan 27 03:04:26 +0000 2018", + "favorited": false, + "full_text": "The people favoriting this tweet mostly seem to live in the same extremely specific cultural intersection that I do and this pleases me.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957068280774012928" + ], + "editableUntil": "2018-01-27T02:50:34.262Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashley", + "screen_name": "rabcyr", + "indices": [ + "0", + "7" + ], + "id_str": "26157562", + "id": "26157562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "18" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "957066569292673024", + "id_str": "957068280774012928", + "in_reply_to_user_id": "26157562", + "truncated": false, + "retweet_count": "0", + "id": "957068280774012928", + "in_reply_to_status_id": "957066569292673024", + "created_at": "Sat Jan 27 01:50:34 +0000 2018", + "favorited": false, + "full_text": "@rabcyr Delightful", + "lang": "en", + "in_reply_to_screen_name": "rabcyr", + "in_reply_to_user_id_str": "26157562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957056119599349761" + ], + "editableUntil": "2018-01-27T02:02:14.812Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/IubY1mdtlt", + "expanded_url": "https://twitter.com/thatsmrbio/status/956564321982713857", + "display_url": "twitter.com/thatsmrbio/sta…", + "indices": [ + "70", + "93" + ] + } + ] + }, + "display_text_range": [ + "0", + "93" + ], + "favorite_count": "23", + "id_str": "957056119599349761", + "truncated": false, + "retweet_count": "8", + "id": "957056119599349761", + "possibly_sensitive": false, + "created_at": "Sat Jan 27 01:02:14 +0000 2018", + "favorited": false, + "full_text": "This is a delightfully unexpected combination of cultural influences: https://t.co/IubY1mdtlt", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957026301054894080" + ], + "editableUntil": "2018-01-27T00:03:45.517Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956979474599264256", + "id_str": "957026301054894080", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "957026301054894080", + "in_reply_to_status_id": "956979474599264256", + "created_at": "Fri Jan 26 23:03:45 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu *waves weakly from own sick bed*", + "lang": "en", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "957025783704256513" + ], + "editableUntil": "2018-01-27T00:01:42.171Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bruce Lawson", + "screen_name": "brucel", + "indices": [ + "0", + "7" + ], + "id_str": "409823", + "id": "409823" + }, + { + "name": "Jake Archibald", + "screen_name": "jaffathecake", + "indices": [ + "8", + "21" + ], + "id_str": "15390783", + "id": "15390783" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "55", + "64" + ], + "id_str": "17198118", + "id": "17198118" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "64" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "956980044366151681", + "id_str": "957025783704256513", + "in_reply_to_user_id": "409823", + "truncated": false, + "retweet_count": "0", + "id": "957025783704256513", + "in_reply_to_status_id": "956980044366151681", + "created_at": "Fri Jan 26 23:01:42 +0000 2018", + "favorited": false, + "full_text": "@brucel @jaffathecake This is the Pokémon evolution of @samccone", + "lang": "de", + "in_reply_to_screen_name": "brucel", + "in_reply_to_user_id_str": "409823" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956988107429093376" + ], + "editableUntil": "2018-01-26T21:31:59.447Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "M.G. Siegler", + "screen_name": "mgsiegler", + "indices": [ + "0", + "10" + ], + "id_str": "652193", + "id": "652193" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "77" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956987641068597248", + "id_str": "956988107429093376", + "in_reply_to_user_id": "652193", + "truncated": false, + "retweet_count": "0", + "id": "956988107429093376", + "in_reply_to_status_id": "956987641068597248", + "created_at": "Fri Jan 26 20:31:59 +0000 2018", + "favorited": false, + "full_text": "@mgsiegler I got the flu shot and got the flu anyway so I recommend option B.", + "lang": "en", + "in_reply_to_screen_name": "mgsiegler", + "in_reply_to_user_id_str": "652193" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956987173139460101" + ], + "editableUntil": "2018-01-26T21:28:16.695Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "sailor mercury", + "screen_name": "sailorhg", + "indices": [ + "0", + "9" + ], + "id_str": "61705400", + "id": "61705400" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "21", + "in_reply_to_status_id_str": "956986459608657920", + "id_str": "956987173139460101", + "in_reply_to_user_id": "61705400", + "truncated": false, + "retweet_count": "0", + "id": "956987173139460101", + "in_reply_to_status_id": "956986459608657920", + "created_at": "Fri Jan 26 20:28:16 +0000 2018", + "favorited": false, + "full_text": "@sailorhg Omg you had such a treat in store for you. Just remember, it’s not a movie about what computers are, it’s a movie about what computers feel like.", + "lang": "en", + "in_reply_to_screen_name": "sailorhg", + "in_reply_to_user_id_str": "61705400" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956986933648834560" + ], + "editableUntil": "2018-01-26T21:27:19.596Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "22" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956986655319216128", + "id_str": "956986933648834560", + "in_reply_to_user_id": "40714930", + "truncated": false, + "retweet_count": "0", + "id": "956986933648834560", + "in_reply_to_status_id": "956986655319216128", + "created_at": "Fri Jan 26 20:27:19 +0000 2018", + "favorited": false, + "full_text": "@taskboy3000 Likewise!", + "lang": "en", + "in_reply_to_user_id_str": "40714930" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956986053788712960" + ], + "editableUntil": "2018-01-26T21:23:49.821Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956978192941662208", + "id_str": "956986053788712960", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "956986053788712960", + "in_reply_to_status_id": "956978192941662208", + "created_at": "Fri Jan 26 20:23:49 +0000 2018", + "favorited": false, + "full_text": "Related: I have not eaten solid food in 48 hours.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956981590336315392" + ], + "editableUntil": "2018-01-26T21:06:05.651Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "harper 🤯", + "screen_name": "harper", + "indices": [ + "0", + "7" + ], + "id_str": "1497", + "id": "1497" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "42" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956744549509943296", + "id_str": "956981590336315392", + "in_reply_to_user_id": "1497", + "truncated": false, + "retweet_count": "0", + "id": "956981590336315392", + "in_reply_to_status_id": "956744549509943296", + "created_at": "Fri Jan 26 20:06:05 +0000 2018", + "favorited": false, + "full_text": "@harper In b4 somebody complains about npm", + "lang": "en", + "in_reply_to_screen_name": "harper", + "in_reply_to_user_id_str": "1497" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956979425651785728" + ], + "editableUntil": "2018-01-26T20:57:29.550Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Brady Swenson", + "screen_name": "bswen", + "indices": [ + "0", + "6" + ], + "id_str": "17043927", + "id": "17043927" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "23" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956979168016662528", + "id_str": "956979425651785728", + "in_reply_to_user_id": "17043927", + "truncated": false, + "retweet_count": "0", + "id": "956979425651785728", + "in_reply_to_status_id": "956979168016662528", + "created_at": "Fri Jan 26 19:57:29 +0000 2018", + "favorited": false, + "full_text": "@bswen Doctor's orders!", + "lang": "en", + "in_reply_to_screen_name": "bswen", + "in_reply_to_user_id_str": "17043927" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956979274849726464" + ], + "editableUntil": "2018-01-26T20:56:53.596Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇧🇧🇹🇹🏳️🌈🌉 🚴🏿Ed says Yes on J, No on I", + "screen_name": "eparillon", + "indices": [ + "0", + "10" + ], + "id_str": "5818162", + "id": "5818162" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "27" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956978566713020417", + "id_str": "956979274849726464", + "in_reply_to_user_id": "5818162", + "truncated": false, + "retweet_count": "0", + "id": "956979274849726464", + "in_reply_to_status_id": "956978566713020417", + "created_at": "Fri Jan 26 19:56:53 +0000 2018", + "favorited": false, + "full_text": "@eparillon Gastroenteritis.", + "lang": "lt", + "in_reply_to_screen_name": "eparillon", + "in_reply_to_user_id_str": "5818162" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956978192941662208" + ], + "editableUntil": "2018-01-26T20:52:35.649Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "24" + ], + "favorite_count": "24", + "id_str": "956978192941662208", + "truncated": false, + "retweet_count": "0", + "id": "956978192941662208", + "created_at": "Fri Jan 26 19:52:35 +0000 2018", + "favorited": false, + "full_text": "Pedialyte is my new jam.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956944112011296769" + ], + "editableUntil": "2018-01-26T18:37:10.122Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@mcc@mastodon.social", + "screen_name": "mcclure111", + "indices": [ + "0", + "11" + ], + "id_str": "312426579", + "id": "312426579" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "186" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "956940920884166659", + "id_str": "956944112011296769", + "in_reply_to_user_id": "312426579", + "truncated": false, + "retweet_count": "0", + "id": "956944112011296769", + "in_reply_to_status_id": "956940920884166659", + "created_at": "Fri Jan 26 17:37:10 +0000 2018", + "favorited": false, + "full_text": "@mcclure111 Also, how good are the rats at taking tactical direction? With 5,000 pounds of rat at my disposal I can just brute force a ton of stuff, but only if they follow instructions.", + "lang": "en", + "in_reply_to_screen_name": "mcclure111", + "in_reply_to_user_id_str": "312426579" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956938105113657344" + ], + "editableUntil": "2018-01-26T18:13:17.966Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@mcc@mastodon.social", + "screen_name": "mcclure111", + "indices": [ + "0", + "11" + ], + "id_str": "312426579", + "id": "312426579" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "184" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956933565337538560", + "id_str": "956938105113657344", + "in_reply_to_user_id": "312426579", + "truncated": false, + "retweet_count": "0", + "id": "956938105113657344", + "in_reply_to_status_id": "956933565337538560", + "created_at": "Fri Jan 26 17:13:17 +0000 2018", + "favorited": false, + "full_text": "@mcclure111 You have to pick the guy with the rifle, not because he'll be useful but because he's the only one with a ranged weapon. Then the 10,000 rats. That's a lot of fucking rats.", + "lang": "en", + "in_reply_to_screen_name": "mcclure111", + "in_reply_to_user_id_str": "312426579" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494536809224671233" + ], + "editableUntil": "2022-02-18T05:58:37.127Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Eddy on the Group W Bench", + "screen_name": "jaydeflix", + "indices": [ + "0", + "10" + ], + "id_str": "14871593", + "id": "14871593" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "1494536590181289986", + "id_str": "1494536809224671233", + "in_reply_to_user_id": "14871593", + "truncated": false, + "retweet_count": "0", + "id": "1494536809224671233", + "in_reply_to_status_id": "1494536590181289986", + "created_at": "Fri Feb 18 04:58:37 +0000 2022", + "favorited": false, + "full_text": "@jaydeflix Wait what do Americans call it? A \"turn signal\"?", + "lang": "en", + "in_reply_to_screen_name": "jaydeflix", + "in_reply_to_user_id_str": "14871593" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494536066572767234" + ], + "editableUntil": "2022-02-18T05:55:40.065Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kylie Robison", + "screen_name": "kyliebytes", + "indices": [ + "0", + "11" + ], + "id_str": "253350725", + "id": "253350725" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "1494535179871813632", + "id_str": "1494536066572767234", + "in_reply_to_user_id": "253350725", + "truncated": false, + "retweet_count": "0", + "id": "1494536066572767234", + "in_reply_to_status_id": "1494535179871813632", + "created_at": "Fri Feb 18 04:55:40 +0000 2022", + "favorited": false, + "full_text": "@kyliebytes 120 miles from Sea Ranch to SF.", + "lang": "en", + "in_reply_to_screen_name": "kyliebytes", + "in_reply_to_user_id_str": "253350725" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494535839975559170" + ], + "editableUntil": "2022-02-18T05:54:46.040Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "150" + ], + "favorite_count": "38", + "in_reply_to_status_id_str": "1494534680636387328", + "id_str": "1494535839975559170", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "1494535839975559170", + "in_reply_to_status_id": "1494534680636387328", + "created_at": "Fri Feb 18 04:54:46 +0000 2022", + "favorited": false, + "full_text": "At least one of you has had the honesty to answer \"what's an indicator\", a solid 50% of the people on the 101 tonight have never heard of this device.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494534680636387328" + ], + "editableUntil": "2022-02-18T05:50:09.632Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "208" + ], + "favorite_count": "14", + "id_str": "1494534680636387328", + "truncated": false, + "retweet_count": "1", + "id": "1494534680636387328", + "created_at": "Fri Feb 18 04:50:09 +0000 2022", + "favorited": false, + "full_text": "Okay, genuine question for people who learned to drive in California: were you taught that you are supposed to indicate when you are changing lanes on the highway? Like, did your instructor mention it to you?", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494531339810316289" + ], + "editableUntil": "2022-02-18T05:36:53.117Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "James Ray", + "screen_name": "sidecut", + "indices": [ + "0", + "8" + ], + "id_str": "30031279", + "id": "30031279" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "91" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494511438542557201", + "id_str": "1494531339810316289", + "in_reply_to_user_id": "30031279", + "truncated": false, + "retweet_count": "0", + "id": "1494531339810316289", + "in_reply_to_status_id": "1494511438542557201", + "created_at": "Fri Feb 18 04:36:53 +0000 2022", + "favorited": false, + "full_text": "@sidecut And yet they remain popular, so maybe this is a Let People Enjoy Things situation?", + "lang": "en", + "in_reply_to_screen_name": "sidecut", + "in_reply_to_user_id_str": "30031279" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494479172831354881" + ], + "editableUntil": "2022-02-18T02:09:35.540Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + }, + { + "name": "ale najpierw herbatka", + "screen_name": "iamjager", + "indices": [ + "7", + "16" + ], + "id_str": "346164400", + "id": "346164400" + }, + { + "name": "Campbell", + "screen_name": "cambel", + "indices": [ + "17", + "24" + ], + "id_str": "15614459", + "id": "15614459" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1494478588917301250", + "id_str": "1494479172831354881", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "1494479172831354881", + "in_reply_to_status_id": "1494478588917301250", + "created_at": "Fri Feb 18 01:09:35 +0000 2022", + "favorited": false, + "full_text": "@ohhoe @iamjager @cambel DAOs will fix this", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494444821875867673" + ], + "editableUntil": "2022-02-17T23:53:05.634Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + }, + { + "name": "Ruben Martinez Jr. 💖💜💙", + "screen_name": "rubencodes", + "indices": [ + "7", + "18" + ], + "id_str": "105899128", + "id": "105899128" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494444725407031297", + "id_str": "1494444821875867673", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "1494444821875867673", + "in_reply_to_status_id": "1494444725407031297", + "created_at": "Thu Feb 17 22:53:05 +0000 2022", + "favorited": false, + "full_text": "@ohhoe @rubencodes Why can't it be?", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494442419646971919" + ], + "editableUntil": "2022-02-17T23:43:32.898Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "99" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494441256474357761", + "id_str": "1494442419646971919", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "1494442419646971919", + "in_reply_to_status_id": "1494441256474357761", + "created_at": "Thu Feb 17 22:43:32 +0000 2022", + "favorited": false, + "full_text": "@ohhoe I guess I struggle to understand why a formula that is fine in print would be bad in movies.", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494440889149636610" + ], + "editableUntil": "2022-02-17T23:37:27.999Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "216" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1494438229671612419", + "id_str": "1494440889149636610", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "1494440889149636610", + "in_reply_to_status_id": "1494438229671612419", + "created_at": "Thu Feb 17 22:37:27 +0000 2022", + "favorited": false, + "full_text": "@ohhoe I mean... that's kind of how comic books work? It's a big universe and you can follow the whole thing or just your favorite character and they all tie together. Like, it's not for everyone, but it's not *bad*.", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494440568016945153" + ], + "editableUntil": "2022-02-17T23:36:11.435Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "live, laugh, @lawnsea@mastodon.social", + "screen_name": "lawnsea", + "indices": [ + "0", + "8" + ], + "id_str": "14132172", + "id": "14132172" + }, + { + "name": "Ryan Cavanaugh 👉 searyanc.dev on bsky", + "screen_name": "SeaRyanC", + "indices": [ + "9", + "18" + ], + "id_str": "1177182800", + "id": "1177182800" + }, + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "19", + "25" + ], + "id_str": "2141321", + "id": "2141321" + } + ], + "urls": [ + { + "url": "https://t.co/r3ON66x3CY", + "expanded_url": "https://en.wikipedia.org/wiki/Air_Bud_(series)", + "display_url": "en.wikipedia.org/wiki/Air_Bud_(…", + "indices": [ + "83", + "106" + ] + } + ] + }, + "display_text_range": [ + "0", + "106" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494439358685855744", + "id_str": "1494440568016945153", + "in_reply_to_user_id": "14132172", + "truncated": false, + "retweet_count": "0", + "id": "1494440568016945153", + "in_reply_to_status_id": "1494439358685855744", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 22:36:11 +0000 2022", + "favorited": false, + "full_text": "@lawnsea @SeaRyanC @ohhoe True story: there are 14 movies in the Air Bud universe: https://t.co/r3ON66x3CY", + "lang": "en", + "in_reply_to_screen_name": "lawnsea", + "in_reply_to_user_id_str": "14132172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494437882936770578" + ], + "editableUntil": "2022-02-17T23:25:31.262Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "188" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "1494436304758587410", + "id_str": "1494437882936770578", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494437882936770578", + "in_reply_to_status_id": "1494436304758587410", + "created_at": "Thu Feb 17 22:25:31 +0000 2022", + "favorited": false, + "full_text": "It's possible that my perception here is skewed by growing up in Trinidad, which is a very small market for movies, so the only movies that ever made it to cinemas there were blockbusters.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494437435664580616" + ], + "editableUntil": "2022-02-17T23:23:44.624Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "111" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "1494437066905686023", + "id_str": "1494437435664580616", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "1494437435664580616", + "in_reply_to_status_id": "1494437066905686023", + "created_at": "Thu Feb 17 22:23:44 +0000 2022", + "favorited": false, + "full_text": "@ohhoe I don't get how a comic book movie is not just another genre of thematical structure, but somehow worse?", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494436806988730368" + ], + "editableUntil": "2022-02-17T23:21:14.736Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ale najpierw herbatka", + "screen_name": "iamjager", + "indices": [ + "0", + "9" + ], + "id_str": "346164400", + "id": "346164400" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "78" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "1494436541787213825", + "id_str": "1494436806988730368", + "in_reply_to_user_id": "346164400", + "truncated": false, + "retweet_count": "0", + "id": "1494436806988730368", + "in_reply_to_status_id": "1494436541787213825", + "created_at": "Thu Feb 17 22:21:14 +0000 2022", + "favorited": false, + "full_text": "@iamjager It really does not seem any more hegemonic than the 80s and 90s did.", + "lang": "en", + "in_reply_to_screen_name": "iamjager", + "in_reply_to_user_id_str": "346164400" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494436304758587410" + ], + "editableUntil": "2022-02-17T23:19:14.995Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494436304758587410/photo/1", + "indices": [ + "42", + "65" + ], + "url": "https://t.co/qohDG0yDOd", + "media_url": "http://pbs.twimg.com/media/FL1N2B_VQAwuDRd.jpg", + "id_str": "1494436241999216652", + "id": "1494436241999216652", + "media_url_https": "https://pbs.twimg.com/media/FL1N2B_VQAwuDRd.jpg", + "sizes": { + "small": { + "w": "482", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "850", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1063", + "h": "1500", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/qohDG0yDOd" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "65" + ], + "favorite_count": "35", + "in_reply_to_status_id_str": "1494434353102802948", + "id_str": "1494436304758587410", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494436304758587410", + "in_reply_to_status_id": "1494434353102802948", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 22:19:14 +0000 2022", + "favorited": false, + "full_text": "The sheer genius creativity of yesteryear https://t.co/qohDG0yDOd", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494436304758587410/photo/1", + "indices": [ + "42", + "65" + ], + "url": "https://t.co/qohDG0yDOd", + "media_url": "http://pbs.twimg.com/media/FL1N2B_VQAwuDRd.jpg", + "id_str": "1494436241999216652", + "id": "1494436241999216652", + "media_url_https": "https://pbs.twimg.com/media/FL1N2B_VQAwuDRd.jpg", + "sizes": { + "small": { + "w": "482", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "850", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1063", + "h": "1500", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/qohDG0yDOd" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494436146692046858" + ], + "editableUntil": "2022-02-17T23:18:37.309Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "169" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "1494435329109016589", + "id_str": "1494436146692046858", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "1494436146692046858", + "in_reply_to_status_id": "1494435329109016589", + "created_at": "Thu Feb 17 22:18:37 +0000 2022", + "favorited": false, + "full_text": "@ohhoe I'd argue that makes the MCU *more* interesting, because it's a single continuous story rather than every buddy cop movie being just the same story over and over.", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494434353102802948" + ], + "editableUntil": "2022-02-17T23:11:29.684Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/AlKt0NTYH2", + "expanded_url": "https://twitter.com/screentime/status/1494380639713300480", + "display_url": "twitter.com/screentime/sta…", + "indices": [ + "160", + "183" + ] + } + ] + }, + "display_text_range": [ + "0", + "183" + ], + "favorite_count": "136", + "id_str": "1494434353102802948", + "truncated": false, + "retweet_count": "12", + "id": "1494434353102802948", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 22:11:29 +0000 2022", + "favorited": false, + "full_text": "Every action movie in the 80s was the same, every buddy cop movie is the same, every rom com is the same, why is it bad that a comic book movie is a genre now? https://t.co/AlKt0NTYH2", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494419140865445889" + ], + "editableUntil": "2022-02-17T22:11:02.804Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Uq84IRfG4g", + "expanded_url": "https://www.nytimes.com/2022/02/17/nyregion/trump-investigation-letitia-james.html", + "display_url": "nytimes.com/2022/02/17/nyr…", + "indices": [ + "75", + "98" + ] + } + ] + }, + "display_text_range": [ + "0", + "98" + ], + "favorite_count": "11", + "id_str": "1494419140865445889", + "truncated": false, + "retweet_count": "0", + "id": "1494419140865445889", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 21:11:02 +0000 2022", + "favorited": false, + "full_text": "TLDR: unless they appeal or plead the fifth, which they will certainly do. https://t.co/Uq84IRfG4g", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494415679977517066" + ], + "editableUntil": "2022-02-17T21:57:17.664Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "115", + "id_str": "1494415679977517066", + "truncated": false, + "retweet_count": "13", + "id": "1494415679977517066", + "created_at": "Thu Feb 17 20:57:17 +0000 2022", + "favorited": false, + "full_text": "If you are afraid for your kids if they turn out to be gay, remember that your fear will be the hardest part about it for them.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494383219554209792" + ], + "editableUntil": "2022-02-17T19:48:18.496Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/iVOQ7eGDux", + "expanded_url": "https://twitter.com/SilvermanJacob/status/1494142837625081859", + "display_url": "twitter.com/SilvermanJacob…", + "indices": [ + "101", + "124" + ] + } + ] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "12", + "id_str": "1494383219554209792", + "truncated": false, + "retweet_count": "0", + "id": "1494383219554209792", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 18:48:18 +0000 2022", + "favorited": false, + "full_text": "Nothing says \"we are a legitimate art collector group\" like mass-reporting people who criticize you. https://t.co/iVOQ7eGDux", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494378506783838209" + ], + "editableUntil": "2022-02-17T19:29:34.884Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "akash", + "screen_name": "nocashirl", + "indices": [ + "0", + "10" + ], + "id_str": "497059734", + "id": "497059734" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494376446373949440", + "id_str": "1494378506783838209", + "in_reply_to_user_id": "497059734", + "truncated": false, + "retweet_count": "0", + "id": "1494378506783838209", + "in_reply_to_status_id": "1494376446373949440", + "created_at": "Thu Feb 17 18:29:34 +0000 2022", + "favorited": false, + "full_text": "@nocashirl Yes, they're called Venture Capitalists.", + "lang": "en", + "in_reply_to_screen_name": "nocashirl", + "in_reply_to_user_id_str": "497059734" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956926042484088832" + ], + "editableUntil": "2018-01-26T17:25:22.011Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/ZlRAZTqTdv", + "expanded_url": "https://www.wired.com/story/the-dirty-war-over-diversity-inside-google/", + "display_url": "wired.com/story/the-dirt…", + "indices": [ + "59", + "82" + ] + } + ] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "24", + "id_str": "956926042484088832", + "truncated": false, + "retweet_count": "10", + "id": "956926042484088832", + "possibly_sensitive": false, + "created_at": "Fri Jan 26 16:25:22 +0000 2018", + "favorited": false, + "full_text": "Google's internal fight over diversity is very, very ugly. https://t.co/ZlRAZTqTdv", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956919208641613826" + ], + "editableUntil": "2018-01-26T16:58:12.696Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + }, + { + "name": "Patrick Stewart", + "screen_name": "SirPatStew", + "indices": [ + "9", + "20" + ], + "id_str": "602317143", + "id": "602317143" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "57" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956790843100164096", + "id_str": "956919208641613826", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "956919208641613826", + "in_reply_to_status_id": "956790843100164096", + "created_at": "Fri Jan 26 15:58:12 +0000 2018", + "favorited": false, + "full_text": "@terronk @SirPatStew 19th century British naval captains.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956768807963389952" + ], + "editableUntil": "2018-01-26T07:00:34.380Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "The Asa Who Taits", + "screen_name": "AsaTait", + "indices": [ + "0", + "8" + ], + "id_str": "944670973", + "id": "944670973" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "75" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956766568649703424", + "id_str": "956768807963389952", + "in_reply_to_user_id": "944670973", + "truncated": false, + "retweet_count": "0", + "id": "956768807963389952", + "in_reply_to_status_id": "956766568649703424", + "created_at": "Fri Jan 26 06:00:34 +0000 2018", + "favorited": false, + "full_text": "@AsaTait Exactly. Also very clearly tied into the first three X-Men movies.", + "lang": "en", + "in_reply_to_screen_name": "AsaTait", + "in_reply_to_user_id_str": "944670973" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956768579436687360" + ], + "editableUntil": "2018-01-26T06:59:39.895Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ben", + "screen_name": "sangster", + "indices": [ + "0", + "9" + ], + "id_str": "312909735", + "id": "312909735" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "17" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956765135460122625", + "id_str": "956768579436687360", + "in_reply_to_user_id": "312909735", + "truncated": false, + "retweet_count": "0", + "id": "956768579436687360", + "in_reply_to_status_id": "956765135460122625", + "created_at": "Fri Jan 26 05:59:39 +0000 2018", + "favorited": false, + "full_text": "@sangster Right??", + "lang": "en", + "in_reply_to_screen_name": "sangster", + "in_reply_to_user_id_str": "312909735" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956747248867540992" + ], + "editableUntil": "2018-01-26T05:34:54.291Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956746421696262147", + "id_str": "956747248867540992", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "956747248867540992", + "in_reply_to_status_id": "956746421696262147", + "created_at": "Fri Jan 26 04:34:54 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu I still seem to be confined to my bed so it's possible I will find out.", + "lang": "en", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956746098227363840" + ], + "editableUntil": "2018-01-26T05:30:19.957Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956653672137613312", + "id_str": "956746098227363840", + "in_reply_to_user_id": "154189594", + "truncated": false, + "retweet_count": "0", + "id": "956746098227363840", + "in_reply_to_status_id": "956653672137613312", + "created_at": "Fri Jan 26 04:30:19 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes I loved Earthsea.", + "lang": "en", + "in_reply_to_screen_name": "tandemNuclei", + "in_reply_to_user_id_str": "154189594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956745988080730113" + ], + "editableUntil": "2018-01-26T05:29:53.696Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "4", + "id_str": "956745988080730113", + "truncated": false, + "retweet_count": "0", + "id": "956745988080730113", + "created_at": "Fri Jan 26 04:29:53 +0000 2018", + "favorited": false, + "full_text": "Caught up on The Gifted and oh my the cuckoos are in this? I am suddenly on board.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956742947050897409" + ], + "editableUntil": "2018-01-26T05:17:48.658Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kole", + "screen_name": "kolsvein", + "indices": [ + "0", + "9" + ], + "id_str": "15175789", + "id": "15175789" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "93" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956742217334444032", + "id_str": "956742947050897409", + "in_reply_to_user_id": "15175789", + "truncated": false, + "retweet_count": "0", + "id": "956742947050897409", + "in_reply_to_status_id": "956742217334444032", + "created_at": "Fri Jan 26 04:17:48 +0000 2018", + "favorited": false, + "full_text": "@kolsvein That’s extremely specific but not so specific that I would bet against it existing.", + "lang": "en", + "in_reply_to_screen_name": "kolsvein", + "in_reply_to_user_id_str": "15175789" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956741815406743552" + ], + "editableUntil": "2018-01-26T05:13:18.853Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "acapella foley artist", + "screen_name": "ELLIOTTCABLE", + "indices": [ + "0", + "13" + ], + "id_str": "771681", + "id": "771681" + }, + { + "name": "Kole", + "screen_name": "kolsvein", + "indices": [ + "14", + "23" + ], + "id_str": "15175789", + "id": "15175789" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "102" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956741497902194696", + "id_str": "956741815406743552", + "in_reply_to_user_id": "771681", + "truncated": false, + "retweet_count": "0", + "id": "956741815406743552", + "in_reply_to_status_id": "956741497902194696", + "created_at": "Fri Jan 26 04:13:18 +0000 2018", + "favorited": false, + "full_text": "@ELLIOTTCABLE @kolsvein We’ve never met! This was a thirst follow who turned out to be interesting tbh", + "lang": "en", + "in_reply_to_screen_name": "ELLIOTTCABLE", + "in_reply_to_user_id_str": "771681" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956741254301155329" + ], + "editableUntil": "2018-01-26T05:11:05.075Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kole", + "screen_name": "kolsvein", + "indices": [ + "0", + "9" + ], + "id_str": "15175789", + "id": "15175789" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "198" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956740076377198592", + "id_str": "956741254301155329", + "in_reply_to_user_id": "15175789", + "truncated": false, + "retweet_count": "0", + "id": "956741254301155329", + "in_reply_to_status_id": "956740076377198592", + "created_at": "Fri Jan 26 04:11:05 +0000 2018", + "favorited": false, + "full_text": "@kolsvein No, I mean pro trainers all have this kink and they get you to pay them. In the same way that all the people who work in shoe stores are foot fetishists, and all cops are into power trips.", + "lang": "en", + "in_reply_to_screen_name": "kolsvein", + "in_reply_to_user_id_str": "15175789" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956738802088796162" + ], + "editableUntil": "2018-01-26T05:01:20.422Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kole", + "screen_name": "kolsvein", + "indices": [ + "0", + "9" + ], + "id_str": "15175789", + "id": "15175789" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956737606817021953", + "id_str": "956738802088796162", + "in_reply_to_user_id": "15175789", + "truncated": false, + "retweet_count": "0", + "id": "956738802088796162", + "in_reply_to_status_id": "956737606817021953", + "created_at": "Fri Jan 26 04:01:20 +0000 2018", + "favorited": false, + "full_text": "@kolsvein Lots of people have this kink but they monetize it.", + "lang": "en", + "in_reply_to_screen_name": "kolsvein", + "in_reply_to_user_id_str": "15175789" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956720411235921920" + ], + "editableUntil": "2018-01-26T03:48:15.701Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "user_mentions": [ + { + "name": "sailor mercury", + "screen_name": "sailorhg", + "indices": [ + "0", + "9" + ], + "id_str": "61705400", + "id": "61705400" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/956720411235921920/photo/1", + "indices": [ + "25", + "48" + ], + "url": "https://t.co/6QU4GB3iC4", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DUb0Ig1U8AATP25.jpg", + "id_str": "956720397952544768", + "id": "956720397952544768", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DUb0Ig1U8AATP25.jpg", + "sizes": { + "small": { + "w": "500", + "h": "500", + "resize": "fit" + }, + "medium": { + "w": "500", + "h": "500", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "500", + "h": "500", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/6QU4GB3iC4" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "30", + "in_reply_to_status_id_str": "956714236767387648", + "id_str": "956720411235921920", + "in_reply_to_user_id": "61705400", + "truncated": false, + "retweet_count": "0", + "id": "956720411235921920", + "in_reply_to_status_id": "956714236767387648", + "possibly_sensitive": false, + "created_at": "Fri Jan 26 02:48:15 +0000 2018", + "favorited": false, + "full_text": "@sailorhg Kate Libby obv https://t.co/6QU4GB3iC4", + "lang": "en", + "in_reply_to_screen_name": "sailorhg", + "in_reply_to_user_id_str": "61705400", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/956720411235921920/photo/1", + "indices": [ + "25", + "48" + ], + "url": "https://t.co/6QU4GB3iC4", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DUb0Ig1U8AATP25.jpg", + "id_str": "956720397952544768", + "video_info": { + "aspect_ratio": [ + "1", + "1" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DUb0Ig1U8AATP25.mp4" + } + ] + }, + "id": "956720397952544768", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DUb0Ig1U8AATP25.jpg", + "sizes": { + "small": { + "w": "500", + "h": "500", + "resize": "fit" + }, + "medium": { + "w": "500", + "h": "500", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "500", + "h": "500", + "resize": "fit" + } + }, + "type": "animated_gif", + "display_url": "pic.twitter.com/6QU4GB3iC4" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956716180785446913" + ], + "editableUntil": "2018-01-26T03:31:27.083Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Here Comes The Sun", + "screen_name": "SunOfSeldo", + "indices": [ + "3", + "14" + ], + "id_str": "456374925", + "id": "456374925" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "956716180785446913", + "truncated": false, + "retweet_count": "0", + "id": "956716180785446913", + "created_at": "Fri Jan 26 02:31:27 +0000 2018", + "favorited": false, + "full_text": "RT @SunOfSeldo: There’s less than a week left in January, the end of this crappy month is in sight. And today had 1 minute and 45 seconds m…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956683930148589568" + ], + "editableUntil": "2018-01-26T01:23:17.932Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "deray", + "screen_name": "deray", + "indices": [ + "0", + "6" + ], + "id_str": "29417304", + "id": "29417304" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "66", + "in_reply_to_status_id_str": "956683664145944576", + "id_str": "956683930148589568", + "in_reply_to_user_id": "29417304", + "truncated": false, + "retweet_count": "0", + "id": "956683930148589568", + "in_reply_to_status_id": "956683664145944576", + "created_at": "Fri Jan 26 00:23:17 +0000 2018", + "favorited": false, + "full_text": "@deray 120,000 emails??? You are giving me anxiety man.", + "lang": "en", + "in_reply_to_screen_name": "deray", + "in_reply_to_user_id_str": "29417304" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956683654880673792" + ], + "editableUntil": "2018-01-26T01:22:12.303Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "0", + "11" + ], + "id_str": "68567860", + "id": "68567860" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "63" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956682697883209731", + "id_str": "956683654880673792", + "in_reply_to_user_id": "68567860", + "truncated": false, + "retweet_count": "0", + "id": "956683654880673792", + "in_reply_to_status_id": "956682697883209731", + "created_at": "Fri Jan 26 00:22:12 +0000 2018", + "favorited": false, + "full_text": "@AdamRackis A+ parenting. My brother used to eat limes for fun.", + "lang": "en", + "in_reply_to_screen_name": "AdamRackis", + "in_reply_to_user_id_str": "68567860" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956662866613911552" + ], + "editableUntil": "2018-01-25T23:59:35.994Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andrew Betts", + "screen_name": "triblondon", + "indices": [ + "0", + "11" + ], + "id_str": "7311232", + "id": "7311232" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956658778535063553", + "id_str": "956662866613911552", + "in_reply_to_user_id": "7311232", + "truncated": false, + "retweet_count": "0", + "id": "956662866613911552", + "in_reply_to_status_id": "956658778535063553", + "created_at": "Thu Jan 25 22:59:35 +0000 2018", + "favorited": false, + "full_text": "@triblondon The system works!", + "lang": "en", + "in_reply_to_screen_name": "triblondon", + "in_reply_to_user_id_str": "7311232" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956622992951328768" + ], + "editableUntil": "2018-01-25T21:21:09.372Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Osborn 🏳️🌈", + "screen_name": "john_osborn", + "indices": [ + "0", + "12" + ], + "id_str": "17811991", + "id": "17811991" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "77" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956619747575070721", + "id_str": "956622992951328768", + "in_reply_to_user_id": "17811991", + "truncated": false, + "retweet_count": "0", + "id": "956622992951328768", + "in_reply_to_status_id": "956619747575070721", + "created_at": "Thu Jan 25 20:21:09 +0000 2018", + "favorited": false, + "full_text": "@john_osborn I did this morning. It is apparently normal post food poisoning.", + "lang": "en", + "in_reply_to_screen_name": "john_osborn", + "in_reply_to_user_id_str": "17811991" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956617287947075585" + ], + "editableUntil": "2018-01-25T20:58:29.193Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "coco", + "screen_name": "cococoyote", + "indices": [ + "0", + "11" + ], + "id_str": "954596036", + "id": "954596036" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956616909411311617", + "id_str": "956617287947075585", + "in_reply_to_user_id": "954596036", + "truncated": false, + "retweet_count": "0", + "id": "956617287947075585", + "in_reply_to_status_id": "956616909411311617", + "created_at": "Thu Jan 25 19:58:29 +0000 2018", + "favorited": false, + "full_text": "@cococoyote Always with the world war 2 atrocities.", + "lang": "en", + "in_reply_to_screen_name": "cococoyote", + "in_reply_to_user_id_str": "954596036" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956616632675086336" + ], + "editableUntil": "2018-01-25T20:55:52.964Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "sigh- o na BLACK LIVES MATTER !!", + "screen_name": "Mark_kaosat_dev", + "indices": [ + "0", + "16" + ], + "id_str": "261787927", + "id": "261787927" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956615986278526977", + "id_str": "956616632675086336", + "in_reply_to_user_id": "261787927", + "truncated": false, + "retweet_count": "0", + "id": "956616632675086336", + "in_reply_to_status_id": "956615986278526977", + "created_at": "Thu Jan 25 19:55:52 +0000 2018", + "favorited": false, + "full_text": "@Mark_kaosat_dev I went this morning and have been assigned rehydration and rest :-)", + "lang": "en", + "in_reply_to_screen_name": "Mark_kaosat_dev", + "in_reply_to_user_id_str": "261787927" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956613604043759616" + ], + "editableUntil": "2018-01-25T20:43:50.882Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "148" + ], + "favorite_count": "9", + "id_str": "956613604043759616", + "truncated": false, + "retweet_count": "0", + "id": "956613604043759616", + "created_at": "Thu Jan 25 19:43:50 +0000 2018", + "favorited": false, + "full_text": "I have been in constant low level abdominal pain for 48 hours and some people have it much worse than me obviously but this is getting olllllllllld.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956607035344175104" + ], + "editableUntil": "2018-01-25T20:17:44.782Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "106" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956606348707287040", + "id_str": "956607035344175104", + "in_reply_to_user_id": "154189594", + "truncated": false, + "retweet_count": "0", + "id": "956607035344175104", + "in_reply_to_status_id": "956606348707287040", + "created_at": "Thu Jan 25 19:17:44 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes I suspect really stupid and extremely old software is involved. I don't know the exact reason.", + "lang": "en", + "in_reply_to_screen_name": "tandemNuclei", + "in_reply_to_user_id_str": "154189594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956604471970209792" + ], + "editableUntil": "2018-01-25T20:07:33.626Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [ + { + "url": "https://t.co/XU42PGhax4", + "expanded_url": "https://www.taxact.com/support/1183/2017/form-1099-div-rounding", + "display_url": "taxact.com/support/1183/2…", + "indices": [ + "51", + "74" + ] + } + ] + }, + "display_text_range": [ + "0", + "74" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956603837585924096", + "id_str": "956604471970209792", + "in_reply_to_user_id": "154189594", + "truncated": false, + "retweet_count": "0", + "id": "956604471970209792", + "in_reply_to_status_id": "956603837585924096", + "possibly_sensitive": false, + "created_at": "Thu Jan 25 19:07:33 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes That's not a bug, the IRS requires it: https://t.co/XU42PGhax4", + "lang": "en", + "in_reply_to_screen_name": "tandemNuclei", + "in_reply_to_user_id_str": "154189594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956601954737651713" + ], + "editableUntil": "2018-01-25T19:57:33.471Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "cara esten", + "screen_name": "esten", + "indices": [ + "0", + "6" + ], + "id_str": "1108462281237520384", + "id": "1108462281237520384" + }, + { + "name": "Butt Praxis buttpraxis.bsky.social", + "screen_name": "buttpraxis", + "indices": [ + "7", + "18" + ], + "id_str": "1270758145", + "id": "1270758145" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956598774268178433", + "id_str": "956601954737651713", + "in_reply_to_user_id": "15374401", + "truncated": false, + "retweet_count": "0", + "id": "956601954737651713", + "in_reply_to_status_id": "956598774268178433", + "created_at": "Thu Jan 25 18:57:33 +0000 2018", + "favorited": false, + "full_text": "@esten @buttpraxis I bet you could take Kay Ivey.", + "lang": "en", + "in_reply_to_screen_name": "caraesten", + "in_reply_to_user_id_str": "15374401" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956588812192202753" + ], + "editableUntil": "2018-01-25T19:05:20.044Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "143" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "956586762813370368", + "id_str": "956588812192202753", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "956588812192202753", + "in_reply_to_status_id": "956586762813370368", + "created_at": "Thu Jan 25 18:05:20 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton I would pay twitter extra for an ultra-block that not only blocked them but notified them they have been blocked and taunted them.", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956571793120149504" + ], + "editableUntil": "2018-01-25T17:57:42.381Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "", + "screen_name": "shherief", + "indices": [ + "3", + "12" + ], + "id_str": "-1", + "id": "-1" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "956571793120149504", + "truncated": false, + "retweet_count": "0", + "id": "956571793120149504", + "created_at": "Thu Jan 25 16:57:42 +0000 2018", + "favorited": false, + "full_text": "RT @shherief: having curly hair is like playing a really scary guessing game where you dont know what it's going to do until it does it and…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956562776180183040" + ], + "editableUntil": "2018-01-25T17:21:52.575Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/8a8iicJrgA", + "expanded_url": "https://twitter.com/tnewtondunn/status/956561983813414912", + "display_url": "twitter.com/tnewtondunn/st…", + "indices": [ + "85", + "108" + ] + } + ] + }, + "display_text_range": [ + "0", + "108" + ], + "favorite_count": "4", + "id_str": "956562776180183040", + "truncated": false, + "retweet_count": "1", + "id": "956562776180183040", + "possibly_sensitive": false, + "created_at": "Thu Jan 25 16:21:52 +0000 2018", + "favorited": false, + "full_text": "I have not eyes enough to roll at these assholes begrudgingly acknowledging reality. https://t.co/8a8iicJrgA", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956545148824952832" + ], + "editableUntil": "2018-01-25T16:11:49.886Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "erowid coin bot", + "screen_name": "icowid", + "indices": [ + "3", + "10" + ], + "id_str": "956405780458045440", + "id": "956405780458045440" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "71" + ], + "favorite_count": "0", + "id_str": "956545148824952832", + "truncated": false, + "retweet_count": "0", + "id": "956545148824952832", + "created_at": "Thu Jan 25 15:11:49 +0000 2018", + "favorited": false, + "full_text": "RT @icowid: I slowly drifted back into the traditional financial system", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956544972987105280" + ], + "editableUntil": "2018-01-25T16:11:07.963Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "yan", + "screen_name": "bcrypt", + "indices": [ + "3", + "10" + ], + "id_str": "968881477", + "id": "968881477" + }, + { + "name": "erowid coin bot", + "screen_name": "icowid", + "indices": [ + "24", + "31" + ], + "id_str": "956405780458045440", + "id": "956405780458045440" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "119" + ], + "favorite_count": "0", + "id_str": "956544972987105280", + "truncated": false, + "retweet_count": "0", + "id": "956544972987105280", + "created_at": "Thu Jan 25 15:11:07 +0000 2018", + "favorited": false, + "full_text": "RT @bcrypt: introducing @icowid, an account that tweets markov chain mashups of ICO whitepapers and erowid trip reports", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956377168044371968" + ], + "editableUntil": "2018-01-25T05:04:20.147Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Laura Klein", + "screen_name": "lauraklein", + "indices": [ + "0", + "11" + ], + "id_str": "14804195", + "id": "14804195" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "52" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956375882297323521", + "id_str": "956377168044371968", + "in_reply_to_user_id": "14804195", + "truncated": false, + "retweet_count": "0", + "id": "956377168044371968", + "in_reply_to_status_id": "956375882297323521", + "created_at": "Thu Jan 25 04:04:20 +0000 2018", + "favorited": false, + "full_text": "@lauraklein I've been on this train for a long time.", + "lang": "en", + "in_reply_to_screen_name": "lauraklein", + "in_reply_to_user_id_str": "14804195" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956339981546545152" + ], + "editableUntil": "2018-01-25T02:36:34.195Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jess Zimmerman", + "screen_name": "j_zimms", + "indices": [ + "0", + "8" + ], + "id_str": "14714760", + "id": "14714760" + }, + { + "name": "bela lugosi's dad", + "screen_name": "markpopham", + "indices": [ + "9", + "20" + ], + "id_str": "66288602", + "id": "66288602" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "30" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956265793968377856", + "id_str": "956339981546545152", + "in_reply_to_user_id": "14714760", + "truncated": false, + "retweet_count": "0", + "id": "956339981546545152", + "in_reply_to_status_id": "956265793968377856", + "created_at": "Thu Jan 25 01:36:34 +0000 2018", + "favorited": false, + "full_text": "@j_zimms @markpopham For real.", + "lang": "en", + "in_reply_to_screen_name": "j_zimms", + "in_reply_to_user_id_str": "14714760" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956339622816067584" + ], + "editableUntil": "2018-01-25T02:35:08.667Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/jEd0CqM1I6", + "expanded_url": "https://www.nytimes.com/2018/01/24/us/politics/trump-immigration-daca-dreamers-path-to-citizenship.html", + "display_url": "nytimes.com/2018/01/24/us/…", + "indices": [ + "191", + "214" + ] + } + ] + }, + "display_text_range": [ + "0", + "214" + ], + "favorite_count": "19", + "id_str": "956339622816067584", + "truncated": false, + "retweet_count": "5", + "id": "956339622816067584", + "possibly_sensitive": false, + "created_at": "Thu Jan 25 01:35:08 +0000 2018", + "favorited": false, + "full_text": "Trump dropped in unannounced to a briefing on his administration's immigration policy and, in unscripted remarks, reversed that policy. But don't get excited, nothing he says means anything. https://t.co/jEd0CqM1I6", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956335179785629696" + ], + "editableUntil": "2018-01-25T02:17:29.366Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "React", + "screen_name": "reactjs", + "indices": [ + "9", + "17" + ], + "id_str": "1566463268", + "id": "1566463268" + }, + { + "name": "Vue.js", + "screen_name": "vuejs", + "indices": [ + "18", + "24" + ], + "id_str": "2292889800", + "id": "2292889800" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "104" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956300385915932672", + "id_str": "956335179785629696", + "in_reply_to_user_id": "119589307", + "truncated": false, + "retweet_count": "0", + "id": "956335179785629696", + "in_reply_to_status_id": "956300385915932672", + "created_at": "Thu Jan 25 01:17:29 +0000 2018", + "favorited": false, + "full_text": "@kessir_ @reactjs @vuejs I find Vue templating less ergonomic than JSX, but I'm really a newbie at both.", + "lang": "en", + "in_reply_to_screen_name": "kessrr", + "in_reply_to_user_id_str": "119589307" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956317078021070848" + ], + "editableUntil": "2018-01-25T01:05:33.569Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@mcc@mastodon.social", + "screen_name": "mcclure111", + "indices": [ + "0", + "11" + ], + "id_str": "312426579", + "id": "312426579" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956316704317026304", + "id_str": "956317078021070848", + "in_reply_to_user_id": "312426579", + "truncated": false, + "retweet_count": "0", + "id": "956317078021070848", + "in_reply_to_status_id": "956316704317026304", + "created_at": "Thu Jan 25 00:05:33 +0000 2018", + "favorited": false, + "full_text": "@mcclure111 Hodiernae haedos.", + "lang": "es", + "in_reply_to_screen_name": "mcclure111", + "in_reply_to_user_id_str": "312426579" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956315836423192576" + ], + "editableUntil": "2018-01-25T01:00:37.549Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "126" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "956135578377994240", + "id_str": "956315836423192576", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "956315836423192576", + "in_reply_to_status_id": "956135578377994240", + "created_at": "Thu Jan 25 00:00:37 +0000 2018", + "favorited": false, + "full_text": "Did you know food poisoning could give you a fever? I, under this pile of blankets with the thermostat cranked to 80, did not.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956315532759715840" + ], + "editableUntil": "2018-01-25T00:59:25.150Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/SVbPH5nObp", + "expanded_url": "https://twitter.com/jamilsmith/status/956289295383330817", + "display_url": "twitter.com/jamilsmith/sta…", + "indices": [ + "40", + "63" + ] + } + ] + }, + "display_text_range": [ + "0", + "63" + ], + "favorite_count": "27", + "id_str": "956315532759715840", + "truncated": false, + "retweet_count": "6", + "id": "956315532759715840", + "possibly_sensitive": false, + "created_at": "Wed Jan 24 23:59:25 +0000 2018", + "favorited": false, + "full_text": "Oh we *could*? I have bad news for you. https://t.co/SVbPH5nObp", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956311434857558016" + ], + "editableUntil": "2018-01-25T00:43:08.134Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "17" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "956304543058354179", + "id_str": "956311434857558016", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "956311434857558016", + "in_reply_to_status_id": "956304543058354179", + "created_at": "Wed Jan 24 23:43:08 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu Close.", + "lang": "en", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956294671822503936" + ], + "editableUntil": "2018-01-24T23:36:31.515Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "0", + "11" + ], + "id_str": "68567860", + "id": "68567860" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "956294461981626368", + "id_str": "956294671822503936", + "in_reply_to_user_id": "68567860", + "truncated": false, + "retweet_count": "0", + "id": "956294671822503936", + "in_reply_to_status_id": "956294461981626368", + "created_at": "Wed Jan 24 22:36:31 +0000 2018", + "favorited": false, + "full_text": "@AdamRackis They're not broken, just missing from cache. Will fix.", + "lang": "en", + "in_reply_to_screen_name": "AdamRackis", + "in_reply_to_user_id_str": "68567860" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956285752953851913" + ], + "editableUntil": "2018-01-24T23:01:05.091Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "TashasEv", + "screen_name": "TashasEv", + "indices": [ + "0", + "9" + ], + "id_str": "86327261", + "id": "86327261" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "60" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956283479976640513", + "id_str": "956285752953851913", + "in_reply_to_user_id": "86327261", + "truncated": false, + "retweet_count": "0", + "id": "956285752953851913", + "in_reply_to_status_id": "956283479976640513", + "created_at": "Wed Jan 24 22:01:05 +0000 2018", + "favorited": false, + "full_text": "@TashasEv But if a dog wore these pants, how would it do so?", + "lang": "en", + "in_reply_to_screen_name": "TashasEv", + "in_reply_to_user_id_str": "86327261" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956272045624508416" + ], + "editableUntil": "2018-01-24T22:06:37.009Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "zacharyorr", + "screen_name": "ZacharyOrr", + "indices": [ + "15", + "26" + ], + "id_str": "1108803871109976064", + "id": "1108803871109976064" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "74" + ], + "favorite_count": "7", + "id_str": "956272045624508416", + "truncated": false, + "retweet_count": "1", + "id": "956272045624508416", + "created_at": "Wed Jan 24 21:06:37 +0000 2018", + "favorited": false, + "full_text": "TIL talking to @ZacharyOrr in person is like listening to a podcast at 2x.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956248408137777152" + ], + "editableUntil": "2018-01-24T20:32:41.393Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956236870165434368", + "id_str": "956248408137777152", + "in_reply_to_user_id": "1261726454", + "truncated": false, + "retweet_count": "0", + "id": "956248408137777152", + "in_reply_to_status_id": "956236870165434368", + "created_at": "Wed Jan 24 19:32:41 +0000 2018", + "favorited": false, + "full_text": "@incogellen Mysteriously Well Paid Freelance Magazine Feature Writer.", + "lang": "en", + "in_reply_to_screen_name": "flounge_girl", + "in_reply_to_user_id_str": "1261726454" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956247127037952001" + ], + "editableUntil": "2018-01-24T20:27:35.955Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "alex norris", + "screen_name": "dorrismccomics", + "indices": [ + "3", + "18" + ], + "id_str": "522519631", + "id": "522519631" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/dorrismccomics/status/956244207487930368/photo/1", + "source_status_id": "956244207487930368", + "indices": [ + "20", + "43" + ], + "url": "https://t.co/ionnCUhH5H", + "media_url": "http://pbs.twimg.com/media/DUVC-9SWAAEyznv.jpg", + "id_str": "956244145256923137", + "source_user_id": "522519631", + "id": "956244145256923137", + "media_url_https": "https://pbs.twimg.com/media/DUVC-9SWAAEyznv.jpg", + "source_user_id_str": "522519631", + "sizes": { + "large": { + "w": "2048", + "h": "878", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "514", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "291", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "956244207487930368", + "display_url": "pic.twitter.com/ionnCUhH5H" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "0", + "id_str": "956247127037952001", + "truncated": false, + "retweet_count": "0", + "id": "956247127037952001", + "possibly_sensitive": false, + "created_at": "Wed Jan 24 19:27:35 +0000 2018", + "favorited": false, + "full_text": "RT @dorrismccomics: https://t.co/ionnCUhH5H", + "lang": "zxx", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/dorrismccomics/status/956244207487930368/photo/1", + "source_status_id": "956244207487930368", + "indices": [ + "20", + "43" + ], + "url": "https://t.co/ionnCUhH5H", + "media_url": "http://pbs.twimg.com/media/DUVC-9SWAAEyznv.jpg", + "id_str": "956244145256923137", + "source_user_id": "522519631", + "id": "956244145256923137", + "media_url_https": "https://pbs.twimg.com/media/DUVC-9SWAAEyznv.jpg", + "source_user_id_str": "522519631", + "sizes": { + "large": { + "w": "2048", + "h": "878", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "514", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "291", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "956244207487930368", + "display_url": "pic.twitter.com/ionnCUhH5H" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956162311432974336" + ], + "editableUntil": "2018-01-24T14:50:34.339Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "mattie", + "screen_name": "thotxcouture", + "indices": [ + "0", + "13" + ], + "id_str": "276322412", + "id": "276322412" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "65" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "956161619838619650", + "id_str": "956162311432974336", + "in_reply_to_user_id": "276322412", + "truncated": false, + "retweet_count": "0", + "id": "956162311432974336", + "in_reply_to_status_id": "956161619838619650", + "created_at": "Wed Jan 24 13:50:34 +0000 2018", + "favorited": false, + "full_text": "@thotxcouture This was also how gay dating was when I was a teen.", + "lang": "en", + "in_reply_to_screen_name": "thotxcouture", + "in_reply_to_user_id_str": "276322412" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956159154913034240" + ], + "editableUntil": "2018-01-24T14:38:01.766Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@mwdelaney@mastodon.social", + "screen_name": "MichaelWDelaney", + "indices": [ + "0", + "16" + ], + "id_str": "114543786", + "id": "114543786" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "17", + "27" + ], + "id_str": "17950990", + "id": "17950990" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "91" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956042911161909250", + "id_str": "956159154913034240", + "in_reply_to_user_id": "114543786", + "truncated": false, + "retweet_count": "0", + "id": "956159154913034240", + "in_reply_to_status_id": "956042911161909250", + "created_at": "Wed Jan 24 13:38:01 +0000 2018", + "favorited": false, + "full_text": "@MichaelWDelaney @aredridel I live that story and use it all the time to explain inflation.", + "lang": "en", + "in_reply_to_screen_name": "MichaelWDelaney", + "in_reply_to_user_id_str": "114543786" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956151280430325760" + ], + "editableUntil": "2018-01-24T14:06:44.343Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Stewart Butterfield", + "screen_name": "stewart", + "indices": [ + "0", + "8" + ], + "id_str": "5699", + "id": "5699" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956148350474248192", + "id_str": "956151280430325760", + "in_reply_to_user_id": "5699", + "truncated": false, + "retweet_count": "0", + "id": "956151280430325760", + "in_reply_to_status_id": "956148350474248192", + "created_at": "Wed Jan 24 13:06:44 +0000 2018", + "favorited": false, + "full_text": "@stewart My word, why are you awake at 5am?", + "lang": "en", + "in_reply_to_screen_name": "stewart", + "in_reply_to_user_id_str": "5699" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956135578377994240" + ], + "editableUntil": "2018-01-24T13:04:20.682Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "105" + ], + "favorite_count": "57", + "id_str": "956135578377994240", + "truncated": false, + "retweet_count": "0", + "id": "956135578377994240", + "created_at": "Wed Jan 24 12:04:20 +0000 2018", + "favorited": false, + "full_text": "I got some bad news yesterday so I treated myself to comfort food and it gave me food poisoning. Awesome.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956042067368710145" + ], + "editableUntil": "2018-01-24T06:52:45.920Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@mwdelaney@mastodon.social", + "screen_name": "MichaelWDelaney", + "indices": [ + "3", + "19" + ], + "id_str": "114543786", + "id": "114543786" + }, + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "21", + "27" + ], + "id_str": "15453", + "id": "15453" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "28", + "38" + ], + "id_str": "17950990", + "id": "17950990" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "956042067368710145", + "truncated": false, + "retweet_count": "0", + "id": "956042067368710145", + "created_at": "Wed Jan 24 05:52:45 +0000 2018", + "favorited": false, + "full_text": "RT @MichaelWDelaney: @seldo @aredridel It’s almost like there isn’t a central authority dedicated to the currency remaining useful to its u…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956042018932871169" + ], + "editableUntil": "2018-01-24T06:52:34.372Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@mwdelaney@mastodon.social", + "screen_name": "MichaelWDelaney", + "indices": [ + "0", + "16" + ], + "id_str": "114543786", + "id": "114543786" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "17", + "27" + ], + "id_str": "17950990", + "id": "17950990" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "62" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "956041274552995840", + "id_str": "956042018932871169", + "in_reply_to_user_id": "114543786", + "truncated": false, + "retweet_count": "0", + "id": "956042018932871169", + "in_reply_to_status_id": "956041274552995840", + "created_at": "Wed Jan 24 05:52:34 +0000 2018", + "favorited": false, + "full_text": "@MichaelWDelaney @aredridel ding ding ding ding ding ding ding", + "lang": "en", + "in_reply_to_screen_name": "MichaelWDelaney", + "in_reply_to_user_id_str": "114543786" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956029923084423169" + ], + "editableUntil": "2018-01-24T06:04:30.497Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "180" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "956024007182176256", + "id_str": "956029923084423169", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "956029923084423169", + "in_reply_to_status_id": "956024007182176256", + "created_at": "Wed Jan 24 05:04:30 +0000 2018", + "favorited": false, + "full_text": "Next episode, Chakotay attempts to revive an unconscious Janeway by reciting a series of clichés:\n\"Breathe dammit, breathe!\"\n\"Don't you die on me now!\"\n\"Breathe! C'mon!\"\n(It works)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956024007182176256" + ], + "editableUntil": "2018-01-24T05:41:00.036Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "148" + ], + "favorite_count": "19", + "id_str": "956024007182176256", + "truncated": false, + "retweet_count": "0", + "id": "956024007182176256", + "created_at": "Wed Jan 24 04:41:00 +0000 2018", + "favorited": false, + "full_text": "In tonight's episode of me screaming \"WHO WROTE THIS SHIT?!\" at my screen, a holodeck malfunction takes control of the Enterprise... I mean Voyager.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956012249553911808" + ], + "editableUntil": "2018-01-24T04:54:16.799Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lev Grossman", + "screen_name": "leverus", + "indices": [ + "3", + "11" + ], + "id_str": "30980778", + "id": "30980778" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "956012249553911808", + "truncated": false, + "retweet_count": "0", + "id": "956012249553911808", + "created_at": "Wed Jan 24 03:54:16 +0000 2018", + "favorited": false, + "full_text": "RT @leverus: Interviewer: Which would you rather have, a National Book Award or a Hugo?\nLe Guin: Oh, a Nobel, of course\nInterviewer: They d…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956008138737516544" + ], + "editableUntil": "2018-01-24T04:37:56.704Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "0", + "8" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "11" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955965097607745536", + "id_str": "956008138737516544", + "in_reply_to_user_id": "78663", + "truncated": false, + "retweet_count": "0", + "id": "956008138737516544", + "in_reply_to_status_id": "955965097607745536", + "created_at": "Wed Jan 24 03:37:56 +0000 2018", + "favorited": false, + "full_text": "@ceejbot ❤️", + "lang": "qme", + "in_reply_to_screen_name": "ceejbot", + "in_reply_to_user_id_str": "78663" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956005021245571072" + ], + "editableUntil": "2018-01-24T04:25:33.436Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nicole Sanchez", + "screen_name": "nmsanchez", + "indices": [ + "0", + "10" + ], + "id_str": "15813127", + "id": "15813127" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "135" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "956004852328415232", + "id_str": "956005021245571072", + "in_reply_to_user_id": "15813127", + "truncated": false, + "retweet_count": "0", + "id": "956005021245571072", + "in_reply_to_status_id": "956004852328415232", + "created_at": "Wed Jan 24 03:25:33 +0000 2018", + "favorited": false, + "full_text": "@nmsanchez I am seeing commentary on this thing but not the actual thing. Is there a live stream? Somebody I should follow for updates?", + "lang": "en", + "in_reply_to_screen_name": "nmsanchez", + "in_reply_to_user_id_str": "15813127" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "956004296335634432" + ], + "editableUntil": "2018-01-24T04:22:40.604Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dan Primack", + "screen_name": "danprimack", + "indices": [ + "0", + "11" + ], + "id_str": "16246929", + "id": "16246929" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955902481304825856", + "id_str": "956004296335634432", + "in_reply_to_user_id": "16246929", + "truncated": false, + "retweet_count": "0", + "id": "956004296335634432", + "in_reply_to_status_id": "955902481304825856", + "created_at": "Wed Jan 24 03:22:40 +0000 2018", + "favorited": false, + "full_text": "@danprimack \"old conventional wisdom\" from, like, 12 months ago...", + "lang": "en", + "in_reply_to_screen_name": "danprimack", + "in_reply_to_user_id_str": "16246929" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955997430981410816" + ], + "editableUntil": "2018-01-24T03:55:23.776Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matthew Green", + "screen_name": "matthew_d_green", + "indices": [ + "3", + "19" + ], + "id_str": "106234268", + "id": "106234268" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "955997430981410816", + "truncated": false, + "retweet_count": "0", + "id": "955997430981410816", + "created_at": "Wed Jan 24 02:55:23 +0000 2018", + "favorited": false, + "full_text": "RT @matthew_d_green: I feel like “Tom Karlo” deserves a place in the dictionary. Like “oh no, are you Tom Karloing me?” It means ‘to pour d…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955997414007058432" + ], + "editableUntil": "2018-01-24T03:55:19.729Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matthew Green", + "screen_name": "matthew_d_green", + "indices": [ + "3", + "19" + ], + "id_str": "106234268", + "id": "106234268" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "955997414007058432", + "truncated": false, + "retweet_count": "0", + "id": "955997414007058432", + "created_at": "Wed Jan 24 02:55:19 +0000 2018", + "favorited": false, + "full_text": "RT @matthew_d_green: I’m going to hire Tom Karlo if I ever need to fire someone and want it to be really, really gentle. https://t.co/ivE7v…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955971892707442688" + ], + "editableUntil": "2018-01-24T02:13:54.977Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Derek Braid", + "screen_name": "Royal_Arse", + "indices": [ + "0", + "11" + ], + "id_str": "246360228", + "id": "246360228" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955963245587726341", + "id_str": "955971892707442688", + "in_reply_to_user_id": "246360228", + "truncated": false, + "retweet_count": "0", + "id": "955971892707442688", + "in_reply_to_status_id": "955963245587726341", + "created_at": "Wed Jan 24 01:13:54 +0000 2018", + "favorited": false, + "full_text": "@Royal_Arse So even though they don't like non-fiat currencies they supported them because it was fashionable and then stopped because it cost too much?", + "lang": "en", + "in_reply_to_screen_name": "Royal_Arse", + "in_reply_to_user_id_str": "246360228" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955962619138994177" + ], + "editableUntil": "2018-01-24T01:37:03.986Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "65" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955962449345343490", + "id_str": "955962619138994177", + "in_reply_to_user_id": "594182089", + "truncated": false, + "retweet_count": "0", + "id": "955962619138994177", + "in_reply_to_status_id": "955962449345343490", + "created_at": "Wed Jan 24 00:37:03 +0000 2018", + "favorited": false, + "full_text": "@whozzawuzza Disagree, Tuvix was WAY less irritating than Neelix.", + "lang": "en", + "in_reply_to_user_id_str": "594182089" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955962417753673728" + ], + "editableUntil": "2018-01-24T01:36:15.972Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Derek Braid", + "screen_name": "Royal_Arse", + "indices": [ + "0", + "11" + ], + "id_str": "246360228", + "id": "246360228" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "110" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955959552771526657", + "id_str": "955962417753673728", + "in_reply_to_user_id": "246360228", + "truncated": false, + "retweet_count": "0", + "id": "955962417753673728", + "in_reply_to_status_id": "955959552771526657", + "created_at": "Wed Jan 24 00:36:15 +0000 2018", + "favorited": false, + "full_text": "@Royal_Arse Why would they have bothered to support it in the first place if they don't like cryptocurrencies?", + "lang": "en", + "in_reply_to_screen_name": "Royal_Arse", + "in_reply_to_user_id_str": "246360228" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955956817988694021" + ], + "editableUntil": "2018-01-24T01:14:00.884Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Amy Crimmens", + "screen_name": "AmyCrimmens", + "indices": [ + "0", + "12" + ], + "id_str": "206228797", + "id": "206228797" + }, + { + "name": "React London", + "screen_name": "ReactLondon_", + "indices": [ + "13", + "26" + ], + "id_str": "3115053970", + "id": "3115053970" + }, + { + "name": "Marcel Cutts", + "screen_name": "marcelcutts", + "indices": [ + "27", + "39" + ], + "id_str": "1615587182", + "id": "1615587182" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "75" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "955888135363325953", + "id_str": "955956817988694021", + "in_reply_to_user_id": "206228797", + "truncated": false, + "retweet_count": "0", + "id": "955956817988694021", + "in_reply_to_status_id": "955888135363325953", + "created_at": "Wed Jan 24 00:14:00 +0000 2018", + "favorited": false, + "full_text": "@AmyCrimmens @ReactLondon_ @marcelcutts Instant follow just for the tights.", + "lang": "en", + "in_reply_to_screen_name": "AmyCrimmens", + "in_reply_to_user_id_str": "206228797" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955955479141756928" + ], + "editableUntil": "2018-01-24T01:08:41.678Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/kQbmr8OHbE", + "expanded_url": "https://www.nbcnews.com/business/travel/tourism-u-s-down-trump-took-office-costing-4-6-n840326?cid=sm_npd_nn_tw_ma", + "display_url": "nbcnews.com/business/trave…", + "indices": [ + "105", + "128" + ] + } + ] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "15", + "id_str": "955955479141756928", + "truncated": false, + "retweet_count": "14", + "id": "955955479141756928", + "possibly_sensitive": false, + "created_at": "Wed Jan 24 00:08:41 +0000 2018", + "favorited": false, + "full_text": "Trump's xenophobic administration has hit US tourism to the tune of 4.6 billion dollars and 40,000 jobs: https://t.co/kQbmr8OHbE", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955953284023443456" + ], + "editableUntil": "2018-01-24T00:59:58.321Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "27" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955953006121443333", + "id_str": "955953284023443456", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "955953284023443456", + "in_reply_to_status_id": "955953006121443333", + "created_at": "Tue Jan 23 23:59:58 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait B I T C O I N", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955936044435697665" + ], + "editableUntil": "2018-01-23T23:51:28.083Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/UVhx86rvxz", + "expanded_url": "http://www.apple.com/newsroom/2018/01/homepod-arrives-february-9-available-to-order-this-friday/", + "display_url": "apple.com/newsroom/2018/…", + "indices": [ + "112", + "135" + ] + } + ] + }, + "display_text_range": [ + "0", + "135" + ], + "favorite_count": "17", + "id_str": "955936044435697665", + "truncated": false, + "retweet_count": "0", + "id": "955936044435697665", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 22:51:28 +0000 2018", + "favorited": false, + "full_text": "If you've always wanted to buy a giant loud speaker that misunderstands everything you say, now is your chance: https://t.co/UVhx86rvxz", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955933899837734912" + ], + "editableUntil": "2018-01-23T23:42:56.771Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/955933899837734912/photo/1", + "indices": [ + "65", + "88" + ], + "url": "https://t.co/TaKelfsRD4", + "media_url": "http://pbs.twimg.com/media/DUQo0CUU0AEKU7p.jpg", + "id_str": "955933895349817345", + "id": "955933895349817345", + "media_url_https": "https://pbs.twimg.com/media/DUQo0CUU0AEKU7p.jpg", + "sizes": { + "small": { + "w": "511", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "901", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1538", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/TaKelfsRD4" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "88" + ], + "favorite_count": "47", + "id_str": "955933899837734912", + "truncated": false, + "retweet_count": "0", + "id": "955933899837734912", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 22:42:56 +0000 2018", + "favorited": false, + "full_text": "I describe my look today as \"business alpaca\". Haircut tomorrow. https://t.co/TaKelfsRD4", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/955933899837734912/photo/1", + "indices": [ + "65", + "88" + ], + "url": "https://t.co/TaKelfsRD4", + "media_url": "http://pbs.twimg.com/media/DUQo0CUU0AEKU7p.jpg", + "id_str": "955933895349817345", + "id": "955933895349817345", + "media_url_https": "https://pbs.twimg.com/media/DUQo0CUU0AEKU7p.jpg", + "sizes": { + "small": { + "w": "511", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "901", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1538", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/TaKelfsRD4" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955932299446464512" + ], + "editableUntil": "2018-01-23T23:36:35.208Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955931653649518592", + "id_str": "955932299446464512", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "955932299446464512", + "in_reply_to_status_id": "955931653649518592", + "created_at": "Tue Jan 23 22:36:35 +0000 2018", + "favorited": false, + "full_text": "@nebrius I promise you it's neither.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955930305927376896" + ], + "editableUntil": "2018-01-23T23:28:39.916Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Mrnwtn5eqZ", + "expanded_url": "https://stripe.com/blog/ending-bitcoin-support", + "display_url": "stripe.com/blog/ending-bi…", + "indices": [ + "119", + "142" + ] + } + ] + }, + "display_text_range": [ + "0", + "142" + ], + "favorite_count": "184", + "id_str": "955930305927376896", + "truncated": false, + "retweet_count": "97", + "id": "955930305927376896", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 22:28:39 +0000 2018", + "favorited": false, + "full_text": "Nobody uses Bitcoin to buy anything anymore because transaction fees are too high, so Stripe is ending support for it: https://t.co/Mrnwtn5eqZ", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955915895594893312" + ], + "editableUntil": "2018-01-23T22:31:24.225Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955876130019397632", + "id_str": "955915895594893312", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "955915895594893312", + "in_reply_to_status_id": "955876130019397632", + "created_at": "Tue Jan 23 21:31:24 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait \"And mirrors\" according to some googling.", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955869410081718272" + ], + "editableUntil": "2018-01-23T19:26:41.215Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "121" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "955869063741431808", + "id_str": "955869410081718272", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "955869410081718272", + "in_reply_to_status_id": "955869063741431808", + "created_at": "Tue Jan 23 18:26:41 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ I mean, if you are a medical company and gender is relevant to the type of medical service you are providing.", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955869071202897920" + ], + "editableUntil": "2018-01-23T19:25:20.420Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "78" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955863399849648129", + "id_str": "955869071202897920", + "in_reply_to_user_id": "4254951", + "truncated": false, + "retweet_count": "0", + "id": "955869071202897920", + "in_reply_to_status_id": "955863399849648129", + "created_at": "Tue Jan 23 18:25:20 +0000 2018", + "favorited": false, + "full_text": "@jef_poskanzer He was none of those things. A tall skinny white dude, on foot.", + "lang": "en", + "in_reply_to_screen_name": "jefposk", + "in_reply_to_user_id_str": "4254951" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955868865254146048" + ], + "editableUntil": "2018-01-23T19:24:31.318Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/50gGBrNeWi", + "expanded_url": "https://twitter.com/esten/status/955863343503298560", + "display_url": "twitter.com/esten/status/9…", + "indices": [ + "34", + "57" + ] + } + ] + }, + "display_text_range": [ + "0", + "57" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "954596651439566853", + "id_str": "955868865254146048", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "955868865254146048", + "in_reply_to_status_id": "954596651439566853", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 18:24:31 +0000 2018", + "favorited": false, + "full_text": "This can't just be a coincidence: https://t.co/50gGBrNeWi", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955868752137957376" + ], + "editableUntil": "2018-01-23T19:24:04.349Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "cara esten", + "screen_name": "esten", + "indices": [ + "0", + "6" + ], + "id_str": "1108462281237520384", + "id": "1108462281237520384" + }, + { + "name": "ellen teapot 🇨🇦🇺🇸🏳️⚧️", + "screen_name": "asmallteapot", + "indices": [ + "7", + "20" + ], + "id_str": "14202167", + "id": "14202167" + } + ], + "urls": [ + { + "url": "https://t.co/bWrfbo6CuK", + "expanded_url": "https://twitter.com/seldo/status/954592937702125568", + "display_url": "twitter.com/seldo/status/9…", + "indices": [ + "61", + "84" + ] + } + ] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955864431887450112", + "id_str": "955868752137957376", + "in_reply_to_user_id": "15374401", + "truncated": false, + "retweet_count": "0", + "id": "955868752137957376", + "in_reply_to_status_id": "955864431887450112", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 18:24:04 +0000 2018", + "favorited": false, + "full_text": "@esten @asmallteapot I got so angry about it I tweetstormed: https://t.co/bWrfbo6CuK", + "lang": "en", + "in_reply_to_screen_name": "caraesten", + "in_reply_to_user_id_str": "15374401" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955868634781401088" + ], + "editableUntil": "2018-01-23T19:23:36.369Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/CJg8Mp65Tl", + "expanded_url": "https://twitter.com/mspowahs/status/955851780411109376", + "display_url": "twitter.com/mspowahs/statu…", + "indices": [ + "157", + "180" + ] + } + ] + }, + "display_text_range": [ + "0", + "180" + ], + "favorite_count": "72", + "id_str": "955868634781401088", + "truncated": false, + "retweet_count": "13", + "id": "955868634781401088", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 18:23:36 +0000 2018", + "favorited": false, + "full_text": "I cannot emphasize enough how extremely useless it is to collect gender unless you are literally a medical company. All it will let you do is bad marketing. https://t.co/CJg8Mp65Tl", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955868184669638656" + ], + "editableUntil": "2018-01-23T19:21:49.054Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "13", + "id_str": "955868184669638656", + "truncated": false, + "retweet_count": "1", + "id": "955868184669638656", + "created_at": "Tue Jan 23 18:21:49 +0000 2018", + "favorited": false, + "full_text": "I have absolutely no idea how I would run my life without Slack's \"/remind\" command.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955860517746196480" + ], + "editableUntil": "2018-01-23T18:51:21.117Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "134" + ], + "favorite_count": "44", + "id_str": "955860517746196480", + "truncated": false, + "retweet_count": "2", + "id": "955860517746196480", + "created_at": "Tue Jan 23 17:51:21 +0000 2018", + "favorited": false, + "full_text": "There is a whole bottle of milk spilled all over the floor of this BART car, and a man happily eating a bowl of cereal. J'accuse, sir.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955857849686441984" + ], + "editableUntil": "2018-01-23T18:40:45.002Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ellen K. Pao", + "screen_name": "ekp", + "indices": [ + "3", + "7" + ], + "id_str": "6655612", + "id": "6655612" + } + ], + "urls": [ + { + "url": "https://t.co/cG0s6SNhWr", + "expanded_url": "https://twitter.com/mims/status/955484555041038337", + "display_url": "twitter.com/mims/status/95…", + "indices": [ + "77", + "100" + ] + } + ] + }, + "display_text_range": [ + "0", + "100" + ], + "favorite_count": "0", + "id_str": "955857849686441984", + "truncated": false, + "retweet_count": "0", + "id": "955857849686441984", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 17:40:45 +0000 2018", + "favorited": false, + "full_text": "RT @ekp: Yet another report showing diversity improves financial performance https://t.co/cG0s6SNhWr", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955677057857478657" + ], + "editableUntil": "2018-01-23T06:42:20.871Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Born SQL", + "screen_name": "BornSQL", + "indices": [ + "0", + "8" + ], + "id_str": "4043034494", + "id": "4043034494" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "68" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955675885717393408", + "id_str": "955677057857478657", + "in_reply_to_user_id": "625912772", + "truncated": false, + "retweet_count": "0", + "id": "955677057857478657", + "in_reply_to_status_id": "955675885717393408", + "created_at": "Tue Jan 23 05:42:20 +0000 2018", + "favorited": false, + "full_text": "@BornSQL That's just lazy writing, but then that's Voyager all over.", + "lang": "en", + "in_reply_to_user_id_str": "625912772" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955675708507922432" + ], + "editableUntil": "2018-01-23T06:36:59.161Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Osborn 🏳️🌈", + "screen_name": "john_osborn", + "indices": [ + "0", + "12" + ], + "id_str": "17811991", + "id": "17811991" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "955674705058516999", + "id_str": "955675708507922432", + "in_reply_to_user_id": "17811991", + "truncated": false, + "retweet_count": "0", + "id": "955675708507922432", + "in_reply_to_status_id": "955674705058516999", + "created_at": "Tue Jan 23 05:36:59 +0000 2018", + "favorited": false, + "full_text": "@john_osborn I am 3 years into the show and she is still here. It's not fast enough.", + "lang": "en", + "in_reply_to_screen_name": "john_osborn", + "in_reply_to_user_id_str": "17811991" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955675546406477824" + ], + "editableUntil": "2018-01-23T06:36:20.513Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Born SQL", + "screen_name": "BornSQL", + "indices": [ + "0", + "8" + ], + "id_str": "4043034494", + "id": "4043034494" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955673238985695237", + "id_str": "955675546406477824", + "in_reply_to_user_id": "625912772", + "truncated": false, + "retweet_count": "0", + "id": "955675546406477824", + "in_reply_to_status_id": "955673238985695237", + "created_at": "Tue Jan 23 05:36:20 +0000 2018", + "favorited": false, + "full_text": "@BornSQL Being annoying on purpose doesn't make them less annoying. Also, why do they write annoying characters into their show?", + "lang": "en", + "in_reply_to_user_id_str": "625912772" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955672622485794816" + ], + "editableUntil": "2018-01-23T06:24:43.396Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "25", + "id_str": "955672622485794816", + "truncated": false, + "retweet_count": "0", + "id": "955672622485794816", + "created_at": "Tue Jan 23 05:24:43 +0000 2018", + "favorited": false, + "full_text": "I can't decide which Voyager character I hate more: Kes, Neelix, or Harry Kim? They're all so terrible.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955672108960440322" + ], + "editableUntil": "2018-01-23T06:22:40.962Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "165" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955671693292285952", + "id_str": "955672108960440322", + "in_reply_to_user_id": "823484", + "truncated": false, + "retweet_count": "0", + "id": "955672108960440322", + "in_reply_to_status_id": "955671693292285952", + "created_at": "Tue Jan 23 05:22:40 +0000 2018", + "favorited": false, + "full_text": "@abritinthebay They have got a lot of great engineers and identified a huge market. I don't fault them for going after it. It's not nearly as scammy as the ICO boom.", + "lang": "en", + "in_reply_to_screen_name": "GregWildSmith", + "in_reply_to_user_id_str": "823484" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955671055892271104" + ], + "editableUntil": "2018-01-23T06:18:29.891Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/8Fy1tREgTD", + "expanded_url": "http://www.looptt.com/content/its-official-tt-elects-first-female-president", + "display_url": "looptt.com/content/its-of…", + "indices": [ + "83", + "106" + ] + } + ] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "3", + "id_str": "955671055892271104", + "truncated": false, + "retweet_count": "0", + "id": "955671055892271104", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 05:18:29 +0000 2018", + "favorited": false, + "full_text": "Trinidad has already had a woman as prime minister, now we have a woman president: https://t.co/8Fy1tREgTD (a largely ceremonial position, but still: neat)", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955665491929919490" + ], + "editableUntil": "2018-01-23T05:56:23.339Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/yySbccJonK", + "expanded_url": "https://www.recode.net/2018/1/22/16911692/cryptocurrency-bitcoin-trading-coinbase-revenue-secondary", + "display_url": "recode.net/2018/1/22/1691…", + "indices": [ + "59", + "82" + ] + } + ] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "1", + "id_str": "955665491929919490", + "truncated": false, + "retweet_count": "1", + "id": "955665491929919490", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 04:56:23 +0000 2018", + "favorited": false, + "full_text": "Coinbase did $1 billion -- with a B -- of revenue in 2017: https://t.co/yySbccJonK", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955664077791019010" + ], + "editableUntil": "2018-01-23T05:50:46.182Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Chris DeLauder", + "screen_name": "beaglebets", + "indices": [ + "0", + "11" + ], + "id_str": "2297251502", + "id": "2297251502" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "58" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955663905321246720", + "id_str": "955664077791019010", + "in_reply_to_user_id": "2297251502", + "truncated": false, + "retweet_count": "0", + "id": "955664077791019010", + "in_reply_to_status_id": "955663905321246720", + "created_at": "Tue Jan 23 04:50:46 +0000 2018", + "favorited": false, + "full_text": "@beaglebets Computers are over, man. Time to become a vet.", + "lang": "en", + "in_reply_to_screen_name": "beaglebets", + "in_reply_to_user_id_str": "2297251502" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955662521649655808" + ], + "editableUntil": "2018-01-23T05:44:35.169Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/i3DKQUw1WN", + "expanded_url": "http://www.zdnet.com/article/spectre-and-meltdown-linux-creator-linus-torvalds-criticises-intels-garbage-patches/", + "display_url": "zdnet.com/article/spectr…", + "indices": [ + "88", + "111" + ] + } + ] + }, + "display_text_range": [ + "0", + "111" + ], + "favorite_count": "41", + "in_reply_to_status_id_str": "955662285199962112", + "id_str": "955662521649655808", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "6", + "id": "955662521649655808", + "in_reply_to_status_id": "955662285199962112", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 04:44:35 +0000 2018", + "favorited": false, + "full_text": "Linus remains his calm, adult, helpful self, calling the patches \"garbage\" and \"insane\" https://t.co/i3DKQUw1WN", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955662285199962112" + ], + "editableUntil": "2018-01-23T05:43:38.795Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/nPkuFIZp2Q", + "expanded_url": "https://www.theverge.com/2018/1/22/16919426/intel-advises-pause-deployment-of-spectre-patch", + "display_url": "theverge.com/2018/1/22/1691…", + "indices": [ + "154", + "177" + ] + } + ] + }, + "display_text_range": [ + "0", + "177" + ], + "favorite_count": "19", + "id_str": "955662285199962112", + "truncated": false, + "retweet_count": "11", + "id": "955662285199962112", + "possibly_sensitive": false, + "created_at": "Tue Jan 23 04:43:38 +0000 2018", + "favorited": false, + "full_text": "Today in \"all computers are still broken\" news, the Spectre and Meltdown patches released trash your machine and Intel recommends you don't install them: https://t.co/nPkuFIZp2Q", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955619064482742272" + ], + "editableUntil": "2018-01-23T02:51:54.173Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "sarah✨", + "screen_name": "meyerini", + "indices": [ + "0", + "9" + ], + "id_str": "576601748", + "id": "576601748" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "62" + ], + "favorite_count": "22", + "in_reply_to_status_id_str": "955618955359608832", + "id_str": "955619064482742272", + "in_reply_to_user_id": "576601748", + "truncated": false, + "retweet_count": "0", + "id": "955619064482742272", + "in_reply_to_status_id": "955618955359608832", + "created_at": "Tue Jan 23 01:51:54 +0000 2018", + "favorited": false, + "full_text": "@meyerini If this was true literally nobody would work at npm.", + "lang": "en", + "in_reply_to_screen_name": "meyerini", + "in_reply_to_user_id_str": "576601748" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955609979880333312" + ], + "editableUntil": "2018-01-23T02:15:48.235Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇧🇧🇹🇹🏳️🌈🌉 🚴🏿Ed says Yes on J, No on I", + "screen_name": "eparillon", + "indices": [ + "0", + "10" + ], + "id_str": "5818162", + "id": "5818162" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "54" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955608388682919936", + "id_str": "955609979880333312", + "in_reply_to_user_id": "5818162", + "truncated": false, + "retweet_count": "0", + "id": "955609979880333312", + "in_reply_to_status_id": "955608388682919936", + "created_at": "Tue Jan 23 01:15:48 +0000 2018", + "favorited": false, + "full_text": "@eparillon I don't understand why not, it was awesome.", + "lang": "en", + "in_reply_to_screen_name": "eparillon", + "in_reply_to_user_id_str": "5818162" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955607668562866176" + ], + "editableUntil": "2018-01-23T02:06:37.174Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇧🇧🇹🇹🏳️🌈🌉 🚴🏿Ed says Yes on J, No on I", + "screen_name": "eparillon", + "indices": [ + "0", + "10" + ], + "id_str": "5818162", + "id": "5818162" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "15" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955605912718213120", + "id_str": "955607668562866176", + "in_reply_to_user_id": "5818162", + "truncated": false, + "retweet_count": "0", + "id": "955607668562866176", + "in_reply_to_status_id": "955605912718213120", + "created_at": "Tue Jan 23 01:06:37 +0000 2018", + "favorited": false, + "full_text": "@eparillon Shh.", + "lang": "und", + "in_reply_to_screen_name": "eparillon", + "in_reply_to_user_id_str": "5818162" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955605608740225024" + ], + "editableUntil": "2018-01-23T01:58:26.074Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "92" + ], + "favorite_count": "20", + "id_str": "955605608740225024", + "truncated": false, + "retweet_count": "0", + "id": "955605608740225024", + "created_at": "Tue Jan 23 00:58:26 +0000 2018", + "favorited": false, + "full_text": "OH: \"I'm hoping the three of you will combine into a glorious Captain Planet of competence.\"", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955583901342187520" + ], + "editableUntil": "2018-01-23T00:32:10.627Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "sarah✨", + "screen_name": "meyerini", + "indices": [ + "0", + "9" + ], + "id_str": "576601748", + "id": "576601748" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "26" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "955581609490747393", + "id_str": "955583901342187520", + "in_reply_to_user_id": "576601748", + "truncated": false, + "retweet_count": "0", + "id": "955583901342187520", + "in_reply_to_status_id": "955581609490747393", + "created_at": "Mon Jan 22 23:32:10 +0000 2018", + "favorited": false, + "full_text": "@meyerini Evergreen tweet.", + "lang": "en", + "in_reply_to_screen_name": "meyerini", + "in_reply_to_user_id_str": "576601748" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955549394362757120" + ], + "editableUntil": "2018-01-22T22:15:03.522Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nick Hurley", + "screen_name": "nickhurley", + "indices": [ + "0", + "11" + ], + "id_str": "23445717", + "id": "23445717" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "38" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955518161851383809", + "id_str": "955549394362757120", + "in_reply_to_user_id": "23445717", + "truncated": false, + "retweet_count": "0", + "id": "955549394362757120", + "in_reply_to_status_id": "955518161851383809", + "created_at": "Mon Jan 22 21:15:03 +0000 2018", + "favorited": false, + "full_text": "@nickhurley Of the Devonshire Likelys?", + "lang": "en", + "in_reply_to_screen_name": "nickhurley", + "in_reply_to_user_id_str": "23445717" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955490345113944064" + ], + "editableUntil": "2018-01-22T18:20:25.084Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [ + { + "text": "dangerous", + "indices": [ + "75", + "85" + ] + }, + { + "text": "wild", + "indices": [ + "86", + "91" + ] + }, + { + "text": "rebel", + "indices": [ + "92", + "98" + ] + } + ], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "98" + ], + "favorite_count": "34", + "id_str": "955490345113944064", + "truncated": false, + "retweet_count": "0", + "id": "955490345113944064", + "created_at": "Mon Jan 22 17:20:25 +0000 2018", + "favorited": false, + "full_text": "Today I dressed myself sock-shoe-sock-shoe instead of sock-sock-shoe-shoe. #dangerous #wild #rebel", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955479513852387328" + ], + "editableUntil": "2018-01-22T17:37:22.710Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sarah Lacy", + "screen_name": "sarahcuda", + "indices": [ + "0", + "10" + ], + "id_str": "5668942", + "id": "5668942" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "111" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "955478679160631297", + "id_str": "955479513852387328", + "in_reply_to_user_id": "5668942", + "truncated": false, + "retweet_count": "0", + "id": "955479513852387328", + "in_reply_to_status_id": "955478679160631297", + "created_at": "Mon Jan 22 16:37:22 +0000 2018", + "favorited": false, + "full_text": "@sarahcuda Alternative headline: \"Uber CEO is already signing paperwork to have the flying cars team laid off.\"", + "lang": "en", + "in_reply_to_screen_name": "sarahcuda", + "in_reply_to_user_id_str": "5668942" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955460026956525568" + ], + "editableUntil": "2018-01-22T16:19:56.672Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/b9ieIANMo0", + "expanded_url": "https://washingtonpost.com/powerpost/trump-slams-democrats-as-third-day-of-government-shutdown-begins/2018/01/22/3a3eecf0-ff25-11e7-9d31-d72cf78dbeee_story.html", + "display_url": "washingtonpost.com/powerpost/trum…", + "indices": [ + "234", + "257" + ] + } + ] + }, + "display_text_range": [ + "0", + "257" + ], + "favorite_count": "10", + "id_str": "955460026956525568", + "truncated": false, + "retweet_count": "0", + "id": "955460026956525568", + "possibly_sensitive": false, + "created_at": "Mon Jan 22 15:19:56 +0000 2018", + "favorited": false, + "full_text": "Day 3: Prevented from hurting the economy by slowing immigration, the republicans have decided to hurt the economy by shutting down the government. Some GOP moderates have suggested not hurting the economy but are being shouted down. https://t.co/b9ieIANMo0", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955308214257532928" + ], + "editableUntil": "2018-01-22T06:16:41.704Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Born SQL", + "screen_name": "BornSQL", + "indices": [ + "0", + "8" + ], + "id_str": "4043034494", + "id": "4043034494" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "81" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "955306611618312192", + "id_str": "955308214257532928", + "in_reply_to_user_id": "625912772", + "truncated": false, + "retweet_count": "0", + "id": "955308214257532928", + "in_reply_to_status_id": "955306611618312192", + "created_at": "Mon Jan 22 05:16:41 +0000 2018", + "favorited": false, + "full_text": "@BornSQL \"Orson Card did it\" is not a recommendation of a plot device in my book.", + "lang": "en", + "in_reply_to_user_id_str": "625912772" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955305629911928832" + ], + "editableUntil": "2018-01-22T06:06:25.548Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Born SQL", + "screen_name": "BornSQL", + "indices": [ + "0", + "8" + ], + "id_str": "4043034494", + "id": "4043034494" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "93" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955302693437878272", + "id_str": "955305629911928832", + "in_reply_to_user_id": "625912772", + "truncated": false, + "retweet_count": "0", + "id": "955305629911928832", + "in_reply_to_status_id": "955302693437878272", + "created_at": "Mon Jan 22 05:06:25 +0000 2018", + "favorited": false, + "full_text": "@BornSQL The arc is pretty clear already; I wonder how they make it last past 2 or 3 seasons.", + "lang": "en", + "in_reply_to_user_id_str": "625912772" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955302217820422144" + ], + "editableUntil": "2018-01-22T05:52:52.042Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Born SQL", + "screen_name": "BornSQL", + "indices": [ + "0", + "8" + ], + "id_str": "4043034494", + "id": "4043034494" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "132" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955301806665543681", + "id_str": "955302217820422144", + "in_reply_to_user_id": "625912772", + "truncated": false, + "retweet_count": "0", + "id": "955302217820422144", + "in_reply_to_status_id": "955301806665543681", + "created_at": "Mon Jan 22 04:52:52 +0000 2018", + "favorited": false, + "full_text": "@BornSQL It's been leaning really heavily on its absurd production budget up until now, but the plot is really beginning to pay off.", + "lang": "en", + "in_reply_to_user_id_str": "625912772" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955301431795318784" + ], + "editableUntil": "2018-01-22T05:49:44.639Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "34", + "id_str": "955301431795318784", + "truncated": false, + "retweet_count": "3", + "id": "955301431795318784", + "created_at": "Mon Jan 22 04:49:44 +0000 2018", + "favorited": false, + "full_text": "Star Trek Discovery has jumped in 3 episodes from \"not terrible\" to \"doing interesting new stuff\" to \"wow, okay, I'm on board\".", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955289950966054912" + ], + "editableUntil": "2018-01-22T05:04:07.396Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/7x3LiTdM9X", + "expanded_url": "https://twitter.com/millenpolitics/status/954842240303628288", + "display_url": "twitter.com/millenpolitics…", + "indices": [ + "97", + "120" + ] + } + ] + }, + "display_text_range": [ + "0", + "120" + ], + "favorite_count": "26", + "id_str": "955289950966054912", + "truncated": false, + "retweet_count": "11", + "id": "955289950966054912", + "possibly_sensitive": false, + "created_at": "Mon Jan 22 04:04:07 +0000 2018", + "favorited": false, + "full_text": "Maybe the republicans only think government is useless because they're so very bad at governing? https://t.co/7x3LiTdM9X", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955287434836627457" + ], + "editableUntil": "2018-01-22T04:54:07.504Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JP", + "screen_name": "jpbrammer", + "indices": [ + "0", + "10" + ], + "id_str": "74087670", + "id": "74087670" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955286899337433090", + "id_str": "955287434836627457", + "in_reply_to_user_id": "74087670", + "truncated": false, + "retweet_count": "0", + "id": "955287434836627457", + "in_reply_to_status_id": "955286899337433090", + "created_at": "Mon Jan 22 03:54:07 +0000 2018", + "favorited": false, + "full_text": "@jpbrammer Is it possible to be more wrong?", + "lang": "en", + "in_reply_to_screen_name": "jpbrammer", + "in_reply_to_user_id_str": "74087670" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955282881357668352" + ], + "editableUntil": "2018-01-22T04:36:01.870Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "21", + "id_str": "955282881357668352", + "truncated": false, + "retweet_count": "3", + "id": "955282881357668352", + "created_at": "Mon Jan 22 03:36:01 +0000 2018", + "favorited": false, + "full_text": "Petition for a government shutdown that affects only the White House and Congress.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955278839470465025" + ], + "editableUntil": "2018-01-22T04:19:58.209Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jennifer Davis", + "screen_name": "sigje", + "indices": [ + "0", + "6" + ], + "id_str": "17527655", + "id": "17527655" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "955278460414341121", + "id_str": "955278839470465025", + "in_reply_to_user_id": "17527655", + "truncated": false, + "retweet_count": "1", + "id": "955278839470465025", + "in_reply_to_status_id": "955278460414341121", + "created_at": "Mon Jan 22 03:19:58 +0000 2018", + "favorited": false, + "full_text": "@sigje Honestly, anybody calling me on the phone is likely a scam.", + "lang": "en", + "in_reply_to_screen_name": "sigje", + "in_reply_to_user_id_str": "17527655" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955274631060979712" + ], + "editableUntil": "2018-01-22T04:03:14.846Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/sTGeph8YUe", + "expanded_url": "http://clark.com/technology/why-you-may-be-receiving-calls-someone-named-scam-likely/", + "display_url": "clark.com/technology/why…", + "indices": [ + "160", + "183" + ] + } + ] + }, + "display_text_range": [ + "0", + "183" + ], + "favorite_count": "39", + "id_str": "955274631060979712", + "truncated": false, + "retweet_count": "5", + "id": "955274631060979712", + "possibly_sensitive": false, + "created_at": "Mon Jan 22 03:03:14 +0000 2018", + "favorited": false, + "full_text": "I thought \"Scam Likely\" was an iOS feature but it turns out it's T-mobile! And you can set it so it just automatically blocks scams and your phone never rings: https://t.co/sTGeph8YUe", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955252719362621440" + ], + "editableUntil": "2018-01-22T02:36:10.690Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Will Johansson", + "screen_name": "willjohansson", + "indices": [ + "0", + "14" + ], + "id_str": "52934331", + "id": "52934331" + }, + { + "name": "Tyler", + "screen_name": "tbreisacher", + "indices": [ + "15", + "27" + ], + "id_str": "72212594", + "id": "72212594" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "53" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955252456484519937", + "id_str": "955252719362621440", + "in_reply_to_user_id": "52934331", + "truncated": false, + "retweet_count": "0", + "id": "955252719362621440", + "in_reply_to_status_id": "955252456484519937", + "created_at": "Mon Jan 22 01:36:10 +0000 2018", + "favorited": false, + "full_text": "@willjohansson @tbreisacher Galaxy brain: don't drive", + "lang": "en", + "in_reply_to_screen_name": "willjohansson", + "in_reply_to_user_id_str": "52934331" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955249425164599296" + ], + "editableUntil": "2018-01-22T02:23:05.292Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Here Comes The Sun", + "screen_name": "SunOfSeldo", + "indices": [ + "3", + "14" + ], + "id_str": "456374925", + "id": "456374925" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "955249425164599296", + "truncated": false, + "retweet_count": "0", + "id": "955249425164599296", + "created_at": "Mon Jan 22 01:23:05 +0000 2018", + "favorited": false, + "full_text": "RT @SunOfSeldo: Woo! Today was 10 hours long! The last 10 hour day wasn’t since November 19th. Sunset moved back by a minute to 5.21pm, too.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955209720674988033" + ], + "editableUntil": "2018-01-21T23:45:19.004Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Curt 🏳️🌈", + "screen_name": "curtytate", + "indices": [ + "0", + "10" + ], + "id_str": "837971126567383041", + "id": "837971126567383041" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "28" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955209651456327680", + "id_str": "955209720674988033", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "955209720674988033", + "in_reply_to_status_id": "955209651456327680", + "created_at": "Sun Jan 21 22:45:19 +0000 2018", + "favorited": false, + "full_text": "@curtytate (Not counting CI)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955209651456327680" + ], + "editableUntil": "2018-01-21T23:45:02.501Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Curt 🏳️🌈", + "screen_name": "curtytate", + "indices": [ + "0", + "10" + ], + "id_str": "837971126567383041", + "id": "837971126567383041" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "96" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "955207331276468225", + "id_str": "955209651456327680", + "in_reply_to_user_id": "837971126567383041", + "truncated": false, + "retweet_count": "0", + "id": "955209651456327680", + "in_reply_to_status_id": "955207331276468225", + "created_at": "Sun Jan 21 22:45:02 +0000 2018", + "favorited": false, + "full_text": "@curtytate About 500 every time a new package is published or updated. 50-100 per day otherwise.", + "lang": "en", + "in_reply_to_screen_name": "curtytate", + "in_reply_to_user_id_str": "837971126567383041" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955142269572595712" + ], + "editableUntil": "2018-01-21T19:17:17.408Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇧🇧🇹🇹🏳️🌈🌉 🚴🏿Ed says Yes on J, No on I", + "screen_name": "eparillon", + "indices": [ + "0", + "10" + ], + "id_str": "5818162", + "id": "5818162" + } + ], + "urls": [ + { + "url": "https://t.co/DVNFYUMt3z", + "expanded_url": "https://twitter.com/bodegabot/status/955110554988892160", + "display_url": "twitter.com/bodegabot/stat…", + "indices": [ + "11", + "34" + ] + } + ] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "955141598370709504", + "id_str": "955142269572595712", + "in_reply_to_user_id": "5818162", + "truncated": false, + "retweet_count": "0", + "id": "955142269572595712", + "in_reply_to_status_id": "955141598370709504", + "possibly_sensitive": false, + "created_at": "Sun Jan 21 18:17:17 +0000 2018", + "favorited": false, + "full_text": "@eparillon https://t.co/DVNFYUMt3z", + "lang": "qme", + "in_reply_to_screen_name": "eparillon", + "in_reply_to_user_id_str": "5818162" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955138564869648384" + ], + "editableUntil": "2018-01-21T19:02:34.138Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/jv7PbAfKIs", + "expanded_url": "https://www.recode.net/2018/1/21/16914188/amazon-go-grocery-convenience-store-opening-seattle-dilip-kumar", + "display_url": "recode.net/2018/1/21/1691…", + "indices": [ + "82", + "105" + ] + } + ] + }, + "display_text_range": [ + "0", + "105" + ], + "favorite_count": "6", + "id_str": "955138564869648384", + "truncated": false, + "retweet_count": "1", + "id": "955138564869648384", + "possibly_sensitive": false, + "created_at": "Sun Jan 21 18:02:34 +0000 2018", + "favorited": false, + "full_text": "This Princeton university graduate thinks he can use tech to reinvent the bodega: https://t.co/jv7PbAfKIs", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955137181382672384" + ], + "editableUntil": "2018-01-21T18:57:04.289Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tef's locked account", + "screen_name": "tef", + "indices": [ + "0", + "4" + ], + "id_str": "16681276", + "id": "16681276" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "24" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955136567743537152", + "id_str": "955137181382672384", + "in_reply_to_user_id": "16681276", + "truncated": false, + "retweet_count": "0", + "id": "955137181382672384", + "in_reply_to_status_id": "955136567743537152", + "created_at": "Sun Jan 21 17:57:04 +0000 2018", + "favorited": false, + "full_text": "@tef yaml considered bad", + "lang": "en", + "in_reply_to_screen_name": "tef", + "in_reply_to_user_id_str": "16681276" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955128197166673920" + ], + "editableUntil": "2018-01-21T18:21:22.285Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jessica Tollkuhn", + "screen_name": "tollkuhn", + "indices": [ + "0", + "9" + ], + "id_str": "194456924", + "id": "194456924" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "955127436773134337", + "id_str": "955128197166673920", + "in_reply_to_user_id": "194456924", + "truncated": false, + "retweet_count": "0", + "id": "955128197166673920", + "in_reply_to_status_id": "955127436773134337", + "created_at": "Sun Jan 21 17:21:22 +0000 2018", + "favorited": false, + "full_text": "@tollkuhn ☹️ Sorry to make light of your situation.", + "lang": "en", + "in_reply_to_screen_name": "tollkuhn", + "in_reply_to_user_id_str": "194456924" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955128023367364608" + ], + "editableUntil": "2018-01-21T18:20:40.848Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "24", + "in_reply_to_status_id_str": "955124795158376448", + "id_str": "955128023367364608", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "955128023367364608", + "in_reply_to_status_id": "955124795158376448", + "created_at": "Sun Jan 21 17:20:40 +0000 2018", + "favorited": false, + "full_text": "Oh never mind, I found out that congress still gets paid to work during the shutdown. That's the only part I want shut down.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955125182426787840" + ], + "editableUntil": "2018-01-21T18:09:23.515Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "eevee 💨", + "screen_name": "eevee", + "indices": [ + "3", + "9" + ], + "id_str": "14412937", + "id": "14412937" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "955125182426787840", + "truncated": false, + "retweet_count": "0", + "id": "955125182426787840", + "created_at": "Sun Jan 21 17:09:23 +0000 2018", + "favorited": false, + "full_text": "RT @eevee: ah, it's almost tax season, that time of the year where you have to copy numbers from forms the IRS already has onto forms the I…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955124795158376448" + ], + "editableUntil": "2018-01-21T18:07:51.183Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "38", + "id_str": "955124795158376448", + "truncated": false, + "retweet_count": "4", + "id": "955124795158376448", + "created_at": "Sun Jan 21 17:07:51 +0000 2018", + "favorited": false, + "full_text": "Am I alone in thinking that maybe shut down is the safest thing for the government to be right now? When they're not shut down they're making things worse.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955118330561536001" + ], + "editableUntil": "2018-01-21T17:42:09.903Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@mcc@mastodon.social", + "screen_name": "mcclure111", + "indices": [ + "0", + "11" + ], + "id_str": "312426579", + "id": "312426579" + } + ], + "urls": [ + { + "url": "https://t.co/SAnVCm5YZp", + "expanded_url": "https://twitter.com/seldo/status/844062907751047169", + "display_url": "twitter.com/seldo/status/8…", + "indices": [ + "12", + "35" + ] + } + ] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "955115878974218240", + "id_str": "955118330561536001", + "in_reply_to_user_id": "312426579", + "truncated": false, + "retweet_count": "0", + "id": "955118330561536001", + "in_reply_to_status_id": "955115878974218240", + "possibly_sensitive": false, + "created_at": "Sun Jan 21 16:42:09 +0000 2018", + "favorited": false, + "full_text": "@mcclure111 https://t.co/SAnVCm5YZp", + "lang": "qme", + "in_reply_to_screen_name": "mcclure111", + "in_reply_to_user_id_str": "312426579" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955117597380374529" + ], + "editableUntil": "2018-01-21T17:39:15.099Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "nicole", + "screen_name": "sodevious", + "indices": [ + "0", + "10" + ], + "id_str": "9555772", + "id": "9555772" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "165" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955116489333444614", + "id_str": "955117597380374529", + "in_reply_to_user_id": "9555772", + "truncated": false, + "retweet_count": "0", + "id": "955117597380374529", + "in_reply_to_status_id": "955116489333444614", + "created_at": "Sun Jan 21 16:39:15 +0000 2018", + "favorited": false, + "full_text": "@sodevious FYI: I learned recently that many vendors have a way of automatically billing your new credit card even if the old one expires or is reported lost/stolen.", + "lang": "en", + "in_reply_to_screen_name": "sodevious", + "in_reply_to_user_id_str": "9555772" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955117326067580928" + ], + "editableUntil": "2018-01-21T17:38:10.413Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "955116723971215361", + "id_str": "955117326067580928", + "in_reply_to_user_id": "3170785565", + "truncated": false, + "retweet_count": "0", + "id": "955117326067580928", + "in_reply_to_status_id": "955116723971215361", + "created_at": "Sun Jan 21 16:38:10 +0000 2018", + "favorited": false, + "full_text": "@SebFreitag Dax was great, but it's like the only way they could think of to write a good female character was to tell themselves she was actually male.", + "lang": "en", + "in_reply_to_user_id_str": "3170785565" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "955116293375406080" + ], + "editableUntil": "2018-01-21T17:34:04.200Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/ZoPWwqrsT9", + "expanded_url": "https://twitter.com/jessesingal/status/955088992130695169", + "display_url": "twitter.com/jessesingal/st…", + "indices": [ + "13", + "36" + ] + } + ] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "36", + "id_str": "955116293375406080", + "truncated": false, + "retweet_count": "13", + "id": "955116293375406080", + "possibly_sensitive": false, + "created_at": "Sun Jan 21 16:34:04 +0000 2018", + "favorited": false, + "full_text": "ICE is evil. https://t.co/ZoPWwqrsT9", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954908471916285953" + ], + "editableUntil": "2018-01-21T03:48:15.703Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "stacy-marie ishmael", + "screen_name": "s_m_i", + "indices": [ + "0", + "6" + ], + "id_str": "14173930", + "id": "14173930" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "108" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954908264847654912", + "id_str": "954908471916285953", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954908471916285953", + "in_reply_to_status_id": "954908264847654912", + "created_at": "Sun Jan 21 02:48:15 +0000 2018", + "favorited": false, + "full_text": "@s_m_i The next time somebody expresses a conservative belief I'm going to accuse them of \"evil signalling\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954908264847654912" + ], + "editableUntil": "2018-01-21T03:47:26.334Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "stacy-marie ishmael", + "screen_name": "s_m_i", + "indices": [ + "0", + "6" + ], + "id_str": "14173930", + "id": "14173930" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "193" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "954900417833443329", + "id_str": "954908264847654912", + "in_reply_to_user_id": "14173930", + "truncated": false, + "retweet_count": "0", + "id": "954908264847654912", + "in_reply_to_status_id": "954900417833443329", + "created_at": "Sun Jan 21 02:47:26 +0000 2018", + "favorited": false, + "full_text": "@s_m_i Much like using \"social justice warrior\" as a pejorative: yes, I fight for social justice. What part of this is insulting? Yes, I like to indicate that I believe in things that are good.", + "lang": "en", + "in_reply_to_screen_name": "s_m_i", + "in_reply_to_user_id_str": "14173930" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954903014761840640" + ], + "editableUntil": "2018-01-21T03:26:34.616Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Courtney Enlow", + "screen_name": "courtenlow", + "indices": [ + "3", + "14" + ], + "id_str": "15138822", + "id": "15138822" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "90" + ], + "favorite_count": "0", + "id_str": "954903014761840640", + "truncated": false, + "retweet_count": "0", + "id": "954903014761840640", + "created_at": "Sun Jan 21 02:26:34 +0000 2018", + "favorited": false, + "full_text": "RT @courtenlow: I scream.\nYou scream.\nWe all scream.\nThis is a support group for banshees.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954900064710750208" + ], + "editableUntil": "2018-01-21T03:14:51.269Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mel", + "screen_name": "_melanie", + "indices": [ + "0", + "9" + ], + "id_str": "14695621", + "id": "14695621" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "39" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "954892156103155712", + "id_str": "954900064710750208", + "in_reply_to_user_id": "14695621", + "truncated": false, + "retweet_count": "0", + "id": "954900064710750208", + "in_reply_to_status_id": "954892156103155712", + "created_at": "Sun Jan 21 02:14:51 +0000 2018", + "favorited": false, + "full_text": "@_melanie Or some kind of plasma storm.", + "lang": "en", + "in_reply_to_screen_name": "_melanie", + "in_reply_to_user_id_str": "14695621" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954885174457647105" + ], + "editableUntil": "2018-01-21T02:15:41.156Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "35", + "in_reply_to_status_id_str": "954884410406461440", + "id_str": "954885174457647105", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954885174457647105", + "in_reply_to_status_id": "954884410406461440", + "created_at": "Sun Jan 21 01:15:41 +0000 2018", + "favorited": false, + "full_text": "e.g. \"If we depolarize the protease inhibitor we might be able to cure the plague!\"\n\"Like dissolving a tooth in a can of soda!\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954884410406461440" + ], + "editableUntil": "2018-01-21T02:12:38.992Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "253" + ], + "favorite_count": "59", + "id_str": "954884410406461440", + "truncated": false, + "retweet_count": "5", + "id": "954884410406461440", + "created_at": "Sun Jan 21 01:12:38 +0000 2018", + "favorited": false, + "full_text": "Every episode of Voyager:\n\"If we can <random college physics verb> the <unrelated college chemistry noun> we might be able to <achieve goal>.\"\n\"Like <elementary school science project>!\"\n\"It's crazy but it just... might... work.\"", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954880636631728130" + ], + "editableUntil": "2018-01-21T01:57:39.254Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tommy Collison", + "screen_name": "tommycollison", + "indices": [ + "0", + "14" + ], + "id_str": "13220072", + "id": "13220072" + }, + { + "name": ".", + "screen_name": "freialobo", + "indices": [ + "15", + "25" + ], + "id_str": "278450525", + "id": "278450525" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "28" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954879683748798464", + "id_str": "954880636631728130", + "in_reply_to_user_id": "13220072", + "truncated": false, + "retweet_count": "0", + "id": "954880636631728130", + "in_reply_to_status_id": "954879683748798464", + "created_at": "Sun Jan 21 00:57:39 +0000 2018", + "favorited": false, + "full_text": "@tommycollison @freialobo 👌🏻", + "lang": "qme", + "in_reply_to_screen_name": "tommycollison", + "in_reply_to_user_id_str": "13220072" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954867186278965248" + ], + "editableUntil": "2018-01-21T01:04:12.440Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ava Ex Machina", + "screen_name": "silicondomme", + "indices": [ + "0", + "13" + ], + "id_str": "726197352264949760", + "id": "726197352264949760" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "215" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954764364703195136", + "id_str": "954867186278965248", + "in_reply_to_user_id": "726197352264949760", + "truncated": false, + "retweet_count": "0", + "id": "954867186278965248", + "in_reply_to_status_id": "954764364703195136", + "created_at": "Sun Jan 21 00:04:12 +0000 2018", + "favorited": false, + "full_text": "@silicondomme I second this and submit and amendment that whenever we see tourists walking through the Mission district we instruct them to avoid Mission between 16th and 17th and tell them where Taqueria Cancun is.", + "lang": "en", + "in_reply_to_screen_name": "silicondomme", + "in_reply_to_user_id_str": "726197352264949760" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954866913418428416" + ], + "editableUntil": "2018-01-21T01:03:07.385Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ava Ex Machina", + "screen_name": "silicondomme", + "indices": [ + "3", + "16" + ], + "id_str": "726197352264949760", + "id": "726197352264949760" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "954866913418428416", + "truncated": false, + "retweet_count": "0", + "id": "954866913418428416", + "created_at": "Sun Jan 21 00:03:07 +0000 2018", + "favorited": false, + "full_text": "RT @silicondomme: I feel there should be a SF citywide pact when anytime you see a fellow Millennial out with anxious visiting parents that…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954861912377798656" + ], + "editableUntil": "2018-01-21T00:43:15.044Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954861912377798656/photo/1", + "indices": [ + "18", + "41" + ], + "url": "https://t.co/lNv5clCGfY", + "media_url": "http://pbs.twimg.com/media/DUBZ0QBX4AAvq0s.jpg", + "id_str": "954861875191341056", + "id": "954861875191341056", + "media_url_https": "https://pbs.twimg.com/media/DUBZ0QBX4AAvq0s.jpg", + "sizes": { + "medium": { + "w": "1024", + "h": "768", + "resize": "fit" + }, + "large": { + "w": "1024", + "h": "768", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "510", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/lNv5clCGfY" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "22", + "id_str": "954861912377798656", + "truncated": false, + "retweet_count": "1", + "id": "954861912377798656", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 23:43:15 +0000 2018", + "favorited": false, + "full_text": "California today. https://t.co/lNv5clCGfY", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954861912377798656/photo/1", + "indices": [ + "18", + "41" + ], + "url": "https://t.co/lNv5clCGfY", + "media_url": "http://pbs.twimg.com/media/DUBZ0QBX4AAvq0s.jpg", + "id_str": "954861875191341056", + "id": "954861875191341056", + "media_url_https": "https://pbs.twimg.com/media/DUBZ0QBX4AAvq0s.jpg", + "sizes": { + "medium": { + "w": "1024", + "h": "768", + "resize": "fit" + }, + "large": { + "w": "1024", + "h": "768", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "510", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/lNv5clCGfY" + }, + { + "expanded_url": "https://twitter.com/seldo/status/954861912377798656/photo/1", + "indices": [ + "18", + "41" + ], + "url": "https://t.co/lNv5clCGfY", + "media_url": "http://pbs.twimg.com/media/DUBZ0QMVMAA-0os.jpg", + "id_str": "954861875237302272", + "id": "954861875237302272", + "media_url_https": "https://pbs.twimg.com/media/DUBZ0QMVMAA-0os.jpg", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "768", + "h": "1024", + "resize": "fit" + }, + "medium": { + "w": "768", + "h": "1024", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/lNv5clCGfY" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954858289430343680" + ], + "editableUntil": "2018-01-21T00:28:51.266Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Christmas (in November) Kennedy", + "screen_name": "onebrightlight", + "indices": [ + "0", + "15" + ], + "id_str": "755485", + "id": "755485" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "60" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954839143560880128", + "id_str": "954858289430343680", + "in_reply_to_user_id": "755485", + "truncated": false, + "retweet_count": "0", + "id": "954858289430343680", + "in_reply_to_status_id": "954839143560880128", + "created_at": "Sat Jan 20 23:28:51 +0000 2018", + "favorited": false, + "full_text": "@onebrightlight Disagree, but it's a very long conversation.", + "lang": "en", + "in_reply_to_screen_name": "onebrightlight", + "in_reply_to_user_id_str": "755485" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954855049284370433" + ], + "editableUntil": "2018-01-21T00:15:58.755Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇧🇧🇹🇹🏳️🌈🌉 🚴🏿Ed says Yes on J, No on I", + "screen_name": "eparillon", + "indices": [ + "0", + "10" + ], + "id_str": "5818162", + "id": "5818162" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "47" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "954854745151234048", + "id_str": "954855049284370433", + "in_reply_to_user_id": "5818162", + "truncated": false, + "retweet_count": "0", + "id": "954855049284370433", + "in_reply_to_status_id": "954854745151234048", + "created_at": "Sat Jan 20 23:15:58 +0000 2018", + "favorited": false, + "full_text": "@eparillon Still tho. This shit is inescapable.", + "lang": "en", + "in_reply_to_screen_name": "eparillon", + "in_reply_to_user_id_str": "5818162" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954854355202535426" + ], + "editableUntil": "2018-01-21T00:13:13.273Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "101" + ], + "favorite_count": "280", + "id_str": "954854355202535426", + "truncated": false, + "retweet_count": "17", + "id": "954854355202535426", + "created_at": "Sat Jan 20 23:13:13 +0000 2018", + "favorited": false, + "full_text": "I went to a birthday party for a 3 year old this morning and the conversation was still about crypto.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954824172579913728" + ], + "editableUntil": "2018-01-20T22:13:17.175Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/tm4zRUCtxX", + "expanded_url": "https://twitter.com/ValaAfshar/status/954790675136045056", + "display_url": "twitter.com/ValaAfshar/sta…", + "indices": [ + "105", + "128" + ] + } + ] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "40", + "id_str": "954824172579913728", + "truncated": false, + "retweet_count": "5", + "id": "954824172579913728", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 21:13:17 +0000 2018", + "favorited": false, + "full_text": "(Also npm which is obviously as big and important a technology company as all of these, yes, definitely) https://t.co/tm4zRUCtxX", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954823767275941888" + ], + "editableUntil": "2018-01-20T22:11:40.543Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "Barbara Malmet", + "screen_name": "B52Malmet", + "indices": [ + "3", + "13" + ], + "id_str": "2876041031", + "id": "2876041031" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/B52Malmet/status/954753187130609666/photo/1", + "source_status_id": "954753187130609666", + "indices": [ + "68", + "91" + ], + "url": "https://t.co/dtI09ksxNg", + "media_url": "http://pbs.twimg.com/media/DT_280fX0AAPMH6.jpg", + "id_str": "954753170768646144", + "source_user_id": "2876041031", + "id": "954753170768646144", + "media_url_https": "https://pbs.twimg.com/media/DT_280fX0AAPMH6.jpg", + "source_user_id_str": "2876041031", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "954753187130609666", + "display_url": "pic.twitter.com/dtI09ksxNg" + } + ], + "hashtags": [ + { + "text": "WomensMarch2018", + "indices": [ + "51", + "67" + ] + } + ] + }, + "display_text_range": [ + "0", + "91" + ], + "favorite_count": "0", + "id_str": "954823767275941888", + "truncated": false, + "retweet_count": "0", + "id": "954823767275941888", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 21:11:40 +0000 2018", + "favorited": false, + "full_text": "RT @B52Malmet: 7 year old with next level signage. #WomensMarch2018 https://t.co/dtI09ksxNg", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/B52Malmet/status/954753187130609666/photo/1", + "source_status_id": "954753187130609666", + "indices": [ + "68", + "91" + ], + "url": "https://t.co/dtI09ksxNg", + "media_url": "http://pbs.twimg.com/media/DT_280fX0AAPMH6.jpg", + "id_str": "954753170768646144", + "source_user_id": "2876041031", + "id": "954753170768646144", + "media_url_https": "https://pbs.twimg.com/media/DT_280fX0AAPMH6.jpg", + "source_user_id_str": "2876041031", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "954753187130609666", + "display_url": "pic.twitter.com/dtI09ksxNg" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954821698716549120" + ], + "editableUntil": "2018-01-20T22:03:27.360Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Yoel Roth", + "screen_name": "yoyoel", + "indices": [ + "0", + "7" + ], + "id_str": "14893345", + "id": "14893345" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "42" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "954820793824821248", + "id_str": "954821698716549120", + "in_reply_to_user_id": "14893345", + "truncated": false, + "retweet_count": "0", + "id": "954821698716549120", + "in_reply_to_status_id": "954820793824821248", + "created_at": "Sat Jan 20 21:03:27 +0000 2018", + "favorited": false, + "full_text": "@yoyoel Today in unsurprising revelations.", + "lang": "en", + "in_reply_to_screen_name": "yoyoel", + "in_reply_to_user_id_str": "14893345" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954817226070155264" + ], + "editableUntil": "2018-01-20T21:45:40.998Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Susan Rigetti", + "screen_name": "susanthesquark", + "indices": [ + "0", + "15" + ], + "id_str": "4625037762", + "id": "4625037762" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "19" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "954789806378139648", + "id_str": "954817226070155264", + "in_reply_to_user_id": "4625037762", + "truncated": false, + "retweet_count": "0", + "id": "954817226070155264", + "in_reply_to_status_id": "954789806378139648", + "created_at": "Sat Jan 20 20:45:40 +0000 2018", + "favorited": false, + "full_text": "@susanthesquark 🎉🎉🎉", + "lang": "qme", + "in_reply_to_screen_name": "susanthesquark", + "in_reply_to_user_id_str": "4625037762" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954817069278613504" + ], + "editableUntil": "2018-01-20T21:45:03.616Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jen Dziura", + "screen_name": "jendziura", + "indices": [ + "0", + "10" + ], + "id_str": "18006802", + "id": "18006802" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "18" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954806596844052480", + "id_str": "954817069278613504", + "in_reply_to_user_id": "18006802", + "truncated": false, + "retweet_count": "0", + "id": "954817069278613504", + "in_reply_to_status_id": "954806596844052480", + "created_at": "Sat Jan 20 20:45:03 +0000 2018", + "favorited": false, + "full_text": "@jendziura Agreed.", + "lang": "en", + "in_reply_to_screen_name": "jendziura", + "in_reply_to_user_id_str": "18006802" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954803050576662528" + ], + "editableUntil": "2018-01-20T20:49:21.297Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jen Dziura", + "screen_name": "jendziura", + "indices": [ + "0", + "10" + ], + "id_str": "18006802", + "id": "18006802" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "31" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954800435487035394", + "id_str": "954803050576662528", + "in_reply_to_user_id": "18006802", + "truncated": false, + "retweet_count": "0", + "id": "954803050576662528", + "in_reply_to_status_id": "954800435487035394", + "created_at": "Sat Jan 20 19:49:21 +0000 2018", + "favorited": false, + "full_text": "@jendziura Kes is terrible tho.", + "lang": "en", + "in_reply_to_screen_name": "jendziura", + "in_reply_to_user_id_str": "18006802" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954786515145523200" + ], + "editableUntil": "2018-01-20T19:43:38.943Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "159" + ], + "favorite_count": "50", + "id_str": "954786515145523200", + "truncated": false, + "retweet_count": "1", + "id": "954786515145523200", + "created_at": "Sat Jan 20 18:43:38 +0000 2018", + "favorited": false, + "full_text": "You'd think 23 years post-puberty I would be over the disgust and inconvenience of hair constantly sprouting out of my face but that is very much not the case.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954769351764160512" + ], + "editableUntil": "2018-01-20T18:35:26.874Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jasper 🌈", + "screen_name": "DaleJStephens", + "indices": [ + "0", + "14" + ], + "id_str": "84245958", + "id": "84245958" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954767863444733953", + "id_str": "954769351764160512", + "in_reply_to_user_id": "84245958", + "truncated": false, + "retweet_count": "0", + "id": "954769351764160512", + "in_reply_to_status_id": "954767863444733953", + "created_at": "Sat Jan 20 17:35:26 +0000 2018", + "favorited": false, + "full_text": "@DaleJStephens My whole life is spreadsheets and stats.", + "lang": "en", + "in_reply_to_screen_name": "DaleJStephens", + "in_reply_to_user_id_str": "84245958" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954767625904467968" + ], + "editableUntil": "2018-01-20T18:28:35.397Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jasper 🌈", + "screen_name": "DaleJStephens", + "indices": [ + "0", + "14" + ], + "id_str": "84245958", + "id": "84245958" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954767224773926912", + "id_str": "954767625904467968", + "in_reply_to_user_id": "84245958", + "truncated": false, + "retweet_count": "0", + "id": "954767625904467968", + "in_reply_to_status_id": "954767224773926912", + "created_at": "Sat Jan 20 17:28:35 +0000 2018", + "favorited": false, + "full_text": "@DaleJStephens This is so strange. I use algebra every day.", + "lang": "en", + "in_reply_to_screen_name": "DaleJStephens", + "in_reply_to_user_id_str": "84245958" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954621647654330368" + ], + "editableUntil": "2018-01-20T08:48:31.470Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jamar Parris", + "screen_name": "JamarParris", + "indices": [ + "0", + "12" + ], + "id_str": "171878775", + "id": "171878775" + }, + { + "name": "Jovan from Peak Shift", + "screen_name": "johnsBeharry", + "indices": [ + "13", + "26" + ], + "id_str": "15802846", + "id": "15802846" + } + ], + "urls": [ + { + "url": "https://t.co/bTsFEnIwTq", + "expanded_url": "https://twitter.com/seldo/status/954617366779912192", + "display_url": "twitter.com/seldo/status/9…", + "indices": [ + "64", + "87" + ] + } + ] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954620449173815296", + "id_str": "954621647654330368", + "in_reply_to_user_id": "171878775", + "truncated": false, + "retweet_count": "0", + "id": "954621647654330368", + "in_reply_to_status_id": "954620449173815296", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 07:48:31 +0000 2018", + "favorited": false, + "full_text": "@JamarParris @johnsbeharry Exactly what I was saying elsewhere: https://t.co/bTsFEnIwTq", + "lang": "en", + "in_reply_to_screen_name": "JamarParris", + "in_reply_to_user_id_str": "171878775" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954617798528872448" + ], + "editableUntil": "2018-01-20T08:33:13.767Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "25" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954613435517485056", + "id_str": "954617798528872448", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "954617798528872448", + "in_reply_to_status_id": "954613435517485056", + "created_at": "Sat Jan 20 07:33:13 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu Good callback.", + "lang": "en", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954617366779912192" + ], + "editableUntil": "2018-01-20T08:31:30.830Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jovan from Peak Shift", + "screen_name": "johnsBeharry", + "indices": [ + "0", + "13" + ], + "id_str": "15802846", + "id": "15802846" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954609088717049857", + "id_str": "954617366779912192", + "in_reply_to_user_id": "15802846", + "truncated": false, + "retweet_count": "0", + "id": "954617366779912192", + "in_reply_to_status_id": "954609088717049857", + "created_at": "Sat Jan 20 07:31:30 +0000 2018", + "favorited": false, + "full_text": "@johnsbeharry Being exploited is better than starving. I wish we had better options. The federation, R.I.P., might have helped.", + "lang": "en", + "in_reply_to_screen_name": "johnsBeharry", + "in_reply_to_user_id_str": "15802846" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954616998155055104" + ], + "editableUntil": "2018-01-20T08:30:02.943Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jamar Parris", + "screen_name": "JamarParris", + "indices": [ + "0", + "12" + ], + "id_str": "171878775", + "id": "171878775" + }, + { + "name": "Jovan from Peak Shift", + "screen_name": "johnsBeharry", + "indices": [ + "13", + "26" + ], + "id_str": "15802846", + "id": "15802846" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "167" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954608025309868033", + "id_str": "954616998155055104", + "in_reply_to_user_id": "171878775", + "truncated": false, + "retweet_count": "0", + "id": "954616998155055104", + "in_reply_to_status_id": "954608025309868033", + "created_at": "Sat Jan 20 07:30:02 +0000 2018", + "favorited": false, + "full_text": "@JamarParris @johnsbeharry That's a fair point, but even in their current state they are barely sustainable. After hurricanes they cannot recover without external aid.", + "lang": "en", + "in_reply_to_screen_name": "JamarParris", + "in_reply_to_user_id_str": "171878775" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954603574570377217" + ], + "editableUntil": "2018-01-20T07:36:42.511Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jovan from Peak Shift", + "screen_name": "johnsBeharry", + "indices": [ + "0", + "13" + ], + "id_str": "15802846", + "id": "15802846" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "121" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954603274505629696", + "id_str": "954603574570377217", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954603574570377217", + "in_reply_to_status_id": "954603274505629696", + "created_at": "Sat Jan 20 06:36:42 +0000 2018", + "favorited": false, + "full_text": "@johnsbeharry Trinidad only works because of the oil. Jamaica doesn't work. All the smaller islands scrape by on tourism.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954603274505629696" + ], + "editableUntil": "2018-01-20T07:35:30.970Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jovan from Peak Shift", + "screen_name": "johnsBeharry", + "indices": [ + "0", + "13" + ], + "id_str": "15802846", + "id": "15802846" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954602833235599360", + "id_str": "954603274505629696", + "in_reply_to_user_id": "15802846", + "truncated": false, + "retweet_count": "0", + "id": "954603274505629696", + "in_reply_to_status_id": "954602833235599360", + "created_at": "Sat Jan 20 06:35:30 +0000 2018", + "favorited": false, + "full_text": "@johnsbeharry No offense intended, but the small islands are economically pretty fucked no matter what they try. Not enough space, not enough resources.", + "lang": "en", + "in_reply_to_screen_name": "johnsBeharry", + "in_reply_to_user_id_str": "15802846" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954602301498388480" + ], + "editableUntil": "2018-01-20T07:31:38.987Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "KING KORTNEY😷", + "screen_name": "fakerapper", + "indices": [ + "0", + "11" + ], + "id_str": "14256353", + "id": "14256353" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954427669537370112", + "id_str": "954602301498388480", + "in_reply_to_user_id": "14256353", + "truncated": false, + "retweet_count": "0", + "id": "954602301498388480", + "in_reply_to_status_id": "954427669537370112", + "created_at": "Sat Jan 20 06:31:38 +0000 2018", + "favorited": false, + "full_text": "@fakerapper How did I not know you have an adorable dog until now?", + "lang": "en", + "in_reply_to_screen_name": "fakerapper", + "in_reply_to_user_id_str": "14256353" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954600170104107008" + ], + "editableUntil": "2018-01-20T07:23:10.823Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nathan Fritz 🌯🤔", + "screen_name": "fritzy", + "indices": [ + "0", + "7" + ], + "id_str": "14498374", + "id": "14498374" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "46" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954598885292322816", + "id_str": "954600170104107008", + "in_reply_to_user_id": "14498374", + "truncated": false, + "retweet_count": "0", + "id": "954600170104107008", + "in_reply_to_status_id": "954598885292322816", + "created_at": "Sat Jan 20 06:23:10 +0000 2018", + "favorited": false, + "full_text": "@fritzy Nope. Still grinding through season 2.", + "lang": "en", + "in_reply_to_screen_name": "fritzy", + "in_reply_to_user_id_str": "14498374" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954597393923624962" + ], + "editableUntil": "2018-01-20T07:12:08.930Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "theg", + "screen_name": "thegareth", + "indices": [ + "0", + "10" + ], + "id_str": "37883", + "id": "37883" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "70" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954597187249418242", + "id_str": "954597393923624962", + "in_reply_to_user_id": "37883", + "truncated": false, + "retweet_count": "0", + "id": "954597393923624962", + "in_reply_to_status_id": "954597187249418242", + "created_at": "Sat Jan 20 06:12:08 +0000 2018", + "favorited": false, + "full_text": "@thegareth That's what I did the rest of this week but I'm sick today.", + "lang": "en", + "in_reply_to_screen_name": "thegareth", + "in_reply_to_user_id_str": "37883" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954597281281449984" + ], + "editableUntil": "2018-01-20T07:11:42.074Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Chris Anderson", + "screen_name": "crandycodes", + "indices": [ + "0", + "12" + ], + "id_str": "1355546107", + "id": "1355546107" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954597049093169160", + "id_str": "954597281281449984", + "in_reply_to_user_id": "1355546107", + "truncated": false, + "retweet_count": "0", + "id": "954597281281449984", + "in_reply_to_status_id": "954597049093169160", + "created_at": "Sat Jan 20 06:11:42 +0000 2018", + "favorited": false, + "full_text": "@crandycodes But would that be a bad thing?", + "lang": "en", + "in_reply_to_screen_name": "crandycodes", + "in_reply_to_user_id_str": "1355546107" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954597097474371585" + ], + "editableUntil": "2018-01-20T07:10:58.251Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "⭐@mollymorphic@mastodon.social✨", + "screen_name": "mollymorphic", + "indices": [ + "0", + "13" + ], + "id_str": "1616354534", + "id": "1616354534" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "189" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954596610117423104", + "id_str": "954597097474371585", + "in_reply_to_user_id": "1616354534", + "truncated": false, + "retweet_count": "0", + "id": "954597097474371585", + "in_reply_to_status_id": "954596610117423104", + "created_at": "Sat Jan 20 06:10:58 +0000 2018", + "favorited": false, + "full_text": "@mollymorphic If he tells one more story about an ancient legend of his people that turns out to be key to unraveling that episode's mystery I am going to throw something through my screen.", + "lang": "en", + "in_reply_to_screen_name": "mollymorphic", + "in_reply_to_user_id_str": "1616354534" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954596651439566853" + ], + "editableUntil": "2018-01-20T07:09:11.908Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "209" + ], + "favorite_count": "92", + "in_reply_to_status_id_str": "954596327861624834", + "id_str": "954596651439566853", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "7", + "id": "954596651439566853", + "in_reply_to_status_id": "954596327861624834", + "created_at": "Sat Jan 20 06:09:11 +0000 2018", + "favorited": false, + "full_text": "Why am I spending my Friday night explaining to an uncaring internet why people should not invest in banana futures via a startup blockchain nonsense scam? I need to find better things to do with my damn time.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954596327861624834" + ], + "editableUntil": "2018-01-20T07:07:54.761Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "200" + ], + "favorite_count": "63", + "in_reply_to_status_id_str": "954596084046733312", + "id_str": "954596327861624834", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "5", + "id": "954596327861624834", + "in_reply_to_status_id": "954596084046733312", + "created_at": "Sat Jan 20 06:07:54 +0000 2018", + "favorited": false, + "full_text": "(p.s. it is SUPER PROBLEMATIC that there is a brand of clothing popular with rich white people named after a cruel system that locks nations into poverty against their will but I will pick my battles)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954596084046733312" + ], + "editableUntil": "2018-01-20T07:06:56.631Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/naYG4GMzHC", + "expanded_url": "https://en.wikipedia.org/wiki/Banana_republic", + "display_url": "en.wikipedia.org/wiki/Banana_re…", + "indices": [ + "248", + "271" + ] + } + ] + }, + "display_text_range": [ + "0", + "271" + ], + "favorite_count": "57", + "in_reply_to_status_id_str": "954592937702125568", + "id_str": "954596084046733312", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "13", + "id": "954596084046733312", + "in_reply_to_status_id": "954592937702125568", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 06:06:56 +0000 2018", + "favorited": false, + "full_text": "Bananas are such a terrible business that the only way you can make money with them is to viciously exploit labor to keep costs low, which requires controlling the entire political structure of a country. That's where \"banana republic\" comes from: https://t.co/naYG4GMzHC", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954593005767241730" + ], + "editableUntil": "2018-01-20T06:54:42.712Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "suldrew 🚲☕️🏳️🌈 now at suldrew@xoxo.zone", + "screen_name": "suldrew", + "indices": [ + "3", + "11" + ], + "id_str": "15742043", + "id": "15742043" + }, + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "13", + "19" + ], + "id_str": "15453", + "id": "15453" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "0", + "id_str": "954593005767241730", + "truncated": false, + "retweet_count": "0", + "id": "954593005767241730", + "created_at": "Sat Jan 20 05:54:42 +0000 2018", + "favorited": false, + "full_text": "RT @suldrew: @seldo There’s always money in the banana coin", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954592937702125568" + ], + "editableUntil": "2018-01-20T06:54:26.484Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "207" + ], + "favorite_count": "37", + "in_reply_to_status_id_str": "954591087984701440", + "id_str": "954592937702125568", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "4", + "id": "954592937702125568", + "in_reply_to_status_id": "954591087984701440", + "created_at": "Sat Jan 20 05:54:26 +0000 2018", + "favorited": false, + "full_text": "Look folks, I grew up in the Caribbean, learning a little bit about bananas is inevitable. And one of the most obvious things about bananas is that they are a terrible investment. They barely make any money.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954591653976719360" + ], + "editableUntil": "2018-01-20T06:49:20.420Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Sven Haster", + "screen_name": "BuurmanSven", + "indices": [ + "11", + "23" + ], + "id_str": "352956496", + "id": "352956496" + }, + { + "name": "Travis CI", + "screen_name": "travisci", + "indices": [ + "24", + "33" + ], + "id_str": "252481460", + "id": "252481460" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "141" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954585072471953408", + "id_str": "954591653976719360", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "954591653976719360", + "in_reply_to_status_id": "954585072471953408", + "created_at": "Sat Jan 20 05:49:20 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @BuurmanSven @travisci They recognize the problem, it’s just not their #1 issue right now. I understand their position completely.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954591288996712449" + ], + "editableUntil": "2018-01-20T06:47:53.402Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt Hargett", + "screen_name": "syke", + "indices": [ + "0", + "5" + ], + "id_str": "14270895", + "id": "14270895" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "65" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954583329637941248", + "id_str": "954591288996712449", + "in_reply_to_user_id": "14270895", + "truncated": false, + "retweet_count": "0", + "id": "954591288996712449", + "in_reply_to_status_id": "954583329637941248", + "created_at": "Sat Jan 20 05:47:53 +0000 2018", + "favorited": false, + "full_text": "@syke Starbuck is kind of an avatar but the president is awesome.", + "lang": "en", + "in_reply_to_screen_name": "syke", + "in_reply_to_user_id_str": "14270895" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954591087984701440" + ], + "editableUntil": "2018-01-20T06:47:05.477Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/lzOiA8qJAq", + "expanded_url": "https://twitter.com/thegrugq/status/954543461817970688", + "display_url": "twitter.com/thegrugq/statu…", + "indices": [ + "17", + "40" + ] + } + ] + }, + "display_text_range": [ + "0", + "40" + ], + "favorite_count": "77", + "id_str": "954591087984701440", + "truncated": false, + "retweet_count": "18", + "id": "954591087984701440", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 05:47:05 +0000 2018", + "favorited": false, + "full_text": "HOW IS THIS REAL https://t.co/lzOiA8qJAq", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954581392687448064" + ], + "editableUntil": "2018-01-20T06:08:33.938Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt Hargett", + "screen_name": "syke", + "indices": [ + "0", + "5" + ], + "id_str": "14270895", + "id": "14270895" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "151" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954580263425662979", + "id_str": "954581392687448064", + "in_reply_to_user_id": "14270895", + "truncated": false, + "retweet_count": "0", + "id": "954581392687448064", + "in_reply_to_status_id": "954580263425662979", + "created_at": "Sat Jan 20 05:08:33 +0000 2018", + "favorited": false, + "full_text": "@syke Every Star Trek series I've seen (except, refreshingly, Discovery) writes women this way. I don't think it's a specific problem with this series.", + "lang": "en", + "in_reply_to_screen_name": "syke", + "in_reply_to_user_id_str": "14270895" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954580852087799808" + ], + "editableUntil": "2018-01-20T06:06:25.049Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Sven Haster", + "screen_name": "BuurmanSven", + "indices": [ + "11", + "23" + ], + "id_str": "352956496", + "id": "352956496" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "206" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954579970369536000", + "id_str": "954580852087799808", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954580852087799808", + "in_reply_to_status_id": "954579970369536000", + "created_at": "Sat Jan 20 05:06:25 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @BuurmanSven Travis CI is all by itself responsible for 10% of downloads from npm. We've offered to supply them with a caching proxy but they, like us, are a small company with limited resources.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954580357029900290" + ], + "editableUntil": "2018-01-20T06:04:27.018Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nick Maietta", + "screen_name": "maietta", + "indices": [ + "0", + "8" + ], + "id_str": "17108257", + "id": "17108257" + }, + { + "name": "📦🛠👷🏻♂️Sean Larkin", + "screen_name": "TheLarkInn", + "indices": [ + "9", + "20" + ], + "id_str": "17607249", + "id": "17607249" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954579859862298626", + "id_str": "954580357029900290", + "in_reply_to_user_id": "17108257", + "truncated": false, + "retweet_count": "0", + "id": "954580357029900290", + "in_reply_to_status_id": "954579859862298626", + "created_at": "Sat Jan 20 05:04:27 +0000 2018", + "favorited": false, + "full_text": "@maietta @TheLarkInn Have you tried --prefer-offline in npm 5? It works very well in situations with slow or flaky internet.", + "lang": "en", + "in_reply_to_screen_name": "maietta", + "in_reply_to_user_id_str": "17108257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954580113923829763" + ], + "editableUntil": "2018-01-20T06:03:29.057Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Revin Guillen", + "screen_name": "revin", + "indices": [ + "3", + "9" + ], + "id_str": "14496796", + "id": "14496796" + }, + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "11", + "17" + ], + "id_str": "15453", + "id": "15453" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "954580113923829763", + "truncated": false, + "retweet_count": "0", + "id": "954580113923829763", + "created_at": "Sat Jan 20 05:03:29 +0000 2018", + "favorited": false, + "full_text": "RT @revin: @seldo And the Vulcans gave the same generation the false sense that they could just adopt logic and become superior to lesser/e…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954579970369536000" + ], + "editableUntil": "2018-01-20T06:02:54.831Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Sven Haster", + "screen_name": "BuurmanSven", + "indices": [ + "11", + "23" + ], + "id_str": "352956496", + "id": "352956496" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "218" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "954578318052872192", + "id_str": "954579970369536000", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "954579970369536000", + "in_reply_to_status_id": "954578318052872192", + "created_at": "Sat Jan 20 05:02:54 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @BuurmanSven It's not a problem with npm's caching, it's a symptom of CI workflows -- most CI sets up a fresh VM on every build, with no cache. So, yes, an enormous number of uncached builds are responsible.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954576965482106880" + ], + "editableUntil": "2018-01-20T05:50:58.410Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ben", + "screen_name": "sangster", + "indices": [ + "0", + "9" + ], + "id_str": "312909735", + "id": "312909735" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "85" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954576778122571776", + "id_str": "954576965482106880", + "in_reply_to_user_id": "312909735", + "truncated": false, + "retweet_count": "0", + "id": "954576965482106880", + "in_reply_to_status_id": "954576778122571776", + "created_at": "Sat Jan 20 04:50:58 +0000 2018", + "favorited": false, + "full_text": "@sangster Yessssss. And also why Star Trek fans are having trouble getting behind it.", + "lang": "en", + "in_reply_to_screen_name": "sangster", + "in_reply_to_user_id_str": "312909735" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954576196745904128" + ], + "editableUntil": "2018-01-20T05:47:55.129Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "183" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "954575666376204289", + "id_str": "954576196745904128", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "954576196745904128", + "in_reply_to_status_id": "954575666376204289", + "created_at": "Sat Jan 20 04:47:55 +0000 2018", + "favorited": false, + "full_text": "I genuinely believe the absurdly written women of Star Trek created a generation of men with warped expectations of how relationships are supposed to work, resulting in entitled MRAs.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954575666376204289" + ], + "editableUntil": "2018-01-20T05:45:48.679Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "194" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "954574261296902146", + "id_str": "954575666376204289", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "954575666376204289", + "in_reply_to_status_id": "954574261296902146", + "created_at": "Sat Jan 20 04:45:48 +0000 2018", + "favorited": false, + "full_text": "And do not get me started on how every member of the crew is emotionally stunted. Women are written more like feral cats, to be tricked or bribed into doing what men want, with no agency at all.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954574261296902146" + ], + "editableUntil": "2018-01-20T05:40:13.682Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "168" + ], + "favorite_count": "20", + "in_reply_to_status_id_str": "954573019086639104", + "id_str": "954574261296902146", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "954574261296902146", + "in_reply_to_status_id": "954573019086639104", + "created_at": "Sat Jan 20 04:40:13 +0000 2018", + "favorited": false, + "full_text": "In S3E24, the crew have to wait to travel down to a planet because of bad weather at night. They are on a fucking spaceship. They can go to the side where it's daytime.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954573019086639104" + ], + "editableUntil": "2018-01-20T05:35:17.516Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "45", + "id_str": "954573019086639104", + "truncated": false, + "retweet_count": "1", + "id": "954573019086639104", + "created_at": "Sat Jan 20 04:35:17 +0000 2018", + "favorited": false, + "full_text": "My completist hate-watching of Voyager continues. It consists of me repeatedly screaming \"WHO WROTE THIS SHIT?!\" at the screen.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954538476354994177" + ], + "editableUntil": "2018-01-20T03:18:01.887Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "212" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "954537797536436224", + "id_str": "954538476354994177", + "in_reply_to_user_id": "5447362", + "truncated": false, + "retweet_count": "0", + "id": "954538476354994177", + "in_reply_to_status_id": "954537797536436224", + "created_at": "Sat Jan 20 02:18:01 +0000 2018", + "favorited": false, + "full_text": "@sintaxi I really AM done, but: you can believe if you wish that the free market resists corruption better than other systems, but the evidence does not support that conclusion. Again, I appreciate your civility.", + "lang": "en", + "in_reply_to_screen_name": "sintaxi", + "in_reply_to_user_id_str": "5447362" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954536034280161281" + ], + "editableUntil": "2018-01-20T03:08:19.651Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "954535409584824320", + "id_str": "954536034280161281", + "in_reply_to_user_id": "5447362", + "truncated": false, + "retweet_count": "1", + "id": "954536034280161281", + "in_reply_to_status_id": "954535409584824320", + "created_at": "Sat Jan 20 02:08:19 +0000 2018", + "favorited": false, + "full_text": "@sintaxi The solution to corruption and inefficiency is not to abandon the attempt to run a government.", + "lang": "en", + "in_reply_to_screen_name": "sintaxi", + "in_reply_to_user_id_str": "5447362" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954535657124196352" + ], + "editableUntil": "2018-01-20T03:06:49.730Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "248" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954533820090339329", + "id_str": "954535657124196352", + "in_reply_to_user_id": "5447362", + "truncated": false, + "retweet_count": "0", + "id": "954535657124196352", + "in_reply_to_status_id": "954533820090339329", + "created_at": "Sat Jan 20 02:06:49 +0000 2018", + "favorited": false, + "full_text": "@sintaxi Much as I would love to present you with facts counter to your statements indefinitely, only to have you ignore them and present some new statement for me to disprove yet again, I'm done doing research for you tonight. Have a good evening!", + "lang": "en", + "in_reply_to_screen_name": "sintaxi", + "in_reply_to_user_id_str": "5447362" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954531239934943232" + ], + "editableUntil": "2018-01-20T02:49:16.590Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [ + { + "url": "https://t.co/452OvveIJr", + "expanded_url": "http://www.chicagotribune.com/business/columnists/ct-harris-chicago-junk-0621-biz-20150619-column.html", + "display_url": "chicagotribune.com/business/colum…", + "indices": [ + "140", + "163" + ] + } + ] + }, + "display_text_range": [ + "0", + "163" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954529992901246976", + "id_str": "954531239934943232", + "in_reply_to_user_id": "5447362", + "truncated": false, + "retweet_count": "0", + "id": "954531239934943232", + "in_reply_to_status_id": "954529992901246976", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 01:49:16 +0000 2018", + "favorited": false, + "full_text": "@sintaxi Detroit's auto industry collapsed. I'm not sure that can be blamed on the democrats. Chicago is not insolvent or even close to it: https://t.co/452OvveIJr", + "lang": "en", + "in_reply_to_screen_name": "sintaxi", + "in_reply_to_user_id_str": "5447362" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954530776338464768" + ], + "editableUntil": "2018-01-20T02:47:26.060Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954530776338464768/photo/1", + "indices": [ + "69", + "92" + ], + "url": "https://t.co/3XviZ1VCpC", + "media_url": "http://pbs.twimg.com/media/DT8sfW8VwAANU9c.jpg", + "id_str": "954530563272065024", + "id": "954530563272065024", + "media_url_https": "https://pbs.twimg.com/media/DT8sfW8VwAANU9c.jpg", + "sizes": { + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "409", + "h": "765", + "resize": "fit" + }, + "medium": { + "w": "409", + "h": "765", + "resize": "fit" + }, + "small": { + "w": "364", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/3XviZ1VCpC" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "92" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954530207888678912", + "id_str": "954530776338464768", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954530776338464768", + "in_reply_to_status_id": "954530207888678912", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 01:47:26 +0000 2018", + "favorited": false, + "full_text": "@sintaxi States by unemployment rate is a mixed bag, no clear trend. https://t.co/3XviZ1VCpC", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954530776338464768/photo/1", + "indices": [ + "69", + "92" + ], + "url": "https://t.co/3XviZ1VCpC", + "media_url": "http://pbs.twimg.com/media/DT8sfW8VwAANU9c.jpg", + "id_str": "954530563272065024", + "id": "954530563272065024", + "media_url_https": "https://pbs.twimg.com/media/DT8sfW8VwAANU9c.jpg", + "sizes": { + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "409", + "h": "765", + "resize": "fit" + }, + "medium": { + "w": "409", + "h": "765", + "resize": "fit" + }, + "small": { + "w": "364", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/3XviZ1VCpC" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954530207888678912" + ], + "editableUntil": "2018-01-20T02:45:10.531Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954530207888678912/photo/1", + "indices": [ + "124", + "147" + ], + "url": "https://t.co/4s6gt8B7io", + "media_url": "http://pbs.twimg.com/media/DT8sAf9VAAAml3_.jpg", + "id_str": "954530033116184576", + "id": "954530033116184576", + "media_url_https": "https://pbs.twimg.com/media/DT8sAf9VAAAml3_.jpg", + "sizes": { + "small": { + "w": "216", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "266", + "h": "836", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "266", + "h": "836", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/4s6gt8B7io" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "147" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954529662453006337", + "id_str": "954530207888678912", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954530207888678912", + "in_reply_to_status_id": "954529662453006337", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 01:45:10 +0000 2018", + "favorited": false, + "full_text": "@sintaxi Here is a list of US states by GDP per capita (lowest first) [source: wikipedia]. Another long list of red states. https://t.co/4s6gt8B7io", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954530207888678912/photo/1", + "indices": [ + "124", + "147" + ], + "url": "https://t.co/4s6gt8B7io", + "media_url": "http://pbs.twimg.com/media/DT8sAf9VAAAml3_.jpg", + "id_str": "954530033116184576", + "id": "954530033116184576", + "media_url_https": "https://pbs.twimg.com/media/DT8sAf9VAAAml3_.jpg", + "sizes": { + "small": { + "w": "216", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "266", + "h": "836", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "266", + "h": "836", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/4s6gt8B7io" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954529662453006337" + ], + "editableUntil": "2018-01-20T02:43:00.489Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [ + { + "url": "https://t.co/RMLYqGXCEe", + "expanded_url": "https://www.statista.com/statistics/252064/us-infant-mortality-rate-by-ethnicity-2011/", + "display_url": "statista.com/statistics/252…", + "indices": [ + "58", + "81" + ] + } + ] + }, + "display_text_range": [ + "0", + "126" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954528770571948032", + "id_str": "954529662453006337", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954529662453006337", + "in_reply_to_status_id": "954528770571948032", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 01:43:00 +0000 2018", + "favorited": false, + "full_text": "@sintaxi Here is a list of US states by infant mortality: https://t.co/RMLYqGXCEe The bottom end is overwhelmingly red states.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954529051766505472" + ], + "editableUntil": "2018-01-20T02:40:34.890Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "99" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954528710429876224", + "id_str": "954529051766505472", + "in_reply_to_user_id": "5447362", + "truncated": false, + "retweet_count": "0", + "id": "954529051766505472", + "in_reply_to_status_id": "954528710429876224", + "created_at": "Sat Jan 20 01:40:34 +0000 2018", + "favorited": false, + "full_text": "@sintaxi The preamble to the list does not mention opinions of the residents being a factor at all.", + "lang": "en", + "in_reply_to_screen_name": "sintaxi", + "in_reply_to_user_id_str": "5447362" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954528770571948032" + ], + "editableUntil": "2018-01-20T02:39:27.848Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "227" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954528293868388352", + "id_str": "954528770571948032", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954528770571948032", + "in_reply_to_status_id": "954528293868388352", + "created_at": "Sat Jan 20 01:39:27 +0000 2018", + "favorited": false, + "full_text": "@sintaxi Any list that puts North Dakota at the top of \"well run\" is pretty suspect anyway -- North Dakota is in the middle of a gigantic fracking-driven energy boom. They are swimming in money. That doesn't make them well run.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954528293868388352" + ], + "editableUntil": "2018-01-20T02:37:34.193Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954527965525651456", + "id_str": "954528293868388352", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954528293868388352", + "in_reply_to_status_id": "954527965525651456", + "created_at": "Sat Jan 20 01:37:34 +0000 2018", + "favorited": false, + "full_text": "@sintaxi And I'm afraid, without being disingenuous, that I don't know what you mean by \"what happened in Detroit and Chicago\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954527965525651456" + ], + "editableUntil": "2018-01-20T02:36:15.910Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "286" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954525164376436736", + "id_str": "954527965525651456", + "in_reply_to_user_id": "5447362", + "truncated": false, + "retweet_count": "0", + "id": "954527965525651456", + "in_reply_to_status_id": "954525164376436736", + "created_at": "Sat Jan 20 01:36:15 +0000 2018", + "favorited": false, + "full_text": "@sintaxi In what order are the states in this list being ranked? It's not poverty, nor unemployment, nor debt, nor budget deficit, nor household income, nor as far as I can tell any combination of these. They do not explain their methodology, making it opaque at best, suspect at worst.", + "lang": "en", + "in_reply_to_screen_name": "sintaxi", + "in_reply_to_user_id_str": "5447362" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954524582014144512" + ], + "editableUntil": "2018-01-20T02:22:49.218Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JC Grubbs", + "screen_name": "thegrubbsian", + "indices": [ + "0", + "13" + ], + "id_str": "12521122", + "id": "12521122" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "116" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954524392641396737", + "id_str": "954524582014144512", + "in_reply_to_user_id": "12521122", + "truncated": false, + "retweet_count": "0", + "id": "954524582014144512", + "in_reply_to_status_id": "954524392641396737", + "created_at": "Sat Jan 20 01:22:49 +0000 2018", + "favorited": false, + "full_text": "@thegrubbsian I believe he substituted the word \"born\" for the word \"torn\" in his text, but even then it's not true.", + "lang": "en", + "in_reply_to_screen_name": "thegrubbsian", + "in_reply_to_user_id_str": "12521122" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954524327331872768" + ], + "editableUntil": "2018-01-20T02:21:48.497Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "56" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954523964440592384", + "id_str": "954524327331872768", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954524327331872768", + "in_reply_to_status_id": "954523964440592384", + "created_at": "Sat Jan 20 01:21:48 +0000 2018", + "favorited": false, + "full_text": "@sintaxi So let me know what metric you're referring to.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954523964440592384" + ], + "editableUntil": "2018-01-20T02:20:21.977Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954523964440592384/photo/1", + "indices": [ + "139", + "162" + ], + "url": "https://t.co/xTZaR7Dsew", + "media_url": "http://pbs.twimg.com/media/DT8mX_fVAAACP96.jpg", + "id_str": "954523839647514624", + "id": "954523839647514624", + "media_url_https": "https://pbs.twimg.com/media/DT8mX_fVAAACP96.jpg", + "sizes": { + "small": { + "w": "680", + "h": "487", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "783", + "h": "561", + "resize": "fit" + }, + "medium": { + "w": "783", + "h": "561", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/xTZaR7Dsew" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "162" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954522985259417600", + "id_str": "954523964440592384", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "954523964440592384", + "in_reply_to_status_id": "954522985259417600", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 01:20:21 +0000 2018", + "favorited": false, + "full_text": "@sintaxi This map of states with revenue shortfalls this year (as a proxy for \"fiscally responsible\") doesn't show a clear red/blue trend: https://t.co/xTZaR7Dsew", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954523964440592384/photo/1", + "indices": [ + "139", + "162" + ], + "url": "https://t.co/xTZaR7Dsew", + "media_url": "http://pbs.twimg.com/media/DT8mX_fVAAACP96.jpg", + "id_str": "954523839647514624", + "id": "954523839647514624", + "media_url_https": "https://pbs.twimg.com/media/DT8mX_fVAAACP96.jpg", + "sizes": { + "small": { + "w": "680", + "h": "487", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "783", + "h": "561", + "resize": "fit" + }, + "medium": { + "w": "783", + "h": "561", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/xTZaR7Dsew" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954522985259417600" + ], + "editableUntil": "2018-01-20T02:16:28.522Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "◢ Brøck Whitten", + "screen_name": "sintaxi", + "indices": [ + "0", + "8" + ], + "id_str": "5447362", + "id": "5447362" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954522985259417600/photo/1", + "indices": [ + "153", + "176" + ], + "url": "https://t.co/4eICrMWHFM", + "media_url": "http://pbs.twimg.com/media/DT8llK6XkAArcNE.jpg", + "id_str": "954522966540390400", + "id": "954522966540390400", + "media_url_https": "https://pbs.twimg.com/media/DT8llK6XkAArcNE.jpg", + "sizes": { + "medium": { + "w": "355", + "h": "837", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "288", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "355", + "h": "837", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/4eICrMWHFM" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "176" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954521405223153670", + "id_str": "954522985259417600", + "in_reply_to_user_id": "5447362", + "truncated": false, + "retweet_count": "0", + "id": "954522985259417600", + "in_reply_to_status_id": "954521405223153670", + "possibly_sensitive": false, + "created_at": "Sat Jan 20 01:16:28 +0000 2018", + "favorited": false, + "full_text": "@sintaxi Not sure how you draw that conclusion from the report you just linked to. Here's the top 20 states are territories by poverty (from wikipedia): https://t.co/4eICrMWHFM", + "lang": "en", + "in_reply_to_screen_name": "sintaxi", + "in_reply_to_user_id_str": "5447362", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/954522985259417600/photo/1", + "indices": [ + "153", + "176" + ], + "url": "https://t.co/4eICrMWHFM", + "media_url": "http://pbs.twimg.com/media/DT8llK6XkAArcNE.jpg", + "id_str": "954522966540390400", + "id": "954522966540390400", + "media_url_https": "https://pbs.twimg.com/media/DT8llK6XkAArcNE.jpg", + "sizes": { + "medium": { + "w": "355", + "h": "837", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "288", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "355", + "h": "837", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/4eICrMWHFM" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954515501488603136" + ], + "editableUntil": "2018-01-20T01:46:44.252Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "153" + ], + "favorite_count": "32", + "in_reply_to_status_id_str": "954507284415070208", + "id_str": "954515501488603136", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "10", + "id": "954515501488603136", + "in_reply_to_status_id": "954507284415070208", + "created_at": "Sat Jan 20 00:46:44 +0000 2018", + "favorited": false, + "full_text": "Compassion and fiscal responsibility are not at odds. Being kind is cheaper than being cruel. Those who say otherwise are not in possession of the facts.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954509400432984064" + ], + "editableUntil": "2018-01-20T01:22:29.647Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Aaron P Blohowiak", + "screen_name": "aaronblohowiak", + "indices": [ + "0", + "15" + ], + "id_str": "7142142", + "id": "7142142" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "173" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954508946584215552", + "id_str": "954509400432984064", + "in_reply_to_user_id": "7142142", + "truncated": false, + "retweet_count": "0", + "id": "954509400432984064", + "in_reply_to_status_id": "954508946584215552", + "created_at": "Sat Jan 20 00:22:29 +0000 2018", + "favorited": false, + "full_text": "@aaronblohowiak GOP supporters either:\nA: understand that cutting healthcare increases costs (cruel)\nB: do not understand this (ignorant)\nThere's not some other option here.", + "lang": "en", + "in_reply_to_screen_name": "aaronblohowiak", + "in_reply_to_user_id_str": "7142142" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954508592781996033" + ], + "editableUntil": "2018-01-20T01:19:17.088Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Waylon is god Amen 🎶🤠", + "screen_name": "livemusic4me", + "indices": [ + "0", + "13" + ], + "id_str": "151766733", + "id": "151766733" + }, + { + "name": "Rudra", + "screen_name": "rudrayogini", + "indices": [ + "14", + "26" + ], + "id_str": "767512100621082624", + "id": "767512100621082624" + }, + { + "name": "💖💜💙 Kaylara's Queer Rage Hour 🌈", + "screen_name": "KaylaraOwl", + "indices": [ + "27", + "38" + ], + "id_str": "119166897", + "id": "119166897" + }, + { + "name": "🇨🇦 Captain Snark 🌹", + "screen_name": "KermitHigby", + "indices": [ + "51", + "63" + ], + "id_str": "901288458748080128", + "id": "901288458748080128" + }, + { + "name": "Taylor Jones 🌹", + "screen_name": "Tay_J_Jones", + "indices": [ + "64", + "76" + ], + "id_str": "93746094", + "id": "93746094" + }, + { + "name": "CitizensFedUp", + "screen_name": "CitizensFedUp", + "indices": [ + "77", + "91" + ], + "id_str": "2732944034", + "id": "2732944034" + }, + { + "name": "Dems Find Solution To Bernie Sanders Problem", + "screen_name": "AntiSocialstPAC", + "indices": [ + "92", + "108" + ], + "id_str": "941512655961055235", + "id": "941512655961055235" + }, + { + "name": "Puesto Loco™", + "screen_name": "PuestoLoco", + "indices": [ + "109", + "120" + ], + "id_str": "157099071", + "id": "157099071" + }, + { + "name": "Emanuel Zbeda", + "screen_name": "therealezway", + "indices": [ + "121", + "134" + ], + "id_str": "2784089552", + "id": "2784089552" + }, + { + "name": "Sally Albright", + "screen_name": "SallyAlbright", + "indices": [ + "135", + "149" + ], + "id_str": "11395432", + "id": "11395432" + }, + { + "name": "Queen of Shade🇺🇸", + "screen_name": "Gravityisback1", + "indices": [ + "167", + "182" + ], + "id_str": "847110247843938304", + "id": "847110247843938304" + }, + { + "name": "I was too busy ratfucking a lady to notice sexism", + "screen_name": "BravenakBlog", + "indices": [ + "183", + "196" + ], + "id_str": "913983698013274112", + "id": "913983698013274112" + }, + { + "name": "Candypants Moiston", + "screen_name": "CandiceAiston", + "indices": [ + "197", + "211" + ], + "id_str": "18337740", + "id": "18337740" + }, + { + "name": "Mr. Weeks 🤴🏾", + "screen_name": "MrDane1982", + "indices": [ + "212", + "223" + ], + "id_str": "543780273", + "id": "543780273" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "297" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952343380406734848", + "id_str": "954508592781996033", + "in_reply_to_user_id": "151766733", + "truncated": false, + "retweet_count": "0", + "id": "954508592781996033", + "in_reply_to_status_id": "952343380406734848", + "created_at": "Sat Jan 20 00:19:17 +0000 2018", + "favorited": false, + "full_text": "@livemusic4me @rudrayogini @KaylaraOwl @Phaedrus08 @KermitHigby @Tay_J_Jones @CitizensFedUp @AntiSocialstPAC @PuestoLoco @therealezway @SallyAlbright @Chrisnotmypotus @Gravityisback1 @BravenakBlog @CandiceAiston @MrDane1982 This is an argument for paying teachers more, not for paying clerks less.", + "lang": "en", + "in_reply_to_screen_name": "livemusic4me", + "in_reply_to_user_id_str": "151766733" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954507643783069696" + ], + "editableUntil": "2018-01-20T01:15:30.829Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dan \"Quietly Quit\" Hon", + "screen_name": "hondanhon", + "indices": [ + "0", + "10" + ], + "id_str": "32124032", + "id": "32124032" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "147" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954507481610305536", + "id_str": "954507643783069696", + "in_reply_to_user_id": "32124032", + "truncated": false, + "retweet_count": "0", + "id": "954507643783069696", + "in_reply_to_status_id": "954507481610305536", + "created_at": "Sat Jan 20 00:15:30 +0000 2018", + "favorited": false, + "full_text": "@hondanhon With the exception of unborn children, who must be protected at all costs. Once they're born, fuck 'em. Let 'em starve and get diseases.", + "lang": "en", + "in_reply_to_screen_name": "hondanhon", + "in_reply_to_user_id_str": "32124032" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954507284415070208" + ], + "editableUntil": "2018-01-20T01:14:05.149Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "240" + ], + "favorite_count": "112", + "in_reply_to_status_id_str": "954506543927447552", + "id_str": "954507284415070208", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "42", + "id": "954507284415070208", + "in_reply_to_status_id": "954506543927447552", + "created_at": "Sat Jan 20 00:14:05 +0000 2018", + "favorited": false, + "full_text": "Paying for firefighters is cheaper than letting buildings burn down. Providing housing is cheaper than letting people be homeless. Paying teachers is cheaper than having an uneducated work force. Governments have a function, and this is it.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954506543927447552" + ], + "editableUntil": "2018-01-20T01:11:08.603Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "167" + ], + "favorite_count": "31", + "in_reply_to_status_id_str": "954506332370948096", + "id_str": "954506543927447552", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "9", + "id": "954506543927447552", + "in_reply_to_status_id": "954506332370948096", + "created_at": "Sat Jan 20 00:11:08 +0000 2018", + "favorited": false, + "full_text": "The GOP is not the party of fiscal responsibility, they are the party of high spending plus pointless and unnecessary cruelty, because that plays well with their base.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954506332370948096" + ], + "editableUntil": "2018-01-20T01:10:18.164Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "173" + ], + "favorite_count": "100", + "id_str": "954506332370948096", + "truncated": false, + "retweet_count": "33", + "id": "954506332370948096", + "created_at": "Sat Jan 20 00:10:18 +0000 2018", + "favorited": false, + "full_text": "Always remember: providing healthcare is always cheaper than not providing it. Any time the GOP talks about cutting healthcare, they are increasing spending, not cutting it.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954492398725296128" + ], + "editableUntil": "2018-01-20T00:14:56.124Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/xOlJl89mNu", + "expanded_url": "https://twitter.com/SenateMajLdr/status/954409393507876864", + "display_url": "twitter.com/SenateMajLdr/s…", + "indices": [ + "169", + "192" + ] + } + ] + }, + "display_text_range": [ + "0", + "192" + ], + "favorite_count": "43", + "id_str": "954492398725296128", + "truncated": false, + "retweet_count": "20", + "id": "954492398725296128", + "possibly_sensitive": false, + "created_at": "Fri Jan 19 23:14:56 +0000 2018", + "favorited": false, + "full_text": "This is not an either-or choice. This country can do both. It won't cost anything. Both programs generate more money than they cost. You're just being mindlessly cruel. https://t.co/xOlJl89mNu", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954491547914924032" + ], + "editableUntil": "2018-01-20T00:11:33.275Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sthupa Shakur", + "screen_name": "vinnehvincent", + "indices": [ + "0", + "14" + ], + "id_str": "25178913", + "id": "25178913" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "64" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954490706684465153", + "id_str": "954491547914924032", + "in_reply_to_user_id": "25178913", + "truncated": false, + "retweet_count": "0", + "id": "954491547914924032", + "in_reply_to_status_id": "954490706684465153", + "created_at": "Fri Jan 19 23:11:33 +0000 2018", + "favorited": false, + "full_text": "@vinnehvincent Not sure if this is a compliment or an insult tbh", + "lang": "en", + "in_reply_to_screen_name": "vinnehvincent", + "in_reply_to_user_id_str": "25178913" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954465715343343616" + ], + "editableUntil": "2018-01-19T22:28:54.310Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt", + "screen_name": "mattsiegel", + "indices": [ + "0", + "11" + ], + "id_str": "14904769", + "id": "14904769" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "954465137104007168", + "id_str": "954465715343343616", + "in_reply_to_user_id": "14904769", + "truncated": false, + "retweet_count": "0", + "id": "954465715343343616", + "in_reply_to_status_id": "954465137104007168", + "created_at": "Fri Jan 19 21:28:54 +0000 2018", + "favorited": false, + "full_text": "@mattsiegel Well as a Virgo I'm outraged.", + "lang": "en", + "in_reply_to_screen_name": "mattsiegel", + "in_reply_to_user_id_str": "14904769" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954465496895700992" + ], + "editableUntil": "2018-01-19T22:28:02.228Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ee", + "screen_name": "EWDurbin", + "indices": [ + "0", + "9" + ], + "id_str": "14590010", + "id": "14590010" + } + ], + "urls": [ + { + "url": "https://t.co/bqzuV5WDXz", + "expanded_url": "http://package.community", + "display_url": "package.community", + "indices": [ + "44", + "67" + ] + } + ] + }, + "display_text_range": [ + "0", + "68" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954464637218631680", + "id_str": "954465496895700992", + "in_reply_to_user_id": "14590010", + "truncated": false, + "retweet_count": "0", + "id": "954465496895700992", + "in_reply_to_status_id": "954464637218631680", + "possibly_sensitive": false, + "created_at": "Fri Jan 19 21:28:02 +0000 2018", + "favorited": false, + "full_text": "@EWDurbin Would love to! Also have you seen https://t.co/bqzuV5WDXz?", + "lang": "en", + "in_reply_to_screen_name": "EWDurbin", + "in_reply_to_user_id_str": "14590010" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954463760730607616" + ], + "editableUntil": "2018-01-19T22:21:08.294Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/XPRwSypkQy", + "expanded_url": "https://twitter.com/ms_bianca_bisa/status/954432446300393473", + "display_url": "twitter.com/ms_bianca_bisa…", + "indices": [ + "130", + "153" + ] + } + ] + }, + "display_text_range": [ + "0", + "153" + ], + "favorite_count": "23", + "id_str": "954463760730607616", + "truncated": false, + "retweet_count": "7", + "id": "954463760730607616", + "possibly_sensitive": false, + "created_at": "Fri Jan 19 21:21:08 +0000 2018", + "favorited": false, + "full_text": "Trump's bold new political position is that he is against any babies being born whatsoever. Let's see how it plays with his base. https://t.co/XPRwSypkQy", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583490085458042881" + ], + "editableUntil": "2022-10-21T16:37:10.000Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "205" + ], + "favorite_count": "31", + "id_str": "1583490085458042881", + "truncated": false, + "retweet_count": "0", + "id": "1583490085458042881", + "created_at": "Fri Oct 21 16:07:10 +0000 2022", + "favorited": false, + "full_text": "Gotta say my schooling led me to believe that the pre-colombian history and politics of the Yucatan Peninsula would be a lot more important and relevant to modern life than it has in fact turned out to be.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583460820930899968" + ], + "editableUntil": "2022-10-21T14:40:53.646Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "Brodsky", + "screen_name": "a_drewsky", + "indices": [ + "3", + "13" + ], + "id_str": "364634154", + "id": "364634154" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/a_drewsky/status/1583082040932474880/photo/1", + "source_status_id": "1583082040932474880", + "indices": [ + "34", + "57" + ], + "url": "https://t.co/8IQRpVF7gN", + "media_url": "http://pbs.twimg.com/media/Ffg8YSLUoAIFNNG.png", + "id_str": "1583081656914583554", + "source_user_id": "364634154", + "id": "1583081656914583554", + "media_url_https": "https://pbs.twimg.com/media/Ffg8YSLUoAIFNNG.png", + "source_user_id_str": "364634154", + "sizes": { + "large": { + "w": "1274", + "h": "752", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "401", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "708", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "1583082040932474880", + "display_url": "pic.twitter.com/8IQRpVF7gN" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "57" + ], + "favorite_count": "0", + "id_str": "1583460820930899968", + "truncated": false, + "retweet_count": "0", + "id": "1583460820930899968", + "possibly_sensitive": false, + "created_at": "Fri Oct 21 14:10:53 +0000 2022", + "favorited": false, + "full_text": "RT @a_drewsky: data is my passion https://t.co/8IQRpVF7gN", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/a_drewsky/status/1583082040932474880/photo/1", + "source_status_id": "1583082040932474880", + "indices": [ + "34", + "57" + ], + "url": "https://t.co/8IQRpVF7gN", + "media_url": "http://pbs.twimg.com/media/Ffg8YSLUoAIFNNG.png", + "id_str": "1583081656914583554", + "source_user_id": "364634154", + "id": "1583081656914583554", + "media_url_https": "https://pbs.twimg.com/media/Ffg8YSLUoAIFNNG.png", + "source_user_id_str": "364634154", + "sizes": { + "large": { + "w": "1274", + "h": "752", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "401", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "708", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "1583082040932474880", + "display_url": "pic.twitter.com/8IQRpVF7gN" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583447431370272769" + ], + "editableUntil": "2022-10-21T13:47:41.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Phil Dennis-Jordan 😷", + "screen_name": "pmjordan", + "indices": [ + "0", + "9" + ], + "id_str": "14133059", + "id": "14133059" + }, + { + "name": "John Bull", + "screen_name": "garius", + "indices": [ + "10", + "17" + ], + "id_str": "7709782", + "id": "7709782" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "116" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "1583446715948204032", + "id_str": "1583447431370272769", + "in_reply_to_user_id": "14133059", + "truncated": false, + "retweet_count": "0", + "id": "1583447431370272769", + "in_reply_to_status_id": "1583446715948204032", + "created_at": "Fri Oct 21 13:17:41 +0000 2022", + "favorited": false, + "full_text": "@pmjordan @garius He is unbelievably arrogant, he genuinely believes he was doing a good job and can fix everything.", + "lang": "en", + "in_reply_to_screen_name": "pmjordan", + "in_reply_to_user_id_str": "14133059" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583446476058828801" + ], + "editableUntil": "2022-10-21T13:43:53.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Phil Dennis-Jordan 😷", + "screen_name": "pmjordan", + "indices": [ + "0", + "9" + ], + "id_str": "14133059", + "id": "14133059" + }, + { + "name": "John Bull", + "screen_name": "garius", + "indices": [ + "10", + "17" + ], + "id_str": "7709782", + "id": "7709782" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "169" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1583446090736553985", + "id_str": "1583446476058828801", + "in_reply_to_user_id": "14133059", + "truncated": false, + "retweet_count": "0", + "id": "1583446476058828801", + "in_reply_to_status_id": "1583446090736553985", + "created_at": "Fri Oct 21 13:13:53 +0000 2022", + "favorited": false, + "full_text": "@pmjordan @garius Are you kidding the man believes he is the second Churchill, there is nothing in life he wants more than to be PM again, it is the only thing he wants.", + "lang": "en", + "in_reply_to_screen_name": "pmjordan", + "in_reply_to_user_id_str": "14133059" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583445015979708416" + ], + "editableUntil": "2022-10-21T13:38:05.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "182" + ], + "favorite_count": "27", + "in_reply_to_status_id_str": "1583444761859436544", + "id_str": "1583445015979708416", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "1583445015979708416", + "in_reply_to_status_id": "1583444761859436544", + "created_at": "Fri Oct 21 13:08:05 +0000 2022", + "favorited": false, + "full_text": "I cannot stress enough that re-appointing Johnson as PM 3 months after kicking him out would destroy the Tory party inside and out and take the UK's international reputation with it.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583444761859436544" + ], + "editableUntil": "2022-10-21T13:37:04.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "14", + "in_reply_to_status_id_str": "1583444013025091584", + "id_str": "1583444761859436544", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "1583444761859436544", + "in_reply_to_status_id": "1583444013025091584", + "created_at": "Fri Oct 21 13:07:04 +0000 2022", + "favorited": false, + "full_text": "MPs have until Monday to find 100 others to nominate them for leadership of the party; Rishi Sunak currently has about 45 and Boris fucking Johnson has 24.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583444013025091584" + ], + "editableUntil": "2022-10-21T13:34:06.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/P3fU604zhG", + "expanded_url": "https://twitter.com/Jacob_Rees_Mogg/status/1583372255496896512", + "display_url": "twitter.com/Jacob_Rees_Mog…", + "indices": [ + "12", + "35" + ] + } + ] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "39", + "id_str": "1583444013025091584", + "truncated": false, + "retweet_count": "1", + "id": "1583444013025091584", + "possibly_sensitive": false, + "created_at": "Fri Oct 21 13:04:06 +0000 2022", + "favorited": false, + "full_text": "Bust it is. https://t.co/P3fU604zhG", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583301576969441281" + ], + "editableUntil": "2022-10-21T04:08:06.000Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/oxTTVsHzGa", + "expanded_url": "https://twitter.com/CaseyNewton/status/1583186623239290881", + "display_url": "twitter.com/CaseyNewton/st…", + "indices": [ + "59", + "82" + ] + } + ] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "28", + "id_str": "1583301576969441281", + "truncated": false, + "retweet_count": "4", + "id": "1583301576969441281", + "possibly_sensitive": false, + "created_at": "Fri Oct 21 03:38:06 +0000 2022", + "favorited": false, + "full_text": "Remember kids, using pronouns is the same as being a nazi. https://t.co/oxTTVsHzGa", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583284504830963713" + ], + "editableUntil": "2022-10-21T03:00:16.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Christopher Neugebauer (@chrisjrn@social.coop)", + "screen_name": "chrisjrn", + "indices": [ + "0", + "9" + ], + "id_str": "40449158", + "id": "40449158" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "120" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "1583284273590607872", + "id_str": "1583284504830963713", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1583284504830963713", + "in_reply_to_status_id": "1583284273590607872", + "created_at": "Fri Oct 21 02:30:16 +0000 2022", + "favorited": false, + "full_text": "@chrisjrn But nobody called themselves \"prime minister\" at all until the mid 1800s so lots of them don't pass that test.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583284273590607872" + ], + "editableUntil": "2022-10-21T02:59:21.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Christopher Neugebauer (@chrisjrn@social.coop)", + "screen_name": "chrisjrn", + "indices": [ + "0", + "9" + ], + "id_str": "40449158", + "id": "40449158" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "1583283311421448192", + "id_str": "1583284273590607872", + "in_reply_to_user_id": "40449158", + "truncated": false, + "retweet_count": "0", + "id": "1583284273590607872", + "in_reply_to_status_id": "1583283311421448192", + "created_at": "Fri Oct 21 02:29:21 +0000 2022", + "favorited": false, + "full_text": "@chrisjrn He did not. Interesting qualification.", + "lang": "en", + "in_reply_to_screen_name": "chrisjrn", + "in_reply_to_user_id_str": "40449158" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583279816672886784" + ], + "editableUntil": "2022-10-21T02:41:38.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Glockymolo Enjoyer", + "screen_name": "ysaw", + "indices": [ + "0", + "5" + ], + "id_str": "8340382", + "id": "8340382" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "96" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1583278923059560448", + "id_str": "1583279816672886784", + "in_reply_to_user_id": "8340382", + "truncated": false, + "retweet_count": "0", + "id": "1583279816672886784", + "in_reply_to_status_id": "1583278923059560448", + "created_at": "Fri Oct 21 02:11:38 +0000 2022", + "favorited": false, + "full_text": "@ysaw The stats are hard to find because immigration stats are googlebombed by right wing jerks.", + "lang": "en", + "in_reply_to_screen_name": "ysaw", + "in_reply_to_user_id_str": "8340382" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583279115334844416" + ], + "editableUntil": "2022-10-21T02:38:51.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "58" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1583278885831004161", + "id_str": "1583279115334844416", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1583279115334844416", + "in_reply_to_status_id": "1583278885831004161", + "created_at": "Fri Oct 21 02:08:51 +0000 2022", + "favorited": false, + "full_text": "If you don't last 2 weeks, were you PM? What about 7 days?", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583278885831004161" + ], + "editableUntil": "2022-10-21T02:37:56.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "220" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "1583137448707489793", + "id_str": "1583278885831004161", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1583278885831004161", + "in_reply_to_status_id": "1583137448707489793", + "created_at": "Fri Oct 21 02:07:56 +0000 2022", + "favorited": false, + "full_text": "Fun thought experiment: how brief would a prime minister's tenure need to be before you'd say \"they were never really PM\"? Lower bound is 4 days (Waldegrave is not considered a PM) and upper bound is Truss at 44, who is.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583274152584040448" + ], + "editableUntil": "2022-10-21T02:19:08.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kaydubs 🦖🦕🐀", + "screen_name": "KWiersoAgain", + "indices": [ + "0", + "13" + ], + "id_str": "1475145564782166019", + "id": "1475145564782166019" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1583273790821535745", + "id_str": "1583274152584040448", + "in_reply_to_user_id": "1475145564782166019", + "truncated": false, + "retweet_count": "0", + "id": "1583274152584040448", + "in_reply_to_status_id": "1583273790821535745", + "created_at": "Fri Oct 21 01:49:08 +0000 2022", + "favorited": false, + "full_text": "@KWiersoAgain Right, because we were never paying people enough to stay home, people knocked out of in-person industries flooded into delivery restaurants.", + "lang": "en", + "in_reply_to_screen_name": "KWiersoAgain", + "in_reply_to_user_id_str": "1475145564782166019" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583273349727150081" + ], + "editableUntil": "2022-10-21T02:15:57.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mike Morton", + "screen_name": "theycallmemorty", + "indices": [ + "0", + "16" + ], + "id_str": "69927304", + "id": "69927304" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "197" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "1583273095388835841", + "id_str": "1583273349727150081", + "in_reply_to_user_id": "69927304", + "truncated": false, + "retweet_count": "0", + "id": "1583273349727150081", + "in_reply_to_status_id": "1583273095388835841", + "created_at": "Fri Oct 21 01:45:57 +0000 2022", + "favorited": false, + "full_text": "@theycallmemorty I haven't done the math but at first glance it would be surprising if boomers were disproportionately employed in low-wage manual jobs, especially towards the end of their careers.", + "lang": "en", + "in_reply_to_screen_name": "theycallmemorty", + "in_reply_to_user_id_str": "69927304" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583272837292302336" + ], + "editableUntil": "2022-10-21T02:13:54.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "226" + ], + "favorite_count": "35", + "in_reply_to_status_id_str": "1583272545020583937", + "id_str": "1583272837292302336", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "1583272837292302336", + "in_reply_to_status_id": "1583272545020583937", + "created_at": "Fri Oct 21 01:43:54 +0000 2022", + "favorited": false, + "full_text": "Certainly killing shit-tons of people was terrible and probably affected the labor market as well, but it wasn't nearly a big enough effect to account for the labor market changes. 500,000 working-age people switching jobs is.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583272545020583937" + ], + "editableUntil": "2022-10-21T02:12:45.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "280" + ], + "favorite_count": "30", + "in_reply_to_status_id_str": "1583257066126249984", + "id_str": "1583272545020583937", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "6", + "id": "1583272545020583937", + "in_reply_to_status_id": "1583257066126249984", + "created_at": "Fri Oct 21 01:42:45 +0000 2022", + "favorited": false, + "full_text": "For those suggesting covid also caused this: warehouses employ 1.8m people, up 37% since 2020, so roughly 500,000 people have moved into the warehouse industry. Of the 1m dead of covid more than 750,000 of them were already past retirement age. So warehouses > 2x covid effect.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583272338367254529" + ], + "editableUntil": "2022-10-21T02:11:55.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Harry Hawk", + "screen_name": "hhawk", + "indices": [ + "0", + "6" + ], + "id_str": "2223531", + "id": "2223531" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "287" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1583270764387540992", + "id_str": "1583272338367254529", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "1583272338367254529", + "in_reply_to_status_id": "1583270764387540992", + "created_at": "Fri Oct 21 01:41:55 +0000 2022", + "favorited": false, + "full_text": "@hhawk It's not even particularly complicated math: warehouses employ 1.8m people, up 37% since 2020, so roughly 500,000 people have moved into the warehouse industry. Of the 1m dead of covid more than 750,000 of them were already past retirement age. So warehouses > 2x covid effect.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583271239866494978" + ], + "editableUntil": "2022-10-21T02:07:33.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Corey Quinn", + "screen_name": "QuinnyPig", + "indices": [ + "123", + "133" + ], + "id_str": "97114171", + "id": "97114171" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "195" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "1583261049796452353", + "id_str": "1583271239866494978", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1583271239866494978", + "in_reply_to_status_id": "1583261049796452353", + "created_at": "Fri Oct 21 01:37:33 +0000 2022", + "favorited": false, + "full_text": "This is the closest I've seen a respected* source come to actively calling out Microsoft for dishonesty here.\n\n* Obviously @QuinnyPig calls them out all the time, but is he really *respected*? /s", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1583270764387540992" + ], + "editableUntil": "2022-10-21T02:05:40.000Z", + "editsRemaining": "5", + "isEditEligible": false + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Harry Hawk", + "screen_name": "hhawk", + "indices": [ + "0", + "6" + ], + "id_str": "2223531", + "id": "2223531" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "150" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1583269739618455552", + "id_str": "1583270764387540992", + "in_reply_to_user_id": "2223531", + "truncated": false, + "retweet_count": "1", + "id": "1583270764387540992", + "in_reply_to_status_id": "1583269739618455552", + "created_at": "Fri Oct 21 01:35:40 +0000 2022", + "favorited": false, + "full_text": "@hhawk It's probably a contributing factor to be sure, but having done some math on this it's nowhere near enough to steer the market where it's gone.", + "lang": "en", + "in_reply_to_screen_name": "hhawk", + "in_reply_to_user_id_str": "2223531" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494372909615251456" + ], + "editableUntil": "2022-02-17T19:07:20.415Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/hXaZpJange", + "expanded_url": "https://twitter.com/kefimochi/status/1494064252482555907", + "display_url": "twitter.com/kefimochi/stat…", + "indices": [ + "9", + "32" + ] + } + ] + }, + "display_text_range": [ + "0", + "32" + ], + "favorite_count": "97", + "id_str": "1494372909615251456", + "truncated": false, + "retweet_count": "11", + "id": "1494372909615251456", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 18:07:20 +0000 2022", + "favorited": false, + "full_text": "Startups https://t.co/hXaZpJange", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494340454040551428" + ], + "editableUntil": "2022-02-17T16:58:22.403Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sean Barry Parsons®", + "screen_name": "SeanBParsons", + "indices": [ + "0", + "13" + ], + "id_str": "1240630370934173697", + "id": "1240630370934173697" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "19" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494339945028145155", + "id_str": "1494340454040551428", + "in_reply_to_user_id": "1240630370934173697", + "truncated": false, + "retweet_count": "0", + "id": "1494340454040551428", + "in_reply_to_status_id": "1494339945028145155", + "created_at": "Thu Feb 17 15:58:22 +0000 2022", + "favorited": false, + "full_text": "@SeanBParsons Sean.", + "lang": "eu", + "in_reply_to_screen_name": "SeanBParsons", + "in_reply_to_user_id_str": "1240630370934173697" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494339796801519617" + ], + "editableUntil": "2022-02-17T16:55:45.705Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "50" + ], + "favorite_count": "11", + "id_str": "1494339796801519617", + "truncated": false, + "retweet_count": "0", + "id": "1494339796801519617", + "created_at": "Thu Feb 17 15:55:45 +0000 2022", + "favorited": false, + "full_text": "Consider this\nConsider this the tip of the century", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494336909283192839" + ], + "editableUntil": "2022-02-17T16:44:17.267Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "anildash.com", + "screen_name": "anildash", + "indices": [ + "0", + "9" + ], + "id_str": "36823", + "id": "36823" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "89" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "1494336598120415241", + "id_str": "1494336909283192839", + "in_reply_to_user_id": "36823", + "truncated": false, + "retweet_count": "0", + "id": "1494336909283192839", + "in_reply_to_status_id": "1494336598120415241", + "created_at": "Thu Feb 17 15:44:17 +0000 2022", + "favorited": false, + "full_text": "@anildash \"Why don't we just GIVE everyone FREE HOUSES??\"\n\"That'd be great. Let's do it.\"", + "lang": "en", + "in_reply_to_screen_name": "anildash", + "in_reply_to_user_id_str": "36823" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494336156648890371" + ], + "editableUntil": "2022-02-17T16:41:17.825Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "anildash.com", + "screen_name": "anildash", + "indices": [ + "0", + "9" + ], + "id_str": "36823", + "id": "36823" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "60" + ], + "favorite_count": "17", + "in_reply_to_status_id_str": "1494335443608899584", + "id_str": "1494336156648890371", + "in_reply_to_user_id": "36823", + "truncated": false, + "retweet_count": "0", + "id": "1494336156648890371", + "in_reply_to_status_id": "1494335443608899584", + "created_at": "Thu Feb 17 15:41:17 +0000 2022", + "favorited": false, + "full_text": "@anildash Good to know all my recruiting hasn't been in vain", + "lang": "en", + "in_reply_to_screen_name": "anildash", + "in_reply_to_user_id_str": "36823" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494334451102273545" + ], + "editableUntil": "2022-02-17T16:34:31.191Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/xZiYWYI6D0", + "expanded_url": "https://news.gallup.com/poll/389792/lgbt-identification-ticks-up.aspx", + "display_url": "news.gallup.com/poll/389792/lg…", + "indices": [ + "63", + "86" + ] + } + ] + }, + "display_text_range": [ + "0", + "86" + ], + "favorite_count": "103", + "id_str": "1494334451102273545", + "truncated": false, + "retweet_count": "18", + "id": "1494334451102273545", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 15:34:31 +0000 2022", + "favorited": false, + "full_text": "21% of Americans born between 1997 and 2003 identify as LGBTQ: https://t.co/xZiYWYI6D0", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494185357553799168" + ], + "editableUntil": "2022-02-17T06:42:04.519Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sacha Greif @sachagreif@hachyderm.io", + "screen_name": "SachaGreif", + "indices": [ + "0", + "11" + ], + "id_str": "14261086", + "id": "14261086" + }, + { + "name": "Evan You", + "screen_name": "youyuxi", + "indices": [ + "12", + "20" + ], + "id_str": "182821975", + "id": "182821975" + }, + { + "name": "Rich Harris", + "screen_name": "Rich_Harris", + "indices": [ + "21", + "33" + ], + "id_str": "19487837", + "id": "19487837" + }, + { + "name": "Matteo Collina", + "screen_name": "matteocollina", + "indices": [ + "34", + "48" + ], + "id_str": "15979784", + "id": "15979784" + }, + { + "name": "Ryan Carniato", + "screen_name": "RyanCarniato", + "indices": [ + "49", + "62" + ], + "id_str": "1200926075733176320", + "id": "1200926075733176320" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "167" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494171661972967424", + "id_str": "1494185357553799168", + "in_reply_to_user_id": "14261086", + "truncated": false, + "retweet_count": "0", + "id": "1494185357553799168", + "in_reply_to_status_id": "1494171661972967424", + "created_at": "Thu Feb 17 05:42:04 +0000 2022", + "favorited": false, + "full_text": "@SachaGreif @youyuxi @Rich_Harris @matteocollina @RyanCarniato Lol at the Hacker News coverage. \"As usual, this was just people being mindlessly angry. Here's a link!\"", + "lang": "en", + "in_reply_to_screen_name": "SachaGreif", + "in_reply_to_user_id_str": "14261086" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494156808973217793" + ], + "editableUntil": "2022-02-17T04:48:38.007Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "amro", + "screen_name": "amdev", + "indices": [ + "0", + "6" + ], + "id_str": "14335093", + "id": "14335093" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "31" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494155346948018176", + "id_str": "1494156808973217793", + "in_reply_to_user_id": "14335093", + "truncated": false, + "retweet_count": "0", + "id": "1494156808973217793", + "in_reply_to_status_id": "1494155346948018176", + "created_at": "Thu Feb 17 03:48:38 +0000 2022", + "favorited": false, + "full_text": "@amdev *blinking white guy gif*", + "lang": "en", + "in_reply_to_screen_name": "amdev", + "in_reply_to_user_id_str": "14335093" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494142746201755650" + ], + "editableUntil": "2022-02-17T03:52:45.181Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Michael Donohoe", + "screen_name": "donohoe", + "indices": [ + "0", + "8" + ], + "id_str": "8067002", + "id": "8067002" + }, + { + "name": "Sacha Greif @sachagreif@hachyderm.io", + "screen_name": "SachaGreif", + "indices": [ + "9", + "20" + ], + "id_str": "14261086", + "id": "14261086" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "272" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1494142412825890817", + "id_str": "1494142746201755650", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494142746201755650", + "in_reply_to_status_id": "1494142412825890817", + "created_at": "Thu Feb 17 02:52:45 +0000 2022", + "favorited": false, + "full_text": "@donohoe @SachaGreif And one of the *signs* that it's changing is trend data like this one -- State of JS, Netlify's Jamstack survey and GitHub's Octoverse are three recent surveys all of which showed the same trend to greater diversity by experience. I believe it's real.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494142412825890817" + ], + "editableUntil": "2022-02-17T03:51:25.698Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Michael Donohoe", + "screen_name": "donohoe", + "indices": [ + "0", + "8" + ], + "id_str": "8067002", + "id": "8067002" + }, + { + "name": "Sacha Greif @sachagreif@hachyderm.io", + "screen_name": "SachaGreif", + "indices": [ + "9", + "20" + ], + "id_str": "14261086", + "id": "14261086" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "290" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494136821239926784", + "id_str": "1494142412825890817", + "in_reply_to_user_id": "8067002", + "truncated": false, + "retweet_count": "0", + "id": "1494142412825890817", + "in_reply_to_status_id": "1494136821239926784", + "created_at": "Thu Feb 17 02:51:25 +0000 2022", + "favorited": false, + "full_text": "@donohoe @SachaGreif As I alluded to earlier, regardless of the bias in *this* survey, I haven't seen any survey of the developer population that doesn't come up with roughly the same demographics. That can change, it is changing, but my current reading of the data is that it is a reality.", + "lang": "en", + "in_reply_to_screen_name": "donohoe", + "in_reply_to_user_id_str": "8067002" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494141925032546309" + ], + "editableUntil": "2022-02-17T03:49:29.399Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt Hackett 📙", + "screen_name": "richtaur", + "indices": [ + "23", + "32" + ], + "id_str": "14965072", + "id": "14965072" + } + ], + "urls": [ + { + "url": "https://t.co/x4Tfw5Wtms", + "expanded_url": "https://www.valadria.com/how-to-make-a-video-game-all-by-yourself/", + "display_url": "valadria.com/how-to-make-a-…", + "indices": [ + "162", + "185" + ] + } + ] + }, + "display_text_range": [ + "0", + "185" + ], + "favorite_count": "35", + "id_str": "1494141925032546309", + "truncated": false, + "retweet_count": "5", + "id": "1494141925032546309", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 02:49:29 +0000 2022", + "favorited": false, + "full_text": "The supremely talented @richtaur has written a book called \"How To Make A Video Game All By Yourself\" (you'll never guess what it's about). So great to see this! https://t.co/x4Tfw5Wtms", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494134957945413634" + ], + "editableUntil": "2022-02-17T03:21:48.316Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Michael Donohoe", + "screen_name": "donohoe", + "indices": [ + "0", + "8" + ], + "id_str": "8067002", + "id": "8067002" + }, + { + "name": "Sacha Greif @sachagreif@hachyderm.io", + "screen_name": "SachaGreif", + "indices": [ + "9", + "20" + ], + "id_str": "14261086", + "id": "14261086" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "237" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "1494130481578840064", + "id_str": "1494134957945413634", + "in_reply_to_user_id": "8067002", + "truncated": false, + "retweet_count": "0", + "id": "1494134957945413634", + "in_reply_to_status_id": "1494130481578840064", + "created_at": "Thu Feb 17 02:21:48 +0000 2022", + "favorited": false, + "full_text": "@donohoe @SachaGreif I mean, every study of the programmer population I have seen suggests that it is, in fact, full of white dudes, and that began to change relatively recently. The bias isn't in the survey, the bias is in the industry.", + "lang": "en", + "in_reply_to_screen_name": "donohoe", + "in_reply_to_user_id_str": "8067002" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494128736853053440" + ], + "editableUntil": "2022-02-17T02:57:05.092Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/8u4m2DZWM9", + "expanded_url": "https://twitter.com/itamarst/status/1494111599493357574", + "display_url": "twitter.com/itamarst/statu…", + "indices": [ + "125", + "148" + ] + } + ] + }, + "display_text_range": [ + "0", + "148" + ], + "favorite_count": "22", + "id_str": "1494128736853053440", + "truncated": false, + "retweet_count": "2", + "id": "1494128736853053440", + "possibly_sensitive": false, + "created_at": "Thu Feb 17 01:57:05 +0000 2022", + "favorited": false, + "full_text": "What weird brain poison was it made people be able to say \"convenient parking is more important than the lives of children\"? https://t.co/8u4m2DZWM9", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494119066973327361" + ], + "editableUntil": "2022-02-17T02:18:39.613Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "manakin guywalker", + "screen_name": "destroyeroftroy", + "indices": [ + "0", + "16" + ], + "id_str": "476011586", + "id": "476011586" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "25" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494118490076332032", + "id_str": "1494119066973327361", + "in_reply_to_user_id": "476011586", + "truncated": false, + "retweet_count": "0", + "id": "1494119066973327361", + "in_reply_to_status_id": "1494118490076332032", + "created_at": "Thu Feb 17 01:18:39 +0000 2022", + "favorited": false, + "full_text": "@destroyeroftroy Amazing.", + "lang": "en", + "in_reply_to_screen_name": "destroyeroftroy", + "in_reply_to_user_id_str": "476011586" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494117993151823882" + ], + "editableUntil": "2022-02-17T02:14:23.594Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "manakin guywalker", + "screen_name": "destroyeroftroy", + "indices": [ + "0", + "16" + ], + "id_str": "476011586", + "id": "476011586" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494117450731954179", + "id_str": "1494117993151823882", + "in_reply_to_user_id": "476011586", + "truncated": false, + "retweet_count": "0", + "id": "1494117993151823882", + "in_reply_to_status_id": "1494117450731954179", + "created_at": "Thu Feb 17 01:14:23 +0000 2022", + "favorited": false, + "full_text": "@destroyeroftroy Okay but since when?", + "lang": "en", + "in_reply_to_screen_name": "destroyeroftroy", + "in_reply_to_user_id_str": "476011586" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494117185467207680" + ], + "editableUntil": "2022-02-17T02:11:11.027Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "manakin guywalker", + "screen_name": "destroyeroftroy", + "indices": [ + "0", + "16" + ], + "id_str": "476011586", + "id": "476011586" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "60" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494117047995080704", + "id_str": "1494117185467207680", + "in_reply_to_user_id": "476011586", + "truncated": false, + "retweet_count": "0", + "id": "1494117185467207680", + "in_reply_to_status_id": "1494117047995080704", + "created_at": "Thu Feb 17 01:11:11 +0000 2022", + "favorited": false, + "full_text": "@destroyeroftroy Lololololol how long have you believed this", + "lang": "en", + "in_reply_to_screen_name": "destroyeroftroy", + "in_reply_to_user_id_str": "476011586" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494105968057016321" + ], + "editableUntil": "2022-02-17T01:26:36.588Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sacha Greif @sachagreif@hachyderm.io", + "screen_name": "SachaGreif", + "indices": [ + "0", + "11" + ], + "id_str": "14261086", + "id": "14261086" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "1494105279411425282", + "id_str": "1494105968057016321", + "in_reply_to_user_id": "14261086", + "truncated": false, + "retweet_count": "0", + "id": "1494105968057016321", + "in_reply_to_status_id": "1494105279411425282", + "created_at": "Thu Feb 17 00:26:36 +0000 2022", + "favorited": false, + "full_text": "@SachaGreif That would be truly delightful!", + "lang": "en", + "in_reply_to_screen_name": "SachaGreif", + "in_reply_to_user_id_str": "14261086" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954463314511249408" + ], + "editableUntil": "2018-01-19T22:19:21.907Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mike Hogan", + "screen_name": "mike_hogan", + "indices": [ + "0", + "11" + ], + "id_str": "14863800", + "id": "14863800" + }, + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "12", + "24" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954462222239006721", + "id_str": "954463314511249408", + "in_reply_to_user_id": "14863800", + "truncated": false, + "retweet_count": "0", + "id": "954463314511249408", + "in_reply_to_status_id": "954462222239006721", + "created_at": "Fri Jan 19 21:19:21 +0000 2018", + "favorited": false, + "full_text": "@mike_hogan @CaseyNewton Yeah, a 20% cut does seem like it would hurt some people.", + "lang": "en", + "in_reply_to_screen_name": "mike_hogan", + "in_reply_to_user_id_str": "14863800" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954462902085328896" + ], + "editableUntil": "2018-01-19T22:17:43.577Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Malthe Sigurdsson", + "screen_name": "malthe", + "indices": [ + "0", + "7" + ], + "id_str": "496223", + "id": "496223" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "81" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954461155371581440", + "id_str": "954462902085328896", + "in_reply_to_user_id": "496223", + "truncated": false, + "retweet_count": "0", + "id": "954462902085328896", + "in_reply_to_status_id": "954461155371581440", + "created_at": "Fri Jan 19 21:17:43 +0000 2018", + "favorited": false, + "full_text": "@malthe School-organized dances are such an alien part of American culture to me.", + "lang": "en", + "in_reply_to_screen_name": "malthe", + "in_reply_to_user_id_str": "496223" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954460207756722177" + ], + "editableUntil": "2018-01-19T22:07:01.199Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "111" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954119753240629250", + "id_str": "954460207756722177", + "in_reply_to_user_id": "37441336", + "truncated": false, + "retweet_count": "0", + "id": "954460207756722177", + "in_reply_to_status_id": "954119753240629250", + "created_at": "Fri Jan 19 21:07:01 +0000 2018", + "favorited": false, + "full_text": "@jose_pedro_dias It's actually quite hard to tell! We're hoping to improve our metrics on that front this year.", + "lang": "en", + "in_reply_to_user_id_str": "37441336" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954456150212198400" + ], + "editableUntil": "2018-01-19T21:50:53.805Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Sven Haster", + "screen_name": "BuurmanSven", + "indices": [ + "11", + "23" + ], + "id_str": "352956496", + "id": "352956496" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "163" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954455509603512320", + "id_str": "954456150212198400", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "954456150212198400", + "in_reply_to_status_id": "954455509603512320", + "created_at": "Fri Jan 19 20:50:53 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @BuurmanSven Thank you! For comparison to this post, registered users are currently just over 600,000. Most of the other numbers have similarly tripled.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954422729280647168" + ], + "editableUntil": "2018-01-19T19:38:05.634Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "113" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954421598400008193", + "id_str": "954422729280647168", + "in_reply_to_user_id": "3948913527", + "truncated": false, + "retweet_count": "0", + "id": "954422729280647168", + "in_reply_to_status_id": "954421598400008193", + "created_at": "Fri Jan 19 18:38:05 +0000 2018", + "favorited": false, + "full_text": "@ventutech I'm not prepared to concede that merely having a lot of dependencies is bad per se. What harm is done?", + "lang": "en", + "in_reply_to_user_id_str": "3948913527" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954421137122865153" + ], + "editableUntil": "2018-01-19T19:31:46.034Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954421039303405568", + "id_str": "954421137122865153", + "in_reply_to_user_id": "3948913527", + "truncated": false, + "retweet_count": "0", + "id": "954421137122865153", + "in_reply_to_status_id": "954421039303405568", + "created_at": "Fri Jan 19 18:31:46 +0000 2018", + "favorited": false, + "full_text": "@ventutech What's hellish about it?", + "lang": "en", + "in_reply_to_user_id_str": "3948913527" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954411586134851584" + ], + "editableUntil": "2018-01-19T18:53:48.901Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "The Great and Terrible Meateater 🦖", + "screen_name": "MeateaterT", + "indices": [ + "0", + "11" + ], + "id_str": "2660701336", + "id": "2660701336" + }, + { + "name": "Brent Ozar", + "screen_name": "BrentO", + "indices": [ + "12", + "19" + ], + "id_str": "495643", + "id": "495643" + }, + { + "name": "Baron Robert Verell", + "screen_name": "SQLCowbell", + "indices": [ + "20", + "31" + ], + "id_str": "721686517", + "id": "721686517" + } + ], + "urls": [ + { + "url": "https://t.co/BjXrYh5h58", + "expanded_url": "https://twitter.com/seldo/status/954405350051991552", + "display_url": "twitter.com/seldo/status/9…", + "indices": [ + "32", + "55" + ] + } + ] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954411025595592706", + "id_str": "954411586134851584", + "in_reply_to_user_id": "2660701336", + "truncated": false, + "retweet_count": "0", + "id": "954411586134851584", + "in_reply_to_status_id": "954411025595592706", + "possibly_sensitive": false, + "created_at": "Fri Jan 19 17:53:48 +0000 2018", + "favorited": false, + "full_text": "@MeateaterT @BrentO @SQLCowbell https://t.co/BjXrYh5h58", + "lang": "qme", + "in_reply_to_screen_name": "MeateaterT", + "in_reply_to_user_id_str": "2660701336" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954405350051991552" + ], + "editableUntil": "2018-01-19T18:29:02.103Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Baron Robert Verell", + "screen_name": "SQLCowbell", + "indices": [ + "0", + "11" + ], + "id_str": "721686517", + "id": "721686517" + }, + { + "name": "Born SQL", + "screen_name": "BornSQL", + "indices": [ + "12", + "20" + ], + "id_str": "4043034494", + "id": "4043034494" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "98" + ], + "favorite_count": "51", + "in_reply_to_status_id_str": "954405113191370752", + "id_str": "954405350051991552", + "in_reply_to_user_id": "721686517", + "truncated": false, + "retweet_count": "1", + "id": "954405350051991552", + "in_reply_to_status_id": "954405113191370752", + "created_at": "Fri Jan 19 17:29:02 +0000 2018", + "favorited": false, + "full_text": "@SQLCowbell @BornSQL If you don't have a verifiable restore, you don't have a backup. So we agree.", + "lang": "en", + "in_reply_to_screen_name": "SQLCowbell", + "in_reply_to_user_id_str": "721686517" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954403721290514432" + ], + "editableUntil": "2018-01-19T18:22:33.776Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "99" + ], + "favorite_count": "1969", + "id_str": "954403721290514432", + "truncated": false, + "retweet_count": "725", + "id": "954403721290514432", + "created_at": "Fri Jan 19 17:22:33 +0000 2018", + "favorited": false, + "full_text": "Until you have backups, you don't have a database. What you have is a prolonged period of optimism.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954400222829936640" + ], + "editableUntil": "2018-01-19T18:08:39.678Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "enantiomer", + "screen_name": "bonkydog", + "indices": [ + "3", + "12" + ], + "id_str": "45216044", + "id": "45216044" + }, + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "14", + "20" + ], + "id_str": "15453", + "id": "15453" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "954400222829936640", + "truncated": false, + "retweet_count": "0", + "id": "954400222829936640", + "created_at": "Fri Jan 19 17:08:39 +0000 2018", + "favorited": false, + "full_text": "RT @bonkydog: @seldo There is only one scarf, gradually changing in color, material, and texture. Where it intersects 3D space, we wrap our…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954398610250121216" + ], + "editableUntil": "2018-01-19T18:02:15.209Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "3", + "9" + ], + "id_str": "15453", + "id": "15453" + }, + { + "name": "cara esten", + "screen_name": "esten", + "indices": [ + "11", + "17" + ], + "id_str": "1108462281237520384", + "id": "1108462281237520384" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "25" + ], + "favorite_count": "0", + "id_str": "954398610250121216", + "truncated": false, + "retweet_count": "0", + "id": "954398610250121216", + "created_at": "Fri Jan 19 17:02:15 +0000 2018", + "favorited": false, + "full_text": "RT @seldo: @esten Scarfae", + "lang": "und" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954398591107215360" + ], + "editableUntil": "2018-01-19T18:02:10.645Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "cara esten", + "screen_name": "esten", + "indices": [ + "3", + "9" + ], + "id_str": "1108462281237520384", + "id": "1108462281237520384" + }, + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "11", + "17" + ], + "id_str": "15453", + "id": "15453" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "25" + ], + "favorite_count": "0", + "id_str": "954398591107215360", + "truncated": false, + "retweet_count": "0", + "id": "954398591107215360", + "created_at": "Fri Jan 19 17:02:10 +0000 2018", + "favorited": false, + "full_text": "RT @esten: @seldo Scarfii", + "lang": "ro" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954398577379262464" + ], + "editableUntil": "2018-01-19T18:02:07.372Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@aaronfriel@hachyderm.io", + "screen_name": "AaronFriel", + "indices": [ + "3", + "14" + ], + "id_str": "184674078", + "id": "184674078" + }, + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "16", + "22" + ], + "id_str": "15453", + "id": "15453" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "0", + "id_str": "954398577379262464", + "truncated": false, + "retweet_count": "0", + "id": "954398577379262464", + "created_at": "Fri Jan 19 17:02:07 +0000 2018", + "favorited": false, + "full_text": "RT @AaronFriel: @seldo Scarfipodes", + "lang": "es" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954398413046493185" + ], + "editableUntil": "2018-01-19T18:01:28.192Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "cara esten", + "screen_name": "esten", + "indices": [ + "0", + "6" + ], + "id_str": "1108462281237520384", + "id": "1108462281237520384" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "14" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "954397786748813312", + "id_str": "954398413046493185", + "in_reply_to_user_id": "15374401", + "truncated": false, + "retweet_count": "1", + "id": "954398413046493185", + "in_reply_to_status_id": "954397786748813312", + "created_at": "Fri Jan 19 17:01:28 +0000 2018", + "favorited": false, + "full_text": "@esten Scarfae", + "lang": "und", + "in_reply_to_screen_name": "caraesten", + "in_reply_to_user_id_str": "15374401" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954396881374687232" + ], + "editableUntil": "2018-01-19T17:55:23.013Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "25" + ], + "favorite_count": "2", + "id_str": "954396881374687232", + "truncated": false, + "retweet_count": "0", + "id": "954396881374687232", + "created_at": "Fri Jan 19 16:55:23 +0000 2018", + "favorited": false, + "full_text": "The plural of \"scarf\" is:", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954394916255252480" + ], + "editableUntil": "2018-01-19T17:47:34.492Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Scott 🐗 Trinh", + "screen_name": "scotttrinh", + "indices": [ + "0", + "11" + ], + "id_str": "2438625889", + "id": "2438625889" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "12", + "19" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "118" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954393992204115968", + "id_str": "954394916255252480", + "in_reply_to_user_id": "2438625889", + "truncated": false, + "retweet_count": "0", + "id": "954394916255252480", + "in_reply_to_status_id": "954393992204115968", + "created_at": "Fri Jan 19 16:47:34 +0000 2018", + "favorited": false, + "full_text": "@scotttrinh @sebmck I've tried them but last I checked they share cookies across containers, which defeats my purpose.", + "lang": "en", + "in_reply_to_screen_name": "scotttrinh", + "in_reply_to_user_id_str": "2438625889" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954390934715691008" + ], + "editableUntil": "2018-01-19T17:31:45.219Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sven Haster", + "screen_name": "BuurmanSven", + "indices": [ + "0", + "12" + ], + "id_str": "352956496", + "id": "352956496" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "13", + "23" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [ + { + "url": "https://t.co/EltC4V8fVT", + "expanded_url": "http://blog.npmjs.org/post/143451680695/how-many-npm-users-are-there", + "display_url": "blog.npmjs.org/post/143451680…", + "indices": [ + "80", + "103" + ] + } + ] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954390625163665411", + "id_str": "954390934715691008", + "in_reply_to_user_id": "352956496", + "truncated": false, + "retweet_count": "0", + "id": "954390934715691008", + "in_reply_to_status_id": "954390625163665411", + "possibly_sensitive": false, + "created_at": "Fri Jan 19 16:31:45 +0000 2018", + "favorited": false, + "full_text": "@BuurmanSven @IgorMinar Ugh, did I fail to paste the link? I'm home sick today. https://t.co/EltC4V8fVT", + "lang": "en", + "in_reply_to_screen_name": "BuurmanSven", + "in_reply_to_user_id_str": "352956496" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954372505468207104" + ], + "editableUntil": "2018-01-19T16:18:31.344Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "J. A. Guerrero-Saade", + "screen_name": "juanandres_gs", + "indices": [ + "3", + "17" + ], + "id_str": "187027710", + "id": "187027710" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "131" + ], + "favorite_count": "0", + "id_str": "954372505468207104", + "truncated": false, + "retweet_count": "0", + "id": "954372505468207104", + "created_at": "Fri Jan 19 15:18:31 +0000 2018", + "favorited": false, + "full_text": "RT @juanandres_gs: The most unrealistic part of the 1995 movie Hackers is that they noticed the intrusion the day it was happening.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954368162522214401" + ], + "editableUntil": "2018-01-19T16:01:15.905Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "116" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954367783076208640", + "id_str": "954368162522214401", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954368162522214401", + "in_reply_to_status_id": "954367783076208640", + "created_at": "Fri Jan 19 15:01:15 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar Here's a post about how we arrived at that number (when it was lower) and why the error bars are so high.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954367783076208640" + ], + "editableUntil": "2018-01-19T15:59:45.438Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "254" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954365883056504832", + "id_str": "954367783076208640", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "954367783076208640", + "in_reply_to_status_id": "954365883056504832", + "created_at": "Fri Jan 19 14:59:45 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar It's in the region of 10-12 million users, and it's roughly doubled in the last year. It's very very tricky to estimate how many users npm has because most users aren't logged in when they download, and IPs and users don't entirely correspond.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954367333690044416" + ], + "editableUntil": "2018-01-19T15:57:58.296Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Benedykt Dryl", + "screen_name": "benedyktdryl", + "indices": [ + "0", + "13" + ], + "id_str": "13665822", + "id": "13665822" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "144" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954283111180840960", + "id_str": "954367333690044416", + "in_reply_to_user_id": "13665822", + "truncated": false, + "retweet_count": "0", + "id": "954367333690044416", + "in_reply_to_status_id": "954283111180840960", + "created_at": "Fri Jan 19 14:57:58 +0000 2018", + "favorited": false, + "full_text": "@benedyktdryl I'm not saying we couldn't do better, but we do have a mechanism by which people can and do successfully contribute PRs and fixes.", + "lang": "en", + "in_reply_to_screen_name": "benedyktdryl", + "in_reply_to_user_id_str": "13665822" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954364295931838465" + ], + "editableUntil": "2018-01-19T15:45:54.038Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "954197347151433728", + "id_str": "954364295931838465", + "in_reply_to_user_id": "290549888", + "truncated": false, + "retweet_count": "0", + "id": "954364295931838465", + "in_reply_to_status_id": "954197347151433728", + "created_at": "Fri Jan 19 14:45:54 +0000 2018", + "favorited": false, + "full_text": "@sebmck I did. I miss having multiple profiles, but the speed is keeping me on FF.", + "lang": "en", + "in_reply_to_screen_name": "sebmck", + "in_reply_to_user_id_str": "290549888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954362082010349569" + ], + "editableUntil": "2018-01-19T15:37:06.198Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "𝕃𝕚𝕡𝕚𝕤", + "screen_name": "Lipis", + "indices": [ + "0", + "6" + ], + "id_str": "14112788", + "id": "14112788" + }, + { + "name": "Sindre Sorhus", + "screen_name": "sindresorhus", + "indices": [ + "7", + "20" + ], + "id_str": "170686450", + "id": "170686450" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "954361917396738048", + "id_str": "954362082010349569", + "in_reply_to_user_id": "14112788", + "truncated": false, + "retweet_count": "0", + "id": "954362082010349569", + "in_reply_to_status_id": "954361917396738048", + "created_at": "Fri Jan 19 14:37:06 +0000 2018", + "favorited": false, + "full_text": "@Lipis @sindresorhus Lots and lots.", + "lang": "en", + "in_reply_to_screen_name": "Lipis", + "in_reply_to_user_id_str": "14112788" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954184834481471488" + ], + "editableUntil": "2018-01-19T03:52:47.094Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Not Important", + "screen_name": "mlafleur", + "indices": [ + "0", + "9" + ], + "id_str": "16152516", + "id": "16152516" + }, + { + "name": "VJ", + "screen_name": "andrewvijay", + "indices": [ + "10", + "22" + ], + "id_str": "88160292", + "id": "88160292" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "214" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954175402632728576", + "id_str": "954184834481471488", + "in_reply_to_user_id": "16152516", + "truncated": false, + "retweet_count": "0", + "id": "954184834481471488", + "in_reply_to_status_id": "954175402632728576", + "created_at": "Fri Jan 19 02:52:47 +0000 2018", + "favorited": false, + "full_text": "@mlafleur @andrewvijay Plugin models were a pretty established pattern; I don't think jQuery's was particularly influential. I'm told Dojo's module pattern influenced early design thinking on JavaScript modularity.", + "lang": "en", + "in_reply_to_screen_name": "mlafleur", + "in_reply_to_user_id_str": "16152516" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954133302927024128" + ], + "editableUntil": "2018-01-19T00:28:01.014Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andrew Betts", + "screen_name": "triblondon", + "indices": [ + "0", + "11" + ], + "id_str": "7311232", + "id": "7311232" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "115" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954132536053125120", + "id_str": "954133302927024128", + "in_reply_to_user_id": "7311232", + "truncated": false, + "retweet_count": "0", + "id": "954133302927024128", + "in_reply_to_status_id": "954132536053125120", + "created_at": "Thu Jan 18 23:28:01 +0000 2018", + "favorited": false, + "full_text": "@triblondon I think demolition companies are still construction companies in a \"-1 is also an integer\" kind of way.", + "lang": "en", + "in_reply_to_screen_name": "triblondon", + "in_reply_to_user_id_str": "7311232" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954133011590598656" + ], + "editableUntil": "2018-01-19T00:26:51.554Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "case", + "screen_name": "CaseSandberg", + "indices": [ + "3", + "16" + ], + "id_str": "20654202", + "id": "20654202" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/CaseSandberg/status/954121572071104512/photo/1", + "source_status_id": "954121572071104512", + "indices": [ + "52", + "75" + ], + "url": "https://t.co/HvWIc7QnwH", + "media_url": "http://pbs.twimg.com/media/DT24fslVAAAttMi.jpg", + "id_str": "954121550755594240", + "source_user_id": "20654202", + "id": "954121550755594240", + "media_url_https": "https://pbs.twimg.com/media/DT24fslVAAAttMi.jpg", + "source_user_id_str": "20654202", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "954121572071104512", + "display_url": "pic.twitter.com/HvWIc7QnwH" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "75" + ], + "favorite_count": "0", + "id_str": "954133011590598656", + "truncated": false, + "retweet_count": "0", + "id": "954133011590598656", + "possibly_sensitive": false, + "created_at": "Thu Jan 18 23:26:51 +0000 2018", + "favorited": false, + "full_text": "RT @CaseSandberg: EVERYONE MEET HAZEL, MY NEW DOG 🐕 https://t.co/HvWIc7QnwH", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/CaseSandberg/status/954121572071104512/photo/1", + "source_status_id": "954121572071104512", + "indices": [ + "52", + "75" + ], + "url": "https://t.co/HvWIc7QnwH", + "media_url": "http://pbs.twimg.com/media/DT24fslVAAAttMi.jpg", + "id_str": "954121550755594240", + "source_user_id": "20654202", + "id": "954121550755594240", + "media_url_https": "https://pbs.twimg.com/media/DT24fslVAAAttMi.jpg", + "source_user_id_str": "20654202", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "954121572071104512", + "display_url": "pic.twitter.com/HvWIc7QnwH" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954132827854880768" + ], + "editableUntil": "2018-01-19T00:26:07.748Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "case", + "screen_name": "CaseSandberg", + "indices": [ + "0", + "13" + ], + "id_str": "20654202", + "id": "20654202" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954121934806986752", + "id_str": "954132827854880768", + "in_reply_to_user_id": "20654202", + "truncated": false, + "retweet_count": "0", + "id": "954132827854880768", + "in_reply_to_status_id": "954121934806986752", + "created_at": "Thu Jan 18 23:26:07 +0000 2018", + "favorited": false, + "full_text": "@CaseSandberg EEEEEEEEEEEEEEEEEEEE", + "lang": "und", + "in_reply_to_screen_name": "CaseSandberg", + "in_reply_to_user_id_str": "20654202" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954113422894903296" + ], + "editableUntil": "2018-01-18T23:09:01.245Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "case", + "screen_name": "CaseSandberg", + "indices": [ + "0", + "13" + ], + "id_str": "20654202", + "id": "20654202" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "31" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954112282782449665", + "id_str": "954113422894903296", + "in_reply_to_user_id": "20654202", + "truncated": false, + "retweet_count": "0", + "id": "954113422894903296", + "in_reply_to_status_id": "954112282782449665", + "created_at": "Thu Jan 18 22:09:01 +0000 2018", + "favorited": false, + "full_text": "@CaseSandberg MOAR DOG PICTURES", + "lang": "en", + "in_reply_to_screen_name": "CaseSandberg", + "in_reply_to_user_id_str": "20654202" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954112951329280000" + ], + "editableUntil": "2018-01-18T23:07:08.815Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "VJ", + "screen_name": "andrewvijay", + "indices": [ + "0", + "12" + ], + "id_str": "88160292", + "id": "88160292" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "216" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "954084701169360896", + "id_str": "954112951329280000", + "in_reply_to_user_id": "88160292", + "truncated": false, + "retweet_count": "1", + "id": "954112951329280000", + "in_reply_to_status_id": "954084701169360896", + "created_at": "Thu Jan 18 22:07:08 +0000 2018", + "favorited": false, + "full_text": "@andrewvijay In JavaScript? It wasn't. npm and several other package managers were all invented around the same time (2008/2009) and npm became the most popular. Prior to that modular JavaScript was not very popular.", + "lang": "en", + "in_reply_to_screen_name": "andrewvijay", + "in_reply_to_user_id_str": "88160292" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954112628028096513" + ], + "editableUntil": "2018-01-18T23:05:51.734Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "kat", + "screen_name": "maybekatz", + "indices": [ + "0", + "10" + ], + "id_str": "1199492153832902658", + "id": "1199492153832902658" + }, + { + "name": "Thomas Jensen 🇪🇺🇩🇰", + "screen_name": "tjconceptdk", + "indices": [ + "11", + "23" + ], + "id_str": "33298151", + "id": "33298151" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "24", + "30" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "233" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954106010456608768", + "id_str": "954112628028096513", + "in_reply_to_user_id": "2978661890", + "truncated": false, + "retweet_count": "0", + "id": "954112628028096513", + "in_reply_to_status_id": "954106010456608768", + "created_at": "Thu Jan 18 22:05:51 +0000 2018", + "favorited": false, + "full_text": "@maybekatz @tjconceptdk @npmjs It hasn't affected download counts very much because the same number of actual packages are downloaded (mostly by CI, mostly not cached). But request volume (bandwidth from us) has definitely gone down.", + "lang": "en", + "in_reply_to_screen_name": "zkat__", + "in_reply_to_user_id_str": "2978661890" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954112393277091841" + ], + "editableUntil": "2018-01-18T23:04:55.765Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sam", + "screen_name": "sjransom", + "indices": [ + "0", + "9" + ], + "id_str": "2187247891", + "id": "2187247891" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "954100725826707458", + "id_str": "954112393277091841", + "in_reply_to_user_id": "2187247891", + "truncated": false, + "retweet_count": "1", + "id": "954112393277091841", + "in_reply_to_status_id": "954100725826707458", + "created_at": "Thu Jan 18 22:04:55 +0000 2018", + "favorited": false, + "full_text": "@sjransom npm started in 2008; npm Inc. not until 2014.", + "lang": "en", + "in_reply_to_screen_name": "sjransom", + "in_reply_to_user_id_str": "2187247891" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954081838279966720" + ], + "editableUntil": "2018-01-18T21:03:30.886Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Aaron P Blohowiak", + "screen_name": "aaronblohowiak", + "indices": [ + "0", + "15" + ], + "id_str": "7142142", + "id": "7142142" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954081534415269888", + "id_str": "954081838279966720", + "in_reply_to_user_id": "7142142", + "truncated": false, + "retweet_count": "0", + "id": "954081838279966720", + "in_reply_to_status_id": "954081534415269888", + "created_at": "Thu Jan 18 20:03:30 +0000 2018", + "favorited": false, + "full_text": "@aaronblohowiak Is it? It's just robots doing what robots do best.", + "lang": "en", + "in_reply_to_screen_name": "aaronblohowiak", + "in_reply_to_user_id_str": "7142142" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954080825817030656" + ], + "editableUntil": "2018-01-18T20:59:29.496Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Aaron P Blohowiak", + "screen_name": "aaronblohowiak", + "indices": [ + "0", + "15" + ], + "id_str": "7142142", + "id": "7142142" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "186" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "954079051609600000", + "id_str": "954080825817030656", + "in_reply_to_user_id": "7142142", + "truncated": false, + "retweet_count": "0", + "id": "954080825817030656", + "in_reply_to_status_id": "954079051609600000", + "created_at": "Thu Jan 18 19:59:29 +0000 2018", + "favorited": false, + "full_text": "@aaronblohowiak The average project has 1000 packages, and lots of companies do CI, so every commit generates a full (uncached, because fresh VM) project download, dozens of times a day.", + "lang": "en", + "in_reply_to_screen_name": "aaronblohowiak", + "in_reply_to_user_id_str": "7142142" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954077076524490752" + ], + "editableUntil": "2018-01-18T20:44:35.595Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/cWfnwzvQBg", + "expanded_url": "https://www.seldemo.com", + "display_url": "seldemo.com", + "indices": [ + "78", + "101" + ] + }, + { + "url": "https://t.co/dTGXWIDkxt", + "expanded_url": "http://seldo.com", + "display_url": "seldo.com", + "indices": [ + "107", + "130" + ] + } + ] + }, + "display_text_range": [ + "0", + "132" + ], + "favorite_count": "15", + "in_reply_to_status_id_str": "953694432934576128", + "id_str": "954077076524490752", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "954077076524490752", + "in_reply_to_status_id": "953694432934576128", + "possibly_sensitive": false, + "created_at": "Thu Jan 18 19:44:35 +0000 2018", + "favorited": false, + "full_text": "MYSTERY SOLVED: the company's name is \"Selective Demolition\", their domain is https://t.co/cWfnwzvQBg (not https://t.co/dTGXWIDkxt).", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954076294383153152" + ], + "editableUntil": "2018-01-18T20:41:29.118Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Aaron P Blohowiak", + "screen_name": "aaronblohowiak", + "indices": [ + "0", + "15" + ], + "id_str": "7142142", + "id": "7142142" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "92" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954075544349323264", + "id_str": "954076294383153152", + "in_reply_to_user_id": "7142142", + "truncated": false, + "retweet_count": "0", + "id": "954076294383153152", + "in_reply_to_status_id": "954075544349323264", + "created_at": "Thu Jan 18 19:41:29 +0000 2018", + "favorited": false, + "full_text": "@aaronblohowiak On a per-user basis it's only 60 packages. We just have a shit-ton of users.", + "lang": "en", + "in_reply_to_screen_name": "aaronblohowiak", + "in_reply_to_user_id_str": "7142142" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954074605672587264" + ], + "editableUntil": "2018-01-18T20:34:46.498Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ꓕꓤꓱꓭꓳꓠ", + "screen_name": "nobert", + "indices": [ + "0", + "7" + ], + "id_str": "917368036746825728", + "id": "917368036746825728" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "33" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954074267993325569", + "id_str": "954074605672587264", + "in_reply_to_user_id": "14861000", + "truncated": false, + "retweet_count": "0", + "id": "954074605672587264", + "in_reply_to_status_id": "954074267993325569", + "created_at": "Thu Jan 18 19:34:46 +0000 2018", + "favorited": false, + "full_text": "@nobert Definitely release order.", + "lang": "en", + "in_reply_to_user_id_str": "14861000" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954073631646130176" + ], + "editableUntil": "2018-01-18T20:30:54.272Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "122" + ], + "favorite_count": "83", + "in_reply_to_status_id_str": "954068787187171328", + "id_str": "954073631646130176", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "11", + "id": "954073631646130176", + "in_reply_to_status_id": "954068787187171328", + "created_at": "Thu Jan 18 19:30:54 +0000 2018", + "favorited": false, + "full_text": "If you're wondering what npm's engineers do all day, it's \"constantly rebuild the rocket ship while it remains in flight\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954068787187171328" + ], + "editableUntil": "2018-01-18T20:11:39.263Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "163" + ], + "favorite_count": "330", + "id_str": "954068787187171328", + "truncated": false, + "retweet_count": "112", + "id": "954068787187171328", + "created_at": "Thu Jan 18 19:11:39 +0000 2018", + "favorited": false, + "full_text": "npm users downloaded 7 hundred million packages yesterday, a new record. When npm Inc. started in 2014, that was how many packages were downloaded in a whole year.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954048495073222658" + ], + "editableUntil": "2018-01-18T18:51:01.246Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@wraithan@mastodon.art", + "screen_name": "Wraithan", + "indices": [ + "3", + "12" + ], + "id_str": "14220560", + "id": "14220560" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "19", + "25" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "0", + "id_str": "954048495073222658", + "truncated": false, + "retweet_count": "0", + "id": "954048495073222658", + "created_at": "Thu Jan 18 17:51:01 +0000 2018", + "favorited": false, + "full_text": "RT @Wraithan: Ugh, @npmjs finished installing all my deps before I could finish taking a drink of coffee. What happen to the good old days…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954032911824576512" + ], + "editableUntil": "2018-01-18T17:49:05.910Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "webinista dot com", + "screen_name": "webinista", + "indices": [ + "0", + "10" + ], + "id_str": "14197043", + "id": "14197043" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "136" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "954032247761285120", + "id_str": "954032911824576512", + "in_reply_to_user_id": "14197043", + "truncated": false, + "retweet_count": "0", + "id": "954032911824576512", + "in_reply_to_status_id": "954032247761285120", + "created_at": "Thu Jan 18 16:49:05 +0000 2018", + "favorited": false, + "full_text": "@webinista I am beyond understanding how any women voted for him in the first place, so I can't imagine what would lose him their votes.", + "lang": "en", + "in_reply_to_screen_name": "webinista", + "in_reply_to_user_id_str": "14197043" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954031049855574016" + ], + "editableUntil": "2018-01-18T17:41:41.982Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "169" + ], + "favorite_count": "76", + "id_str": "954031049855574016", + "truncated": false, + "retweet_count": "3", + "id": "954031049855574016", + "created_at": "Thu Jan 18 16:41:41 +0000 2018", + "favorited": false, + "full_text": "Does anyone really think people who voted for Trump after he bragged about assaulting women will be anything less than actively impressed that he slept with a porn star?", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954011438309232640" + ], + "editableUntil": "2018-01-18T16:23:46.225Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sean McLellan", + "screen_name": "Oceanswave", + "indices": [ + "0", + "11" + ], + "id_str": "192434012", + "id": "192434012" + }, + { + "name": "Apple", + "screen_name": "Apple", + "indices": [ + "12", + "18" + ], + "id_str": "380749300", + "id": "380749300" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "220" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "954009737984606210", + "id_str": "954011438309232640", + "in_reply_to_user_id": "192434012", + "truncated": false, + "retweet_count": "0", + "id": "954011438309232640", + "in_reply_to_status_id": "954009737984606210", + "created_at": "Thu Jan 18 15:23:46 +0000 2018", + "favorited": false, + "full_text": "@Oceanswave @Apple The reason it was so large was because they (and others) parked the money overseas for years until the tax rate was reduced. If they'd paid every year instead of waiting they'd have paid twice as much.", + "lang": "en", + "in_reply_to_screen_name": "Oceanswave", + "in_reply_to_user_id_str": "192434012" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "954007275882004480" + ], + "editableUntil": "2018-01-18T16:07:13.825Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tom Rowan (MW0KKR)", + "screen_name": "tomrowan", + "indices": [ + "0", + "9" + ], + "id_str": "14177212", + "id": "14177212" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "65" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953931984031625216", + "id_str": "954007275882004480", + "in_reply_to_user_id": "14177212", + "truncated": false, + "retweet_count": "0", + "id": "954007275882004480", + "in_reply_to_status_id": "953931984031625216", + "created_at": "Thu Jan 18 15:07:13 +0000 2018", + "favorited": false, + "full_text": "@tomrowan They are jpegs, so my phone email client displays them.", + "lang": "en", + "in_reply_to_screen_name": "tomrowan", + "in_reply_to_user_id_str": "14177212" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953885675119566848" + ], + "editableUntil": "2018-01-18T08:04:01.944Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jan Lehnardt is on Mastodon: @janl@narrativ.es", + "screen_name": "janl", + "indices": [ + "0", + "5" + ], + "id_str": "819606", + "id": "819606" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "115" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953883121669361664", + "id_str": "953885675119566848", + "in_reply_to_user_id": "819606", + "truncated": false, + "retweet_count": "0", + "id": "953885675119566848", + "in_reply_to_status_id": "953883121669361664", + "created_at": "Thu Jan 18 07:04:01 +0000 2018", + "favorited": false, + "full_text": "@janl They've been sitting on it for 8 years. It would have been twice as much if they'd brought it in under Obama.", + "lang": "en", + "in_reply_to_screen_name": "janl", + "in_reply_to_user_id_str": "819606" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953885396143767552" + ], + "editableUntil": "2018-01-18T08:02:55.431Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Justin Wolfers", + "screen_name": "JustinWolfers", + "indices": [ + "3", + "17" + ], + "id_str": "327577091", + "id": "327577091" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "953885396143767552", + "truncated": false, + "retweet_count": "0", + "id": "953885396143767552", + "created_at": "Thu Jan 18 07:02:55 +0000 2018", + "favorited": false, + "full_text": "RT @JustinWolfers: Hard to know who to blame: The Republican House, the Republican Senate, or the Republican White House. https://t.co/NZpK…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953882534554648576" + ], + "editableUntil": "2018-01-18T07:51:33.175Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lachlan Campbell", + "screen_name": "lachlanjc", + "indices": [ + "0", + "10" + ], + "id_str": "2464774904", + "id": "2464774904" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "11", + "17" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "131" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953881538848002048", + "id_str": "953882534554648576", + "in_reply_to_user_id": "2464774904", + "truncated": false, + "retweet_count": "0", + "id": "953882534554648576", + "in_reply_to_status_id": "953881538848002048", + "created_at": "Thu Jan 18 06:51:33 +0000 2018", + "favorited": false, + "full_text": "@lachlanjc @npmjs Hmm. It's probably not that big by the standards of these things, but I'm not sure how to calculate such a thing.", + "lang": "en", + "in_reply_to_screen_name": "lachlanjc", + "in_reply_to_user_id_str": "2464774904" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953867747540140033" + ], + "editableUntil": "2018-01-18T06:52:47.676Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "Apple", + "screen_name": "Apple", + "indices": [ + "23", + "29" + ], + "id_str": "380749300", + "id": "380749300" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953867747540140033/photo/1", + "indices": [ + "110", + "133" + ], + "url": "https://t.co/WK7tOE7PMq", + "media_url": "http://pbs.twimg.com/media/DTzRiVhUMAAOYFE.jpg", + "id_str": "953867608918339584", + "id": "953867608918339584", + "media_url_https": "https://pbs.twimg.com/media/DTzRiVhUMAAOYFE.jpg", + "sizes": { + "medium": { + "w": "585", + "h": "209", + "resize": "fit" + }, + "small": { + "w": "585", + "h": "209", + "resize": "fit" + }, + "large": { + "w": "585", + "h": "209", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/WK7tOE7PMq" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "133" + ], + "favorite_count": "147", + "id_str": "953867747540140033", + "truncated": false, + "retweet_count": "33", + "id": "953867747540140033", + "possibly_sensitive": false, + "created_at": "Thu Jan 18 05:52:47 +0000 2018", + "favorited": false, + "full_text": "Of course, another way @Apple could make a \"direct contribution to the US economy\" would be to pay its taxes. https://t.co/WK7tOE7PMq", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953867747540140033/photo/1", + "indices": [ + "110", + "133" + ], + "url": "https://t.co/WK7tOE7PMq", + "media_url": "http://pbs.twimg.com/media/DTzRiVhUMAAOYFE.jpg", + "id_str": "953867608918339584", + "id": "953867608918339584", + "media_url_https": "https://pbs.twimg.com/media/DTzRiVhUMAAOYFE.jpg", + "sizes": { + "medium": { + "w": "585", + "h": "209", + "resize": "fit" + }, + "small": { + "w": "585", + "h": "209", + "resize": "fit" + }, + "large": { + "w": "585", + "h": "209", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/WK7tOE7PMq" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953865760434143232" + ], + "editableUntil": "2018-01-18T06:44:53.913Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "kimberlybryant.eth", + "screen_name": "6Gems", + "indices": [ + "0", + "6" + ], + "id_str": "79365337", + "id": "79365337" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "110" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "953842762624983040", + "id_str": "953865760434143232", + "in_reply_to_user_id": "79365337", + "truncated": false, + "retweet_count": "0", + "id": "953865760434143232", + "in_reply_to_status_id": "953842762624983040", + "created_at": "Thu Jan 18 05:44:53 +0000 2018", + "favorited": false, + "full_text": "@6Gems This is like, as late as it is possible to be and there still even BE a train. But happy you joined us!", + "lang": "en", + "in_reply_to_screen_name": "6Gems", + "in_reply_to_user_id_str": "79365337" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953862396208078848" + ], + "editableUntil": "2018-01-18T06:31:31.819Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "Walt", + "screen_name": "TheLastWalt", + "indices": [ + "3", + "15" + ], + "id_str": "1323666865227505664", + "id": "1323666865227505664" + }, + { + "name": "samcorb", + "screen_name": "samcorb", + "indices": [ + "17", + "25" + ], + "id_str": "20244991", + "id": "20244991" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/thelastwalt/status/952735521117151232/photo/1", + "source_status_id": "952735521117151232", + "indices": [ + "54", + "77" + ], + "url": "https://t.co/0U7z6MqiST", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTjL5Z7VwAA8lq0.jpg", + "id_str": "952735508261617664", + "source_user_id": "115837697", + "id": "952735508261617664", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTjL5Z7VwAA8lq0.jpg", + "source_user_id_str": "115837697", + "sizes": { + "large": { + "w": "498", + "h": "242", + "resize": "fit" + }, + "small": { + "w": "498", + "h": "242", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "498", + "h": "242", + "resize": "fit" + } + }, + "type": "photo", + "source_status_id_str": "952735521117151232", + "display_url": "pic.twitter.com/0U7z6MqiST" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "77" + ], + "favorite_count": "0", + "id_str": "953862396208078848", + "truncated": false, + "retweet_count": "0", + "id": "953862396208078848", + "possibly_sensitive": false, + "created_at": "Thu Jan 18 05:31:31 +0000 2018", + "favorited": false, + "full_text": "RT @thelastwalt: @samcorb CALL ME BY YOUR NAME (2017) https://t.co/0U7z6MqiST", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/thelastwalt/status/952735521117151232/photo/1", + "source_status_id": "952735521117151232", + "indices": [ + "54", + "77" + ], + "url": "https://t.co/0U7z6MqiST", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTjL5Z7VwAA8lq0.jpg", + "id_str": "952735508261617664", + "video_info": { + "aspect_ratio": [ + "249", + "121" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DTjL5Z7VwAA8lq0.mp4" + } + ] + }, + "source_user_id": "115837697", + "id": "952735508261617664", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTjL5Z7VwAA8lq0.jpg", + "source_user_id_str": "115837697", + "sizes": { + "large": { + "w": "498", + "h": "242", + "resize": "fit" + }, + "small": { + "w": "498", + "h": "242", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "498", + "h": "242", + "resize": "fit" + } + }, + "type": "animated_gif", + "source_status_id_str": "952735521117151232", + "display_url": "pic.twitter.com/0U7z6MqiST" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953829524436762625" + ], + "editableUntil": "2018-01-18T04:20:54.578Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": ".", + "screen_name": "freialobo", + "indices": [ + "0", + "10" + ], + "id_str": "278450525", + "id": "278450525" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "63" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "944816903976919040", + "id_str": "953829524436762625", + "in_reply_to_user_id": "278450525", + "truncated": false, + "retweet_count": "0", + "id": "953829524436762625", + "in_reply_to_status_id": "944816903976919040", + "created_at": "Thu Jan 18 03:20:54 +0000 2018", + "favorited": false, + "full_text": "@freialobo I am now at this movie because you told me about it.", + "lang": "en", + "in_reply_to_screen_name": "freialobo", + "in_reply_to_user_id_str": "278450525" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953729112379596800" + ], + "editableUntil": "2018-01-17T21:41:54.478Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "0", + "11" + ], + "id_str": "622960227", + "id": "622960227" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "12", + "19" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "78" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "953727933054636032", + "id_str": "953729112379596800", + "in_reply_to_user_id": "622960227", + "truncated": false, + "retweet_count": "0", + "id": "953729112379596800", + "in_reply_to_status_id": "953727933054636032", + "created_at": "Wed Jan 17 20:41:54 +0000 2018", + "favorited": false, + "full_text": "@bitandbang @sebmck I'm waiting for the first person to not think it's a joke.", + "lang": "en", + "in_reply_to_screen_name": "bitandbang", + "in_reply_to_user_id_str": "622960227" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953728833722531840" + ], + "editableUntil": "2018-01-17T21:40:48.041Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "YouTube TV", + "screen_name": "YouTubeTV", + "indices": [ + "8", + "18" + ], + "id_str": "803263807489536000", + "id": "803263807489536000" + }, + { + "name": "Hulu", + "screen_name": "hulu", + "indices": [ + "19", + "24" + ], + "id_str": "15033883", + "id": "15033883" + } + ], + "urls": [ + { + "url": "https://t.co/IQvOjuSyRC", + "expanded_url": "https://www.sling.com", + "display_url": "sling.com", + "indices": [ + "29", + "52" + ] + } + ] + }, + "display_text_range": [ + "0", + "52" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953722865035001856", + "id_str": "953728833722531840", + "in_reply_to_user_id": "290549888", + "truncated": false, + "retweet_count": "0", + "id": "953728833722531840", + "in_reply_to_status_id": "953722865035001856", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 20:40:48 +0000 2018", + "favorited": false, + "full_text": "@sebmck @YouTubeTV @hulu Try https://t.co/IQvOjuSyRC", + "lang": "und", + "in_reply_to_screen_name": "sebmck", + "in_reply_to_user_id_str": "290549888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953704189716148224" + ], + "editableUntil": "2018-01-17T20:02:52.452Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "23" + ], + "favorite_count": "59", + "id_str": "953704189716148224", + "truncated": false, + "retweet_count": "9", + "id": "953704189716148224", + "created_at": "Wed Jan 17 19:02:52 +0000 2018", + "favorited": false, + "full_text": "SELL BITCOIN\nBUY TULIPS", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953702209371324416" + ], + "editableUntil": "2018-01-17T19:55:00.301Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@LittleMxSurly@yharnam.singles", + "screen_name": "LittleMxSurly", + "indices": [ + "0", + "14" + ], + "id_str": "22009627", + "id": "22009627" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "18" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953702079972884481", + "id_str": "953702209371324416", + "in_reply_to_user_id": "22009627", + "truncated": false, + "retweet_count": "0", + "id": "953702209371324416", + "in_reply_to_status_id": "953702079972884481", + "created_at": "Wed Jan 17 18:55:00 +0000 2018", + "favorited": false, + "full_text": "@LittleMxSurly wat", + "lang": "und", + "in_reply_to_screen_name": "LittleMxSurly", + "in_reply_to_user_id_str": "22009627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953701725138862080" + ], + "editableUntil": "2018-01-17T19:53:04.851Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Malte Ubl", + "screen_name": "cramforce", + "indices": [ + "3", + "13" + ], + "id_str": "15534471", + "id": "15534471" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "953701725138862080", + "truncated": false, + "retweet_count": "0", + "id": "953701725138862080", + "created_at": "Wed Jan 17 18:53:04 +0000 2018", + "favorited": false, + "full_text": "RT @cramforce: 💥 OMG biggest news in web performance in, like, a decade:\n\nTechnology independent performance based ranking in Google Search…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953699835923726337" + ], + "editableUntil": "2018-01-17T19:45:34.427Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "AZIZUL HAKIM", + "screen_name": "_Azzy23", + "indices": [ + "0", + "8" + ], + "id_str": "1604363425555283970", + "id": "1604363425555283970" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953698576592326656", + "id_str": "953699835923726337", + "in_reply_to_user_id": "310038791", + "truncated": false, + "retweet_count": "0", + "id": "953699835923726337", + "in_reply_to_status_id": "953698576592326656", + "created_at": "Wed Jan 17 18:45:34 +0000 2018", + "favorited": false, + "full_text": "@_azzy23 IS THE PASSWORD WARGAMES+2? OMG.", + "lang": "en", + "in_reply_to_screen_name": "gottbach", + "in_reply_to_user_id_str": "310038791" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953699374021853184" + ], + "editableUntil": "2018-01-17T19:43:44.301Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953699374021853184/photo/1", + "indices": [ + "91", + "114" + ], + "url": "https://t.co/YJNiEQTumZ", + "media_url": "http://pbs.twimg.com/media/DTw4c78VAAAvZCt.jpg", + "id_str": "953699290873921536", + "id": "953699290873921536", + "media_url_https": "https://pbs.twimg.com/media/DTw4c78VAAAvZCt.jpg", + "sizes": { + "large": { + "w": "387", + "h": "448", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "387", + "h": "448", + "resize": "fit" + }, + "small": { + "w": "387", + "h": "448", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/YJNiEQTumZ" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "114" + ], + "favorite_count": "35", + "in_reply_to_status_id_str": "953428532826263553", + "id_str": "953699374021853184", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "953699374021853184", + "in_reply_to_status_id": "953428532826263553", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 18:43:44 +0000 2018", + "favorited": false, + "full_text": "I hate to say I told you so... oh wait, no, that's not right. I LOVE to say I told you so. https://t.co/YJNiEQTumZ", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953699374021853184/photo/1", + "indices": [ + "91", + "114" + ], + "url": "https://t.co/YJNiEQTumZ", + "media_url": "http://pbs.twimg.com/media/DTw4c78VAAAvZCt.jpg", + "id_str": "953699290873921536", + "id": "953699290873921536", + "media_url_https": "https://pbs.twimg.com/media/DTw4c78VAAAvZCt.jpg", + "sizes": { + "large": { + "w": "387", + "h": "448", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "387", + "h": "448", + "resize": "fit" + }, + "small": { + "w": "387", + "h": "448", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/YJNiEQTumZ" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953696117333532673" + ], + "editableUntil": "2018-01-17T19:30:47.846Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "207" + ], + "favorite_count": "15", + "in_reply_to_status_id_str": "953695322718355456", + "id_str": "953696117333532673", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "953696117333532673", + "in_reply_to_status_id": "953695322718355456", + "created_at": "Wed Jan 17 18:30:47 +0000 2018", + "favorited": false, + "full_text": "Cities across America competed to utterly fuck themselves by giving Amazon a massive tax break to bring jobs and people without commensurate funds to build the infrastructure they would need to support them.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953695701472432128" + ], + "editableUntil": "2018-01-17T19:29:08.697Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "53" + ], + "favorite_count": "27", + "in_reply_to_status_id_str": "953695640948703232", + "id_str": "953695701472432128", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "953695701472432128", + "in_reply_to_status_id": "953695640948703232", + "created_at": "Wed Jan 17 18:29:08 +0000 2018", + "favorited": false, + "full_text": "@sebmck Oh man am I going to get in trouble for this.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953695640948703232" + ], + "editableUntil": "2018-01-17T19:28:54.267Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "113" + ], + "favorite_count": "63", + "in_reply_to_status_id_str": "953695261070565376", + "id_str": "953695640948703232", + "in_reply_to_user_id": "290549888", + "truncated": false, + "retweet_count": "2", + "id": "953695640948703232", + "in_reply_to_status_id": "953695261070565376", + "created_at": "Wed Jan 17 18:28:54 +0000 2018", + "favorited": false, + "full_text": "@sebmck They don't take orders from me, they just keep asking me to pay them. It's like open source contributors.", + "lang": "en", + "in_reply_to_screen_name": "sebmck", + "in_reply_to_user_id_str": "290549888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953695322718355456" + ], + "editableUntil": "2018-01-17T19:27:38.395Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/llsL53h1Mx", + "expanded_url": "https://twitter.com/ap/status/953694190117978113", + "display_url": "twitter.com/ap/status/9536…", + "indices": [ + "80", + "103" + ] + } + ] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "24", + "id_str": "953695322718355456", + "truncated": false, + "retweet_count": "1", + "id": "953695322718355456", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 18:27:38 +0000 2018", + "favorited": false, + "full_text": "Are they going to do another nationwide municipal death match, like Amazon did? https://t.co/llsL53h1Mx", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953694432934576128" + ], + "editableUntil": "2018-01-17T19:24:06.254Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "163" + ], + "favorite_count": "20", + "in_reply_to_status_id_str": "953694024560340997", + "id_str": "953694432934576128", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "953694432934576128", + "in_reply_to_status_id": "953694024560340997", + "created_at": "Wed Jan 17 18:24:06 +0000 2018", + "favorited": false, + "full_text": "I can set up a filter but I'm genuinely worried that a bunch of construction workers are going to go unpaid or get fired for not filing their time sheets properly.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953694024560340997" + ], + "editableUntil": "2018-01-17T19:22:28.890Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "188" + ], + "favorite_count": "64", + "id_str": "953694024560340997", + "truncated": false, + "retweet_count": "1", + "id": "953694024560340997", + "created_at": "Wed Jan 17 18:22:28 +0000 2018", + "favorited": false, + "full_text": "A construction company somewhere in America has made a typo and now all their employees are emailing me copies of their time sheets to be filed. My replies asking them to stop are ignored.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953691206906650624" + ], + "editableUntil": "2018-01-17T19:11:17.109Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "54" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "953668006734848000", + "id_str": "953691206906650624", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "953691206906650624", + "in_reply_to_status_id": "953668006734848000", + "created_at": "Wed Jan 17 18:11:17 +0000 2018", + "favorited": false, + "full_text": "Shout out to all my French speaking gym bro followers.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953690858792001536" + ], + "editableUntil": "2018-01-17T19:09:54.112Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/hpwaXUR9gu", + "expanded_url": "http://www.civilbeat.org/2018/01/hawaii-distributed-phony-image-of-missile-warning-screen/", + "display_url": "civilbeat.org/2018/01/hawaii…", + "indices": [ + "80", + "103" + ] + } + ] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "6", + "id_str": "953690858792001536", + "truncated": false, + "retweet_count": "3", + "id": "953690858792001536", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 18:09:54 +0000 2018", + "favorited": false, + "full_text": "What I'm getting out of this is that Hawaii's government is kind of clown shoes https://t.co/hpwaXUR9gu", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953668006734848000" + ], + "editableUntil": "2018-01-17T17:39:05.757Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "9", + "id_str": "953668006734848000", + "truncated": false, + "retweet_count": "0", + "id": "953668006734848000", + "created_at": "Wed Jan 17 16:39:05 +0000 2018", + "favorited": false, + "full_text": "Je ne regrette rien sauf 💀 le jour de la jambe 💀", + "lang": "fr" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953646332568219648" + ], + "editableUntil": "2018-01-17T16:12:58.233Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "223" + ], + "favorite_count": "22", + "id_str": "953646332568219648", + "truncated": false, + "retweet_count": "1", + "id": "953646332568219648", + "created_at": "Wed Jan 17 15:12:58 +0000 2018", + "favorited": false, + "full_text": "If Trump lying about his weight brings up too many complicated issues for you, he is also lying about how tall he is. Can we agree that lying about how tall we can directly see he is is a petty and embarrassing thing to do?", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953645702822871040" + ], + "editableUntil": "2018-01-17T16:10:28.090Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Richard Littauer", + "screen_name": "richlitt", + "indices": [ + "0", + "9" + ], + "id_str": "118133101", + "id": "118133101" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "202" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953644822295965697", + "id_str": "953645702822871040", + "in_reply_to_user_id": "118133101", + "truncated": false, + "retweet_count": "0", + "id": "953645702822871040", + "in_reply_to_status_id": "953644822295965697", + "created_at": "Wed Jan 17 15:10:28 +0000 2018", + "favorited": false, + "full_text": "@richlitt Abramson isn't *wrong*, factually. He just presents a seductive but incorrect impression of a White House that is going to collapse any minute now. I don't believe his take on things any more.", + "lang": "en", + "in_reply_to_screen_name": "richlitt", + "in_reply_to_user_id_str": "118133101" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953644179812376576" + ], + "editableUntil": "2018-01-17T16:04:24.976Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andrew Betts", + "screen_name": "triblondon", + "indices": [ + "0", + "11" + ], + "id_str": "7311232", + "id": "7311232" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953535837144272896", + "id_str": "953644179812376576", + "in_reply_to_user_id": "7311232", + "truncated": false, + "retweet_count": "0", + "id": "953644179812376576", + "in_reply_to_status_id": "953535837144272896", + "created_at": "Wed Jan 17 15:04:24 +0000 2018", + "favorited": false, + "full_text": "@triblondon We need more money first, but that is of course the plan.", + "lang": "en", + "in_reply_to_screen_name": "triblondon", + "in_reply_to_user_id_str": "7311232" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953643981115596800" + ], + "editableUntil": "2018-01-17T16:03:37.603Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Richard Littauer", + "screen_name": "richlitt", + "indices": [ + "0", + "9" + ], + "id_str": "118133101", + "id": "118133101" + } + ], + "urls": [ + { + "url": "https://t.co/btu7aVbnJ1", + "expanded_url": "https://slate.com/news-and-politics/2017/12/sharing-seth-abramson-not-once-not-ever.html", + "display_url": "slate.com/news-and-polit…", + "indices": [ + "109", + "132" + ] + } + ] + }, + "display_text_range": [ + "0", + "132" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953643048331866112", + "id_str": "953643981115596800", + "in_reply_to_user_id": "118133101", + "truncated": false, + "retweet_count": "0", + "id": "953643981115596800", + "in_reply_to_status_id": "953643048331866112", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 15:03:37 +0000 2018", + "favorited": false, + "full_text": "@richlitt I arrived at that conclusion by reading his tweets but it was easy to find a more formal analysis: https://t.co/btu7aVbnJ1", + "lang": "en", + "in_reply_to_screen_name": "richlitt", + "in_reply_to_user_id_str": "118133101" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953641137599782913" + ], + "editableUntil": "2018-01-17T15:52:19.656Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Richard Littauer", + "screen_name": "richlitt", + "indices": [ + "0", + "9" + ], + "id_str": "118133101", + "id": "118133101" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "44" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953640325528121346", + "id_str": "953641137599782913", + "in_reply_to_user_id": "118133101", + "truncated": false, + "retweet_count": "0", + "id": "953641137599782913", + "in_reply_to_status_id": "953640325528121346", + "created_at": "Wed Jan 17 14:52:19 +0000 2018", + "favorited": false, + "full_text": "@richlitt He is a wacky conspiracy theorist.", + "lang": "en", + "in_reply_to_screen_name": "richlitt", + "in_reply_to_user_id_str": "118133101" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953639205317431298" + ], + "editableUntil": "2018-01-17T15:44:38.964Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "21" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "953510815935602688", + "id_str": "953639205317431298", + "in_reply_to_user_id": "6473302", + "truncated": false, + "retweet_count": "0", + "id": "953639205317431298", + "in_reply_to_status_id": "953510815935602688", + "created_at": "Wed Jan 17 14:44:38 +0000 2018", + "favorited": false, + "full_text": "@mspowahs Ohhhhhhhhhh", + "lang": "und", + "in_reply_to_screen_name": "unknownmetric", + "in_reply_to_user_id_str": "6473302" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953638922214453249" + ], + "editableUntil": "2018-01-17T15:43:31.467Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Benedykt Dryl", + "screen_name": "benedyktdryl", + "indices": [ + "0", + "13" + ], + "id_str": "13665822", + "id": "13665822" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "14", + "20" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [ + { + "url": "https://t.co/fL786CRQlO", + "expanded_url": "http://Package.community", + "display_url": "Package.community", + "indices": [ + "40", + "63" + ] + } + ] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953565948765769728", + "id_str": "953638922214453249", + "in_reply_to_user_id": "13665822", + "truncated": false, + "retweet_count": "0", + "id": "953638922214453249", + "in_reply_to_status_id": "953565948765769728", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 14:43:31 +0000 2018", + "favorited": false, + "full_text": "@benedyktdryl @npmjs Who said we don't? https://t.co/fL786CRQlO exists for us to get community contributions and we take them all the time.", + "lang": "en", + "in_reply_to_screen_name": "benedyktdryl", + "in_reply_to_user_id_str": "13665822" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953504064041447424" + ], + "editableUntil": "2018-01-17T06:47:38.773Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/YnIT5NsmXt", + "expanded_url": "https://twitter.com/maybekatz/status/953402549293350913", + "display_url": "twitter.com/maybekatz/stat…", + "indices": [ + "101", + "124" + ] + } + ] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "36", + "id_str": "953504064041447424", + "truncated": false, + "retweet_count": "4", + "id": "953504064041447424", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 05:47:38 +0000 2018", + "favorited": false, + "full_text": "TLDR: in order to have time to actually fix bugs, npm's CLI team has to ignore a lot of bug reports. https://t.co/YnIT5NsmXt", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953498132519645184" + ], + "editableUntil": "2018-01-17T06:24:04.588Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "sarah jeong", + "screen_name": "sarahjeong", + "indices": [ + "3", + "14" + ], + "id_str": "47509268", + "id": "47509268" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "953498132519645184", + "truncated": false, + "retweet_count": "0", + "id": "953498132519645184", + "created_at": "Wed Jan 17 05:24:04 +0000 2018", + "favorited": false, + "full_text": "RT @sarahjeong: Me: Bitcoin solves a problem that is only a problem for a very narrow segment of the population\n\nInternet rando: What about…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953463421365764096" + ], + "editableUntil": "2018-01-17T04:06:08.804Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953463421365764096/photo/1", + "indices": [ + "32", + "55" + ], + "url": "https://t.co/1WHzL6LcE4", + "media_url": "http://pbs.twimg.com/media/DTth5i5VMAAvemb.jpg", + "id_str": "953463387366699008", + "id": "953463387366699008", + "media_url_https": "https://pbs.twimg.com/media/DTth5i5VMAAvemb.jpg", + "sizes": { + "large": { + "w": "789", + "h": "628", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "541", + "resize": "fit" + }, + "medium": { + "w": "789", + "h": "628", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/1WHzL6LcE4" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "79", + "id_str": "953463421365764096", + "truncated": false, + "retweet_count": "6", + "id": "953463421365764096", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 03:06:08 +0000 2018", + "favorited": false, + "full_text": "Everyone is back from vacation! https://t.co/1WHzL6LcE4", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953463421365764096/photo/1", + "indices": [ + "32", + "55" + ], + "url": "https://t.co/1WHzL6LcE4", + "media_url": "http://pbs.twimg.com/media/DTth5i5VMAAvemb.jpg", + "id_str": "953463387366699008", + "id": "953463387366699008", + "media_url_https": "https://pbs.twimg.com/media/DTth5i5VMAAvemb.jpg", + "sizes": { + "large": { + "w": "789", + "h": "628", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "541", + "resize": "fit" + }, + "medium": { + "w": "789", + "h": "628", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/1WHzL6LcE4" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953463142108966912" + ], + "editableUntil": "2018-01-17T04:05:02.224Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Cholo Goth", + "screen_name": "eldealado_", + "indices": [ + "0", + "11" + ], + "id_str": "426352248", + "id": "426352248" + } + ], + "urls": [ + { + "url": "https://t.co/E1jWwE5Iaw", + "expanded_url": "https://www.nytimes.com/2018/01/16/us/politics/trump-health-exam-doctor-cognitive-test.html?_r=0", + "display_url": "nytimes.com/2018/01/16/us/…", + "indices": [ + "12", + "35" + ] + } + ] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953462357115703296", + "id_str": "953463142108966912", + "in_reply_to_user_id": "426352248", + "truncated": false, + "retweet_count": "0", + "id": "953463142108966912", + "in_reply_to_status_id": "953462357115703296", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 03:05:02 +0000 2018", + "favorited": false, + "full_text": "@eldealado_ https://t.co/E1jWwE5Iaw", + "lang": "qme", + "in_reply_to_screen_name": "eldealado_", + "in_reply_to_user_id_str": "426352248" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953461342173736960" + ], + "editableUntil": "2018-01-17T03:57:53.086Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/GwAsc0aEQT", + "expanded_url": "https://twitter.com/Politidope/status/953400128970338304", + "display_url": "twitter.com/Politidope/sta…", + "indices": [ + "174", + "197" + ] + } + ] + }, + "display_text_range": [ + "0", + "197" + ], + "favorite_count": "14", + "id_str": "953461342173736960", + "truncated": false, + "retweet_count": "4", + "id": "953461342173736960", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 02:57:53 +0000 2018", + "favorited": false, + "full_text": "Remember: it's not that Trump is overweight, it's that he repeatedly lies about things that are obviously untrue. You can't trust a single thing that comes out of his mouth. https://t.co/GwAsc0aEQT", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953460720087134208" + ], + "editableUntil": "2018-01-17T03:55:24.769Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "234" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "953460322395856897", + "id_str": "953460720087134208", + "in_reply_to_user_id": "6473302", + "truncated": false, + "retweet_count": "0", + "id": "953460720087134208", + "in_reply_to_status_id": "953460322395856897", + "created_at": "Wed Jan 17 02:55:24 +0000 2018", + "favorited": false, + "full_text": "@mspowahs I got this one in reverse from an Apple support tech who was ma'am-ing me for 5 minutes before I corrected him and then he covered by saying he'd been calling me \"man\" the whole time. He hadn't, but it was a smooth recovery.", + "lang": "en", + "in_reply_to_screen_name": "unknownmetric", + "in_reply_to_user_id_str": "6473302" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953437038757404673" + ], + "editableUntil": "2018-01-17T02:21:18.700Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Here Comes The Sun", + "screen_name": "SunOfSeldo", + "indices": [ + "3", + "14" + ], + "id_str": "456374925", + "id": "456374925" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "0", + "id_str": "953437038757404673", + "truncated": false, + "retweet_count": "0", + "id": "953437038757404673", + "created_at": "Wed Jan 17 01:21:18 +0000 2018", + "favorited": false, + "full_text": "RT @SunOfSeldo: Sunset moved forward to 5.15pm today. You are more than half-way through January! You can make it through January. You can…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953435537204891649" + ], + "editableUntil": "2018-01-17T02:15:20.702Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ben Basson", + "screen_name": "Ben_Basson", + "indices": [ + "0", + "11" + ], + "id_str": "312501914", + "id": "312501914" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "136" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "953434791432646661", + "id_str": "953435537204891649", + "in_reply_to_user_id": "312501914", + "truncated": false, + "retweet_count": "0", + "id": "953435537204891649", + "in_reply_to_status_id": "953434791432646661", + "created_at": "Wed Jan 17 01:15:20 +0000 2018", + "favorited": false, + "full_text": "@Ben_Basson I think lots of people think it's stable and a lot of people think it's a currency and it's neither, unfortunately for them.", + "lang": "en", + "in_reply_to_screen_name": "Ben_Basson", + "in_reply_to_user_id_str": "312501914" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953429136608960513" + ], + "editableUntil": "2018-01-17T01:49:54.681Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tef", + "screen_name": "tef_ebooks", + "indices": [ + "0", + "11" + ], + "id_str": "3107896458", + "id": "3107896458" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "115" + ], + "favorite_count": "0", + "id_str": "953429136608960513", + "in_reply_to_user_id": "3107896458", + "truncated": false, + "retweet_count": "0", + "id": "953429136608960513", + "created_at": "Wed Jan 17 00:49:54 +0000 2018", + "favorited": false, + "full_text": "@tef_ebooks I like your poll but 18% of your respondents are Larry Wall which is really going to skew your results.", + "lang": "en", + "in_reply_to_screen_name": "tef_ebooks", + "in_reply_to_user_id_str": "3107896458" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953428532826263553" + ], + "editableUntil": "2018-01-17T01:47:30.728Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953428532826263553/photo/1", + "indices": [ + "119", + "142" + ], + "url": "https://t.co/BnWBQ84jUL", + "media_url": "http://pbs.twimg.com/media/DTtB4rsUQAEcCkk.jpg", + "id_str": "953428188176072705", + "id": "953428188176072705", + "media_url_https": "https://pbs.twimg.com/media/DTtB4rsUQAEcCkk.jpg", + "sizes": { + "large": { + "w": "469", + "h": "448", + "resize": "fit" + }, + "medium": { + "w": "469", + "h": "448", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "469", + "h": "448", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/BnWBQ84jUL" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "142" + ], + "favorite_count": "51", + "id_str": "953428532826263553", + "truncated": false, + "retweet_count": "4", + "id": "953428532826263553", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 00:47:30 +0000 2018", + "favorited": false, + "full_text": "🎵 Give me that stable store of value\n🎵 That stable store of value\n🎵 I can't get enough of\n🎵 That stable store of value https://t.co/BnWBQ84jUL", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/953428532826263553/photo/1", + "indices": [ + "119", + "142" + ], + "url": "https://t.co/BnWBQ84jUL", + "media_url": "http://pbs.twimg.com/media/DTtB4rsUQAEcCkk.jpg", + "id_str": "953428188176072705", + "id": "953428188176072705", + "media_url_https": "https://pbs.twimg.com/media/DTtB4rsUQAEcCkk.jpg", + "sizes": { + "large": { + "w": "469", + "h": "448", + "resize": "fit" + }, + "medium": { + "w": "469", + "h": "448", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "469", + "h": "448", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/BnWBQ84jUL" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953420816565358592" + ], + "editableUntil": "2018-01-17T01:16:51.028Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/GdL1DJhtRR", + "expanded_url": "https://twitter.com/tef_ebooks/status/953186333455015936", + "display_url": "twitter.com/tef_ebooks/sta…", + "indices": [ + "53", + "76" + ] + } + ] + }, + "display_text_range": [ + "0", + "76" + ], + "favorite_count": "27", + "id_str": "953420816565358592", + "truncated": false, + "retweet_count": "17", + "id": "953420816565358592", + "possibly_sensitive": false, + "created_at": "Wed Jan 17 00:16:51 +0000 2018", + "favorited": false, + "full_text": "This is great and worth your time and also hilarious https://t.co/GdL1DJhtRR", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953416467432718336" + ], + "editableUntil": "2018-01-17T00:59:34.114Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/2sKJs8iD9m", + "expanded_url": "https://twitter.com/sidizenkane/status/953400413419548672", + "display_url": "twitter.com/sidizenkane/st…", + "indices": [ + "69", + "92" + ] + } + ] + }, + "display_text_range": [ + "0", + "92" + ], + "favorite_count": "17", + "id_str": "953416467432718336", + "truncated": false, + "retweet_count": "3", + "id": "953416467432718336", + "possibly_sensitive": false, + "created_at": "Tue Jan 16 23:59:34 +0000 2018", + "favorited": false, + "full_text": "Star Wars fans upset to learn that they do not understand Star Wars. https://t.co/2sKJs8iD9m", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953415452176166912" + ], + "editableUntil": "2018-01-17T00:55:32.058Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashley", + "screen_name": "rabcyr", + "indices": [ + "0", + "7" + ], + "id_str": "26157562", + "id": "26157562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "24" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953414985224540166", + "id_str": "953415452176166912", + "in_reply_to_user_id": "26157562", + "truncated": false, + "retweet_count": "0", + "id": "953415452176166912", + "in_reply_to_status_id": "953414985224540166", + "created_at": "Tue Jan 16 23:55:32 +0000 2018", + "favorited": false, + "full_text": "@rabcyr This is v. good.", + "lang": "en", + "in_reply_to_screen_name": "rabcyr", + "in_reply_to_user_id_str": "26157562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953381321220304896" + ], + "editableUntil": "2018-01-16T22:39:54.604Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/A1WBoA3wNX", + "expanded_url": "https://talkingpointsmemo.com/muckraker/misleading-trump-admin-report-links-immigration-terrorism", + "display_url": "talkingpointsmemo.com/muckraker/misl…", + "indices": [ + "107", + "130" + ] + } + ] + }, + "display_text_range": [ + "0", + "130" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "953379948856688640", + "id_str": "953381321220304896", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "953381321220304896", + "in_reply_to_status_id": "953379948856688640", + "possibly_sensitive": false, + "created_at": "Tue Jan 16 21:39:54 +0000 2018", + "favorited": false, + "full_text": "This is a transparently racist report intended to build a case against immigration by fudging the numbers: https://t.co/A1WBoA3wNX", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953379948856688640" + ], + "editableUntil": "2018-01-16T22:34:27.407Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/swQIwJnRHE", + "expanded_url": "https://twitter.com/TheJusticeDept/status/953275839361187840", + "display_url": "twitter.com/TheJusticeDept…", + "indices": [ + "136", + "159" + ] + } + ] + }, + "display_text_range": [ + "0", + "159" + ], + "favorite_count": "49", + "id_str": "953379948856688640", + "truncated": false, + "retweet_count": "8", + "id": "953379948856688640", + "possibly_sensitive": false, + "created_at": "Tue Jan 16 21:34:27 +0000 2018", + "favorited": false, + "full_text": "Breaking news: a crime called \"international terrorism\" is usually committed by foreigners. Meanwhile \"domestic terrorism\" also exists. https://t.co/swQIwJnRHE", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953328072664653824" + ], + "editableUntil": "2018-01-16T19:08:19.159Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "175" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "953327908889612293", + "id_str": "953328072664653824", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "953328072664653824", + "in_reply_to_status_id": "953327908889612293", + "created_at": "Tue Jan 16 18:08:19 +0000 2018", + "favorited": false, + "full_text": "@terronk c.f. \"things you can't say in Silicon Valley\". It's not that you're not allowed to say them, it's that they're stupid things to say so you get shouted at when you do.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953327908889612293" + ], + "editableUntil": "2018-01-16T19:07:40.112Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "186" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "953326417323765765", + "id_str": "953327908889612293", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "953327908889612293", + "in_reply_to_status_id": "953326417323765765", + "created_at": "Tue Jan 16 18:07:40 +0000 2018", + "favorited": false, + "full_text": "@terronk I think the fact that they focus on the words indicates they don't realize the concepts are offensive. \"It's true but don't say it\" is the form of respectable republican racism.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953323660575588352" + ], + "editableUntil": "2018-01-16T18:50:47.235Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "184" + ], + "favorite_count": "102", + "id_str": "953323660575588352", + "truncated": false, + "retweet_count": "8", + "id": "953323660575588352", + "created_at": "Tue Jan 16 17:50:47 +0000 2018", + "favorited": false, + "full_text": "I am beyond exasperated at the GOP focusing the \"shithole\" scandal on the language used. No you assholes, the problem is that he's racist. The language is the symptom, not the problem.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953322266594430976" + ], + "editableUntil": "2018-01-16T18:45:14.884Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/RI3PGr70OL", + "expanded_url": "https://www.cnet.com/products/oppo-r9s/review/", + "display_url": "cnet.com/products/oppo-…", + "indices": [ + "100", + "123" + ] + } + ] + }, + "display_text_range": [ + "0", + "123" + ], + "favorite_count": "2", + "id_str": "953322266594430976", + "truncated": false, + "retweet_count": "1", + "id": "953322266594430976", + "possibly_sensitive": false, + "created_at": "Tue Jan 16 17:45:14 +0000 2018", + "favorited": false, + "full_text": "Meet the Oppo R9S, the best selling phone in the world's largest market for phones in 2017 (China). https://t.co/RI3PGr70OL", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953320290557165568" + ], + "editableUntil": "2018-01-16T18:37:23.760Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "68" + ], + "favorite_count": "4", + "id_str": "953320290557165568", + "truncated": false, + "retweet_count": "0", + "id": "953320290557165568", + "created_at": "Tue Jan 16 17:37:23 +0000 2018", + "favorited": false, + "full_text": "I can't believe how long it took me to discover Infrastructure Week.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953319613646782464" + ], + "editableUntil": "2018-01-16T18:34:42.372Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matthew Eernisse", + "screen_name": "mde", + "indices": [ + "0", + "4" + ], + "id_str": "778332", + "id": "778332" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "98" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953315979521441793", + "id_str": "953319613646782464", + "in_reply_to_user_id": "778332", + "truncated": false, + "retweet_count": "0", + "id": "953319613646782464", + "in_reply_to_status_id": "953315979521441793", + "created_at": "Tue Jan 16 17:34:42 +0000 2018", + "favorited": false, + "full_text": "@mde Disagree on Discovery. It's the most interesting Trek. Taking risks nobody's taken since TOS.", + "lang": "en", + "in_reply_to_screen_name": "mde", + "in_reply_to_user_id_str": "778332" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953307692063375362" + ], + "editableUntil": "2018-01-16T17:47:20.045Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Michael Del Moro", + "screen_name": "MikeDelMoro", + "indices": [ + "3", + "15" + ], + "id_str": "31059230", + "id": "31059230" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "953307692063375362", + "truncated": false, + "retweet_count": "0", + "id": "953307692063375362", + "created_at": "Tue Jan 16 16:47:20 +0000 2018", + "favorited": false, + "full_text": "RT @MikeDelMoro: AP: Trump ends first year with lowest average approval rating of any elected president in his first term https://t.co/o8Ev…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953307267209707520" + ], + "editableUntil": "2018-01-16T17:45:38.752Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "lauraolin dot com slash newsletter", + "screen_name": "lauraolin", + "indices": [ + "0", + "10" + ], + "id_str": "14069365", + "id": "14069365" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "131" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "953272110348193792", + "id_str": "953307267209707520", + "in_reply_to_user_id": "14069365", + "truncated": false, + "retweet_count": "0", + "id": "953307267209707520", + "in_reply_to_status_id": "953272110348193792", + "created_at": "Tue Jan 16 16:45:38 +0000 2018", + "favorited": false, + "full_text": "@lauraolin Nah, quoting MLK is a favorite pastime of the kind of racist who thinks it's only racism if you're wearing a white hood.", + "lang": "en", + "in_reply_to_screen_name": "lauraolin", + "in_reply_to_user_id_str": "14069365" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953157922720108544" + ], + "editableUntil": "2018-01-16T07:52:12.251Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "57" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "953154180952162304", + "id_str": "953157922720108544", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "953157922720108544", + "in_reply_to_status_id": "953154180952162304", + "created_at": "Tue Jan 16 06:52:12 +0000 2018", + "favorited": false, + "full_text": "@terronk That's why they cut it. It was out of character.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953153409443536896" + ], + "editableUntil": "2018-01-16T07:34:16.202Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "146" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953153184792379392", + "id_str": "953153409443536896", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "953153409443536896", + "in_reply_to_status_id": "953153184792379392", + "created_at": "Tue Jan 16 06:34:16 +0000 2018", + "favorited": false, + "full_text": "@terronk At least Vader has the fundamental honesty to *admit* he's evil and try to convince people evil's the winning side. C3PO is just a snake.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953153184792379392" + ], + "editableUntil": "2018-01-16T07:33:22.641Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "108" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953133527079374849", + "id_str": "953153184792379392", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "953153184792379392", + "in_reply_to_status_id": "953133527079374849", + "created_at": "Tue Jan 16 06:33:22 +0000 2018", + "favorited": false, + "full_text": "@terronk He's not a coward, he's a traitor. A willful, repeated traitor, totally unworthy of anyone's trust.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953127662846853120" + ], + "editableUntil": "2018-01-16T05:51:57.735Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "donjay (https://mastodon.social/@donjay)", + "screen_name": "donjay", + "indices": [ + "0", + "7" + ], + "id_str": "11065502", + "id": "11065502" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "28" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953126440328822784", + "id_str": "953127662846853120", + "in_reply_to_user_id": "11065502", + "truncated": false, + "retweet_count": "0", + "id": "953127662846853120", + "in_reply_to_status_id": "953126440328822784", + "created_at": "Tue Jan 16 04:51:57 +0000 2018", + "favorited": false, + "full_text": "@donjay That's cool as hell.", + "lang": "en", + "in_reply_to_screen_name": "donjay", + "in_reply_to_user_id_str": "11065502" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953122921030942720" + ], + "editableUntil": "2018-01-16T05:33:07.198Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jessica hilberman", + "screen_name": "saysjessbess", + "indices": [ + "0", + "13" + ], + "id_str": "337835487", + "id": "337835487" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "953122097294753792", + "id_str": "953122921030942720", + "in_reply_to_user_id": "337835487", + "truncated": false, + "retweet_count": "0", + "id": "953122921030942720", + "in_reply_to_status_id": "953122097294753792", + "created_at": "Tue Jan 16 04:33:07 +0000 2018", + "favorited": false, + "full_text": "@saysjessbess I'm quite enjoying it!", + "lang": "en", + "in_reply_to_screen_name": "saysjessbess", + "in_reply_to_user_id_str": "337835487" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953121681429549056" + ], + "editableUntil": "2018-01-16T05:28:11.654Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "1", + "id_str": "953121681429549056", + "truncated": false, + "retweet_count": "0", + "id": "953121681429549056", + "created_at": "Tue Jan 16 04:28:11 +0000 2018", + "favorited": false, + "full_text": "Is Jason Isaacs could keep his American accent straight for even a couple of seconds it would stop throwing me out of Discovery.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953109734365659137" + ], + "editableUntil": "2018-01-16T04:40:43.252Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/0wK7G6AU4Q", + "expanded_url": "https://talkingpointsmemo.com/livewire/president-obama-peter-king-tan-suit-rant", + "display_url": "talkingpointsmemo.com/livewire/presi…", + "indices": [ + "182", + "205" + ] + } + ] + }, + "display_text_range": [ + "0", + "205" + ], + "favorite_count": "55", + "id_str": "953109734365659137", + "truncated": false, + "retweet_count": "11", + "id": "953109734365659137", + "possibly_sensitive": false, + "created_at": "Tue Jan 16 03:40:43 +0000 2018", + "favorited": false, + "full_text": "\"There’s no way any of us can excuse what the president did yesterday\" is a real thing a republican member of congress said when Obama wore a tan suit to a press conference in 2014: https://t.co/0wK7G6AU4Q", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953106204342931457" + ], + "editableUntil": "2018-01-16T04:26:41.629Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "donjay (https://mastodon.social/@donjay)", + "screen_name": "donjay", + "indices": [ + "0", + "7" + ], + "id_str": "11065502", + "id": "11065502" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "81" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953104500742500352", + "id_str": "953106204342931457", + "in_reply_to_user_id": "11065502", + "truncated": false, + "retweet_count": "0", + "id": "953106204342931457", + "in_reply_to_status_id": "953104500742500352", + "created_at": "Tue Jan 16 03:26:41 +0000 2018", + "favorited": false, + "full_text": "@donjay (Are you actually related to John Jay because that would be cool as hell)", + "lang": "en", + "in_reply_to_screen_name": "donjay", + "in_reply_to_user_id_str": "11065502" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953105444674744321" + ], + "editableUntil": "2018-01-16T04:23:40.510Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt McDermott", + "screen_name": "mattmfm", + "indices": [ + "3", + "11" + ], + "id_str": "15418628", + "id": "15418628" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "0", + "id_str": "953105444674744321", + "truncated": false, + "retweet_count": "0", + "id": "953105444674744321", + "created_at": "Tue Jan 16 03:23:40 +0000 2018", + "favorited": false, + "full_text": "RT @mattmfm: Obama said it was stupid for a cop to arrest a black guy entering his own home, and it was a month-long story. \n\nTrump had an…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953103387062558720" + ], + "editableUntil": "2018-01-16T04:15:29.937Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "Jemele Hill", + "screen_name": "jemelehill", + "indices": [ + "3", + "14" + ], + "id_str": "35586563", + "id": "35586563" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/jemelehill/status/952917202134491136/photo/1", + "source_status_id": "952917202134491136", + "indices": [ + "117", + "140" + ], + "url": "https://t.co/6C0BWKcTXO", + "media_url": "http://pbs.twimg.com/media/DTlxJIEV4AAFtlZ.jpg", + "id_str": "952917197764026368", + "source_user_id": "35586563", + "id": "952917197764026368", + "media_url_https": "https://pbs.twimg.com/media/DTlxJIEV4AAFtlZ.jpg", + "source_user_id_str": "35586563", + "sizes": { + "large": { + "w": "1024", + "h": "538", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "357", + "resize": "fit" + }, + "medium": { + "w": "1024", + "h": "538", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "source_status_id_str": "952917202134491136", + "display_url": "pic.twitter.com/6C0BWKcTXO" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "953103387062558720", + "truncated": false, + "retweet_count": "0", + "id": "953103387062558720", + "possibly_sensitive": false, + "created_at": "Tue Jan 16 03:15:29 +0000 2018", + "favorited": false, + "full_text": "RT @jemelehill: Me, watching people who criticized Colin Kaepernick for his nonviolent protest post MLK quotes today https://t.co/6C0BWKcTXO", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/jemelehill/status/952917202134491136/photo/1", + "source_status_id": "952917202134491136", + "indices": [ + "117", + "140" + ], + "url": "https://t.co/6C0BWKcTXO", + "media_url": "http://pbs.twimg.com/media/DTlxJIEV4AAFtlZ.jpg", + "id_str": "952917197764026368", + "source_user_id": "35586563", + "id": "952917197764026368", + "media_url_https": "https://pbs.twimg.com/media/DTlxJIEV4AAFtlZ.jpg", + "source_user_id_str": "35586563", + "sizes": { + "large": { + "w": "1024", + "h": "538", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "357", + "resize": "fit" + }, + "medium": { + "w": "1024", + "h": "538", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "source_status_id_str": "952917202134491136", + "display_url": "pic.twitter.com/6C0BWKcTXO" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953099323750805506" + ], + "editableUntil": "2018-01-16T03:59:21.168Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "anildash.com", + "screen_name": "anildash", + "indices": [ + "3", + "12" + ], + "id_str": "36823", + "id": "36823" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "953099323750805506", + "truncated": false, + "retweet_count": "0", + "id": "953099323750805506", + "created_at": "Tue Jan 16 02:59:21 +0000 2018", + "favorited": false, + "full_text": "RT @anildash: There should be a real-life warning label if a person you encounter has a twitter timeline that consists of them angrily twee…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953008012586729472" + ], + "editableUntil": "2018-01-15T21:56:30.890Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/eTAV5uzbB1", + "expanded_url": "https://www.patreon.com/MissionComics/posts", + "display_url": "patreon.com/MissionComics/…", + "indices": [ + "140", + "163" + ] + } + ] + }, + "display_text_range": [ + "0", + "163" + ], + "favorite_count": "6", + "id_str": "953008012586729472", + "truncated": false, + "retweet_count": "3", + "id": "953008012586729472", + "possibly_sensitive": false, + "created_at": "Mon Jan 15 20:56:30 +0000 2018", + "favorited": false, + "full_text": "I'm backing Mission Comics on Patreon (basically subscribing to comic books), why not join me and keep this neighborhood institution going? https://t.co/eTAV5uzbB1", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "953007031866159104" + ], + "editableUntil": "2018-01-15T21:52:37.068Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Rick Waldron", + "screen_name": "rwaldron", + "indices": [ + "0", + "9" + ], + "id_str": "16144669", + "id": "16144669" + }, + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "10", + "21" + ], + "id_str": "68567860", + "id": "68567860" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "175" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "953000070747746304", + "id_str": "953007031866159104", + "in_reply_to_user_id": "16144669", + "truncated": false, + "retweet_count": "0", + "id": "953007031866159104", + "in_reply_to_status_id": "953000070747746304", + "created_at": "Mon Jan 15 20:52:37 +0000 2018", + "favorited": false, + "full_text": "@rwaldron @AdamRackis I donated them to the composting gods. They did not smell at all though and various people have suggested they might have been okay even after that long.", + "lang": "en", + "in_reply_to_screen_name": "rwaldron", + "in_reply_to_user_id_str": "16144669" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952999751162589184" + ], + "editableUntil": "2018-01-15T21:23:41.213Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "0", + "11" + ], + "id_str": "68567860", + "id": "68567860" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "107" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "952969388700954624", + "id_str": "952999751162589184", + "in_reply_to_user_id": "68567860", + "truncated": false, + "retweet_count": "0", + "id": "952999751162589184", + "in_reply_to_status_id": "952969388700954624", + "created_at": "Mon Jan 15 20:23:41 +0000 2018", + "favorited": false, + "full_text": "@AdamRackis I was having a lazy weekend when I didn't feel like cooking breakfast. For six months in a row.", + "lang": "en", + "in_reply_to_screen_name": "AdamRackis", + "in_reply_to_user_id_str": "68567860" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952995180981858305" + ], + "editableUntil": "2018-01-15T21:05:31.597Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "live, laugh, @lawnsea@mastodon.social", + "screen_name": "lawnsea", + "indices": [ + "0", + "8" + ], + "id_str": "14132172", + "id": "14132172" + }, + { + "name": "isaacs", + "screen_name": "izs", + "indices": [ + "9", + "13" + ], + "id_str": "8038312", + "id": "8038312" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952994634619412480", + "id_str": "952995180981858305", + "in_reply_to_user_id": "14132172", + "truncated": false, + "retweet_count": "0", + "id": "952995180981858305", + "in_reply_to_status_id": "952994634619412480", + "created_at": "Mon Jan 15 20:05:31 +0000 2018", + "favorited": false, + "full_text": "@lawnsea @izs My blood curdled at that joke", + "lang": "en", + "in_reply_to_screen_name": "lawnsea", + "in_reply_to_user_id_str": "14132172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952993486260678657" + ], + "editableUntil": "2018-01-15T20:58:47.544Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Robert Yang", + "screen_name": "radiatoryang", + "indices": [ + "0", + "13" + ], + "id_str": "165537786", + "id": "165537786" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "122" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "952988115882401793", + "id_str": "952993486260678657", + "in_reply_to_user_id": "165537786", + "truncated": false, + "retweet_count": "0", + "id": "952993486260678657", + "in_reply_to_status_id": "952988115882401793", + "created_at": "Mon Jan 15 19:58:47 +0000 2018", + "favorited": false, + "full_text": "@radiatoryang I tried this but my professor was all \"this is an algorithms and data structures course\". They're not ready.", + "lang": "en", + "in_reply_to_screen_name": "radiatoryang", + "in_reply_to_user_id_str": "165537786" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952982065753944065" + ], + "editableUntil": "2018-01-15T20:13:24.683Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "isaacs", + "screen_name": "izs", + "indices": [ + "0", + "4" + ], + "id_str": "8038312", + "id": "8038312" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "12" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "952981891023384576", + "id_str": "952982065753944065", + "in_reply_to_user_id": "8038312", + "truncated": false, + "retweet_count": "0", + "id": "952982065753944065", + "in_reply_to_status_id": "952981891023384576", + "created_at": "Mon Jan 15 19:13:24 +0000 2018", + "favorited": false, + "full_text": "@izs why tho", + "lang": "en", + "in_reply_to_screen_name": "izs", + "in_reply_to_user_id_str": "8038312" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952964896827650048" + ], + "editableUntil": "2018-01-15T19:05:11.292Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "176" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952959705629929473", + "id_str": "952964896827650048", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952964896827650048", + "in_reply_to_status_id": "952959705629929473", + "created_at": "Mon Jan 15 18:05:11 +0000 2018", + "favorited": false, + "full_text": "🎵 And now I tell you openly\n🎵 You have my heart so don't hurt me\n🎵 You're what I couldn't find\n🎵 A totally amazing mind\n🎵 So understanding and so kind\n🎵 You're everything to me", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952959705629929473" + ], + "editableUntil": "2018-01-15T18:44:33.614Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/G56LnlC4GD", + "expanded_url": "http://www.bbc.com/news/entertainment-arts-42696376", + "display_url": "bbc.com/news/entertain…", + "indices": [ + "129", + "152" + ] + } + ] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "56", + "id_str": "952959705629929473", + "truncated": false, + "retweet_count": "9", + "id": "952959705629929473", + "possibly_sensitive": false, + "created_at": "Mon Jan 15 17:44:33 +0000 2018", + "favorited": false, + "full_text": "RIP Dolores O'Riordan. Thank you for many hours of angry yelling songs at a time in my life when that was exactly what I needed. https://t.co/G56LnlC4GD", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952957685778927616" + ], + "editableUntil": "2018-01-15T18:36:32.044Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "18", + "in_reply_to_status_id_str": "952947255689924609", + "id_str": "952957685778927616", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952957685778927616", + "in_reply_to_status_id": "952947255689924609", + "created_at": "Mon Jan 15 17:36:32 +0000 2018", + "favorited": false, + "full_text": "I couldn't find a date on the open pack of bacon so I cooked and ate it anyway. RIP me.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952949300052422657" + ], + "editableUntil": "2018-01-15T18:03:12.731Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jenn R", + "screen_name": "jnnfrrss", + "indices": [ + "0", + "9" + ], + "id_str": "2375935285", + "id": "2375935285" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "91" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952948565411758080", + "id_str": "952949300052422657", + "in_reply_to_user_id": "2375935285", + "truncated": false, + "retweet_count": "0", + "id": "952949300052422657", + "in_reply_to_status_id": "952948565411758080", + "created_at": "Mon Jan 15 17:03:12 +0000 2018", + "favorited": false, + "full_text": "@jnnfrrss Usually I give no fucks about expiry dates but six months seems like a long time.", + "lang": "en", + "in_reply_to_screen_name": "jnnfrrss", + "in_reply_to_user_id_str": "2375935285" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952947255689924609" + ], + "editableUntil": "2018-01-15T17:55:05.317Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "106" + ], + "favorite_count": "51", + "id_str": "952947255689924609", + "truncated": false, + "retweet_count": "2", + "id": "952947255689924609", + "created_at": "Mon Jan 15 16:55:05 +0000 2018", + "favorited": false, + "full_text": "\"I should cook breakfast! It's been a while since I did that.\"\nThe eggs in my fridge expired 7 months ago.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952945999068057601" + ], + "editableUntil": "2018-01-15T17:50:05.715Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dennis Collinson", + "screen_name": "dnscollective", + "indices": [ + "0", + "14" + ], + "id_str": "30498562", + "id": "30498562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "77" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952811564846825472", + "id_str": "952945999068057601", + "in_reply_to_user_id": "30498562", + "truncated": false, + "retweet_count": "0", + "id": "952945999068057601", + "in_reply_to_status_id": "952811564846825472", + "created_at": "Mon Jan 15 16:50:05 +0000 2018", + "favorited": false, + "full_text": "@dnscollective I'm hoping they'll be back thanks to mirror universe bullshit.", + "lang": "en", + "in_reply_to_screen_name": "dnscollective", + "in_reply_to_user_id_str": "30498562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952944810762977280" + ], + "editableUntil": "2018-01-15T17:45:22.401Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Christmas (in November) Kennedy", + "screen_name": "onebrightlight", + "indices": [ + "0", + "15" + ], + "id_str": "755485", + "id": "755485" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "33" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952944184306024448", + "id_str": "952944810762977280", + "in_reply_to_user_id": "755485", + "truncated": false, + "retweet_count": "0", + "id": "952944810762977280", + "in_reply_to_status_id": "952944184306024448", + "created_at": "Mon Jan 15 16:45:22 +0000 2018", + "favorited": false, + "full_text": "@onebrightlight But people pay me", + "lang": "en", + "in_reply_to_screen_name": "onebrightlight", + "in_reply_to_user_id_str": "755485" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952943383646945280" + ], + "editableUntil": "2018-01-15T17:39:42.150Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952943383646945280/photo/1", + "indices": [ + "14", + "37" + ], + "url": "https://t.co/4MfVNIGBLc", + "media_url": "http://pbs.twimg.com/media/DTmI83_U8AE2cyY.jpg", + "id_str": "952943375568662529", + "id": "952943375568662529", + "media_url_https": "https://pbs.twimg.com/media/DTmI83_U8AE2cyY.jpg", + "sizes": { + "large": { + "w": "500", + "h": "296", + "resize": "fit" + }, + "small": { + "w": "500", + "h": "296", + "resize": "fit" + }, + "medium": { + "w": "500", + "h": "296", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/4MfVNIGBLc" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952942997456367616", + "id_str": "952943383646945280", + "in_reply_to_user_id": "106463784", + "truncated": false, + "retweet_count": "0", + "id": "952943383646945280", + "in_reply_to_status_id": "952942997456367616", + "possibly_sensitive": false, + "created_at": "Mon Jan 15 16:39:42 +0000 2018", + "favorited": false, + "full_text": "@VilliSpeaks https://t.co/4MfVNIGBLc", + "lang": "qme", + "in_reply_to_screen_name": "villi", + "in_reply_to_user_id_str": "106463784", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952943383646945280/photo/1", + "indices": [ + "14", + "37" + ], + "url": "https://t.co/4MfVNIGBLc", + "media_url": "http://pbs.twimg.com/media/DTmI83_U8AE2cyY.jpg", + "id_str": "952943375568662529", + "id": "952943375568662529", + "media_url_https": "https://pbs.twimg.com/media/DTmI83_U8AE2cyY.jpg", + "sizes": { + "large": { + "w": "500", + "h": "296", + "resize": "fit" + }, + "small": { + "w": "500", + "h": "296", + "resize": "fit" + }, + "medium": { + "w": "500", + "h": "296", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/4MfVNIGBLc" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952943256400113664" + ], + "editableUntil": "2018-01-15T17:39:11.812Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "73" + ], + "favorite_count": "8", + "id_str": "952943256400113664", + "truncated": false, + "retweet_count": "0", + "id": "952943256400113664", + "created_at": "Mon Jan 15 16:39:11 +0000 2018", + "favorited": false, + "full_text": "What if I started an onlyfans account and it was just all-text shitposts.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952928564474597377" + ], + "editableUntil": "2018-01-15T16:40:48.984Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nick Quaranto 🦦", + "screen_name": "qrush", + "indices": [ + "0", + "6" + ], + "id_str": "5743852", + "id": "5743852" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952878058918301696", + "id_str": "952928564474597377", + "in_reply_to_user_id": "5743852", + "truncated": false, + "retweet_count": "0", + "id": "952928564474597377", + "in_reply_to_status_id": "952878058918301696", + "created_at": "Mon Jan 15 15:40:48 +0000 2018", + "favorited": false, + "full_text": "@qrush No phones, internet, or tv. It was all they had.", + "lang": "en", + "in_reply_to_screen_name": "qrush", + "in_reply_to_user_id_str": "5743852" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952802049703297025" + ], + "editableUntil": "2018-01-15T08:18:05.512Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tracy Chou 🌻", + "screen_name": "triketora", + "indices": [ + "3", + "13" + ], + "id_str": "19556080", + "id": "19556080" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "952802049703297025", + "truncated": false, + "retweet_count": "0", + "id": "952802049703297025", + "created_at": "Mon Jan 15 07:18:05 +0000 2018", + "favorited": false, + "full_text": "RT @triketora: These bubbles are the largest in all of history. That means they're going to be the most destructive in history when they fi…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952800382933069825" + ], + "editableUntil": "2018-01-15T08:11:28.123Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adrian Bradley", + "screen_name": "adebradley", + "indices": [ + "0", + "11" + ], + "id_str": "7786722", + "id": "7786722" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "40" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952797973402013697", + "id_str": "952800382933069825", + "in_reply_to_user_id": "7786722", + "truncated": false, + "retweet_count": "0", + "id": "952800382933069825", + "in_reply_to_status_id": "952797973402013697", + "created_at": "Mon Jan 15 07:11:28 +0000 2018", + "favorited": false, + "full_text": "@adebradley Do not throw away your shot.", + "lang": "en", + "in_reply_to_screen_name": "adebradley", + "in_reply_to_user_id_str": "7786722" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952777020777250816" + ], + "editableUntil": "2018-01-15T06:38:38.151Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "kenneth 🌞", + "screen_name": "kpk", + "indices": [ + "0", + "4" + ], + "id_str": "22915745", + "id": "22915745" + }, + { + "name": "Jason Goldman", + "screen_name": "goldman", + "indices": [ + "5", + "13" + ], + "id_str": "291", + "id": "291" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "952776516236013568", + "id_str": "952777020777250816", + "in_reply_to_user_id": "22915745", + "truncated": false, + "retweet_count": "0", + "id": "952777020777250816", + "in_reply_to_status_id": "952776516236013568", + "created_at": "Mon Jan 15 05:38:38 +0000 2018", + "favorited": false, + "full_text": "@kpk @goldman DS9 is Jefferson. Really solid overall arc but the details don't stand up to scrutiny and seriously problematic all the time.", + "lang": "en", + "in_reply_to_screen_name": "kpk", + "in_reply_to_user_id_str": "22915745" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952776110613254144" + ], + "editableUntil": "2018-01-15T06:35:01.151Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jason Goldman", + "screen_name": "goldman", + "indices": [ + "0", + "8" + ], + "id_str": "291", + "id": "291" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "208" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "952775630277365760", + "id_str": "952776110613254144", + "in_reply_to_user_id": "291", + "truncated": false, + "retweet_count": "0", + "id": "952776110613254144", + "in_reply_to_status_id": "952775630277365760", + "created_at": "Mon Jan 15 05:35:01 +0000 2018", + "favorited": false, + "full_text": "@goldman YOU TAKE THAT BACK. But seriously, he's obviously TNG. Annoying to start with, grew a beard, did a bunch of really solid stuff mid-career, fucked up the final season and ultimately canceled too soon.", + "lang": "en", + "in_reply_to_screen_name": "goldman", + "in_reply_to_user_id_str": "291" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952775753149509634" + ], + "editableUntil": "2018-01-15T06:33:35.925Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jason Goldman", + "screen_name": "goldman", + "indices": [ + "3", + "11" + ], + "id_str": "291", + "id": "291" + }, + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "13", + "19" + ], + "id_str": "15453", + "id": "15453" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "0", + "id_str": "952775753149509634", + "truncated": false, + "retweet_count": "0", + "id": "952775753149509634", + "created_at": "Mon Jan 15 05:33:35 +0000 2018", + "favorited": false, + "full_text": "RT @goldman: @seldo Hamilton is the DS9 of founding fathers", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952775173064687616" + ], + "editableUntil": "2018-01-15T06:31:17.622Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "187" + ], + "favorite_count": "44", + "id_str": "952775173064687616", + "truncated": false, + "retweet_count": "1", + "id": "952775173064687616", + "created_at": "Mon Jan 15 05:31:17 +0000 2018", + "favorited": false, + "full_text": "\"One of the founding fathers, revered mythic figures of your country, was a whiny jerk\"\n*crickets*\n\n\"I don't like this particular Star Trek spinoff\"\n*riots, shouting, people throw chairs*", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952772152112988161" + ], + "editableUntil": "2018-01-15T06:19:17.371Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "86" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952771948441939968", + "id_str": "952772152112988161", + "in_reply_to_user_id": "17205841", + "truncated": false, + "retweet_count": "0", + "id": "952772152112988161", + "in_reply_to_status_id": "952771948441939968", + "created_at": "Mon Jan 15 05:19:17 +0000 2018", + "favorited": false, + "full_text": "@TatumCreative I am just past that bit! I get it, he had malaria, k. Move the hell on.", + "lang": "en", + "in_reply_to_screen_name": "gr3gtatum", + "in_reply_to_user_id_str": "17205841" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952771153843519488" + ], + "editableUntil": "2018-01-15T06:15:19.365Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "201" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952769168553717760", + "id_str": "952771153843519488", + "in_reply_to_user_id": "17205841", + "truncated": false, + "retweet_count": "0", + "id": "952771153843519488", + "in_reply_to_status_id": "952769168553717760", + "created_at": "Mon Jan 15 05:15:19 +0000 2018", + "favorited": false, + "full_text": "@TatumCreative Yes. It is extremely long and goes into way more detail about housekeeping details than one might wish. (Do you want to know how many servants he had in Paris and what they did? I know.)", + "lang": "en", + "in_reply_to_screen_name": "gr3gtatum", + "in_reply_to_user_id_str": "17205841" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952770902814437378" + ], + "editableUntil": "2018-01-15T06:14:19.515Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tyler", + "screen_name": "tbreisacher", + "indices": [ + "0", + "12" + ], + "id_str": "72212594", + "id": "72212594" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952769605860130816", + "id_str": "952770902814437378", + "in_reply_to_user_id": "72212594", + "truncated": false, + "retweet_count": "0", + "id": "952770902814437378", + "in_reply_to_status_id": "952769605860130816", + "created_at": "Mon Jan 15 05:14:19 +0000 2018", + "favorited": false, + "full_text": "@tbreisacher Not on purpose but I am certainly being ratioed to hell.", + "lang": "en", + "in_reply_to_screen_name": "tbreisacher", + "in_reply_to_user_id_str": "72212594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952767133003390976" + ], + "editableUntil": "2018-01-15T05:59:20.722Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "175" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "952766444726509569", + "id_str": "952767133003390976", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "952767133003390976", + "in_reply_to_status_id": "952766444726509569", + "created_at": "Mon Jan 15 04:59:20 +0000 2018", + "favorited": false, + "full_text": "Adams himself wandered around Europe writing letters and pissing off important diplomats while Franklin kept France on America's side and John Jay negotiated the final treaty.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952766444726509569" + ], + "editableUntil": "2018-01-15T05:56:36.624Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "269" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "952765757447856128", + "id_str": "952766444726509569", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952766444726509569", + "in_reply_to_status_id": "952765757447856128", + "created_at": "Mon Jan 15 04:56:36 +0000 2018", + "favorited": false, + "full_text": "This has come up in several of these biographies, but it is really amazing that the independence of the USA, and the size of its territory, was roughly equal in importance to fishing rights off the coast of Newfoundland. Disagreements about fish nearly sunk the treaty.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952765757447856128" + ], + "editableUntil": "2018-01-15T05:53:52.764Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "234" + ], + "favorite_count": "27", + "id_str": "952765757447856128", + "truncated": false, + "retweet_count": "1", + "id": "952765757447856128", + "created_at": "Mon Jan 15 04:53:52 +0000 2018", + "favorited": false, + "full_text": "I'm reading a biography of John Adams. My impression of him in passing from the biographies of other founding fathers is that he was a prudish, self-important little shit, and this biography is doing nothing to change that impression.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952763318732668928" + ], + "editableUntil": "2018-01-15T05:44:11.329Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Geraldine @everywhereist@mastodon.social", + "screen_name": "everywhereist", + "indices": [ + "3", + "17" + ], + "id_str": "30409200", + "id": "30409200" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "952763318732668928", + "truncated": false, + "retweet_count": "0", + "id": "952763318732668928", + "created_at": "Mon Jan 15 04:44:11 +0000 2018", + "favorited": false, + "full_text": "RT @everywhereist: Instead of deleting abusive comments on my site I'm editing them to reveal what I think the author's intent truly was. h…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952697772628570112" + ], + "editableUntil": "2018-01-15T01:23:43.920Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sacha Sayan", + "screen_name": "sachasayan", + "indices": [ + "0", + "11" + ], + "id_str": "48093353", + "id": "48093353" + }, + { + "name": "Ariel Waldman", + "screen_name": "arielwaldman", + "indices": [ + "24", + "37" + ], + "id_str": "814304", + "id": "814304" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "108" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952697595931000832", + "id_str": "952697772628570112", + "in_reply_to_user_id": "48093353", + "truncated": false, + "retweet_count": "0", + "id": "952697772628570112", + "in_reply_to_status_id": "952697595931000832", + "created_at": "Mon Jan 15 00:23:43 +0000 2018", + "favorited": false, + "full_text": "@sachasayan @paulcbetts @arielwaldman How much more bullshit do I have to wade through until Seven shows up?", + "lang": "en", + "in_reply_to_screen_name": "sachasayan", + "in_reply_to_user_id_str": "48093353" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952697606429278208" + ], + "editableUntil": "2018-01-15T01:23:04.295Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "0", + "11" + ], + "id_str": "68567860", + "id": "68567860" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "12", + "20" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "184" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952696910112088065", + "id_str": "952697606429278208", + "in_reply_to_user_id": "68567860", + "truncated": false, + "retweet_count": "0", + "id": "952697606429278208", + "in_reply_to_status_id": "952696910112088065", + "created_at": "Mon Jan 15 00:23:04 +0000 2018", + "favorited": false, + "full_text": "@AdamRackis @ceejbot We really don't want to fork Node and as a practical matter don't have the resources to do it anyway. We're part of the Node foundation and want to work within it.", + "lang": "en", + "in_reply_to_screen_name": "AdamRackis", + "in_reply_to_user_id_str": "68567860" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952695612041936896" + ], + "editableUntil": "2018-01-15T01:15:08.796Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ariel Waldman", + "screen_name": "arielwaldman", + "indices": [ + "0", + "13" + ], + "id_str": "814304", + "id": "814304" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952695276388548608", + "id_str": "952695612041936896", + "in_reply_to_user_id": "814304", + "truncated": false, + "retweet_count": "0", + "id": "952695612041936896", + "in_reply_to_status_id": "952695276388548608", + "created_at": "Mon Jan 15 00:15:08 +0000 2018", + "favorited": false, + "full_text": "@arielwaldman I'm in Season 2. Does it improve at some point?", + "lang": "en", + "in_reply_to_screen_name": "arielwaldman", + "in_reply_to_user_id_str": "814304" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952695505041027072" + ], + "editableUntil": "2018-01-15T01:14:43.285Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "79" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952695328976719872", + "id_str": "952695505041027072", + "in_reply_to_user_id": "312270808", + "truncated": false, + "retweet_count": "0", + "id": "952695505041027072", + "in_reply_to_status_id": "952695328976719872", + "created_at": "Mon Jan 15 00:14:43 +0000 2018", + "favorited": false, + "full_text": "@RJasonMorgan I've not watched Enterprise yet. How does it get worse than this?", + "lang": "en", + "in_reply_to_user_id_str": "312270808" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952695407464689664" + ], + "editableUntil": "2018-01-15T01:14:20.021Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "0", + "11" + ], + "id_str": "68567860", + "id": "68567860" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "12", + "20" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952695212807213056", + "id_str": "952695407464689664", + "in_reply_to_user_id": "68567860", + "truncated": false, + "retweet_count": "0", + "id": "952695407464689664", + "in_reply_to_status_id": "952695212807213056", + "created_at": "Mon Jan 15 00:14:20 +0000 2018", + "favorited": false, + "full_text": "@AdamRackis @ceejbot I don't need Node to adopt our PR. I would like to see positive progress in the direction we're indicating, but it's not an ultimatum.", + "lang": "en", + "in_reply_to_screen_name": "AdamRackis", + "in_reply_to_user_id_str": "68567860" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952695007890173952" + ], + "editableUntil": "2018-01-15T01:12:44.755Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "95" + ], + "favorite_count": "27", + "id_str": "952695007890173952", + "truncated": false, + "retweet_count": "1", + "id": "952695007890173952", + "created_at": "Mon Jan 15 00:12:44 +0000 2018", + "favorited": false, + "full_text": "I have been trying to watch Voyager today and it truly is the very worst of all the Star Treks.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952691543223164933" + ], + "editableUntil": "2018-01-15T00:58:58.714Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "0", + "11" + ], + "id_str": "68567860", + "id": "68567860" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "12", + "20" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "52" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "952689664086958080", + "id_str": "952691543223164933", + "in_reply_to_user_id": "68567860", + "truncated": false, + "retweet_count": "0", + "id": "952691543223164933", + "in_reply_to_status_id": "952689664086958080", + "created_at": "Sun Jan 14 23:58:58 +0000 2018", + "favorited": false, + "full_text": "@AdamRackis @ceejbot We are not here to start drama.", + "lang": "en", + "in_reply_to_screen_name": "AdamRackis", + "in_reply_to_user_id_str": "68567860" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952602262806855688" + ], + "editableUntil": "2018-01-14T19:04:12.604Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Arlen Abraham", + "screen_name": "arlenarlenarlen", + "indices": [ + "0", + "16" + ], + "id_str": "15314965", + "id": "15314965" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952598821237764097", + "id_str": "952602262806855688", + "in_reply_to_user_id": "15314965", + "truncated": false, + "retweet_count": "0", + "id": "952602262806855688", + "in_reply_to_status_id": "952598821237764097", + "created_at": "Sun Jan 14 18:04:12 +0000 2018", + "favorited": false, + "full_text": "@arlenarlenarlen Straight people are less fond of how they appear in glasses than gay people, statistically speaking. Not sure why that correlation exists.", + "lang": "en", + "in_reply_to_screen_name": "arlenarlenarlen", + "in_reply_to_user_id_str": "15314965" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952585697113735169" + ], + "editableUntil": "2018-01-14T17:58:23.035Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bree (should be writing 🧹🧹🧹)", + "screen_name": "mostlybree", + "indices": [ + "0", + "11" + ], + "id_str": "15587189", + "id": "15587189" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "142" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "952283598740062208", + "id_str": "952585697113735169", + "in_reply_to_user_id": "15587189", + "truncated": false, + "retweet_count": "0", + "id": "952585697113735169", + "in_reply_to_status_id": "952283598740062208", + "created_at": "Sun Jan 14 16:58:23 +0000 2018", + "favorited": false, + "full_text": "@mostlybree This person also thinks buying a large TV would necessitate a $6,000-a-month payment so it's possible they're just not very smart.", + "lang": "en", + "in_reply_to_screen_name": "mostlybree", + "in_reply_to_user_id_str": "15587189" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952584865232244736" + ], + "editableUntil": "2018-01-14T17:55:04.699Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tilde Thurium", + "screen_name": "annthurium", + "indices": [ + "0", + "11" + ], + "id_str": "17101287", + "id": "17101287" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "145" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952584589016367105", + "id_str": "952584865232244736", + "in_reply_to_user_id": "17101287", + "truncated": false, + "retweet_count": "0", + "id": "952584865232244736", + "in_reply_to_status_id": "952584589016367105", + "created_at": "Sun Jan 14 16:55:04 +0000 2018", + "favorited": false, + "full_text": "@annthurium It's news to me too! I was also surprised to hear gay men are less tan, I thought deliberate tanning would outweigh work environment.", + "lang": "en", + "in_reply_to_screen_name": "annthurium", + "in_reply_to_user_id_str": "17101287" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952584510612258816" + ], + "editableUntil": "2018-01-14T17:53:40.151Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Vorpal Hex", + "screen_name": "VorpalHex", + "indices": [ + "0", + "10" + ], + "id_str": "809600853766184960", + "id": "809600853766184960" + }, + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "11", + "22" + ], + "id_str": "68567860", + "id": "68567860" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "23", + "31" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952583939666915329", + "id_str": "952584510612258816", + "in_reply_to_user_id": "809600853766184960", + "truncated": false, + "retweet_count": "0", + "id": "952584510612258816", + "in_reply_to_status_id": "952583939666915329", + "created_at": "Sun Jan 14 16:53:40 +0000 2018", + "favorited": false, + "full_text": "@VorpalHex @AdamRackis @ceejbot If you change your file extensions don't you already know which files are in which language?", + "lang": "en", + "in_reply_to_screen_name": "VorpalHex", + "in_reply_to_user_id_str": "809600853766184960" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952581649593647104" + ], + "editableUntil": "2018-01-14T17:42:18.031Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "226" + ], + "favorite_count": "30", + "in_reply_to_status_id_str": "952581332378333184", + "id_str": "952581649593647104", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "952581649593647104", + "in_reply_to_status_id": "952581332378333184", + "created_at": "Sun Jan 14 16:42:18 +0000 2018", + "favorited": false, + "full_text": "The folks who wrote the paper took the fact that straight men are more tan on average (because they work outdoors more often) and came up with some bullshit about how melanin levels differ in gay people because ????. So wacky.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952581332378333184" + ], + "editableUntil": "2018-01-14T17:41:02.401Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "259" + ], + "favorite_count": "25", + "in_reply_to_status_id_str": "952579321285062657", + "id_str": "952581332378333184", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "952581332378333184", + "in_reply_to_status_id": "952579321285062657", + "created_at": "Sun Jan 14 16:41:02 +0000 2018", + "favorited": false, + "full_text": "Yes, it's possible to tell if you're gay by looking at you. Gay people often dress in a way that signals their sexuality. The \"AI\" 🙄 does no better than a six-question survey of questions like \"do you like how you look in glasses?\" and \"do you work outdoors?\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952579321285062657" + ], + "editableUntil": "2018-01-14T17:33:02.919Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/5M1doUjgWl", + "expanded_url": "https://twitter.com/dakami/status/952365705768222720", + "display_url": "twitter.com/dakami/status/…", + "indices": [ + "102", + "125" + ] + } + ] + }, + "display_text_range": [ + "0", + "252" + ], + "favorite_count": "97", + "id_str": "952579321285062657", + "truncated": false, + "retweet_count": "23", + "id": "952579321285062657", + "possibly_sensitive": false, + "created_at": "Sun Jan 14 16:33:02 +0000 2018", + "favorited": false, + "full_text": "That \"AI can tell if you're gay just by looking at you\" study has been really thoroughly discredited: https://t.co/5M1doUjgWl It turns out gay people groom themselves differently, and eye shadow is not an intrinsic biological feature of straight women.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952575547028078592" + ], + "editableUntil": "2018-01-14T17:18:03.066Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Martin MacKerel", + "screen_name": "kemokid", + "indices": [ + "0", + "8" + ], + "id_str": "15301778", + "id": "15301778" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "14" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952441038399918080", + "id_str": "952575547028078592", + "in_reply_to_user_id": "15301778", + "truncated": false, + "retweet_count": "0", + "id": "952575547028078592", + "in_reply_to_status_id": "952441038399918080", + "created_at": "Sun Jan 14 16:18:03 +0000 2018", + "favorited": false, + "full_text": "@kemokid What?", + "lang": "en", + "in_reply_to_screen_name": "kemokid", + "in_reply_to_user_id_str": "15301778" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952574335247466496" + ], + "editableUntil": "2018-01-14T17:13:14.155Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Gender API", + "screen_name": "Gender_API", + "indices": [ + "0", + "11" + ], + "id_str": "2960685238", + "id": "2960685238" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "56" + ], + "favorite_count": "298", + "in_reply_to_status_id_str": "915535864662564864", + "id_str": "952574335247466496", + "in_reply_to_user_id": "2960685238", + "truncated": false, + "retweet_count": "5", + "id": "952574335247466496", + "in_reply_to_status_id": "915535864662564864", + "created_at": "Sun Jan 14 16:13:14 +0000 2018", + "favorited": false, + "full_text": "@Gender_API This is a terrible, terrible, terrible idea.", + "lang": "en", + "in_reply_to_screen_name": "Gender_API", + "in_reply_to_user_id_str": "2960685238" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952419467870404608" + ], + "editableUntil": "2018-01-14T06:57:50.895Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952419467870404608/photo/1", + "indices": [ + "41", + "64" + ], + "url": "https://t.co/8I0ogIbj1B", + "media_url": "http://pbs.twimg.com/media/DTesZZLUMAA-i6w.jpg", + "id_str": "952419398467203072", + "id": "952419398467203072", + "media_url_https": "https://pbs.twimg.com/media/DTesZZLUMAA-i6w.jpg", + "sizes": { + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "536", + "h": "604", + "resize": "fit" + }, + "small": { + "w": "536", + "h": "604", + "resize": "fit" + }, + "medium": { + "w": "536", + "h": "604", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/8I0ogIbj1B" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "64" + ], + "favorite_count": "27", + "id_str": "952419467870404608", + "truncated": false, + "retweet_count": "1", + "id": "952419467870404608", + "possibly_sensitive": false, + "created_at": "Sun Jan 14 05:57:50 +0000 2018", + "favorited": false, + "full_text": "It me, but mostly because I'm forgetful. https://t.co/8I0ogIbj1B", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952419467870404608/photo/1", + "indices": [ + "41", + "64" + ], + "url": "https://t.co/8I0ogIbj1B", + "media_url": "http://pbs.twimg.com/media/DTesZZLUMAA-i6w.jpg", + "id_str": "952419398467203072", + "id": "952419398467203072", + "media_url_https": "https://pbs.twimg.com/media/DTesZZLUMAA-i6w.jpg", + "sizes": { + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "536", + "h": "604", + "resize": "fit" + }, + "small": { + "w": "536", + "h": "604", + "resize": "fit" + }, + "medium": { + "w": "536", + "h": "604", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/8I0ogIbj1B" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952408694553112576" + ], + "editableUntil": "2018-01-14T06:15:02.336Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Baldwin", + "screen_name": "adam_baldwin", + "indices": [ + "0", + "13" + ], + "id_str": "14878068", + "id": "14878068" + }, + { + "name": "Babyfro", + "screen_name": "babyfro", + "indices": [ + "14", + "22" + ], + "id_str": "14883693", + "id": "14883693" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "134" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "952397080693161984", + "id_str": "952408694553112576", + "in_reply_to_user_id": "14878068", + "truncated": false, + "retweet_count": "0", + "id": "952408694553112576", + "in_reply_to_status_id": "952397080693161984", + "created_at": "Sun Jan 14 05:15:02 +0000 2018", + "favorited": false, + "full_text": "@adam_baldwin @babyfro There is literally nothing visible in this picture that suggests anything other than an A+ purchasing decision.", + "lang": "en", + "in_reply_to_screen_name": "adam_baldwin", + "in_reply_to_user_id_str": "14878068" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952393905793728512" + ], + "editableUntil": "2018-01-14T05:16:16.421Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Eric Holthaus", + "screen_name": "EricHolthaus", + "indices": [ + "3", + "16" + ], + "id_str": "290180065", + "id": "290180065" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "952393905793728512", + "truncated": false, + "retweet_count": "0", + "id": "952393905793728512", + "created_at": "Sun Jan 14 04:16:16 +0000 2018", + "favorited": false, + "full_text": "RT @EricHolthaus: Puerto Rico, Day 115:\n—About 1.5 million people still w/o power\n—Hundreds of thousands still w/o clean water\n—Still a hum…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952389216788361216" + ], + "editableUntil": "2018-01-14T04:57:38.475Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Scott Dworkin", + "screen_name": "funder", + "indices": [ + "3", + "10" + ], + "id_str": "14247236", + "id": "14247236" + } + ], + "urls": [ + { + "url": "https://t.co/pq0b7b1BEW", + "expanded_url": "https://www.pscp.tv/w/bSlIFzFXZ0tnYWtidkd6RXZ8MWt2SnBrQXphUGtHRc5vSsJu_YYyqxGEwRHzV6izHFqQkfQOk7xDYSW37NtW", + "display_url": "pscp.tv/w/bSlIFzFXZ0tn…", + "indices": [ + "74", + "97" + ] + } + ] + }, + "display_text_range": [ + "0", + "97" + ], + "favorite_count": "0", + "id_str": "952389216788361216", + "truncated": false, + "retweet_count": "0", + "id": "952389216788361216", + "possibly_sensitive": false, + "created_at": "Sun Jan 14 03:57:38 +0000 2018", + "favorited": false, + "full_text": "RT @funder: The word “shithole” is being projected onto Trump’s DC hotel. https://t.co/pq0b7b1BEW", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952389065696985090" + ], + "editableUntil": "2018-01-14T04:57:02.452Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "meat.io on bluesky", + "screen_name": "meat", + "indices": [ + "0", + "5" + ], + "id_str": "21006515", + "id": "21006515" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "40" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952093685033795584", + "id_str": "952389065696985090", + "in_reply_to_user_id": "21006515", + "truncated": false, + "retweet_count": "0", + "id": "952389065696985090", + "in_reply_to_status_id": "952093685033795584", + "created_at": "Sun Jan 14 03:57:02 +0000 2018", + "favorited": false, + "full_text": "@meat Green card process being terrible?", + "lang": "en", + "in_reply_to_screen_name": "meat", + "in_reply_to_user_id_str": "21006515" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952388682236936192" + ], + "editableUntil": "2018-01-14T04:55:31.028Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jen reiber walsh", + "screen_name": "jrw", + "indices": [ + "0", + "4" + ], + "id_str": "15420902", + "id": "15420902" + }, + { + "name": "Nolan Caudill", + "screen_name": "nolancaudill", + "indices": [ + "5", + "18" + ], + "id_str": "23081862", + "id": "23081862" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952388577131773952", + "id_str": "952388682236936192", + "in_reply_to_user_id": "15420902", + "truncated": false, + "retweet_count": "0", + "id": "952388682236936192", + "in_reply_to_status_id": "952388577131773952", + "created_at": "Sun Jan 14 03:55:31 +0000 2018", + "favorited": false, + "full_text": "@jrw @nolancaudill ME NEITHER", + "lang": "en", + "in_reply_to_screen_name": "jrw", + "in_reply_to_user_id_str": "15420902" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952348404411019265" + ], + "editableUntil": "2018-01-14T02:15:28.046Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "David Schmitt", + "screen_name": "dev_el_ops", + "indices": [ + "0", + "11" + ], + "id_str": "2884734326", + "id": "2884734326" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "157" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952346710378008576", + "id_str": "952348404411019265", + "in_reply_to_user_id": "2884734326", + "truncated": false, + "retweet_count": "0", + "id": "952348404411019265", + "in_reply_to_status_id": "952346710378008576", + "created_at": "Sun Jan 14 01:15:28 +0000 2018", + "favorited": false, + "full_text": "@dev_el_ops I'm not saying she doesn't have any experience. I'm saying I think she should run for a lower office before senate. I think any candidate should.", + "lang": "en", + "in_reply_to_screen_name": "dev_el_ops", + "in_reply_to_user_id_str": "2884734326" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952348169483968512" + ], + "editableUntil": "2018-01-14T02:14:32.035Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "thepaulstella", + "screen_name": "thepaulstella", + "indices": [ + "0", + "14" + ], + "id_str": "1567181394345861120", + "id": "1567181394345861120" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "96" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952344977056649217", + "id_str": "952348169483968512", + "in_reply_to_user_id": "11133992", + "truncated": false, + "retweet_count": "0", + "id": "952348169483968512", + "in_reply_to_status_id": "952344977056649217", + "created_at": "Sun Jan 14 01:14:32 +0000 2018", + "favorited": false, + "full_text": "@thepaulstella Similarly, though less so since congress is much less responsibility than senate.", + "lang": "en", + "in_reply_to_user_id_str": "11133992" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952340070731735041" + ], + "editableUntil": "2018-01-14T01:42:21.142Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashley", + "screen_name": "rabcyr", + "indices": [ + "0", + "7" + ], + "id_str": "26157562", + "id": "26157562" + } + ], + "urls": [ + { + "url": "https://t.co/UB8Q92TW1M", + "expanded_url": "https://www.washingtonpost.com/local/md-politics/chelsea-manning-files-to-run-for-us-senate-in-maryland/2018/01/13/6439f0d0-f88c-11e7-beb6-c8d48830c54d_story.html?utm_term=.67db47889ab5", + "display_url": "washingtonpost.com/local/md-polit…", + "indices": [ + "29", + "52" + ] + } + ] + }, + "display_text_range": [ + "0", + "52" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952339797279850496", + "id_str": "952340070731735041", + "in_reply_to_user_id": "26157562", + "truncated": false, + "retweet_count": "0", + "id": "952340070731735041", + "in_reply_to_status_id": "952339797279850496", + "possibly_sensitive": false, + "created_at": "Sun Jan 14 00:42:21 +0000 2018", + "favorited": false, + "full_text": "@rabcyr The Washington Post: https://t.co/UB8Q92TW1M", + "lang": "en", + "in_reply_to_screen_name": "rabcyr", + "in_reply_to_user_id_str": "26157562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952335978852528128" + ], + "editableUntil": "2018-01-14T01:26:05.562Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "176" + ], + "favorite_count": "85", + "id_str": "952335978852528128", + "truncated": false, + "retweet_count": "3", + "id": "952335978852528128", + "created_at": "Sun Jan 14 00:26:05 +0000 2018", + "favorited": false, + "full_text": "I love Chelsea Manning with all my heart but I'll be honest, my first reaction is that maybe she should have run for state or local office before kicking off a senate campaign.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952324964497080320" + ], + "editableUntil": "2018-01-14T00:42:19.535Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sahil Kapur", + "screen_name": "sahilkapur", + "indices": [ + "3", + "14" + ], + "id_str": "19847765", + "id": "19847765" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "952324964497080320", + "truncated": false, + "retweet_count": "0", + "id": "952324964497080320", + "created_at": "Sat Jan 13 23:42:19 +0000 2018", + "favorited": false, + "full_text": "RT @sahilkapur: It’s weird that I have more security in logging into my gmail account than Hawaii apparently does in freaking out its entir…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952322764144128000" + ], + "editableUntil": "2018-01-14T00:33:34.930Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952322764144128000/photo/1", + "indices": [ + "61", + "84" + ], + "url": "https://t.co/VJgMonemwd", + "media_url": "http://pbs.twimg.com/media/DTdUgC5UMAA7Z2b.jpg", + "id_str": "952322755721965568", + "id": "952322755721965568", + "media_url_https": "https://pbs.twimg.com/media/DTdUgC5UMAA7Z2b.jpg", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/VJgMonemwd" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952321875069276165", + "id_str": "952322764144128000", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "952322764144128000", + "in_reply_to_status_id": "952321875069276165", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 23:33:34 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ Yes! Where SF meets the ocean is one long beach. https://t.co/VJgMonemwd", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952322764144128000/photo/1", + "indices": [ + "61", + "84" + ], + "url": "https://t.co/VJgMonemwd", + "media_url": "http://pbs.twimg.com/media/DTdUgC5UMAA7Z2b.jpg", + "id_str": "952322755721965568", + "id": "952322755721965568", + "media_url_https": "https://pbs.twimg.com/media/DTdUgC5UMAA7Z2b.jpg", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/VJgMonemwd" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952320880704503809" + ], + "editableUntil": "2018-01-14T00:26:05.883Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952320880704503809/video/1", + "indices": [ + "13", + "36" + ], + "url": "https://t.co/IXGNoO5Gb7", + "media_url": "http://pbs.twimg.com/ext_tw_video_thumb/952320839902314496/pu/img/l37QtATjhN3gXpF_.jpg", + "id_str": "952320839902314496", + "id": "952320839902314496", + "media_url_https": "https://pbs.twimg.com/ext_tw_video_thumb/952320839902314496/pu/img/l37QtATjhN3gXpF_.jpg", + "sizes": { + "medium": { + "w": "675", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "720", + "h": "1280", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "383", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/IXGNoO5Gb7" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "14", + "in_reply_to_status_id_str": "952311091769430016", + "id_str": "952320880704503809", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "952320880704503809", + "in_reply_to_status_id": "952311091769430016", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 23:26:05 +0000 2018", + "favorited": false, + "full_text": "Ocean beach. https://t.co/IXGNoO5Gb7", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952320880704503809/video/1", + "indices": [ + "13", + "36" + ], + "url": "https://t.co/IXGNoO5Gb7", + "media_url": "http://pbs.twimg.com/ext_tw_video_thumb/952320839902314496/pu/img/l37QtATjhN3gXpF_.jpg", + "id_str": "952320839902314496", + "video_info": { + "aspect_ratio": [ + "9", + "16" + ], + "duration_millis": "10850", + "variants": [ + { + "bitrate": "256000", + "content_type": "video/mp4", + "url": "https://video.twimg.com/ext_tw_video/952320839902314496/pu/vid/180x320/z2WFTD2Y21wFZBSE.mp4" + }, + { + "bitrate": "832000", + "content_type": "video/mp4", + "url": "https://video.twimg.com/ext_tw_video/952320839902314496/pu/vid/360x640/taXq3zayBGnd6Sf4.mp4" + }, + { + "bitrate": "2176000", + "content_type": "video/mp4", + "url": "https://video.twimg.com/ext_tw_video/952320839902314496/pu/vid/720x1280/V4Tyw7vfV8VPZs9n.mp4" + }, + { + "content_type": "application/x-mpegURL", + "url": "https://video.twimg.com/ext_tw_video/952320839902314496/pu/pl/w1TICJMAuhrZnPtL.m3u8" + } + ] + }, + "additional_media_info": { + "monetizable": false + }, + "id": "952320839902314496", + "media_url_https": "https://pbs.twimg.com/ext_tw_video_thumb/952320839902314496/pu/img/l37QtATjhN3gXpF_.jpg", + "sizes": { + "medium": { + "w": "675", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "720", + "h": "1280", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "383", + "h": "680", + "resize": "fit" + } + }, + "type": "video", + "display_url": "pic.twitter.com/IXGNoO5Gb7" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952311091769430016" + ], + "editableUntil": "2018-01-13T23:47:12.019Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952311091769430016/photo/1", + "indices": [ + "4", + "27" + ], + "url": "https://t.co/6mfvhz83SZ", + "media_url": "http://pbs.twimg.com/media/DTdJ4pkVoAAZ9DZ.jpg", + "id_str": "952311083791917056", + "id": "952311083791917056", + "media_url_https": "https://pbs.twimg.com/media/DTdJ4pkVoAAZ9DZ.jpg", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/6mfvhz83SZ" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "27" + ], + "favorite_count": "18", + "in_reply_to_status_id_str": "952310549726904320", + "id_str": "952311091769430016", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952311091769430016", + "in_reply_to_status_id": "952310549726904320", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 22:47:12 +0000 2018", + "favorited": false, + "full_text": "DOG https://t.co/6mfvhz83SZ", + "lang": "und", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952311091769430016/photo/1", + "indices": [ + "4", + "27" + ], + "url": "https://t.co/6mfvhz83SZ", + "media_url": "http://pbs.twimg.com/media/DTdJ4pkVoAAZ9DZ.jpg", + "id_str": "952311083791917056", + "id": "952311083791917056", + "media_url_https": "https://pbs.twimg.com/media/DTdJ4pkVoAAZ9DZ.jpg", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/6mfvhz83SZ" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952310797446692864" + ], + "editableUntil": "2018-01-13T23:46:01.847Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jason quense", + "screen_name": "monasticpanic", + "indices": [ + "0", + "14" + ], + "id_str": "158805214", + "id": "158805214" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "181" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952310349017042949", + "id_str": "952310797446692864", + "in_reply_to_user_id": "158805214", + "truncated": false, + "retweet_count": "0", + "id": "952310797446692864", + "in_reply_to_status_id": "952310349017042949", + "created_at": "Sat Jan 13 22:46:01 +0000 2018", + "favorited": false, + "full_text": "@monasticpanic Right, but that's why it's uncompelling. Pointing out that people are bad at their religion doesn't really advance any kind of debate on immigration or anything else.", + "lang": "en", + "in_reply_to_screen_name": "monasticpanic", + "in_reply_to_user_id_str": "158805214" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952310549726904320" + ], + "editableUntil": "2018-01-13T23:45:02.786Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952310549726904320/photo/1", + "indices": [ + "80", + "103" + ], + "url": "https://t.co/hvhWd2VDzW", + "media_url": "http://pbs.twimg.com/media/DTdJYqsUMAAew2v.jpg", + "id_str": "952310534337998848", + "id": "952310534337998848", + "media_url_https": "https://pbs.twimg.com/media/DTdJYqsUMAAew2v.jpg", + "sizes": { + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/hvhWd2VDzW" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "20", + "in_reply_to_status_id_str": "952301593667366913", + "id_str": "952310549726904320", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "6", + "id": "952310549726904320", + "in_reply_to_status_id": "952301593667366913", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 22:45:02 +0000 2018", + "favorited": false, + "full_text": "Sometimes it seems like everything cool in America was, ultimately, FDR's idea. https://t.co/hvhWd2VDzW", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952310549726904320/photo/1", + "indices": [ + "80", + "103" + ], + "url": "https://t.co/hvhWd2VDzW", + "media_url": "http://pbs.twimg.com/media/DTdJYqsUMAAew2v.jpg", + "id_str": "952310534337998848", + "id": "952310534337998848", + "media_url_https": "https://pbs.twimg.com/media/DTdJYqsUMAAew2v.jpg", + "sizes": { + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/hvhWd2VDzW" + }, + { + "expanded_url": "https://twitter.com/seldo/status/952310549726904320/photo/1", + "indices": [ + "80", + "103" + ], + "url": "https://t.co/hvhWd2VDzW", + "media_url": "http://pbs.twimg.com/media/DTdJYquV4AAln0_.jpg", + "id_str": "952310534346498048", + "id": "952310534346498048", + "media_url_https": "https://pbs.twimg.com/media/DTdJYquV4AAln0_.jpg", + "sizes": { + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/hvhWd2VDzW" + }, + { + "expanded_url": "https://twitter.com/seldo/status/952310549726904320/photo/1", + "indices": [ + "80", + "103" + ], + "url": "https://t.co/hvhWd2VDzW", + "media_url": "http://pbs.twimg.com/media/DTdJYqtVwAAhW6k.jpg", + "id_str": "952310534342295552", + "id": "952310534342295552", + "media_url_https": "https://pbs.twimg.com/media/DTdJYqtVwAAhW6k.jpg", + "sizes": { + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/hvhWd2VDzW" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952305954279714817" + ], + "editableUntil": "2018-01-13T23:26:47.146Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/kizXb8EYRg", + "expanded_url": "https://twitter.com/jamesmartinsj/status/951826937646845952", + "display_url": "twitter.com/jamesmartinsj/…", + "indices": [ + "185", + "208" + ] + } + ] + }, + "display_text_range": [ + "0", + "208" + ], + "favorite_count": "33", + "id_str": "952305954279714817", + "truncated": false, + "retweet_count": "5", + "id": "952305954279714817", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 22:26:47 +0000 2018", + "favorited": false, + "full_text": "\"Jesus was an immigrant\" is such a weirdly uncompelling argument. It is fine for immigrants to not be comic book super heroes. They can just be normal folks. Immigration is still good. https://t.co/kizXb8EYRg", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952301593667366913" + ], + "editableUntil": "2018-01-13T23:09:27.495Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952301593667366913/photo/1", + "indices": [ + "46", + "69" + ], + "url": "https://t.co/i4LmE76fPe", + "media_url": "http://pbs.twimg.com/media/DTdBPfIVoAAQXWI.jpg", + "id_str": "952301580522463232", + "id": "952301580522463232", + "media_url_https": "https://pbs.twimg.com/media/DTdBPfIVoAAQXWI.jpg", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/i4LmE76fPe" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "952293639769620480", + "id_str": "952301593667366913", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952301593667366913", + "in_reply_to_status_id": "952293639769620480", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 22:09:27 +0000 2018", + "favorited": false, + "full_text": "Quite some way to go, but downhill from here. https://t.co/i4LmE76fPe", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952301593667366913/photo/1", + "indices": [ + "46", + "69" + ], + "url": "https://t.co/i4LmE76fPe", + "media_url": "http://pbs.twimg.com/media/DTdBPfIVoAAQXWI.jpg", + "id_str": "952301580522463232", + "id": "952301580522463232", + "media_url_https": "https://pbs.twimg.com/media/DTdBPfIVoAAQXWI.jpg", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/i4LmE76fPe" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952298459427610624" + ], + "editableUntil": "2018-01-13T22:57:00.234Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dennis Collinson", + "screen_name": "dnscollective", + "indices": [ + "0", + "14" + ], + "id_str": "30498562", + "id": "30498562" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "15", + "23" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "60" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952298127058395137", + "id_str": "952298459427610624", + "in_reply_to_user_id": "30498562", + "truncated": false, + "retweet_count": "0", + "id": "952298459427610624", + "in_reply_to_status_id": "952298127058395137", + "created_at": "Sat Jan 13 21:57:00 +0000 2018", + "favorited": false, + "full_text": "@dnscollective @ceejbot Political donations aren't thoughts.", + "lang": "en", + "in_reply_to_screen_name": "dnscollective", + "in_reply_to_user_id_str": "30498562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952297886569545728" + ], + "editableUntil": "2018-01-13T22:54:43.654Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dennis Collinson", + "screen_name": "dnscollective", + "indices": [ + "0", + "14" + ], + "id_str": "30498562", + "id": "30498562" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "15", + "23" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "162" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952297631484493824", + "id_str": "952297886569545728", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952297886569545728", + "in_reply_to_status_id": "952297631484493824", + "created_at": "Sat Jan 13 21:54:43 +0000 2018", + "favorited": false, + "full_text": "@dnscollective @ceejbot I'm walking a very fine line here. I think his actions were detestable, I think he paid a price for them, and I'm willing to call a truce.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952297631484493824" + ], + "editableUntil": "2018-01-13T22:53:42.837Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dennis Collinson", + "screen_name": "dnscollective", + "indices": [ + "0", + "14" + ], + "id_str": "30498562", + "id": "30498562" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "15", + "23" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952297353414717440", + "id_str": "952297631484493824", + "in_reply_to_user_id": "30498562", + "truncated": false, + "retweet_count": "0", + "id": "952297631484493824", + "in_reply_to_status_id": "952297353414717440", + "created_at": "Sat Jan 13 21:53:42 +0000 2018", + "favorited": false, + "full_text": "@dnscollective @ceejbot He unblocked me yesterday apparently!", + "lang": "en", + "in_reply_to_screen_name": "dnscollective", + "in_reply_to_user_id_str": "30498562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952293639769620480" + ], + "editableUntil": "2018-01-13T22:37:51.138Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952293639769620480/photo/1", + "indices": [ + "52", + "75" + ], + "url": "https://t.co/6fB4qrNMx2", + "media_url": "http://pbs.twimg.com/media/DTc57o7VoAAEOs7.jpg", + "id_str": "952293542973513728", + "id": "952293542973513728", + "media_url_https": "https://pbs.twimg.com/media/DTc57o7VoAAEOs7.jpg", + "sizes": { + "medium": { + "w": "768", + "h": "1024", + "resize": "fit" + }, + "large": { + "w": "768", + "h": "1024", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/6fB4qrNMx2" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "75" + ], + "favorite_count": "22", + "id_str": "952293639769620480", + "truncated": false, + "retweet_count": "0", + "id": "952293639769620480", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 21:37:51 +0000 2018", + "favorited": false, + "full_text": "Oh hello, I am walking to the ocean this afternoon. https://t.co/6fB4qrNMx2", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/952293639769620480/photo/1", + "indices": [ + "52", + "75" + ], + "url": "https://t.co/6fB4qrNMx2", + "media_url": "http://pbs.twimg.com/media/DTc57o7VoAAEOs7.jpg", + "id_str": "952293542973513728", + "id": "952293542973513728", + "media_url_https": "https://pbs.twimg.com/media/DTc57o7VoAAEOs7.jpg", + "sizes": { + "medium": { + "w": "768", + "h": "1024", + "resize": "fit" + }, + "large": { + "w": "768", + "h": "1024", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/6fB4qrNMx2" + }, + { + "expanded_url": "https://twitter.com/seldo/status/952293639769620480/photo/1", + "indices": [ + "52", + "75" + ], + "url": "https://t.co/6fB4qrNMx2", + "media_url": "http://pbs.twimg.com/media/DTc57rxUMAAaI__.jpg", + "id_str": "952293543736782848", + "id": "952293543736782848", + "media_url_https": "https://pbs.twimg.com/media/DTc57rxUMAAaI__.jpg", + "sizes": { + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "768", + "h": "1024", + "resize": "fit" + }, + "medium": { + "w": "768", + "h": "1024", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/6fB4qrNMx2" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952285466975289344" + ], + "editableUntil": "2018-01-13T22:05:22.592Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jake Williams", + "screen_name": "MalwareJake", + "indices": [ + "3", + "15" + ], + "id_str": "77346069", + "id": "77346069" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "952285466975289344", + "truncated": false, + "retweet_count": "0", + "id": "952285466975289344", + "created_at": "Sat Jan 13 21:05:22 +0000 2018", + "favorited": false, + "full_text": "RT @MalwareJake: The official Linux kernel mailing list being offline for days because it's hosted on a home Linux server that suffered a p…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952284214400991232" + ], + "editableUntil": "2018-01-13T22:00:23.955Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "81" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952284065943625728", + "id_str": "952284214400991232", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952284214400991232", + "in_reply_to_status_id": "952284065943625728", + "created_at": "Sat Jan 13 21:00:23 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes I also identify heavily with the movie because of my llama-like hair.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952284065943625728" + ], + "editableUntil": "2018-01-13T21:59:48.560Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "105" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952283447090823169", + "id_str": "952284065943625728", + "in_reply_to_user_id": "154189594", + "truncated": false, + "retweet_count": "0", + "id": "952284065943625728", + "in_reply_to_status_id": "952283447090823169", + "created_at": "Sat Jan 13 20:59:48 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes My bucket list includes bursting into a room by kicking the door open and saying \"BOOM baby!\"", + "lang": "en", + "in_reply_to_screen_name": "tandemNuclei", + "in_reply_to_user_id_str": "154189594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952282320823730176" + ], + "editableUntil": "2018-01-13T21:52:52.491Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952279908427866112", + "id_str": "952282320823730176", + "in_reply_to_user_id": "154189594", + "truncated": false, + "retweet_count": "0", + "id": "952282320823730176", + "in_reply_to_status_id": "952279908427866112", + "created_at": "Sat Jan 13 20:52:52 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes Best Disney movie. Possibly best movie.", + "lang": "en", + "in_reply_to_screen_name": "tandemNuclei", + "in_reply_to_user_id_str": "154189594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952271882090196992" + ], + "editableUntil": "2018-01-13T21:11:23.703Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Josh Marshall", + "screen_name": "joshtpm", + "indices": [ + "3", + "11" + ], + "id_str": "21268897", + "id": "21268897" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "952271882090196992", + "truncated": false, + "retweet_count": "0", + "id": "952271882090196992", + "created_at": "Sat Jan 13 20:11:23 +0000 2018", + "favorited": false, + "full_text": "RT @joshtpm: If this was just pushing the wrong button I think you need an additional explanation why it took 38 minutes to sound an all cl…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952269773177372673" + ], + "editableUntil": "2018-01-13T21:03:00.899Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "M.G. Siegler", + "screen_name": "mgsiegler", + "indices": [ + "0", + "10" + ], + "id_str": "652193", + "id": "652193" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952257328555765760", + "id_str": "952269773177372673", + "in_reply_to_user_id": "652193", + "truncated": false, + "retweet_count": "0", + "id": "952269773177372673", + "in_reply_to_status_id": "952257328555765760", + "created_at": "Sat Jan 13 20:03:00 +0000 2018", + "favorited": false, + "full_text": "@mgsiegler The only winning move is not to play.", + "lang": "en", + "in_reply_to_screen_name": "mgsiegler", + "in_reply_to_user_id_str": "652193" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952269401545297921" + ], + "editableUntil": "2018-01-13T21:01:32.295Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Late Stage Millennial", + "screen_name": "TheAmyCode", + "indices": [ + "0", + "11" + ], + "id_str": "1429148504", + "id": "1429148504" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "33" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952268679529418752", + "id_str": "952269401545297921", + "in_reply_to_user_id": "1429148504", + "truncated": false, + "retweet_count": "0", + "id": "952269401545297921", + "in_reply_to_status_id": "952268679529418752", + "created_at": "Sat Jan 13 20:01:32 +0000 2018", + "favorited": false, + "full_text": "@TheAmyCode Such a great feeling.", + "lang": "en", + "in_reply_to_screen_name": "TheAmyCode", + "in_reply_to_user_id_str": "1429148504" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952266317981077504" + ], + "editableUntil": "2018-01-13T20:49:17.116Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/IZfLRrdXly", + "expanded_url": "https://twitter.com/tulsipress/status/952244980944338944", + "display_url": "twitter.com/tulsipress/sta…", + "indices": [ + "33", + "56" + ] + } + ] + }, + "display_text_range": [ + "0", + "56" + ], + "favorite_count": "20", + "id_str": "952266317981077504", + "truncated": false, + "retweet_count": "1", + "id": "952266317981077504", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 19:49:17 +0000 2018", + "favorited": false, + "full_text": "Why do we even have that lever!? https://t.co/IZfLRrdXly", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952238493178126337" + ], + "editableUntil": "2018-01-13T18:58:43.166Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "9", + "19" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "20", + "31" + ], + "id_str": "622960227", + "id": "622960227" + }, + { + "name": "Bradley Farias", + "screen_name": "bradleymeck", + "indices": [ + "32", + "44" + ], + "id_str": "15338477", + "id": "15338477" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "45", + "54" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "207" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952235723507228672", + "id_str": "952238493178126337", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "952238493178126337", + "in_reply_to_status_id": "952235723507228672", + "created_at": "Sat Jan 13 17:58:43 +0000 2018", + "favorited": false, + "full_text": "@nebrius @aredridel @bitandbang @bradleymeck @addaleax Analyzing package.json is for technical reasons orders of magnitude faster than inspecting any other file in a package, so I wouldn't use the third way.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952235693983416320" + ], + "editableUntil": "2018-01-13T18:47:35.786Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "22", + "in_reply_to_status_id_str": "952234733655609344", + "id_str": "952235693983416320", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "952235693983416320", + "in_reply_to_status_id": "952234733655609344", + "created_at": "Sat Jan 13 17:47:35 +0000 2018", + "favorited": false, + "full_text": "\"Premium Cracker\" is my middle name.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952235531483602944" + ], + "editableUntil": "2018-01-13T18:46:57.043Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "9", + "20" + ], + "id_str": "622960227", + "id": "622960227" + }, + { + "name": "Bradley Farias", + "screen_name": "bradleymeck", + "indices": [ + "21", + "33" + ], + "id_str": "15338477", + "id": "15338477" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "34", + "44" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "45", + "54" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "165" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952235018671210498", + "id_str": "952235531483602944", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "952235531483602944", + "in_reply_to_status_id": "952235018671210498", + "created_at": "Sat Jan 13 17:46:57 +0000 2018", + "favorited": false, + "full_text": "@nebrius @bitandbang @bradleymeck @aredridel @addaleax It's orthogonal to your broader point anyway, which is that build steps do many things, not just load modules.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952235191883280384" + ], + "editableUntil": "2018-01-13T18:45:36.076Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "9", + "19" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "20", + "31" + ], + "id_str": "622960227", + "id": "622960227" + }, + { + "name": "Bradley Farias", + "screen_name": "bradleymeck", + "indices": [ + "32", + "44" + ], + "id_str": "15338477", + "id": "15338477" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "45", + "54" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "205" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952233196157992960", + "id_str": "952235191883280384", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "952235191883280384", + "in_reply_to_status_id": "952233196157992960", + "created_at": "Sat Jan 13 17:45:36 +0000 2018", + "favorited": false, + "full_text": "@nebrius @aredridel @bitandbang @bradleymeck @addaleax Hmmm. I don't, but probably can. Is there a reliable way to determine it from the package.json? Is just having typescript as a dep enough of a signal?", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952234733655609344" + ], + "editableUntil": "2018-01-13T18:43:46.826Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "90" + ], + "favorite_count": "24", + "id_str": "952234733655609344", + "truncated": false, + "retweet_count": "1", + "id": "952234733655609344", + "created_at": "Sat Jan 13 17:43:46 +0000 2018", + "favorited": false, + "full_text": "Instacart included two free boxes of \"premium crackers\" in my order and I feel called out.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952233982262853632" + ], + "editableUntil": "2018-01-13T18:40:47.680Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "9", + "20" + ], + "id_str": "622960227", + "id": "622960227" + }, + { + "name": "Bradley Farias", + "screen_name": "bradleymeck", + "indices": [ + "21", + "33" + ], + "id_str": "15338477", + "id": "15338477" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "34", + "44" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "45", + "54" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "147" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952232689674829824", + "id_str": "952233982262853632", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "1", + "id": "952233982262853632", + "in_reply_to_status_id": "952232689674829824", + "created_at": "Sat Jan 13 17:40:47 +0000 2018", + "favorited": false, + "full_text": "@nebrius @bitandbang @bradleymeck @aredridel @addaleax I would like to go on record as predicting that JSX will become a native part of JavaScript.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952233129137393666" + ], + "editableUntil": "2018-01-13T18:37:24.279Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/H6LROp28SD", + "expanded_url": "https://twitter.com/mlnow/status/952230037562056707", + "display_url": "twitter.com/mlnow/status/9…", + "indices": [ + "30", + "53" + ] + } + ] + }, + "display_text_range": [ + "0", + "53" + ], + "favorite_count": "5", + "id_str": "952233129137393666", + "truncated": false, + "retweet_count": "3", + "id": "952233129137393666", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 17:37:24 +0000 2018", + "favorited": false, + "full_text": "Noooooooo *runs to subscribe* https://t.co/H6LROp28SD", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952230977157267456" + ], + "editableUntil": "2018-01-13T18:28:51.207Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Bradley Farias", + "screen_name": "bradleymeck", + "indices": [ + "9", + "21" + ], + "id_str": "15338477", + "id": "15338477" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "22", + "32" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "33", + "42" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "136" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952230627742441472", + "id_str": "952230977157267456", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "952230977157267456", + "in_reply_to_status_id": "952230627742441472", + "created_at": "Sat Jan 13 17:28:51 +0000 2018", + "favorited": false, + "full_text": "@nebrius @bradleymeck @aredridel @addaleax I think it's good that you recognize how that preference might be swaying your opinions here.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952230617575448576" + ], + "editableUntil": "2018-01-13T18:27:25.476Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "9", + "19" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "20", + "29" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "224" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952230003789381632", + "id_str": "952230617575448576", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "952230617575448576", + "in_reply_to_status_id": "952230003789381632", + "created_at": "Sat Jan 13 17:27:25 +0000 2018", + "favorited": false, + "full_text": "@nebrius @aredridel @addaleax I look forward to your further thoughts. We are, as somebody said at a conference recently, implementing every idea we can think of and seeing what works. That's the only way to find the answer.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952229969370869760" + ], + "editableUntil": "2018-01-13T18:24:50.932Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bradley Farias", + "screen_name": "bradleymeck", + "indices": [ + "0", + "12" + ], + "id_str": "15338477", + "id": "15338477" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "13", + "23" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "24", + "32" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "33", + "42" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "258" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952229420546260992", + "id_str": "952229969370869760", + "in_reply_to_user_id": "15338477", + "truncated": false, + "retweet_count": "0", + "id": "952229969370869760", + "in_reply_to_status_id": "952229420546260992", + "created_at": "Sat Jan 13 17:24:50 +0000 2018", + "favorited": false, + "full_text": "@bradleymeck @aredridel @nebrius @addaleax All fair points. We couldn't figure out a way to get around HTTP so we think bundles will still be used as a perf optimization, but getting away without a build step at development time is a worthwhile win, I think.", + "lang": "en", + "in_reply_to_screen_name": "bradleymeck", + "in_reply_to_user_id_str": "15338477" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952229412463788032" + ], + "editableUntil": "2018-01-13T18:22:38.155Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "0", + "8" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "9", + "19" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "20", + "29" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "952228808278487040", + "id_str": "952229412463788032", + "in_reply_to_user_id": "44052627", + "truncated": false, + "retweet_count": "0", + "id": "952229412463788032", + "in_reply_to_status_id": "952228808278487040", + "created_at": "Sat Jan 13 17:22:38 +0000 2018", + "favorited": false, + "full_text": "@nebrius @aredridel @addaleax That's a very fair point.", + "lang": "en", + "in_reply_to_screen_name": "nebrius", + "in_reply_to_user_id_str": "44052627" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952229026021588993" + ], + "editableUntil": "2018-01-13T18:21:06.020Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bradley Farias", + "screen_name": "bradleymeck", + "indices": [ + "0", + "12" + ], + "id_str": "15338477", + "id": "15338477" + }, + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "13", + "23" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "24", + "32" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "33", + "42" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "952228648748232709", + "id_str": "952229026021588993", + "in_reply_to_user_id": "15338477", + "truncated": false, + "retweet_count": "0", + "id": "952229026021588993", + "in_reply_to_status_id": "952228648748232709", + "created_at": "Sat Jan 13 17:21:06 +0000 2018", + "favorited": false, + "full_text": "@bradleymeck @aredridel @nebrius @addaleax Such as?", + "lang": "en", + "in_reply_to_screen_name": "bradleymeck", + "in_reply_to_user_id_str": "15338477" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952228491965095937" + ], + "editableUntil": "2018-01-13T18:18:58.691Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "0", + "10" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "11", + "19" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "20", + "29" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "198" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "952227926291787776", + "id_str": "952228491965095937", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952228491965095937", + "in_reply_to_status_id": "952227926291787776", + "created_at": "Sat Jan 13 17:18:58 +0000 2018", + "favorited": false, + "full_text": "@aredridel @nebrius @addaleax The goal isn't \"we love ES modules\", the goal is simpler web development work flows. ES modules are the modules that work in the browser, so the goal runs through them.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952227926291787776" + ], + "editableUntil": "2018-01-13T18:16:43.824Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "0", + "10" + ], + "id_str": "17950990", + "id": "17950990" + }, + { + "name": "Bryan Hughes 🏳️🌈", + "screen_name": "nebrius", + "indices": [ + "11", + "19" + ], + "id_str": "44052627", + "id": "44052627" + }, + { + "name": "Anna 🏳️⚧️ #blm", + "screen_name": "addaleax", + "indices": [ + "20", + "29" + ], + "id_str": "135577613", + "id": "135577613" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "170" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "952227017130463232", + "id_str": "952227926291787776", + "in_reply_to_user_id": "17950990", + "truncated": false, + "retweet_count": "0", + "id": "952227926291787776", + "in_reply_to_status_id": "952227017130463232", + "created_at": "Sat Jan 13 17:16:43 +0000 2018", + "favorited": false, + "full_text": "@aredridel @nebrius @addaleax I bet if the poll was \"would you like to ship code to browsers without needing to set up webpack and Babel\" the responses would be positive.", + "lang": "en", + "in_reply_to_screen_name": "aredridel", + "in_reply_to_user_id_str": "17950990" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952226939820888064" + ], + "editableUntil": "2018-01-13T18:12:48.631Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tom Forsyth (TODO: replace broken SCOTUS)", + "screen_name": "tom_forsyth", + "indices": [ + "0", + "12" + ], + "id_str": "243293725", + "id": "243293725" + }, + { + "name": "Brian Gesiak", + "screen_name": "modocache", + "indices": [ + "13", + "23" + ], + "id_str": "192478064", + "id": "192478064" + }, + { + "name": "Steve Canon (PARODY) 🧾", + "screen_name": "stephentyrone", + "indices": [ + "24", + "38" + ], + "id_str": "154221301", + "id": "154221301" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "119" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "952225578937073664", + "id_str": "952226939820888064", + "in_reply_to_user_id": "243293725", + "truncated": false, + "retweet_count": "0", + "id": "952226939820888064", + "in_reply_to_status_id": "952225578937073664", + "created_at": "Sat Jan 13 17:12:48 +0000 2018", + "favorited": false, + "full_text": "@tom_forsyth @modocache @stephentyrone Welp. I was definitely in the bucket of software engineers who didn't know that.", + "lang": "en", + "in_reply_to_screen_name": "tom_forsyth", + "in_reply_to_user_id_str": "243293725" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952225879446339584" + ], + "editableUntil": "2018-01-13T18:08:35.818Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Ou7WoCAiRg", + "expanded_url": "https://github.com/npm/spife/blob/master/docs/getting-started.md", + "display_url": "github.com/npm/spife/blob…", + "indices": [ + "116", + "139" + ] + } + ] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "16", + "in_reply_to_status_id_str": "952223414139236352", + "id_str": "952225879446339584", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "4", + "id": "952225879446339584", + "in_reply_to_status_id": "952223414139236352", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 17:08:35 +0000 2018", + "favorited": false, + "full_text": "Oh, and as if that wasn't enough, our engineering team open sourced the framework behind our new website this week: https://t.co/Ou7WoCAiRg", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952223414139236352" + ], + "editableUntil": "2018-01-13T17:58:48.043Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "223" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "952222961817214981", + "id_str": "952223414139236352", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "952223414139236352", + "in_reply_to_status_id": "952222961817214981", + "created_at": "Sat Jan 13 16:58:48 +0000 2018", + "favorited": false, + "full_text": "This last bit is even more experimental, but it's a glimpse at a glorious future where modules just work in browsers, and build steps are a performance optimization, not an unavoidable requirement. It's very, very exciting.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952222961817214981" + ], + "editableUntil": "2018-01-13T17:57:00.201Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/d89y7mpjow", + "expanded_url": "https://twitter.com/maybekatz/status/952006817994891265", + "display_url": "twitter.com/maybekatz/stat…", + "indices": [ + "222", + "245" + ] + } + ] + }, + "display_text_range": [ + "0", + "245" + ], + "favorite_count": "20", + "in_reply_to_status_id_str": "952221784853524481", + "id_str": "952222961817214981", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "6", + "id": "952222961817214981", + "in_reply_to_status_id": "952221784853524481", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 16:57:00 +0000 2018", + "favorited": false, + "full_text": "Most excitingly to web devs like me, the implementation comes with a new npm command, `npm asset`, which installs ES modules into a new `assets` folder, where they can be loaded directly into a browser with no build step: https://t.co/d89y7mpjow", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494101976761597953" + ], + "editableUntil": "2022-02-17T01:10:44.989Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JTK", + "screen_name": "heyJTK", + "indices": [ + "0", + "7" + ], + "id_str": "1023991506934419456", + "id": "1023991506934419456" + }, + { + "name": "Donut", + "screen_name": "Donut", + "indices": [ + "8", + "14" + ], + "id_str": "753998025698189312", + "id": "753998025698189312" + }, + { + "name": "Aaron Reffett is now @madgoat@hachyderm.io", + "screen_name": "madg04t", + "indices": [ + "15", + "23" + ], + "id_str": "158918139", + "id": "158918139" + }, + { + "name": "darth™", + "screen_name": "darth", + "indices": [ + "24", + "30" + ], + "id_str": "1337271", + "id": "1337271" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "166" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1494101846587105280", + "id_str": "1494101976761597953", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494101976761597953", + "in_reply_to_status_id": "1494101846587105280", + "created_at": "Thu Feb 17 00:10:44 +0000 2022", + "favorited": false, + "full_text": "@heyJTK @Donut @madg04t @darth The answer is \"curly fries\", though shoelace fries are an acceptable substitute, and I need to see how many of my colleagues are wrong.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494101846587105280" + ], + "editableUntil": "2022-02-17T01:10:13.953Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JTK", + "screen_name": "heyJTK", + "indices": [ + "0", + "7" + ], + "id_str": "1023991506934419456", + "id": "1023991506934419456" + }, + { + "name": "Donut", + "screen_name": "Donut", + "indices": [ + "8", + "14" + ], + "id_str": "753998025698189312", + "id": "753998025698189312" + }, + { + "name": "Aaron Reffett is now @madgoat@hachyderm.io", + "screen_name": "madg04t", + "indices": [ + "15", + "23" + ], + "id_str": "158918139", + "id": "158918139" + }, + { + "name": "darth™", + "screen_name": "darth", + "indices": [ + "24", + "30" + ], + "id_str": "1337271", + "id": "1337271" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "102" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1494099171586240517", + "id_str": "1494101846587105280", + "in_reply_to_user_id": "1023991506934419456", + "truncated": false, + "retweet_count": "0", + "id": "1494101846587105280", + "in_reply_to_status_id": "1494099171586240517", + "created_at": "Thu Feb 17 00:10:13 +0000 2022", + "favorited": false, + "full_text": "@heyJTK @Donut @madg04t @darth I have now taken this question to Netlify's internal hot takes channel.", + "lang": "en", + "in_reply_to_screen_name": "heyJTK", + "in_reply_to_user_id_str": "1023991506934419456" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494084560073547782" + ], + "editableUntil": "2022-02-17T00:01:32.527Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "foone🏳️⚧️", + "screen_name": "Foone", + "indices": [ + "3", + "9" + ], + "id_str": "13502732", + "id": "13502732" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "1494084560073547782", + "truncated": false, + "retweet_count": "0", + "id": "1494084560073547782", + "created_at": "Wed Feb 16 23:01:32 +0000 2022", + "favorited": false, + "full_text": "RT @Foone: ahh, it uses SQLite.\nThat's perfectly normal for an android app, but still, remember this is for a toothbrush. \ntell people in 1…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494080921158373377" + ], + "editableUntil": "2022-02-16T23:47:04.942Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Derrick Knight", + "screen_name": "knight427", + "indices": [ + "0", + "10" + ], + "id_str": "74209189", + "id": "74209189" + }, + { + "name": "jeppeReinhold 🇩🇰 @reinhold@fosstodon.org", + "screen_name": "DrReinhold", + "indices": [ + "11", + "22" + ], + "id_str": "2415054492", + "id": "2415054492" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "130" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1494080468135944195", + "id_str": "1494080921158373377", + "in_reply_to_user_id": "74209189", + "truncated": false, + "retweet_count": "0", + "id": "1494080921158373377", + "in_reply_to_status_id": "1494080468135944195", + "created_at": "Wed Feb 16 22:47:04 +0000 2022", + "favorited": false, + "full_text": "@knight427 @DrReinhold I mean, it makes the room warmer for anyone who the fan isn't pointed at, which probably meant the teacher.", + "lang": "en", + "in_reply_to_screen_name": "knight427", + "in_reply_to_user_id_str": "74209189" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494064603319308293" + ], + "editableUntil": "2022-02-16T22:42:14.466Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [ + { + "text": "productivity", + "indices": [ + "123", + "136" + ] + } + ], + "symbols": [], + "user_mentions": [ + { + "name": "Erik Rasmussen 🇺🇸🇪🇸 @erikras@erikras.com", + "screen_name": "erikras", + "indices": [ + "3", + "11" + ], + "id_str": "7618412", + "id": "7618412" + }, + { + "name": "1Password", + "screen_name": "1Password", + "indices": [ + "18", + "28" + ], + "id_str": "793926", + "id": "793926" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "69", + "75" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "1494064603319308293", + "truncated": false, + "retweet_count": "0", + "id": "1494064603319308293", + "created_at": "Wed Feb 16 21:42:14 +0000 2022", + "favorited": false, + "full_text": "RT @erikras: TIL: @1Password has a CLI! So I can securely publish to @npmjs with:\n\nnpm publish --otp $(op get totp npmjs)\n\n#productivity #d…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494064070453985280" + ], + "editableUntil": "2022-02-16T22:40:07.421Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Rob Palmer", + "screen_name": "robpalmer2", + "indices": [ + "0", + "11" + ], + "id_str": "55897406", + "id": "55897406" + }, + { + "name": "Ryan Cavanaugh 👉 searyanc.dev on bsky", + "screen_name": "SeaRyanC", + "indices": [ + "12", + "21" + ], + "id_str": "1177182800", + "id": "1177182800" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "1494058393446793221", + "id_str": "1494064070453985280", + "in_reply_to_user_id": "55897406", + "truncated": false, + "retweet_count": "0", + "id": "1494064070453985280", + "in_reply_to_status_id": "1494058393446793221", + "created_at": "Wed Feb 16 21:40:07 +0000 2022", + "favorited": false, + "full_text": "@robpalmer2 @SeaRyanC It is not pointing at where people are sitting.", + "lang": "en", + "in_reply_to_screen_name": "robpalmer2", + "in_reply_to_user_id_str": "55897406" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494063204346982401" + ], + "editableUntil": "2022-02-16T22:36:40.925Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nate Cohn", + "screen_name": "Nate_Cohn", + "indices": [ + "0", + "10" + ], + "id_str": "463765807", + "id": "463765807" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "52" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "1494062495979425796", + "id_str": "1494063204346982401", + "in_reply_to_user_id": "463765807", + "truncated": false, + "retweet_count": "0", + "id": "1494063204346982401", + "in_reply_to_status_id": "1494062495979425796", + "created_at": "Wed Feb 16 21:36:40 +0000 2022", + "favorited": false, + "full_text": "@Nate_Cohn 1. Get hired\n2. Delete the needle\n3. Quit", + "lang": "en", + "in_reply_to_screen_name": "Nate_Cohn", + "in_reply_to_user_id_str": "463765807" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494062164155400199" + ], + "editableUntil": "2022-02-16T22:32:32.924Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jeppeReinhold 🇩🇰 @reinhold@fosstodon.org", + "screen_name": "DrReinhold", + "indices": [ + "0", + "11" + ], + "id_str": "2415054492", + "id": "2415054492" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "42" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "1494058653338456066", + "id_str": "1494062164155400199", + "in_reply_to_user_id": "2415054492", + "truncated": false, + "retweet_count": "0", + "id": "1494062164155400199", + "in_reply_to_status_id": "1494058653338456066", + "created_at": "Wed Feb 16 21:32:32 +0000 2022", + "favorited": false, + "full_text": "@DrReinhold No, definitely a fan anti-fan.", + "lang": "ht", + "in_reply_to_screen_name": "DrReinhold", + "in_reply_to_user_id_str": "2415054492" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494062064066707457" + ], + "editableUntil": "2022-02-16T22:32:09.061Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Gary Olsen (LosHuertos)", + "screen_name": "garylosh", + "indices": [ + "0", + "9" + ], + "id_str": "20668569", + "id": "20668569" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "39" + ], + "favorite_count": "14", + "in_reply_to_status_id_str": "1494056729906085891", + "id_str": "1494062064066707457", + "in_reply_to_user_id": "20668569", + "truncated": false, + "retweet_count": "0", + "id": "1494062064066707457", + "in_reply_to_status_id": "1494056729906085891", + "created_at": "Wed Feb 16 21:32:09 +0000 2022", + "favorited": false, + "full_text": "@garylosh Dammit, that domain is taken.", + "lang": "en", + "in_reply_to_screen_name": "garylosh", + "in_reply_to_user_id_str": "20668569" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494055094748278785" + ], + "editableUntil": "2022-02-16T22:04:27.446Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ryan Cavanaugh 👉 searyanc.dev on bsky", + "screen_name": "SeaRyanC", + "indices": [ + "0", + "9" + ], + "id_str": "1177182800", + "id": "1177182800" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "204" + ], + "favorite_count": "19", + "in_reply_to_status_id_str": "1494054890124939264", + "id_str": "1494055094748278785", + "in_reply_to_user_id": "1177182800", + "truncated": false, + "retweet_count": "0", + "id": "1494055094748278785", + "in_reply_to_status_id": "1494054890124939264", + "created_at": "Wed Feb 16 21:04:27 +0000 2022", + "favorited": false, + "full_text": "@SeaRyanC 1. Unless you can physically feel air moving over your skin from the fan, the fan is not working, it is probably making you warmer\n2. They are almost never properly installed to make (1) happen.", + "lang": "en", + "in_reply_to_screen_name": "SeaRyanC", + "in_reply_to_user_id_str": "1177182800" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494054786156531712" + ], + "editableUntil": "2022-02-16T22:03:13.872Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494054786156531712/photo/1", + "indices": [ + "0", + "23" + ], + "url": "https://t.co/J2RYuAikSR", + "media_url": "http://pbs.twimg.com/media/FLvy5VVUYAUWkVr.jpg", + "id_str": "1494054768196476933", + "id": "1494054768196476933", + "media_url_https": "https://pbs.twimg.com/media/FLvy5VVUYAUWkVr.jpg", + "sizes": { + "large": { + "w": "1280", + "h": "960", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "510", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "900", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/J2RYuAikSR" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "23" + ], + "favorite_count": "45", + "in_reply_to_status_id_str": "1494054559882223616", + "id_str": "1494054786156531712", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494054786156531712", + "in_reply_to_status_id": "1494054559882223616", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 21:03:13 +0000 2022", + "favorited": false, + "full_text": "https://t.co/J2RYuAikSR", + "lang": "zxx", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494054786156531712/photo/1", + "indices": [ + "0", + "23" + ], + "url": "https://t.co/J2RYuAikSR", + "media_url": "http://pbs.twimg.com/media/FLvy5VVUYAUWkVr.jpg", + "id_str": "1494054768196476933", + "id": "1494054768196476933", + "media_url_https": "https://pbs.twimg.com/media/FLvy5VVUYAUWkVr.jpg", + "sizes": { + "large": { + "w": "1280", + "h": "960", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "510", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "900", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/J2RYuAikSR" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494054559882223616" + ], + "editableUntil": "2022-02-16T22:02:19.924Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "199" + ], + "favorite_count": "72", + "id_str": "1494054559882223616", + "truncated": false, + "retweet_count": "0", + "id": "1494054559882223616", + "created_at": "Wed Feb 16 21:02:19 +0000 2022", + "favorited": false, + "full_text": "Having an internal company get-to-know-you meeting (we use an app called Donut) and somebody mentioned ceiling fans and now 3 of my co-workers think I'm a complete weirdo obsessed with how fans work.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494044285322153985" + ], + "editableUntil": "2022-02-16T21:21:30.278Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494044285322153985/photo/1", + "indices": [ + "265", + "288" + ], + "url": "https://t.co/OvDJqDhDUg", + "media_url": "http://pbs.twimg.com/media/FLvpAVmUUAA69j3.jpg", + "id_str": "1494043893410582528", + "id": "1494043893410582528", + "media_url_https": "https://pbs.twimg.com/media/FLvpAVmUUAA69j3.jpg", + "sizes": { + "small": { + "w": "680", + "h": "574", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "1014", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1534", + "h": "1296", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/OvDJqDhDUg" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "288" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "1494035027251777536", + "id_str": "1494044285322153985", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "3", + "id": "1494044285322153985", + "in_reply_to_status_id": "1494035027251777536", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 20:21:30 +0000 2022", + "favorited": false, + "full_text": "The native apps space remains very fragmented, with nobody having more than a third of the market and Electron/React Native/Cordova trading places back and forth as the top 3. Capacitor, Expo and Quasar seem to be the up-and-comers creating the flux in this space. https://t.co/OvDJqDhDUg", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494044285322153985/photo/1", + "indices": [ + "265", + "288" + ], + "url": "https://t.co/OvDJqDhDUg", + "media_url": "http://pbs.twimg.com/media/FLvpAVmUUAA69j3.jpg", + "id_str": "1494043893410582528", + "id": "1494043893410582528", + "media_url_https": "https://pbs.twimg.com/media/FLvpAVmUUAA69j3.jpg", + "sizes": { + "small": { + "w": "680", + "h": "574", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "1014", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1534", + "h": "1296", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/OvDJqDhDUg" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494035027251777536" + ], + "editableUntil": "2022-02-16T20:44:42.982Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494035027251777536/photo/1", + "indices": [ + "272", + "295" + ], + "url": "https://t.co/BLDcUJ1kJN", + "media_url": "http://pbs.twimg.com/media/FLvgKSYVUAAsKUO.jpg", + "id_str": "1494034168740663296", + "id": "1494034168740663296", + "media_url_https": "https://pbs.twimg.com/media/FLvgKSYVUAAsKUO.jpg", + "sizes": { + "medium": { + "w": "1200", + "h": "1101", + "resize": "fit" + }, + "large": { + "w": "1412", + "h": "1296", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "624", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/BLDcUJ1kJN" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "295" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "1494033500919402499", + "id_str": "1494035027251777536", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494035027251777536", + "in_reply_to_status_id": "1494033500919402499", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 19:44:42 +0000 2022", + "favorited": false, + "full_text": "SoJ has a somewhat confusing split between \"front-end\" and \"back-end\" frameworks (Ember is front-end but Next.js is back-end?). Surprisingly strong showing from Angular here; if you combined these lists it would be third in usage, which is way stronger than I've seen it. https://t.co/BLDcUJ1kJN", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494035027251777536/photo/1", + "indices": [ + "272", + "295" + ], + "url": "https://t.co/BLDcUJ1kJN", + "media_url": "http://pbs.twimg.com/media/FLvgKSYVUAAsKUO.jpg", + "id_str": "1494034168740663296", + "id": "1494034168740663296", + "media_url_https": "https://pbs.twimg.com/media/FLvgKSYVUAAsKUO.jpg", + "sizes": { + "medium": { + "w": "1200", + "h": "1101", + "resize": "fit" + }, + "large": { + "w": "1412", + "h": "1296", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "624", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/BLDcUJ1kJN" + }, + { + "expanded_url": "https://twitter.com/seldo/status/1494035027251777536/photo/1", + "indices": [ + "272", + "295" + ], + "url": "https://t.co/BLDcUJ1kJN", + "media_url": "http://pbs.twimg.com/media/FLvgKSWVUAIH_eS.jpg", + "id_str": "1494034168732274690", + "id": "1494034168732274690", + "media_url_https": "https://pbs.twimg.com/media/FLvgKSWVUAIH_eS.jpg", + "sizes": { + "medium": { + "w": "1082", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1452", + "h": "1610", + "resize": "fit" + }, + "small": { + "w": "613", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/BLDcUJ1kJN" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494033500919402499" + ], + "editableUntil": "2022-02-16T20:38:39.076Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "163" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1494033001675587587", + "id_str": "1494033500919402499", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494033500919402499", + "in_reply_to_status_id": "1494033001675587587", + "created_at": "Wed Feb 16 19:38:39 +0000 2022", + "favorited": false, + "full_text": "(Though I note that npm Workspaces have a higher satisfaction score than Yarn Workspaces, which is a *little* surprising to me, although the difference is not big)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494033001675587587" + ], + "editableUntil": "2022-02-16T20:36:40.047Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494033001675587587/photo/1", + "indices": [ + "253", + "276" + ], + "url": "https://t.co/gp4HhPYeTc", + "media_url": "http://pbs.twimg.com/media/FLvem5LVQAE5hdU.jpg", + "id_str": "1494032461168197633", + "id": "1494032461168197633", + "media_url_https": "https://pbs.twimg.com/media/FLvem5LVQAE5hdU.jpg", + "sizes": { + "small": { + "w": "610", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "1076", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1690", + "h": "1884", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/gp4HhPYeTc" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "276" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "1494032103582752768", + "id_str": "1494033001675587587", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494033001675587587", + "in_reply_to_status_id": "1494032103582752768", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 19:36:40 +0000 2022", + "favorited": false, + "full_text": "SoJ were the first survey I saw that captured positive/negative sentiment and expressed it as a ratio, a concept I adopted for the Jamstack survey too. Here they're using it to \"tier\" popular libraries. Again, no real surprises in the actual data here. https://t.co/gp4HhPYeTc", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494033001675587587/photo/1", + "indices": [ + "253", + "276" + ], + "url": "https://t.co/gp4HhPYeTc", + "media_url": "http://pbs.twimg.com/media/FLvem5LVQAE5hdU.jpg", + "id_str": "1494032461168197633", + "id": "1494032461168197633", + "media_url_https": "https://pbs.twimg.com/media/FLvem5LVQAE5hdU.jpg", + "sizes": { + "small": { + "w": "610", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "1076", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1690", + "h": "1884", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/gp4HhPYeTc" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494032103582752768" + ], + "editableUntil": "2022-02-16T20:33:05.925Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494032103582752768/photo/1", + "indices": [ + "275", + "298" + ], + "url": "https://t.co/vl7dkkskf9", + "media_url": "http://pbs.twimg.com/media/FLvd9MYUUAIkvJ_.jpg", + "id_str": "1494031744768430082", + "id": "1494031744768430082", + "media_url_https": "https://pbs.twimg.com/media/FLvd9MYUUAIkvJ_.jpg", + "sizes": { + "small": { + "w": "541", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "1630", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "955", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/vl7dkkskf9" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "298" + ], + "favorite_count": "12", + "in_reply_to_status_id_str": "1494030145220345857", + "id_str": "1494032103582752768", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494032103582752768", + "in_reply_to_status_id": "1494030145220345857", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 19:33:05 +0000 2022", + "favorited": false, + "full_text": "I was literally saying yesterday that it's hard to find a use-case for a Minard diagram and here one is, showing changes in popularity and sentiment of a slew of JS libraries over the last 4 years. It's innovative but, perhaps, a little hard to read. No real surprises here. https://t.co/vl7dkkskf9", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494032103582752768/photo/1", + "indices": [ + "275", + "298" + ], + "url": "https://t.co/vl7dkkskf9", + "media_url": "http://pbs.twimg.com/media/FLvd9MYUUAIkvJ_.jpg", + "id_str": "1494031744768430082", + "id": "1494031744768430082", + "media_url_https": "https://pbs.twimg.com/media/FLvd9MYUUAIkvJ_.jpg", + "sizes": { + "small": { + "w": "541", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "1630", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "955", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/vl7dkkskf9" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494030145220345857" + ], + "editableUntil": "2022-02-16T20:25:19.015Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/dJ2yhxIUAp", + "expanded_url": "https://jamstack.org/survey/2021/#demographics", + "display_url": "jamstack.org/survey/2021/#d…", + "indices": [ + "193", + "216" + ] + } + ], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494030145220345857/photo/1", + "indices": [ + "276", + "299" + ], + "url": "https://t.co/8C8OIK4FcG", + "media_url": "http://pbs.twimg.com/media/FLvcQs5VIAA_0Mw.jpg", + "id_str": "1494029880891088896", + "id": "1494029880891088896", + "media_url_https": "https://pbs.twimg.com/media/FLvcQs5VIAA_0Mw.jpg", + "sizes": { + "medium": { + "w": "1200", + "h": "833", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "472", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1740", + "h": "1208", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/8C8OIK4FcG" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "299" + ], + "favorite_count": "16", + "in_reply_to_status_id_str": "1494029673143042050", + "id_str": "1494030145220345857", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1494030145220345857", + "in_reply_to_status_id": "1494029673143042050", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 19:25:19 +0000 2022", + "favorited": false, + "full_text": "SoJ's data seems to show that the developer community is becoming more racially diverse. We saw a similar effect in our State of the Jamstack survey when we asked about geographical diversity: https://t.co/dJ2yhxIUAp This is an excellent sign for the health of the community. https://t.co/8C8OIK4FcG", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494030145220345857/photo/1", + "indices": [ + "276", + "299" + ], + "url": "https://t.co/8C8OIK4FcG", + "media_url": "http://pbs.twimg.com/media/FLvcQs5VIAA_0Mw.jpg", + "id_str": "1494029880891088896", + "id": "1494029880891088896", + "media_url_https": "https://pbs.twimg.com/media/FLvcQs5VIAA_0Mw.jpg", + "sizes": { + "medium": { + "w": "1200", + "h": "833", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "472", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1740", + "h": "1208", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/8C8OIK4FcG" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494029673143042050" + ], + "editableUntil": "2022-02-16T20:23:26.463Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [ + { + "name": "Sacha Greif @sachagreif@hachyderm.io", + "screen_name": "SachaGreif", + "indices": [ + "78", + "89" + ], + "id_str": "14261086", + "id": "14261086" + } + ], + "urls": [ + { + "url": "https://t.co/BJoRYmTAiV", + "expanded_url": "https://dev.to/sachagreif/whats-new-in-the-2021-state-of-javascript-survey-4eej", + "display_url": "dev.to/sachagreif/wha…", + "indices": [ + "91", + "114" + ] + } + ], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494029673143042050/photo/1", + "indices": [ + "255", + "278" + ], + "url": "https://t.co/L6fkmFWlp9", + "media_url": "http://pbs.twimg.com/media/FLvbubkVQAAek7D.jpg", + "id_str": "1494029292124061696", + "id": "1494029292124061696", + "media_url_https": "https://pbs.twimg.com/media/FLvbubkVQAAek7D.jpg", + "sizes": { + "medium": { + "w": "1200", + "h": "831", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "471", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1858", + "h": "1286", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/L6fkmFWlp9" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "278" + ], + "favorite_count": "21", + "in_reply_to_status_id_str": "1494029242828406785", + "id_str": "1494029673143042050", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "1494029673143042050", + "in_reply_to_status_id": "1494029242828406785", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 19:23:26 +0000 2022", + "favorited": false, + "full_text": "SoJ has done some amazing work this year (it's now nearly a full-time job for @SachaGreif: https://t.co/BJoRYmTAiV) and one of the things we get from that is \"facets\", where they split questions by other answers. This is ethnicity by years of experience: https://t.co/L6fkmFWlp9", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1494029673143042050/photo/1", + "indices": [ + "255", + "278" + ], + "url": "https://t.co/L6fkmFWlp9", + "media_url": "http://pbs.twimg.com/media/FLvbubkVQAAek7D.jpg", + "id_str": "1494029292124061696", + "id": "1494029292124061696", + "media_url_https": "https://pbs.twimg.com/media/FLvbubkVQAAek7D.jpg", + "sizes": { + "medium": { + "w": "1200", + "h": "831", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "471", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1858", + "h": "1286", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/L6fkmFWlp9" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1494029242828406785" + ], + "editableUntil": "2022-02-16T20:21:43.868Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/JJz09Jvbc8", + "expanded_url": "https://2021.stateofjs.com", + "display_url": "2021.stateofjs.com", + "indices": [ + "127", + "150" + ] + } + ] + }, + "display_text_range": [ + "0", + "150" + ], + "favorite_count": "27", + "id_str": "1494029242828406785", + "truncated": false, + "retweet_count": "9", + "id": "1494029242828406785", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 19:21:43 +0000 2022", + "favorited": false, + "full_text": "The State of JS 2021 is out (yes they know it's 2022)! Here follows a thread of any interesting graphs I find, as I find them: https://t.co/JJz09Jvbc8", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952221784853524481" + ], + "editableUntil": "2018-01-13T17:52:19.591Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/4UtfK8mhFe", + "expanded_url": "https://twitter.com/jdalton/status/951997590421164032", + "display_url": "twitter.com/jdalton/status…", + "indices": [ + "104", + "127" + ] + } + ] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "952221500462870530", + "id_str": "952221784853524481", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "952221784853524481", + "in_reply_to_status_id": "952221500462870530", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 16:52:19 +0000 2018", + "favorited": false, + "full_text": "But it's not just a document describing how it might work: we implemented it. You can try it out today: https://t.co/4UtfK8mhFe", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952221500462870530" + ], + "editableUntil": "2018-01-13T17:51:11.787Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/AOBFbenCjn", + "expanded_url": "https://twitter.com/adamrackis/status/952204813051351040", + "display_url": "twitter.com/adamrackis/sta…", + "indices": [ + "38", + "61" + ] + } + ] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "952221337757532160", + "id_str": "952221500462870530", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "952221500462870530", + "in_reply_to_status_id": "952221337757532160", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 16:51:11 +0000 2018", + "favorited": false, + "full_text": "Yes, in fact, people seem to like it: https://t.co/AOBFbenCjn", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952221337757532160" + ], + "editableUntil": "2018-01-13T17:50:32.995Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "0", + "8" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [ + { + "url": "https://t.co/clwZ1jyFe3", + "expanded_url": "https://twitter.com/jdalton/status/951995685620006912", + "display_url": "twitter.com/jdalton/status…", + "indices": [ + "20", + "43" + ] + } + ] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "952220966398001152", + "id_str": "952221337757532160", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "952221337757532160", + "in_reply_to_status_id": "952220966398001152", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 16:50:32 +0000 2018", + "favorited": false, + "full_text": "@ceejbot Very good: https://t.co/clwZ1jyFe3", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952220966398001152" + ], + "editableUntil": "2018-01-13T17:49:04.456Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "31", + "39" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [ + { + "url": "https://t.co/GWJG1IJjv1", + "expanded_url": "https://twitter.com/brendaneich/status/951975857093935104", + "display_url": "twitter.com/brendaneich/st…", + "indices": [ + "186", + "209" + ] + } + ] + }, + "display_text_range": [ + "0", + "209" + ], + "favorite_count": "97", + "id_str": "952220966398001152", + "truncated": false, + "retweet_count": "30", + "id": "952220966398001152", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 16:49:04 +0000 2018", + "favorited": false, + "full_text": "npm's engineering team, led by @ceejbot, are taking a stab at making native ES modules easier to work with in node, an important future direction for JavaScript. Early reviews are good: https://t.co/GWJG1IJjv1", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "952073046830927872" + ], + "editableUntil": "2018-01-13T08:01:17.683Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "", + "screen_name": "Braintasm", + "indices": [ + "3", + "13" + ], + "id_str": "-1", + "id": "-1" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "952073046830927872", + "truncated": false, + "retweet_count": "0", + "id": "952073046830927872", + "created_at": "Sat Jan 13 07:01:17 +0000 2018", + "favorited": false, + "full_text": "RT @Braintasm: Went and saw The Post tonight. I watched a film about newspapers inside a movie theater inside of a mall. It was a dying ind…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951989980708028417" + ], + "editableUntil": "2018-01-13T02:31:13.176Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "79" + ], + "favorite_count": "27", + "id_str": "951989980708028417", + "truncated": false, + "retweet_count": "0", + "id": "951989980708028417", + "created_at": "Sat Jan 13 01:31:13 +0000 2018", + "favorited": false, + "full_text": "Let's play everyone's favorite BART game \"who in this car is it smells of pee?\"", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951985765155856385" + ], + "editableUntil": "2018-01-13T02:14:28.110Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951985765155856385/photo/1", + "indices": [ + "209", + "232" + ], + "url": "https://t.co/pji2ZSxJ4G", + "media_url": "http://pbs.twimg.com/media/DTYhnl3VMAAbGOC.jpg", + "id_str": "951985335298240512", + "id": "951985335298240512", + "media_url_https": "https://pbs.twimg.com/media/DTYhnl3VMAAbGOC.jpg", + "sizes": { + "medium": { + "w": "725", + "h": "478", + "resize": "fit" + }, + "large": { + "w": "725", + "h": "478", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "448", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/pji2ZSxJ4G" + } + ], + "hashtags": [ + { + "text": "npmstats", + "indices": [ + "0", + "9" + ] + } + ] + }, + "display_text_range": [ + "0", + "232" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951985184731099136", + "id_str": "951985765155856385", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "951985765155856385", + "in_reply_to_status_id": "951985184731099136", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 01:14:28 +0000 2018", + "favorited": false, + "full_text": "#npmstats for January 2018: 5 is about to overtake 3 as the most popular version (right in line with the shift from node 6 to node 8). Why is anyone still using npm 1.x that thing is really broken these days. https://t.co/pji2ZSxJ4G", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951985765155856385/photo/1", + "indices": [ + "209", + "232" + ], + "url": "https://t.co/pji2ZSxJ4G", + "media_url": "http://pbs.twimg.com/media/DTYhnl3VMAAbGOC.jpg", + "id_str": "951985335298240512", + "id": "951985335298240512", + "media_url_https": "https://pbs.twimg.com/media/DTYhnl3VMAAbGOC.jpg", + "sizes": { + "medium": { + "w": "725", + "h": "478", + "resize": "fit" + }, + "large": { + "w": "725", + "h": "478", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "448", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/pji2ZSxJ4G" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951985184731099136" + ], + "editableUntil": "2018-01-13T02:12:09.726Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951985184731099136/photo/1", + "indices": [ + "175", + "198" + ], + "url": "https://t.co/vugmkGhKuM", + "media_url": "http://pbs.twimg.com/media/DTYhMEOU8AAYpNS.jpg", + "id_str": "951984862411419648", + "id": "951984862411419648", + "media_url_https": "https://pbs.twimg.com/media/DTYhMEOU8AAYpNS.jpg", + "sizes": { + "medium": { + "w": "779", + "h": "521", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "455", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "779", + "h": "521", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/vugmkGhKuM" + } + ], + "hashtags": [ + { + "text": "nodestats", + "indices": [ + "0", + "10" + ] + } + ] + }, + "display_text_range": [ + "0", + "198" + ], + "favorite_count": "8", + "id_str": "951985184731099136", + "truncated": false, + "retweet_count": "3", + "id": "951985184731099136", + "possibly_sensitive": false, + "created_at": "Sat Jan 13 01:12:09 +0000 2018", + "favorited": false, + "full_text": "#nodestats for January 2018: Node 8.x is on track to become the most popular version, node 6.x is still most popular right now, and node 9 is already making a strong showing: https://t.co/vugmkGhKuM", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951985184731099136/photo/1", + "indices": [ + "175", + "198" + ], + "url": "https://t.co/vugmkGhKuM", + "media_url": "http://pbs.twimg.com/media/DTYhMEOU8AAYpNS.jpg", + "id_str": "951984862411419648", + "id": "951984862411419648", + "media_url_https": "https://pbs.twimg.com/media/DTYhMEOU8AAYpNS.jpg", + "sizes": { + "medium": { + "w": "779", + "h": "521", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "455", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "779", + "h": "521", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/vugmkGhKuM" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951971585887387648" + ], + "editableUntil": "2018-01-13T01:18:07.509Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "82" + ], + "favorite_count": "68", + "id_str": "951971585887387648", + "truncated": false, + "retweet_count": "11", + "id": "951971585887387648", + "created_at": "Sat Jan 13 00:18:07 +0000 2018", + "favorited": false, + "full_text": "The number of presidents of the USA who were not racist, by the way, is \"maybe 1\".", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951970388086464513" + ], + "editableUntil": "2018-01-13T01:13:21.931Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Catherynne M. Valente", + "screen_name": "catvalente", + "indices": [ + "3", + "14" + ], + "id_str": "18000189", + "id": "18000189" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951970388086464513", + "truncated": false, + "retweet_count": "0", + "id": "951970388086464513", + "created_at": "Sat Jan 13 00:13:21 +0000 2018", + "favorited": false, + "full_text": "RT @catvalente: Trump was just asked publicly if he is a racist.\n\nHe immediately ended the presser.\n\nHe turned around and left the room.\n\nB…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951942919224569856" + ], + "editableUntil": "2018-01-12T23:24:12.844Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Amanda Guinzburg", + "screen_name": "Guinz", + "indices": [ + "3", + "9" + ], + "id_str": "19834228", + "id": "19834228" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951942919224569856", + "truncated": false, + "retweet_count": "0", + "id": "951942919224569856", + "created_at": "Fri Jan 12 22:24:12 +0000 2018", + "favorited": false, + "full_text": "RT @Guinz: It's unfortunate and unhelpful that you are a spineless shill who refuses to vehemently condemn disgusting racism from the Presi…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951938226377277440" + ], + "editableUntil": "2018-01-12T23:05:33.982Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Rivers", + "screen_name": "jeffrivers", + "indices": [ + "0", + "11" + ], + "id_str": "1784701", + "id": "1784701" + }, + { + "name": "@meyerweb@mastodon.social", + "screen_name": "meyerweb", + "indices": [ + "12", + "21" + ], + "id_str": "646533", + "id": "646533" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951937252573106176", + "id_str": "951938226377277440", + "in_reply_to_user_id": "1784701", + "truncated": false, + "retweet_count": "0", + "id": "951938226377277440", + "in_reply_to_status_id": "951937252573106176", + "created_at": "Fri Jan 12 22:05:33 +0000 2018", + "favorited": false, + "full_text": "@jeffrivers @meyerweb Definitely too smart.", + "lang": "en", + "in_reply_to_screen_name": "jeffrivers", + "in_reply_to_user_id_str": "1784701" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951933497366560773" + ], + "editableUntil": "2018-01-12T22:46:46.498Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "4", + "id_str": "951933497366560773", + "truncated": false, + "retweet_count": "0", + "id": "951933497366560773", + "created_at": "Fri Jan 12 21:46:46 +0000 2018", + "favorited": false, + "full_text": "So where's he going to go with this. \"Lying Stormy\"? \"Ugly Stormy\"? \"I've never even met her\"?", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951933258609999872" + ], + "editableUntil": "2018-01-12T22:45:49.574Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Yashar Ali 🐘", + "screen_name": "yashar", + "indices": [ + "3", + "10" + ], + "id_str": "11744152", + "id": "11744152" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "79" + ], + "favorite_count": "0", + "id_str": "951933258609999872", + "truncated": false, + "retweet_count": "0", + "id": "951933258609999872", + "created_at": "Fri Jan 12 21:45:49 +0000 2018", + "favorited": false, + "full_text": "RT @yashar: If the President tweets about Stormy Daniels I'm taking a week off.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951904184290353152" + ], + "editableUntil": "2018-01-12T20:50:17.716Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "89" + ], + "favorite_count": "36", + "id_str": "951904184290353152", + "truncated": false, + "retweet_count": "0", + "id": "951904184290353152", + "created_at": "Fri Jan 12 19:50:17 +0000 2018", + "favorited": false, + "full_text": "TFW you spend 3 months putting off a tedious admin phone call and it's over in 3 minutes.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951899468974112768" + ], + "editableUntil": "2018-01-12T20:31:33.497Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/S9G6DeThhe", + "expanded_url": "http://www.sfgate.com/business/networth/article/New-law-bans-California-employers-from-asking-12274431.php", + "display_url": "sfgate.com/business/netwo…", + "indices": [ + "134", + "157" + ] + } + ] + }, + "display_text_range": [ + "0", + "157" + ], + "favorite_count": "11", + "id_str": "951899468974112768", + "truncated": false, + "retweet_count": "4", + "id": "951899468974112768", + "possibly_sensitive": false, + "created_at": "Fri Jan 12 19:31:33 +0000 2018", + "favorited": false, + "full_text": "Your reminder that if you are interviewing for a job it is illegal in California for the employer to ask you what you currently earn: https://t.co/S9G6DeThhe", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951881018973110272" + ], + "editableUntil": "2018-01-12T19:18:14.674Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Daniel Lo Nigro | Mastodon: @dan@d.sb", + "screen_name": "Daniel15", + "indices": [ + "0", + "9" + ], + "id_str": "14282250", + "id": "14282250" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951879085805850629", + "id_str": "951881018973110272", + "in_reply_to_user_id": "14282250", + "truncated": false, + "retweet_count": "0", + "id": "951881018973110272", + "in_reply_to_status_id": "951879085805850629", + "created_at": "Fri Jan 12 18:18:14 +0000 2018", + "favorited": false, + "full_text": "@Daniel15 I mean, a big chunk of it is absolutely CI, but CI usage is legitimate usage.", + "lang": "en", + "in_reply_to_screen_name": "Daniel15", + "in_reply_to_user_id_str": "14282250" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951874671888117765" + ], + "editableUntil": "2018-01-12T18:53:01.411Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "ian bremmer", + "screen_name": "ianbremmer", + "indices": [ + "3", + "14" + ], + "id_str": "60783724", + "id": "60783724" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/ianbremmer/status/951870733088681985/photo/1", + "source_status_id": "951870733088681985", + "indices": [ + "44", + "67" + ], + "url": "https://t.co/ArMLwFW4Cs", + "media_url": "http://pbs.twimg.com/media/DTW5APAWAAAw_1k.jpg", + "id_str": "951870309937840128", + "source_user_id": "60783724", + "id": "951870309937840128", + "media_url_https": "https://pbs.twimg.com/media/DTW5APAWAAAw_1k.jpg", + "source_user_id_str": "60783724", + "sizes": { + "large": { + "w": "578", + "h": "656", + "resize": "fit" + }, + "small": { + "w": "578", + "h": "656", + "resize": "fit" + }, + "medium": { + "w": "578", + "h": "656", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "source_status_id_str": "951870733088681985", + "display_url": "pic.twitter.com/ArMLwFW4Cs" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "67" + ], + "favorite_count": "0", + "id_str": "951874671888117765", + "truncated": false, + "retweet_count": "0", + "id": "951874671888117765", + "possibly_sensitive": false, + "created_at": "Fri Jan 12 17:53:01 +0000 2018", + "favorited": false, + "full_text": "RT @ianbremmer: Press Release of the Month. https://t.co/ArMLwFW4Cs", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/ianbremmer/status/951870733088681985/photo/1", + "source_status_id": "951870733088681985", + "indices": [ + "44", + "67" + ], + "url": "https://t.co/ArMLwFW4Cs", + "media_url": "http://pbs.twimg.com/media/DTW5APAWAAAw_1k.jpg", + "id_str": "951870309937840128", + "source_user_id": "60783724", + "id": "951870309937840128", + "media_url_https": "https://pbs.twimg.com/media/DTW5APAWAAAw_1k.jpg", + "source_user_id_str": "60783724", + "sizes": { + "large": { + "w": "578", + "h": "656", + "resize": "fit" + }, + "small": { + "w": "578", + "h": "656", + "resize": "fit" + }, + "medium": { + "w": "578", + "h": "656", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "source_status_id_str": "951870733088681985", + "display_url": "pic.twitter.com/ArMLwFW4Cs" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951874082601127937" + ], + "editableUntil": "2018-01-12T18:50:40.914Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇧🇧🇹🇹🏳️🌈🌉 🚴🏿Ed says Yes on J, No on I", + "screen_name": "eparillon", + "indices": [ + "3", + "13" + ], + "id_str": "5818162", + "id": "5818162" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951874082601127937", + "truncated": false, + "retweet_count": "0", + "id": "951874082601127937", + "created_at": "Fri Jan 12 17:50:40 +0000 2018", + "favorited": false, + "full_text": "RT @eparillon: Trump has a point. I mean do you know in some of those countries people have to go on gofundme to raise cash for basic medic…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951871696507518977" + ], + "editableUntil": "2018-01-12T18:41:12.025Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jamil Smith جميل كريم", + "screen_name": "JamilSmith", + "indices": [ + "3", + "14" + ], + "id_str": "46213956", + "id": "46213956" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951871696507518977", + "truncated": false, + "retweet_count": "0", + "id": "951871696507518977", + "created_at": "Fri Jan 12 17:41:12 +0000 2018", + "favorited": false, + "full_text": "RT @JamilSmith: \"Donald Trump came onto the political scene with a racist conspiracy theory. He ran a racist campaign. As president, he con…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951871434090934272" + ], + "editableUntil": "2018-01-12T18:40:09.460Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "rat king 🐀", + "screen_name": "MikeIsaac", + "indices": [ + "0", + "10" + ], + "id_str": "19040598", + "id": "19040598" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951871434090934272/photo/1", + "indices": [ + "12", + "35" + ], + "url": "https://t.co/uTLBAvrPdF", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTW6BVsUMAAMgXD.jpg", + "id_str": "951871428424380416", + "id": "951871428424380416", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTW6BVsUMAAMgXD.jpg", + "sizes": { + "medium": { + "w": "250", + "h": "250", + "resize": "fit" + }, + "large": { + "w": "250", + "h": "250", + "resize": "fit" + }, + "small": { + "w": "250", + "h": "250", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/uTLBAvrPdF" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951866653943332864", + "id_str": "951871434090934272", + "in_reply_to_user_id": "19040598", + "truncated": false, + "retweet_count": "0", + "id": "951871434090934272", + "in_reply_to_status_id": "951866653943332864", + "possibly_sensitive": false, + "created_at": "Fri Jan 12 17:40:09 +0000 2018", + "favorited": false, + "full_text": "@MikeIsaac https://t.co/uTLBAvrPdF", + "lang": "qme", + "in_reply_to_screen_name": "MikeIsaac", + "in_reply_to_user_id_str": "19040598", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951871434090934272/photo/1", + "indices": [ + "12", + "35" + ], + "url": "https://t.co/uTLBAvrPdF", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTW6BVsUMAAMgXD.jpg", + "id_str": "951871428424380416", + "video_info": { + "aspect_ratio": [ + "1", + "1" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DTW6BVsUMAAMgXD.mp4" + } + ] + }, + "id": "951871428424380416", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTW6BVsUMAAMgXD.jpg", + "sizes": { + "medium": { + "w": "250", + "h": "250", + "resize": "fit" + }, + "large": { + "w": "250", + "h": "250", + "resize": "fit" + }, + "small": { + "w": "250", + "h": "250", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "animated_gif", + "display_url": "pic.twitter.com/uTLBAvrPdF" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951866006384779264" + ], + "editableUntil": "2018-01-12T18:18:35.394Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ed Miliband", + "screen_name": "Ed_Miliband", + "indices": [ + "3", + "15" + ], + "id_str": "61781260", + "id": "61781260" + } + ], + "urls": [ + { + "url": "https://t.co/9xV7bFZQgL", + "expanded_url": "https://twitter.com/realdonaldtrump/status/951679619341737986", + "display_url": "twitter.com/realdonaldtrum…", + "indices": [ + "87", + "110" + ] + } + ] + }, + "display_text_range": [ + "0", + "110" + ], + "favorite_count": "0", + "id_str": "951866006384779264", + "truncated": false, + "retweet_count": "0", + "id": "951866006384779264", + "possibly_sensitive": false, + "created_at": "Fri Jan 12 17:18:35 +0000 2018", + "favorited": false, + "full_text": "RT @Ed_Miliband: Nope it’s because nobody wanted you to come. And you got the message. https://t.co/9xV7bFZQgL", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951861036239396864" + ], + "editableUntil": "2018-01-12T17:58:50.419Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "lauraolin dot com slash newsletter", + "screen_name": "lauraolin", + "indices": [ + "0", + "10" + ], + "id_str": "14069365", + "id": "14069365" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "107" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951859861519831040", + "id_str": "951861036239396864", + "in_reply_to_user_id": "14069365", + "truncated": false, + "retweet_count": "0", + "id": "951861036239396864", + "in_reply_to_status_id": "951859861519831040", + "created_at": "Fri Jan 12 16:58:50 +0000 2018", + "favorited": false, + "full_text": "@lauraolin I like the concept but think you're going to need to workshop the title after the next 24 hours.", + "lang": "en", + "in_reply_to_screen_name": "lauraolin", + "in_reply_to_user_id_str": "14069365" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951834933202272256" + ], + "editableUntil": "2018-01-12T16:15:06.970Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "David @automatedtester@mastodon.social", + "screen_name": "AutomatedTester", + "indices": [ + "0", + "16" + ], + "id_str": "20143607", + "id": "20143607" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "23" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951803354514157568", + "id_str": "951834933202272256", + "in_reply_to_user_id": "20143607", + "truncated": false, + "retweet_count": "0", + "id": "951834933202272256", + "in_reply_to_status_id": "951803354514157568", + "created_at": "Fri Jan 12 15:15:06 +0000 2018", + "favorited": false, + "full_text": "@AutomatedTester 🇹🇹🇹🇹🇹🇹", + "lang": "qme", + "in_reply_to_screen_name": "AutomatedTester", + "in_reply_to_user_id_str": "20143607" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951725349536071682" + ], + "editableUntil": "2018-01-12T08:59:40.188Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Legend", + "screen_name": "johnlegend", + "indices": [ + "3", + "14" + ], + "id_str": "18228898", + "id": "18228898" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951725349536071682", + "truncated": false, + "retweet_count": "0", + "id": "951725349536071682", + "created_at": "Fri Jan 12 07:59:40 +0000 2018", + "favorited": false, + "full_text": "RT @johnlegend: The president is a racist. He has been for his entire public life. If you vote(d) for him, you do so because of that or des…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951723671403380736" + ], + "editableUntil": "2018-01-12T08:53:00.090Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matthew McGregor", + "screen_name": "mcgregormt", + "indices": [ + "0", + "11" + ], + "id_str": "15205606", + "id": "15205606" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "122" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951722578682490880", + "id_str": "951723671403380736", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951723671403380736", + "in_reply_to_status_id": "951722578682490880", + "created_at": "Fri Jan 12 07:53:00 +0000 2018", + "favorited": false, + "full_text": "@mcgregormt P.S. the automatic passport control machines at MIA still tell you to insert your green card the wrong way up.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951722578682490880" + ], + "editableUntil": "2018-01-12T08:48:39.565Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matthew McGregor", + "screen_name": "mcgregormt", + "indices": [ + "0", + "11" + ], + "id_str": "15205606", + "id": "15205606" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "259" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951720624283668480", + "id_str": "951722578682490880", + "in_reply_to_user_id": "15205606", + "truncated": false, + "retweet_count": "0", + "id": "951722578682490880", + "in_reply_to_status_id": "951720624283668480", + "created_at": "Fri Jan 12 07:48:39 +0000 2018", + "favorited": false, + "full_text": "@mcgregormt As a Trinidadian, it was an excellently representative introduction to the immigration experience in that I was given actively incorrect, illegal instructions by a poorly trained clerk who treated me like a criminal and expected me to be grateful.", + "lang": "en", + "in_reply_to_screen_name": "mcgregormt", + "in_reply_to_user_id_str": "15205606" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951711279630069760" + ], + "editableUntil": "2018-01-12T08:03:45.661Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Evan Goer", + "screen_name": "evangoer", + "indices": [ + "0", + "9" + ], + "id_str": "15164211", + "id": "15164211" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "67" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951711124356923393", + "id_str": "951711279630069760", + "in_reply_to_user_id": "15164211", + "truncated": false, + "retweet_count": "0", + "id": "951711279630069760", + "in_reply_to_status_id": "951711124356923393", + "created_at": "Fri Jan 12 07:03:45 +0000 2018", + "favorited": false, + "full_text": "@evangoer You are suspiciously full of details on this thing, Evan.", + "lang": "en", + "in_reply_to_screen_name": "evangoer", + "in_reply_to_user_id_str": "15164211" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951711050369400832" + ], + "editableUntil": "2018-01-12T08:02:51.001Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "154" + ], + "favorite_count": "197", + "id_str": "951711050369400832", + "truncated": false, + "retweet_count": "14", + "id": "951711050369400832", + "created_at": "Fri Jan 12 07:02:51 +0000 2018", + "favorited": false, + "full_text": "I would just like to say that I am an immigrant from one of the shithole countries, and the orange bastard can go fuck himself, in case that wasn't clear.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951710490375307265" + ], + "editableUntil": "2018-01-12T08:00:37.488Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "KING KORTNEY😷", + "screen_name": "fakerapper", + "indices": [ + "0", + "11" + ], + "id_str": "14256353", + "id": "14256353" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "951688196743573505", + "id_str": "951710490375307265", + "in_reply_to_user_id": "14256353", + "truncated": false, + "retweet_count": "0", + "id": "951710490375307265", + "in_reply_to_status_id": "951688196743573505", + "created_at": "Fri Jan 12 07:00:37 +0000 2018", + "favorited": false, + "full_text": "@fakerapper They're crushing on you.", + "lang": "en", + "in_reply_to_screen_name": "fakerapper", + "in_reply_to_user_id_str": "14256353" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951709841013157889" + ], + "editableUntil": "2018-01-12T07:58:02.668Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Evan Goer", + "screen_name": "evangoer", + "indices": [ + "0", + "9" + ], + "id_str": "15164211", + "id": "15164211" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "68" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951704856674234369", + "id_str": "951709841013157889", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951709841013157889", + "in_reply_to_status_id": "951704856674234369", + "created_at": "Fri Jan 12 06:58:02 +0000 2018", + "favorited": false, + "full_text": "@evangoer Those poor fuckers have been writing a lot of fan fiction.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951708764838666240" + ], + "editableUntil": "2018-01-12T07:53:46.088Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Deanboop", + "screen_name": "deanboop", + "indices": [ + "0", + "9" + ], + "id_str": "1538810077385089024", + "id": "1538810077385089024" + }, + { + "name": "Hack Reactor", + "screen_name": "HackReactor", + "indices": [ + "10", + "22" + ], + "id_str": "1102977272", + "id": "1102977272" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "86" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951707394672750592", + "id_str": "951708764838666240", + "in_reply_to_user_id": "148832579", + "truncated": false, + "retweet_count": "0", + "id": "951708764838666240", + "in_reply_to_status_id": "951707394672750592", + "created_at": "Fri Jan 12 06:53:46 +0000 2018", + "favorited": false, + "full_text": "@deanboop @HackReactor I love finding out where HR grads have got to! How's OpenTable?", + "lang": "en", + "in_reply_to_screen_name": "boopmatt", + "in_reply_to_user_id_str": "148832579" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951706427432685570" + ], + "editableUntil": "2018-01-12T07:44:28.807Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Félix Saparelli", + "screen_name": "passcod", + "indices": [ + "0", + "8" + ], + "id_str": "92200252", + "id": "92200252" + }, + { + "name": "Hack Reactor", + "screen_name": "HackReactor", + "indices": [ + "9", + "21" + ], + "id_str": "1102977272", + "id": "1102977272" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951705997956886528", + "id_str": "951706427432685570", + "in_reply_to_user_id": "92200252", + "truncated": false, + "retweet_count": "0", + "id": "951706427432685570", + "in_reply_to_status_id": "951705997956886528", + "created_at": "Fri Jan 12 06:44:28 +0000 2018", + "favorited": false, + "full_text": "@passcod @HackReactor That exactly.", + "lang": "en", + "in_reply_to_screen_name": "passcod", + "in_reply_to_user_id_str": "92200252" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951705514009706496" + ], + "editableUntil": "2018-01-12T07:40:51.030Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "Hack Reactor", + "screen_name": "HackReactor", + "indices": [ + "37", + "49" + ], + "id_str": "1102977272", + "id": "1102977272" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951705514009706496/photo/1", + "indices": [ + "84", + "107" + ], + "url": "https://t.co/bOwEjSxitZ", + "media_url": "http://pbs.twimg.com/media/DTUjHH2VMAAGMQi.jpg", + "id_str": "951705501531713536", + "id": "951705501531713536", + "media_url_https": "https://pbs.twimg.com/media/DTUjHH2VMAAGMQi.jpg", + "sizes": { + "large": { + "w": "2048", + "h": "1538", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "511", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "901", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/bOwEjSxitZ" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "107" + ], + "favorite_count": "26", + "in_reply_to_status_id_str": "951648938385293312", + "id_str": "951705514009706496", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951705514009706496", + "in_reply_to_status_id": "951648938385293312", + "possibly_sensitive": false, + "created_at": "Fri Jan 12 06:40:51 +0000 2018", + "favorited": false, + "full_text": "Spent time with my favorite folks at @HackReactor. As always, the perfect audience. https://t.co/bOwEjSxitZ", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951705514009706496/photo/1", + "indices": [ + "84", + "107" + ], + "url": "https://t.co/bOwEjSxitZ", + "media_url": "http://pbs.twimg.com/media/DTUjHH2VMAAGMQi.jpg", + "id_str": "951705501531713536", + "id": "951705501531713536", + "media_url_https": "https://pbs.twimg.com/media/DTUjHH2VMAAGMQi.jpg", + "sizes": { + "large": { + "w": "2048", + "h": "1538", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "511", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "901", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/bOwEjSxitZ" + }, + { + "expanded_url": "https://twitter.com/seldo/status/951705514009706496/photo/1", + "indices": [ + "84", + "107" + ], + "url": "https://t.co/bOwEjSxitZ", + "media_url": "http://pbs.twimg.com/media/DTUjHH5VAAAFyDe.jpg", + "id_str": "951705501544284160", + "id": "951705501544284160", + "media_url_https": "https://pbs.twimg.com/media/DTUjHH5VAAAFyDe.jpg", + "sizes": { + "large": { + "w": "2048", + "h": "1538", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "901", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "511", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/bOwEjSxitZ" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951704856674234369" + ], + "editableUntil": "2018-01-12T07:38:14.309Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Evan Goer", + "screen_name": "evangoer", + "indices": [ + "0", + "9" + ], + "id_str": "15164211", + "id": "15164211" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "46" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951675841322262532", + "id_str": "951704856674234369", + "in_reply_to_user_id": "15164211", + "truncated": false, + "retweet_count": "0", + "id": "951704856674234369", + "in_reply_to_status_id": "951675841322262532", + "created_at": "Fri Jan 12 06:38:14 +0000 2018", + "favorited": false, + "full_text": "@evangoer That would be at least equally cool.", + "lang": "en", + "in_reply_to_screen_name": "evangoer", + "in_reply_to_user_id_str": "15164211" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951704508844748800" + ], + "editableUntil": "2018-01-12T07:36:51.380Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lachlan Campbell", + "screen_name": "lachlanjc", + "indices": [ + "0", + "10" + ], + "id_str": "2464774904", + "id": "2464774904" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "14" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951652405522960385", + "id_str": "951704508844748800", + "in_reply_to_user_id": "2464774904", + "truncated": false, + "retweet_count": "0", + "id": "951704508844748800", + "in_reply_to_status_id": "951652405522960385", + "created_at": "Fri Jan 12 06:36:51 +0000 2018", + "favorited": false, + "full_text": "@lachlanjc 😁😁😁", + "lang": "qme", + "in_reply_to_screen_name": "lachlanjc", + "in_reply_to_user_id_str": "2464774904" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951648938385293312" + ], + "editableUntil": "2018-01-12T03:56:02.350Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Hack Reactor", + "screen_name": "HackReactor", + "indices": [ + "70", + "82" + ], + "id_str": "1102977272", + "id": "1102977272" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "110" + ], + "favorite_count": "33", + "in_reply_to_status_id_str": "951646741396209665", + "id_str": "951648938385293312", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "951648938385293312", + "in_reply_to_status_id": "951646741396209665", + "created_at": "Fri Jan 12 02:56:02 +0000 2018", + "favorited": false, + "full_text": "Extremely related: tonight I am speaking to a bunch of junior devs at @HackReactor and I could not be happier.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951647997821009920" + ], + "editableUntil": "2018-01-12T03:52:18.102Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "0", + "11" + ], + "id_str": "622960227", + "id": "622960227" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "169" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "951647766194900993", + "id_str": "951647997821009920", + "in_reply_to_user_id": "622960227", + "truncated": false, + "retweet_count": "0", + "id": "951647997821009920", + "in_reply_to_status_id": "951647766194900993", + "created_at": "Fri Jan 12 02:52:18 +0000 2018", + "favorited": false, + "full_text": "@bitandbang I remember when I was graduating college all my friends freaking out about what they wanted to do with their lives, and I was already 5 years into my career.", + "lang": "en", + "in_reply_to_screen_name": "bitandbang", + "in_reply_to_user_id_str": "622960227" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951646741396209665" + ], + "editableUntil": "2018-01-12T03:47:18.547Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "172" + ], + "favorite_count": "96", + "id_str": "951646741396209665", + "truncated": false, + "retweet_count": "6", + "id": "951646741396209665", + "created_at": "Fri Jan 12 02:47:18 +0000 2018", + "favorited": false, + "full_text": "Very few people discover the thing they want to do for the rest of their life at age 14, and fewer still manage to turn it into an actual paying job. I know how lucky I am.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951645206171983873" + ], + "editableUntil": "2018-01-12T03:41:12.521Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Laurie Voss moved to @seldo@alpaca.gold", + "screen_name": "seldo", + "indices": [ + "3", + "9" + ], + "id_str": "15453", + "id": "15453" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951645206171983873", + "truncated": false, + "retweet_count": "0", + "id": "951645206171983873", + "created_at": "Fri Jan 12 02:41:12 +0000 2018", + "favorited": false, + "full_text": "RT @seldo: @webrender_ October 1995:\n10am: Dial into the internet at a friend's house, see first web page\n11am: Find out about HTML\nnoon: W…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951624169598337024" + ], + "editableUntil": "2018-01-12T02:17:37.011Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "💥 Marco Stipek", + "screen_name": "codeprophet", + "indices": [ + "0", + "12" + ], + "id_str": "1464495715", + "id": "1464495715" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "951624034755604481", + "id_str": "951624169598337024", + "in_reply_to_user_id": "1464495715", + "truncated": false, + "retweet_count": "0", + "id": "951624169598337024", + "in_reply_to_status_id": "951624034755604481", + "created_at": "Fri Jan 12 01:17:37 +0000 2018", + "favorited": false, + "full_text": "@codeprophet @webrender_ Still do.", + "lang": "en", + "in_reply_to_screen_name": "codeprophet", + "in_reply_to_user_id_str": "1464495715" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951623810435837952" + ], + "editableUntil": "2018-01-12T02:16:11.380Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@jackie@toot.cat", + "screen_name": "jackie_cs_", + "indices": [ + "0", + "11" + ], + "id_str": "241267794", + "id": "241267794" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "33" + ], + "favorite_count": "18", + "in_reply_to_status_id_str": "951621699769896962", + "id_str": "951623810435837952", + "in_reply_to_user_id": "241267794", + "truncated": false, + "retweet_count": "0", + "id": "951623810435837952", + "in_reply_to_status_id": "951621699769896962", + "created_at": "Fri Jan 12 01:16:11 +0000 2018", + "favorited": false, + "full_text": "@jackie_cs_ [cries in old person]", + "lang": "en", + "in_reply_to_screen_name": "jackie_cs_", + "in_reply_to_user_id_str": "241267794" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951623003439169536" + ], + "editableUntil": "2018-01-12T02:12:58.977Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "240" + ], + "favorite_count": "43", + "in_reply_to_status_id_str": "951622196664741888", + "id_str": "951623003439169536", + "in_reply_to_user_id": "375774945", + "truncated": false, + "retweet_count": "4", + "id": "951623003439169536", + "in_reply_to_status_id": "951622196664741888", + "created_at": "Fri Jan 12 01:12:58 +0000 2018", + "favorited": false, + "full_text": "@webrender_ October 1995:\n10am: Dial into the internet at a friend's house, see first web page\n11am: Find out about HTML\nnoon: Write first web page\n1pm: Publish to Angelfire\n2pm: Decide that this is all I want to do for the rest of my life.", + "lang": "en", + "in_reply_to_user_id_str": "375774945" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951621296609095680" + ], + "editableUntil": "2018-01-12T02:06:12.037Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "99", + "id_str": "951621296609095680", + "truncated": false, + "retweet_count": "0", + "id": "951621296609095680", + "created_at": "Fri Jan 12 01:06:12 +0000 2018", + "favorited": false, + "full_text": "I have been building websites for 22 years.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951618940886634498" + ], + "editableUntil": "2018-01-12T01:56:50.389Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nick Kocharhook 🇺🇦💪🏼", + "screen_name": "k9", + "indices": [ + "0", + "3" + ], + "id_str": "15601717", + "id": "15601717" + }, + { + "name": "Genesis", + "screen_name": "Genesis", + "indices": [ + "4", + "12" + ], + "id_str": "1369390280286363651", + "id": "1369390280286363651" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951618012670504960", + "id_str": "951618940886634498", + "in_reply_to_user_id": "15601717", + "truncated": false, + "retweet_count": "0", + "id": "951618940886634498", + "in_reply_to_status_id": "951618012670504960", + "created_at": "Fri Jan 12 00:56:50 +0000 2018", + "favorited": false, + "full_text": "@k9 @Genesis I saw it and moved it! I am seeing it again tomorrow!", + "lang": "en", + "in_reply_to_screen_name": "k9", + "in_reply_to_user_id_str": "15601717" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951614511689027584" + ], + "editableUntil": "2018-01-12T01:39:14.386Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Keith Boykin", + "screen_name": "keithboykin", + "indices": [ + "3", + "15" + ], + "id_str": "21728303", + "id": "21728303" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951614511689027584", + "truncated": false, + "retweet_count": "0", + "id": "951614511689027584", + "created_at": "Fri Jan 12 00:39:14 +0000 2018", + "favorited": false, + "full_text": "RT @keithboykin: Wen did you know Trump was racist?\n1. Housing discrimination\n2. Central Park 5 lie\n3. Birtherism\n4. Called Mexicans drug d…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951587695406473216" + ], + "editableUntil": "2018-01-11T23:52:40.886Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "951587531857936384", + "id_str": "951587695406473216", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "951587695406473216", + "in_reply_to_status_id": "951587531857936384", + "created_at": "Thu Jan 11 22:52:40 +0000 2018", + "favorited": false, + "full_text": "I have been working here for 4 years, looking at our numbers every day, and the idea that we grew 67,000% in that time is still very very hard to grasp.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951587531857936384" + ], + "editableUntil": "2018-01-11T23:52:01.893Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "178" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "951574711695155200", + "id_str": "951587531857936384", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "3", + "id": "951587531857936384", + "in_reply_to_status_id": "951574711695155200", + "created_at": "Thu Jan 11 22:52:01 +0000 2018", + "favorited": false, + "full_text": "\"The reason 6000% growth looks like a decline in the previous graph is that the registry itself grew 67,000% in the same time frame\" is one of my favorite sentences in this post.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951586225164402688" + ], + "editableUntil": "2018-01-11T23:46:50.353Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "Peter Wooley", + "screen_name": "peterwooley", + "indices": [ + "0", + "12" + ], + "id_str": "766612", + "id": "766612" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951586225164402688/photo/1", + "indices": [ + "14", + "37" + ], + "url": "https://t.co/4wI3uzrpIo", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTS2ns5VQAAESRR.jpg", + "id_str": "951586214464798720", + "id": "951586214464798720", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTS2ns5VQAAESRR.jpg", + "sizes": { + "small": { + "w": "400", + "h": "276", + "resize": "fit" + }, + "large": { + "w": "400", + "h": "276", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "400", + "h": "276", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/4wI3uzrpIo" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951586095719837696", + "id_str": "951586225164402688", + "in_reply_to_user_id": "766612", + "truncated": false, + "retweet_count": "0", + "id": "951586225164402688", + "in_reply_to_status_id": "951586095719837696", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 22:46:50 +0000 2018", + "favorited": false, + "full_text": "@peterwooley https://t.co/4wI3uzrpIo", + "lang": "qme", + "in_reply_to_screen_name": "peterwooley", + "in_reply_to_user_id_str": "766612", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951586225164402688/photo/1", + "indices": [ + "14", + "37" + ], + "url": "https://t.co/4wI3uzrpIo", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTS2ns5VQAAESRR.jpg", + "id_str": "951586214464798720", + "video_info": { + "aspect_ratio": [ + "100", + "69" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DTS2ns5VQAAESRR.mp4" + } + ] + }, + "id": "951586214464798720", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTS2ns5VQAAESRR.jpg", + "sizes": { + "small": { + "w": "400", + "h": "276", + "resize": "fit" + }, + "large": { + "w": "400", + "h": "276", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "400", + "h": "276", + "resize": "fit" + } + }, + "type": "animated_gif", + "display_url": "pic.twitter.com/4wI3uzrpIo" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951581690748522497" + ], + "editableUntil": "2018-01-11T23:28:49.264Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "insecurity princess @saraislet@infosec.exchange", + "screen_name": "saraislet", + "indices": [ + "0", + "10" + ], + "id_str": "4838355980", + "id": "4838355980" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951581397667299328", + "id_str": "951581690748522497", + "in_reply_to_user_id": "4838355980", + "truncated": false, + "retweet_count": "0", + "id": "951581690748522497", + "in_reply_to_status_id": "951581397667299328", + "created_at": "Thu Jan 11 22:28:49 +0000 2018", + "favorited": false, + "full_text": "@saraislet I feel like my views on ocean-based version control are being misrepresented here 😛", + "lang": "en", + "in_reply_to_screen_name": "saraislet", + "in_reply_to_user_id_str": "4838355980" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951577757951016962" + ], + "editableUntil": "2018-01-11T23:13:11.612Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Henry", + "screen_name": "left_pad", + "indices": [ + "0", + "9" + ], + "id_str": "138173132", + "id": "138173132" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "184" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951575032404365313", + "id_str": "951577757951016962", + "in_reply_to_user_id": "138173132", + "truncated": false, + "retweet_count": "0", + "id": "951577757951016962", + "in_reply_to_status_id": "951575032404365313", + "created_at": "Thu Jan 11 22:13:11 +0000 2018", + "favorited": false, + "full_text": "@left_pad Good question! It was a bit tricky to decide but the numbers I used in the end are the sum of babel-core and 6to5. Does that seem like it would be an accurate representation?", + "lang": "en", + "in_reply_to_screen_name": "left_pad", + "in_reply_to_user_id_str": "138173132" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951574711695155200" + ], + "editableUntil": "2018-01-11T23:01:05.328Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "148" + ], + "favorite_count": "24", + "in_reply_to_status_id_str": "951572010907287552", + "id_str": "951574711695155200", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "3", + "id": "951574711695155200", + "in_reply_to_status_id": "951572010907287552", + "created_at": "Thu Jan 11 22:01:05 +0000 2018", + "favorited": false, + "full_text": "There is a reason npm started referring to itself as \"the package manager for JavaScript\" not just \"the package manager for Node.js\" and this is it.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951574224858103808" + ], + "editableUntil": "2018-01-11T22:59:09.257Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/cWaR1ql40j", + "expanded_url": "https://www.washingtonpost.com/politics/trump-attacks-protections-for-immigrants-from-shithole-countries-in-oval-office-meeting/2018/01/11/bfc0725c-f711-11e7-91af-31ac729add94_story.html?utm_term=.bc65ffd99359", + "display_url": "washingtonpost.com/politics/trump…", + "indices": [ + "52", + "75" + ] + } + ] + }, + "display_text_range": [ + "0", + "75" + ], + "favorite_count": "8", + "id_str": "951574224858103808", + "truncated": false, + "retweet_count": "4", + "id": "951574224858103808", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 21:59:09 +0000 2018", + "favorited": false, + "full_text": "The president is an ignorant bigot, part 1,000,000: https://t.co/cWaR1ql40j", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951572844994904064" + ], + "editableUntil": "2018-01-11T22:53:40.272Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jay g. 🦇", + "screen_name": "jaydestro", + "indices": [ + "0", + "10" + ], + "id_str": "15664858", + "id": "15664858" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "39" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951572346816614400", + "id_str": "951572844994904064", + "in_reply_to_user_id": "15664858", + "truncated": false, + "retweet_count": "0", + "id": "951572844994904064", + "in_reply_to_status_id": "951572346816614400", + "created_at": "Thu Jan 11 21:53:40 +0000 2018", + "favorited": false, + "full_text": "@jaydestro Fixing, thanks for the spot!", + "lang": "en", + "in_reply_to_screen_name": "jaydestro", + "in_reply_to_user_id_str": "15664858" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951572010907287552" + ], + "editableUntil": "2018-01-11T22:50:21.410Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951572010907287552/photo/1", + "indices": [ + "148", + "171" + ], + "url": "https://t.co/Z0GraYSBKB", + "media_url": "http://pbs.twimg.com/media/DTSpsMWUQAA8U6P.jpg", + "id_str": "951571997976182784", + "id": "951571997976182784", + "media_url_https": "https://pbs.twimg.com/media/DTSpsMWUQAA8U6P.jpg", + "sizes": { + "small": { + "w": "680", + "h": "589", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "723", + "h": "626", + "resize": "fit" + }, + "medium": { + "w": "723", + "h": "626", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/Z0GraYSBKB" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "171" + ], + "favorite_count": "16", + "in_reply_to_status_id_str": "951571704580489216", + "id_str": "951572010907287552", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "5", + "id": "951572010907287552", + "in_reply_to_status_id": "951571704580489216", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 21:50:21 +0000 2018", + "favorited": false, + "full_text": "TLDR: front-end usage of npm is growing rapidly towards being the dominant purpose of npm, and webpack's usage is exploding even faster than React: https://t.co/Z0GraYSBKB", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951572010907287552/photo/1", + "indices": [ + "148", + "171" + ], + "url": "https://t.co/Z0GraYSBKB", + "media_url": "http://pbs.twimg.com/media/DTSpsMWUQAA8U6P.jpg", + "id_str": "951571997976182784", + "id": "951571997976182784", + "media_url_https": "https://pbs.twimg.com/media/DTSpsMWUQAA8U6P.jpg", + "sizes": { + "small": { + "w": "680", + "h": "589", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "723", + "h": "626", + "resize": "fit" + }, + "medium": { + "w": "723", + "h": "626", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/Z0GraYSBKB" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951571704580489216" + ], + "editableUntil": "2018-01-11T22:49:08.376Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/wQqhD4szTy", + "expanded_url": "https://www.npmjs.com/npm/the-state-of-javascript-frameworks-2017-part-3-back-end-frameworks", + "display_url": "npmjs.com/npm/the-state-…", + "indices": [ + "40", + "63" + ] + } + ], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951571704580489216/photo/1", + "indices": [ + "134", + "157" + ], + "url": "https://t.co/gT2zsR8Uc0", + "media_url": "http://pbs.twimg.com/media/DTSpZrwUMAAZy8S.jpg", + "id_str": "951571679989215232", + "id": "951571679989215232", + "media_url_https": "https://pbs.twimg.com/media/DTSpZrwUMAAZy8S.jpg", + "sizes": { + "medium": { + "w": "749", + "h": "553", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "502", + "resize": "fit" + }, + "large": { + "w": "749", + "h": "553", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/gT2zsR8Uc0" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "157" + ], + "favorite_count": "47", + "id_str": "951571704580489216", + "truncated": false, + "retweet_count": "12", + "id": "951571704580489216", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 21:49:08 +0000 2018", + "favorited": false, + "full_text": "npm's State of JavaScript 2017, part 3: https://t.co/wQqhD4szTy Includes looks at usage of Express, Next.js, Webpack, Babel and more! https://t.co/gT2zsR8Uc0", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951571704580489216/photo/1", + "indices": [ + "134", + "157" + ], + "url": "https://t.co/gT2zsR8Uc0", + "media_url": "http://pbs.twimg.com/media/DTSpZrwUMAAZy8S.jpg", + "id_str": "951571679989215232", + "id": "951571679989215232", + "media_url_https": "https://pbs.twimg.com/media/DTSpZrwUMAAZy8S.jpg", + "sizes": { + "medium": { + "w": "749", + "h": "553", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "502", + "resize": "fit" + }, + "large": { + "w": "749", + "h": "553", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/gT2zsR8Uc0" + }, + { + "expanded_url": "https://twitter.com/seldo/status/951571704580489216/photo/1", + "indices": [ + "134", + "157" + ], + "url": "https://t.co/gT2zsR8Uc0", + "media_url": "http://pbs.twimg.com/media/DTSpaeEVMAAOIk0.jpg", + "id_str": "951571693494939648", + "id": "951571693494939648", + "media_url_https": "https://pbs.twimg.com/media/DTSpaeEVMAAOIk0.jpg", + "sizes": { + "small": { + "w": "680", + "h": "589", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "723", + "h": "626", + "resize": "fit" + }, + "medium": { + "w": "723", + "h": "626", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/gT2zsR8Uc0" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951568903682981888" + ], + "editableUntil": "2018-01-11T22:38:00.590Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "KirinDave has left for elucidating@mastodon.social", + "screen_name": "KirinDave", + "indices": [ + "0", + "10" + ], + "id_str": "784519", + "id": "784519" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "30" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951566797605502976", + "id_str": "951568903682981888", + "in_reply_to_user_id": "784519", + "truncated": false, + "retweet_count": "0", + "id": "951568903682981888", + "in_reply_to_status_id": "951566797605502976", + "created_at": "Thu Jan 11 21:38:00 +0000 2018", + "favorited": false, + "full_text": "@KirinDave I mean, inevitably.", + "lang": "en", + "in_reply_to_screen_name": "KirinDave", + "in_reply_to_user_id_str": "784519" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951566436085907456" + ], + "editableUntil": "2018-01-11T22:28:12.269Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "154" + ], + "favorite_count": "58", + "id_str": "951566436085907456", + "truncated": false, + "retweet_count": "4", + "id": "951566436085907456", + "created_at": "Thu Jan 11 21:28:12 +0000 2018", + "favorited": false, + "full_text": "Because my brain is a traitor that hates me, it made me Google \"are there BitCoin enthusiasts who are also furries?\" and now there is much I can't un-see.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951566169072259072" + ], + "editableUntil": "2018-01-11T22:27:08.608Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "HTTP 1.1/418 Teapot", + "screen_name": "rmd1023", + "indices": [ + "0", + "8" + ], + "id_str": "14821220", + "id": "14821220" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "76" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951564990623907846", + "id_str": "951566169072259072", + "in_reply_to_user_id": "14821220", + "truncated": false, + "retweet_count": "0", + "id": "951566169072259072", + "in_reply_to_status_id": "951564990623907846", + "created_at": "Thu Jan 11 21:27:08 +0000 2018", + "favorited": false, + "full_text": "@rmd1023 Missed opportunity to corner the BitCoin Enthusiast + Furry market.", + "lang": "en", + "in_reply_to_screen_name": "rmd1023", + "in_reply_to_user_id_str": "14821220" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951563736636047360" + ], + "editableUntil": "2018-01-11T22:17:28.670Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "David Bamford 🏳️🌈🇪🇺🏴", + "screen_name": "DavidBamf0rd", + "indices": [ + "0", + "13" + ], + "id_str": "414315764", + "id": "414315764" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951563283634491393", + "id_str": "951563736636047360", + "in_reply_to_user_id": "414315764", + "truncated": false, + "retweet_count": "0", + "id": "951563736636047360", + "in_reply_to_status_id": "951563283634491393", + "created_at": "Thu Jan 11 21:17:28 +0000 2018", + "favorited": false, + "full_text": "@DavidBamf0rd Killing is more fun.", + "lang": "en", + "in_reply_to_screen_name": "DavidBamf0rd", + "in_reply_to_user_id_str": "414315764" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951558766465499137" + ], + "editableUntil": "2018-01-11T21:57:43.689Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "3", + "id_str": "951558766465499137", + "truncated": false, + "retweet_count": "1", + "id": "951558766465499137", + "created_at": "Thu Jan 11 20:57:43 +0000 2018", + "favorited": false, + "full_text": "🎵 Is there a risk the track could bend? 🎵", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951529805375131648" + ], + "editableUntil": "2018-01-11T20:02:38.827Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "JBaruch 🎩", + "screen_name": "jbaruch", + "indices": [ + "12", + "20" + ], + "id_str": "16887172", + "id": "16887172" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "21", + "30" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "31", + "40" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "41", + "48" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "49", + "62" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "63", + "69" + ], + "id_str": "38003146", + "id": "38003146" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "70", + "81" + ], + "id_str": "14103865", + "id": "14103865" + }, + { + "name": "Stephen Fluin", + "screen_name": "stephenfluin", + "indices": [ + "82", + "95" + ], + "id_str": "15313446", + "id": "15313446" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951528616818442240", + "id_str": "951529805375131648", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "951529805375131648", + "in_reply_to_status_id": "951528616818442240", + "created_at": "Thu Jan 11 19:02:38 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @jbaruch @ZChapple @samccone @sebmck @thejameskyle @jfrog @robwormald @stephenfluin Nice! That's some genuinely persuasive data.", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951527756898037760" + ], + "editableUntil": "2018-01-11T19:54:30.432Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "3", + "9" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [ + { + "url": "https://t.co/KNP3MyNphm", + "expanded_url": "https://buff.ly/2mjNL2o", + "display_url": "buff.ly/2mjNL2o", + "indices": [ + "94", + "117" + ] + } + ] + }, + "display_text_range": [ + "0", + "117" + ], + "favorite_count": "0", + "id_str": "951527756898037760", + "truncated": false, + "retweet_count": "0", + "id": "951527756898037760", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 18:54:30 +0000 2018", + "favorited": false, + "full_text": "RT @npmjs: our full incident report and timeline from the operations incident on january 6th: https://t.co/KNP3MyNphm", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951527004297314304" + ], + "editableUntil": "2018-01-11T19:51:30.998Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "203" + ], + "favorite_count": "21", + "in_reply_to_status_id_str": "951511598975221761", + "id_str": "951527004297314304", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "951527004297314304", + "in_reply_to_status_id": "951511598975221761", + "created_at": "Thu Jan 11 18:51:30 +0000 2018", + "favorited": false, + "full_text": "Why are they wearing Lucha Libre masks with crypto logos instead of incorporating them into the costumes? Is it because none of the women involved wanted their real identities associated with this stunt?", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951511956606787584" + ], + "editableUntil": "2018-01-11T18:51:43.349Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt Stancliff", + "screen_name": "mattsta", + "indices": [ + "0", + "8" + ], + "id_str": "14825696", + "id": "14825696" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "85" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951510997595926530", + "id_str": "951511956606787584", + "in_reply_to_user_id": "14825696", + "truncated": false, + "retweet_count": "0", + "id": "951511956606787584", + "in_reply_to_status_id": "951510997595926530", + "created_at": "Thu Jan 11 17:51:43 +0000 2018", + "favorited": false, + "full_text": "@mattsta My goodness. I gave up years ago. Such a pain in the ass, kept losing stuff.", + "lang": "en", + "in_reply_to_screen_name": "mattsta", + "in_reply_to_user_id_str": "14825696" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951511598975221761" + ], + "editableUntil": "2018-01-11T18:50:18.083Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/AFjtN6bnFH", + "expanded_url": "https://qz.com/1177249/japans-kasotsuka-shojo-the-worlds-first-cryptopop-group-sings-about-bitcoin-and-cryptofraud/?mc_cid=0a04b0b7ba&mc_eid=0a91fadb73", + "display_url": "qz.com/1177249/japans…", + "indices": [ + "149", + "172" + ] + } + ] + }, + "display_text_range": [ + "0", + "172" + ], + "favorite_count": "71", + "id_str": "951511598975221761", + "truncated": false, + "retweet_count": "55", + "id": "951511598975221761", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 17:50:18 +0000 2018", + "favorited": false, + "full_text": "There is a Japanese pop group called Virtual Currency Girls who sing songs about crypto. Each of the 8 girls represents a different crypto currency. https://t.co/AFjtN6bnFH", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951509682643877889" + ], + "editableUntil": "2018-01-11T18:42:41.194Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt Stancliff", + "screen_name": "mattsta", + "indices": [ + "0", + "8" + ], + "id_str": "14825696", + "id": "14825696" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951497713677320192", + "id_str": "951509682643877889", + "in_reply_to_user_id": "14825696", + "truncated": false, + "retweet_count": "0", + "id": "951509682643877889", + "in_reply_to_status_id": "951497713677320192", + "created_at": "Thu Jan 11 17:42:41 +0000 2018", + "favorited": false, + "full_text": "@mattsta You host your own git repos?", + "lang": "en", + "in_reply_to_screen_name": "mattsta", + "in_reply_to_user_id_str": "14825696" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951507925066903552" + ], + "editableUntil": "2018-01-11T18:35:42.155Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zach Cole", + "screen_name": "ZachACole", + "indices": [ + "0", + "10" + ], + "id_str": "17949007", + "id": "17949007" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "15" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951507011501359104", + "id_str": "951507925066903552", + "in_reply_to_user_id": "17949007", + "truncated": false, + "retweet_count": "0", + "id": "951507925066903552", + "in_reply_to_status_id": "951507011501359104", + "created_at": "Thu Jan 11 17:35:42 +0000 2018", + "favorited": false, + "full_text": "@ZachACole Oooo", + "lang": "und", + "in_reply_to_screen_name": "ZachACole", + "in_reply_to_user_id_str": "17949007" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951504269663813632" + ], + "editableUntil": "2018-01-11T18:21:10.639Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "40" + ], + "favorite_count": "2", + "id_str": "951504269663813632", + "truncated": false, + "retweet_count": "0", + "id": "951504269663813632", + "created_at": "Thu Jan 11 17:21:10 +0000 2018", + "favorited": false, + "full_text": "🎵 Are you scared of these boogie feet? 🎵", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951497000645681153" + ], + "editableUntil": "2018-01-11T17:52:17.570Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "WeRateDogs", + "screen_name": "dog_rates", + "indices": [ + "3", + "13" + ], + "id_str": "4196983835", + "id": "4196983835" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "951497000645681153", + "truncated": false, + "retweet_count": "0", + "id": "951497000645681153", + "created_at": "Thu Jan 11 16:52:17 +0000 2018", + "favorited": false, + "full_text": "RT @dog_rates: This is Noisette. She responds well to pats and her name means “tear-inducingly huggable” in French. 13/10 would cherish htt…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951495873741045762" + ], + "editableUntil": "2018-01-11T17:47:48.895Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "sMyle", + "screen_name": "MylesBorins", + "indices": [ + "0", + "12" + ], + "id_str": "150664007", + "id": "150664007" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "80" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951286380495364097", + "id_str": "951495873741045762", + "in_reply_to_user_id": "150664007", + "truncated": false, + "retweet_count": "0", + "id": "951495873741045762", + "in_reply_to_status_id": "951286380495364097", + "created_at": "Thu Jan 11 16:47:48 +0000 2018", + "favorited": false, + "full_text": "@MylesBorins Just assume that I am replying \"same\" to every single one of these.", + "lang": "en", + "in_reply_to_screen_name": "MylesBorins", + "in_reply_to_user_id_str": "150664007" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951494651055284227" + ], + "editableUntil": "2018-01-11T17:42:57.384Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Glockymolo Enjoyer", + "screen_name": "ysaw", + "indices": [ + "0", + "5" + ], + "id_str": "8340382", + "id": "8340382" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "58" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951487379042312192", + "id_str": "951494651055284227", + "in_reply_to_user_id": "8340382", + "truncated": false, + "retweet_count": "0", + "id": "951494651055284227", + "in_reply_to_status_id": "951487379042312192", + "created_at": "Thu Jan 11 16:42:57 +0000 2018", + "favorited": false, + "full_text": "@ysaw In fairness the above was definitely said as a joke.", + "lang": "en", + "in_reply_to_screen_name": "ysaw", + "in_reply_to_user_id_str": "8340382" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951494379872468993" + ], + "editableUntil": "2018-01-11T17:41:52.729Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "You", + "screen_name": "knzconnor", + "indices": [ + "0", + "10" + ], + "id_str": "14086000", + "id": "14086000" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "121" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "951475889274945539", + "id_str": "951494379872468993", + "in_reply_to_user_id": "14086000", + "truncated": false, + "retweet_count": "0", + "id": "951494379872468993", + "in_reply_to_status_id": "951475889274945539", + "created_at": "Thu Jan 11 16:41:52 +0000 2018", + "favorited": false, + "full_text": "@knzconnor So is putting it on a thumb drive and throwing it into the ocean but I don't think that's a good idea, either.", + "lang": "en", + "in_reply_to_screen_name": "knzconnor", + "in_reply_to_user_id_str": "14086000" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951470484733874178" + ], + "editableUntil": "2018-01-11T16:06:55.684Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/U83gGpfyx7", + "expanded_url": "https://twitter.com/jonathanchait/status/951450890396938241", + "display_url": "twitter.com/jonathanchait/…", + "indices": [ + "234", + "257" + ] + } + ] + }, + "display_text_range": [ + "0", + "257" + ], + "favorite_count": "10", + "id_str": "951470484733874178", + "truncated": false, + "retweet_count": "2", + "id": "951470484733874178", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 15:06:55 +0000 2018", + "favorited": false, + "full_text": "\"As impressive as it may have been for Trump to sit upright and participate in a discussion of public policy while only subverting his administration’s position one time ... Trump does not understand his own administration’s policy.\"\nhttps://t.co/U83gGpfyx7", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951468287480639488" + ], + "editableUntil": "2018-01-11T15:58:11.818Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Michelle", + "screen_name": "hope4tigers", + "indices": [ + "0", + "12" + ], + "id_str": "759555100293656577", + "id": "759555100293656577" + }, + { + "name": "Pinboard", + "screen_name": "Pinboard", + "indices": [ + "13", + "22" + ], + "id_str": "55525953", + "id": "55525953" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "244" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951466728822886401", + "id_str": "951468287480639488", + "in_reply_to_user_id": "759555100293656577", + "truncated": false, + "retweet_count": "0", + "id": "951468287480639488", + "in_reply_to_status_id": "951466728822886401", + "created_at": "Thu Jan 11 14:58:11 +0000 2018", + "favorited": false, + "full_text": "@hope4tigers @Pinboard In 2018 if they happened Kellyanne Conway would be on Fox within the hour explaining that only liberals spell it correctly, and by the end of the week there would be a bill to force dictionaries to end the War on Potatoe.", + "lang": "en", + "in_reply_to_screen_name": "hope4tigers", + "in_reply_to_user_id_str": "759555100293656577" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951467384740577281" + ], + "editableUntil": "2018-01-11T15:54:36.588Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kelly Ellis", + "screen_name": "justkelly_ok", + "indices": [ + "0", + "13" + ], + "id_str": "2586997621", + "id": "2586997621" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "185" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "951465673116405760", + "id_str": "951467384740577281", + "in_reply_to_user_id": "2586997621", + "truncated": false, + "retweet_count": "0", + "id": "951467384740577281", + "in_reply_to_status_id": "951465673116405760", + "created_at": "Thu Jan 11 14:54:36 +0000 2018", + "favorited": false, + "full_text": "@justkelly_ok IT IS NOW, KELLY. Stop holding back the march of progress. Everyone will pause before sex to click a bunch of checkboxes on their phones and then never change their minds.", + "lang": "en", + "in_reply_to_screen_name": "justkelly_ok", + "in_reply_to_user_id_str": "2586997621" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951466911585394688" + ], + "editableUntil": "2018-01-11T15:52:43.779Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ee", + "screen_name": "EWDurbin", + "indices": [ + "0", + "9" + ], + "id_str": "14590010", + "id": "14590010" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "951426720283770882", + "id_str": "951466911585394688", + "in_reply_to_user_id": "14590010", + "truncated": false, + "retweet_count": "0", + "id": "951466911585394688", + "in_reply_to_status_id": "951426720283770882", + "created_at": "Thu Jan 11 14:52:43 +0000 2018", + "favorited": false, + "full_text": "@EWDurbin Fresh fruit juices.", + "lang": "en", + "in_reply_to_screen_name": "EWDurbin", + "in_reply_to_user_id_str": "14590010" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951466026452987907" + ], + "editableUntil": "2018-01-11T15:49:12.747Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "You", + "screen_name": "knzconnor", + "indices": [ + "0", + "10" + ], + "id_str": "14086000", + "id": "14086000" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "951463967897083904", + "id_str": "951466026452987907", + "in_reply_to_user_id": "14086000", + "truncated": false, + "retweet_count": "0", + "id": "951466026452987907", + "in_reply_to_status_id": "951463967897083904", + "created_at": "Thu Jan 11 14:49:12 +0000 2018", + "favorited": false, + "full_text": "@knzconnor It's listed under \"I don't use version control\".", + "lang": "en", + "in_reply_to_screen_name": "knzconnor", + "in_reply_to_user_id_str": "14086000" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951461663139545088" + ], + "editableUntil": "2018-01-11T15:31:52.452Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/KCWGE53IGO", + "expanded_url": "https://twitter.com/matt_levine/status/951149190809341952", + "display_url": "twitter.com/matt_levine/st…", + "indices": [ + "14", + "37" + ] + } + ] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "13", + "id_str": "951461663139545088", + "truncated": false, + "retweet_count": "0", + "id": "951461663139545088", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 14:31:52 +0000 2018", + "favorited": false, + "full_text": "Oh no dot gif https://t.co/KCWGE53IGO", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951341649585569792" + ], + "editableUntil": "2018-01-11T07:34:58.991Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Coraline Ada Ehmke", + "screen_name": "CoralineAda", + "indices": [ + "0", + "12" + ], + "id_str": "9526722", + "id": "9526722" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951341177860653056", + "id_str": "951341649585569792", + "in_reply_to_user_id": "9526722", + "truncated": false, + "retweet_count": "0", + "id": "951341649585569792", + "in_reply_to_status_id": "951341177860653056", + "created_at": "Thu Jan 11 06:34:58 +0000 2018", + "favorited": false, + "full_text": "@CoralineAda There's ALWAYS something happening on the internet; find a time zone where it's 10am right now and follow some people there :-)", + "lang": "en", + "in_reply_to_screen_name": "CoralineAda", + "in_reply_to_user_id_str": "9526722" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951340980623491072" + ], + "editableUntil": "2018-01-11T07:32:19.498Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashley", + "screen_name": "rabcyr", + "indices": [ + "0", + "7" + ], + "id_str": "26157562", + "id": "26157562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "83" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951340785986883584", + "id_str": "951340980623491072", + "in_reply_to_user_id": "26157562", + "truncated": false, + "retweet_count": "0", + "id": "951340980623491072", + "in_reply_to_status_id": "951340785986883584", + "created_at": "Thu Jan 11 06:32:19 +0000 2018", + "favorited": false, + "full_text": "@rabcyr That is the usual form of fuckup. I think in our survey we just didn't ask.", + "lang": "en", + "in_reply_to_screen_name": "rabcyr", + "in_reply_to_user_id_str": "26157562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951340803896438784" + ], + "editableUntil": "2018-01-11T07:31:37.363Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "cara esten", + "screen_name": "esten", + "indices": [ + "0", + "6" + ], + "id_str": "1108462281237520384", + "id": "1108462281237520384" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "53" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951336361952292865", + "id_str": "951340803896438784", + "in_reply_to_user_id": "15374401", + "truncated": false, + "retweet_count": "0", + "id": "951340803896438784", + "in_reply_to_status_id": "951336361952292865", + "created_at": "Thu Jan 11 06:31:37 +0000 2018", + "favorited": false, + "full_text": "@esten Every day you reach new heights of hipsterdom.", + "lang": "en", + "in_reply_to_screen_name": "caraesten", + "in_reply_to_user_id_str": "15374401" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951339858449985538" + ], + "editableUntil": "2018-01-11T07:27:51.951Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mx. Aria Stewart", + "screen_name": "aredridel", + "indices": [ + "0", + "10" + ], + "id_str": "17950990", + "id": "17950990" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "100" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951338667129344000", + "id_str": "951339858449985538", + "in_reply_to_user_id": "17950990", + "truncated": false, + "retweet_count": "0", + "id": "951339858449985538", + "in_reply_to_status_id": "951338667129344000", + "created_at": "Thu Jan 11 06:27:51 +0000 2018", + "favorited": false, + "full_text": "@aredridel I've deleted the tweet. It's not my place to tell trans folk how to feel about questions.", + "lang": "en", + "in_reply_to_screen_name": "aredridel", + "in_reply_to_user_id_str": "17950990" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951339598474440704" + ], + "editableUntil": "2018-01-11T07:26:49.968Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashley", + "screen_name": "rabcyr", + "indices": [ + "0", + "7" + ], + "id_str": "26157562", + "id": "26157562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "13" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951336343522693120", + "id_str": "951339598474440704", + "in_reply_to_user_id": "26157562", + "truncated": false, + "retweet_count": "0", + "id": "951339598474440704", + "in_reply_to_status_id": "951336343522693120", + "created_at": "Thu Jan 11 06:26:49 +0000 2018", + "favorited": false, + "full_text": "@rabcyr Oops.", + "lang": "en", + "in_reply_to_screen_name": "rabcyr", + "in_reply_to_user_id_str": "26157562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951332486616776704" + ], + "editableUntil": "2018-01-11T06:58:34.369Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "116" + ], + "favorite_count": "30", + "in_reply_to_status_id_str": "951331681981497345", + "id_str": "951332486616776704", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951332486616776704", + "in_reply_to_status_id": "951331681981497345", + "created_at": "Thu Jan 11 05:58:34 +0000 2018", + "favorited": false, + "full_text": "There are enough people copying and pasting files to network shares that this is a pre-filled answer. I am very sad.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951331681981497345" + ], + "editableUntil": "2018-01-11T06:55:22.529Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951331681981497345/photo/1", + "indices": [ + "73", + "96" + ], + "url": "https://t.co/gJuF2DpJ5I", + "media_url": "http://pbs.twimg.com/media/DTPPEE5VwAAS2DX.jpg", + "id_str": "951331615245975552", + "id": "951331615245975552", + "media_url_https": "https://pbs.twimg.com/media/DTPPEE5VwAAS2DX.jpg", + "sizes": { + "small": { + "w": "668", + "h": "324", + "resize": "fit" + }, + "large": { + "w": "668", + "h": "324", + "resize": "fit" + }, + "medium": { + "w": "668", + "h": "324", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/gJuF2DpJ5I" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "96" + ], + "favorite_count": "37", + "id_str": "951331681981497345", + "truncated": false, + "retweet_count": "6", + "id": "951331681981497345", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 05:55:22 +0000 2018", + "favorited": false, + "full_text": "The available answers to this question make me sad just looking at them. https://t.co/gJuF2DpJ5I", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951331681981497345/photo/1", + "indices": [ + "73", + "96" + ], + "url": "https://t.co/gJuF2DpJ5I", + "media_url": "http://pbs.twimg.com/media/DTPPEE5VwAAS2DX.jpg", + "id_str": "951331615245975552", + "id": "951331615245975552", + "media_url_https": "https://pbs.twimg.com/media/DTPPEE5VwAAS2DX.jpg", + "sizes": { + "small": { + "w": "668", + "h": "324", + "resize": "fit" + }, + "large": { + "w": "668", + "h": "324", + "resize": "fit" + }, + "medium": { + "w": "668", + "h": "324", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/gJuF2DpJ5I" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951327925034401792" + ], + "editableUntil": "2018-01-11T06:40:26.803Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "26" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951324287390003200", + "id_str": "951327925034401792", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "951327925034401792", + "in_reply_to_status_id": "951324287390003200", + "created_at": "Thu Jan 11 05:40:26 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar 👍🏻 Appreciated.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951325916004667393" + ], + "editableUntil": "2018-01-11T06:32:27.813Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Alan", + "screen_name": "akgerber", + "indices": [ + "0", + "9" + ], + "id_str": "115095156", + "id": "115095156" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951297797705388033", + "id_str": "951325916004667393", + "in_reply_to_user_id": "115095156", + "truncated": false, + "retweet_count": "0", + "id": "951325916004667393", + "in_reply_to_status_id": "951297797705388033", + "created_at": "Thu Jan 11 05:32:27 +0000 2018", + "favorited": false, + "full_text": "@akgerber I 100% own polo shirts and khakis and occasionally wear them at the same time. But how could my haircut get any worse?", + "lang": "en", + "in_reply_to_screen_name": "akgerber", + "in_reply_to_user_id_str": "115095156" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951325606033088513" + ], + "editableUntil": "2018-01-11T06:31:13.910Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "0", + "11" + ], + "id_str": "14103865", + "id": "14103865" + }, + { + "name": "Ben Lesh", + "screen_name": "BenLesh", + "indices": [ + "12", + "20" + ], + "id_str": "23795212", + "id": "23795212" + }, + { + "name": "danabramov.bsky.social", + "screen_name": "dan_abramov", + "indices": [ + "21", + "33" + ], + "id_str": "70345946", + "id": "70345946" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "102" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951284011648745482", + "id_str": "951325606033088513", + "in_reply_to_user_id": "14103865", + "truncated": false, + "retweet_count": "0", + "id": "951325606033088513", + "in_reply_to_status_id": "951284011648745482", + "created_at": "Thu Jan 11 05:31:13 +0000 2018", + "favorited": false, + "full_text": "@robwormald @BenLesh @dan_abramov Absolutely! I think it's part 4 or 5? I forget how we split them up.", + "lang": "en", + "in_reply_to_screen_name": "robwormald", + "in_reply_to_user_id_str": "14103865" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951277290943496192" + ], + "editableUntil": "2018-01-11T03:19:14.695Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dennis Collinson", + "screen_name": "dnscollective", + "indices": [ + "0", + "14" + ], + "id_str": "30498562", + "id": "30498562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "214" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951220716514373632", + "id_str": "951277290943496192", + "in_reply_to_user_id": "30498562", + "truncated": false, + "retweet_count": "0", + "id": "951277290943496192", + "in_reply_to_status_id": "951220716514373632", + "created_at": "Thu Jan 11 02:19:14 +0000 2018", + "favorited": false, + "full_text": "@dnscollective I mean, the way worse part is that it was run and paid for by the VC firm itself. Again: the problem is not sex parties, the problem is access to investment being contingent on attending sex parties.", + "lang": "en", + "in_reply_to_screen_name": "dnscollective", + "in_reply_to_user_id_str": "30498562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951275026644328448" + ], + "editableUntil": "2018-01-11T03:10:14.844Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Revin Guillen", + "screen_name": "revin", + "indices": [ + "0", + "6" + ], + "id_str": "14496796", + "id": "14496796" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "7", + "15" + ], + "id_str": "78663", + "id": "78663" + }, + { + "name": "Rick Waldron", + "screen_name": "rwaldron", + "indices": [ + "16", + "25" + ], + "id_str": "16144669", + "id": "16144669" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951268431763877888", + "id_str": "951275026644328448", + "in_reply_to_user_id": "14496796", + "truncated": false, + "retweet_count": "0", + "id": "951275026644328448", + "in_reply_to_status_id": "951268431763877888", + "created_at": "Thu Jan 11 02:10:14 +0000 2018", + "favorited": false, + "full_text": "@revin @ceejbot @rwaldron I *am* the Grump Track.", + "lang": "en", + "in_reply_to_screen_name": "revin", + "in_reply_to_user_id_str": "14496796" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951261859197476865" + ], + "editableUntil": "2018-01-11T02:17:55.480Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951260854338535425", + "id_str": "951261859197476865", + "in_reply_to_user_id": "165524923", + "truncated": false, + "retweet_count": "0", + "id": "951261859197476865", + "in_reply_to_status_id": "951260854338535425", + "created_at": "Thu Jan 11 01:17:55 +0000 2018", + "favorited": false, + "full_text": "@destroyvegas What if... this *is* a left-pad joke?", + "lang": "en", + "in_reply_to_screen_name": "zackschuster", + "in_reply_to_user_id_str": "165524923" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951260645353115648" + ], + "editableUntil": "2018-01-11T02:13:06.077Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951260645353115648/photo/1", + "indices": [ + "21", + "44" + ], + "url": "https://t.co/eOdoQRRoMj", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTOOgWHUMAENm3A.jpg", + "id_str": "951260632648527873", + "id": "951260632648527873", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTOOgWHUMAENm3A.jpg", + "sizes": { + "medium": { + "w": "240", + "h": "300", + "resize": "fit" + }, + "large": { + "w": "240", + "h": "300", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "240", + "h": "300", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/eOdoQRRoMj" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "44" + ], + "favorite_count": "27", + "id_str": "951260645353115648", + "truncated": false, + "retweet_count": "2", + "id": "951260645353115648", + "possibly_sensitive": false, + "created_at": "Thu Jan 11 01:13:06 +0000 2018", + "favorited": false, + "full_text": "Remember left shark? https://t.co/eOdoQRRoMj", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/951260645353115648/photo/1", + "indices": [ + "21", + "44" + ], + "url": "https://t.co/eOdoQRRoMj", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DTOOgWHUMAENm3A.jpg", + "id_str": "951260632648527873", + "video_info": { + "aspect_ratio": [ + "4", + "5" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DTOOgWHUMAENm3A.mp4" + } + ] + }, + "id": "951260632648527873", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DTOOgWHUMAENm3A.jpg", + "sizes": { + "medium": { + "w": "240", + "h": "300", + "resize": "fit" + }, + "large": { + "w": "240", + "h": "300", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "240", + "h": "300", + "resize": "fit" + } + }, + "type": "animated_gif", + "display_url": "pic.twitter.com/eOdoQRRoMj" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951258066065940480" + ], + "editableUntil": "2018-01-11T02:02:51.127Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Omid Monshizadeh", + "screen_name": "monshi", + "indices": [ + "0", + "7" + ], + "id_str": "15391366", + "id": "15391366" + }, + { + "name": "kat", + "screen_name": "maybekatz", + "indices": [ + "8", + "18" + ], + "id_str": "1199492153832902658", + "id": "1199492153832902658" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "19", + "25" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "115" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "951257490947112960", + "id_str": "951258066065940480", + "in_reply_to_user_id": "15391366", + "truncated": false, + "retweet_count": "0", + "id": "951258066065940480", + "in_reply_to_status_id": "951257490947112960", + "created_at": "Thu Jan 11 01:02:51 +0000 2018", + "favorited": false, + "full_text": "@monshi @maybekatz @npmjs That's a bit more work :-) Is this just curiosity or do you need this list for something?", + "lang": "en", + "in_reply_to_screen_name": "monshi", + "in_reply_to_user_id_str": "15391366" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951257468042076160" + ], + "editableUntil": "2018-01-11T02:00:28.547Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "0", + "8" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "28" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951255805205999617", + "id_str": "951257468042076160", + "in_reply_to_user_id": "78663", + "truncated": false, + "retweet_count": "0", + "id": "951257468042076160", + "in_reply_to_status_id": "951255805205999617", + "created_at": "Thu Jan 11 01:00:28 +0000 2018", + "favorited": false, + "full_text": "@ceejbot I'll bring my cane.", + "lang": "en", + "in_reply_to_screen_name": "ceejbot", + "in_reply_to_user_id_str": "78663" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951257183722680320" + ], + "editableUntil": "2018-01-11T01:59:20.760Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "kat", + "screen_name": "maybekatz", + "indices": [ + "0", + "10" + ], + "id_str": "1199492153832902658", + "id": "1199492153832902658" + }, + { + "name": "Omid Monshizadeh", + "screen_name": "monshi", + "indices": [ + "11", + "18" + ], + "id_str": "15391366", + "id": "15391366" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "19", + "25" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "136" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951256010500403200", + "id_str": "951257183722680320", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951257183722680320", + "in_reply_to_status_id": "951256010500403200", + "created_at": "Thu Jan 11 00:59:20 +0000 2018", + "favorited": false, + "full_text": "@maybekatz @monshi @npmjs 2989 packages have mixed-case names, or about 0.5% of the registry. The last one was created in December 2016.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951256010500403200" + ], + "editableUntil": "2018-01-11T01:54:41.042Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "kat", + "screen_name": "maybekatz", + "indices": [ + "0", + "10" + ], + "id_str": "1199492153832902658", + "id": "1199492153832902658" + }, + { + "name": "Omid Monshizadeh", + "screen_name": "monshi", + "indices": [ + "11", + "18" + ], + "id_str": "15391366", + "id": "15391366" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "19", + "25" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "60" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951255692664438784", + "id_str": "951256010500403200", + "in_reply_to_user_id": "2978661890", + "truncated": false, + "retweet_count": "0", + "id": "951256010500403200", + "in_reply_to_status_id": "951255692664438784", + "created_at": "Thu Jan 11 00:54:41 +0000 2018", + "favorited": false, + "full_text": "@maybekatz @monshi @npmjs Hmmm. Sure I do. *computer noises*", + "lang": "en", + "in_reply_to_screen_name": "zkat__", + "in_reply_to_user_id_str": "2978661890" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951254329490460673" + ], + "editableUntil": "2018-01-11T01:48:00.258Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🏳️🌈 Sam Kimbrel | @skimbrel@tech.lgbt", + "screen_name": "skimbrel", + "indices": [ + "0", + "9" + ], + "id_str": "17934129", + "id": "17934129" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "86" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "951254146316779520", + "id_str": "951254329490460673", + "in_reply_to_user_id": "17934129", + "truncated": false, + "retweet_count": "0", + "id": "951254329490460673", + "in_reply_to_status_id": "951254146316779520", + "created_at": "Thu Jan 11 00:48:00 +0000 2018", + "favorited": false, + "full_text": "@skimbrel This would be a bigger perk if I had been to a bar in the last... 2 years...", + "lang": "en", + "in_reply_to_screen_name": "skimbrel", + "in_reply_to_user_id_str": "17934129" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951253264535756801" + ], + "editableUntil": "2018-01-11T01:43:46.353Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "166" + ], + "favorite_count": "48", + "in_reply_to_status_id_str": "951252764612485121", + "id_str": "951253264535756801", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951253264535756801", + "in_reply_to_status_id": "951252764612485121", + "created_at": "Thu Jan 11 00:43:46 +0000 2018", + "favorited": false, + "full_text": "On the other hand, looking like an idiot child sometimes means people let their guard down in negotiations and are unprepared when I ask actually difficult questions.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951252764612485121" + ], + "editableUntil": "2018-01-11T01:41:47.162Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "54" + ], + "favorite_count": "19", + "in_reply_to_status_id_str": "951252533795680256", + "id_str": "951252764612485121", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951252764612485121", + "in_reply_to_status_id": "951252533795680256", + "created_at": "Thu Jan 11 00:41:47 +0000 2018", + "favorited": false, + "full_text": "I'm a hella old, grizzled idiot. Give me some respect.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951252533795680256" + ], + "editableUntil": "2018-01-11T01:40:52.131Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "205" + ], + "favorite_count": "94", + "id_str": "951252533795680256", + "truncated": false, + "retweet_count": "1", + "id": "951252533795680256", + "created_at": "Thu Jan 11 00:40:52 +0000 2018", + "favorited": false, + "full_text": "Sometimes I think my conversations with third-party vendors, consultants, investors etc. would go a lot faster if I wore a big nametag that said \"I am nearly 40, not the idiot child you are taking me for\".", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951250595079380992" + ], + "editableUntil": "2018-01-11T01:33:09.905Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ben Lesh", + "screen_name": "BenLesh", + "indices": [ + "0", + "8" + ], + "id_str": "23795212", + "id": "23795212" + }, + { + "name": "danabramov.bsky.social", + "screen_name": "dan_abramov", + "indices": [ + "9", + "21" + ], + "id_str": "70345946", + "id": "70345946" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "157" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "951249677717970944", + "id_str": "951250595079380992", + "in_reply_to_user_id": "23795212", + "truncated": false, + "retweet_count": "0", + "id": "951250595079380992", + "in_reply_to_status_id": "951249677717970944", + "created_at": "Thu Jan 11 00:33:09 +0000 2018", + "favorited": false, + "full_text": "@BenLesh @dan_abramov The reason I included it was I tweeted publicly about big packages people use in the React space and multiple people chimed in with it.", + "lang": "en", + "in_reply_to_screen_name": "BenLesh", + "in_reply_to_user_id_str": "23795212" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951239648625307649" + ], + "editableUntil": "2018-01-11T00:49:40.067Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ben Lesh", + "screen_name": "BenLesh", + "indices": [ + "0", + "8" + ], + "id_str": "23795212", + "id": "23795212" + }, + { + "name": "danabramov.bsky.social", + "screen_name": "dan_abramov", + "indices": [ + "9", + "21" + ], + "id_str": "70345946", + "id": "70345946" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951239459437080576", + "id_str": "951239648625307649", + "in_reply_to_user_id": "23795212", + "truncated": false, + "retweet_count": "0", + "id": "951239648625307649", + "in_reply_to_status_id": "951239459437080576", + "created_at": "Wed Jan 10 23:49:40 +0000 2018", + "favorited": false, + "full_text": "@BenLesh @dan_abramov As I mentioned in the post, lots of RxJS usage is coming in because the Angular CLI uses it. All Angular CLI users are RxJS users.", + "lang": "en", + "in_reply_to_screen_name": "BenLesh", + "in_reply_to_user_id_str": "23795212" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951236892632088576" + ], + "editableUntil": "2018-01-11T00:38:42.987Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mikeal Rogers", + "screen_name": "mikeal", + "indices": [ + "0", + "7" + ], + "id_str": "668423", + "id": "668423" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "26" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "951236758812835840", + "id_str": "951236892632088576", + "in_reply_to_user_id": "668423", + "truncated": false, + "retweet_count": "0", + "id": "951236892632088576", + "in_reply_to_status_id": "951236758812835840", + "created_at": "Wed Jan 10 23:38:42 +0000 2018", + "favorited": false, + "full_text": "@mikeal DISRUPT ADJECTIVES", + "lang": "en", + "in_reply_to_screen_name": "mikeal", + "in_reply_to_user_id_str": "668423" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951234996592721920" + ], + "editableUntil": "2018-01-11T00:31:10.936Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "148" + ], + "favorite_count": "20", + "in_reply_to_status_id_str": "951234624243474432", + "id_str": "951234996592721920", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "951234996592721920", + "in_reply_to_status_id": "951234624243474432", + "created_at": "Wed Jan 10 23:31:10 +0000 2018", + "favorited": false, + "full_text": "This is where the Bitcoin enthusiasts swoop in to tell me that Bitcoin, down 14% in the last 30 days, is not a currency but a stable store of value.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951234624243474432" + ], + "editableUntil": "2018-01-11T00:29:42.161Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/QZH1fSzbsK", + "expanded_url": "https://twitter.com/Luwhi/status/951165647815348224", + "display_url": "twitter.com/Luwhi/status/9…", + "indices": [ + "36", + "59" + ] + } + ] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "69", + "id_str": "951234624243474432", + "truncated": false, + "retweet_count": "22", + "id": "951234624243474432", + "possibly_sensitive": false, + "created_at": "Wed Jan 10 23:29:42 +0000 2018", + "favorited": false, + "full_text": "The irony never stops with Bitcoin: https://t.co/QZH1fSzbsK", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951208922865520640" + ], + "editableUntil": "2018-01-10T22:47:34.475Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BuzzFeed", + "screen_name": "BuzzFeed", + "indices": [ + "3", + "12" + ], + "id_str": "5695632", + "id": "5695632" + } + ], + "urls": [ + { + "url": "https://t.co/gYYtSpUutf", + "expanded_url": "http://bzfd.it/2mf3i3y", + "display_url": "bzfd.it/2mf3i3y", + "indices": [ + "97", + "120" + ] + } + ] + }, + "display_text_range": [ + "0", + "120" + ], + "favorite_count": "0", + "id_str": "951208922865520640", + "truncated": false, + "retweet_count": "0", + "id": "951208922865520640", + "possibly_sensitive": false, + "created_at": "Wed Jan 10 21:47:34 +0000 2018", + "favorited": false, + "full_text": "RT @BuzzFeed: \"Black Panther\" sold more advance tickets in 24 hours than any other Marvel movie\n\nhttps://t.co/gYYtSpUutf", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951199232173592576" + ], + "editableUntil": "2018-01-10T22:09:04.034Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Ryan T From Tennessee", + "screen_name": "RyanTablada", + "indices": [ + "0", + "12" + ], + "id_str": "90242250", + "id": "90242250" + }, + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "13", + "24" + ], + "id_str": "622960227", + "id": "622960227" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "112" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "951198325084180482", + "id_str": "951199232173592576", + "in_reply_to_user_id": "90242250", + "truncated": false, + "retweet_count": "0", + "id": "951199232173592576", + "in_reply_to_status_id": "951198325084180482", + "created_at": "Wed Jan 10 21:09:04 +0000 2018", + "favorited": false, + "full_text": "@RyanTablada @bitandbang Everything about Steam is terrible and I do not understand what keeps them in business.", + "lang": "en", + "in_reply_to_screen_name": "RyanTablada", + "in_reply_to_user_id_str": "90242250" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951192019547824133" + ], + "editableUntil": "2018-01-10T21:40:24.410Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "131" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951191776961769472", + "id_str": "951192019547824133", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "951192019547824133", + "in_reply_to_status_id": "951191776961769472", + "created_at": "Wed Jan 10 20:40:24 +0000 2018", + "favorited": false, + "full_text": "(I'm not affiliated with HarperDB in any way, except I agreed to be a judge for the competition after meeting them at a conference)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951191776961769472" + ], + "editableUntil": "2018-01-10T21:39:26.573Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/HySVC3m54q", + "expanded_url": "https://twitter.com/harperdbio/status/948983171672047616", + "display_url": "twitter.com/harperdbio/sta…", + "indices": [ + "131", + "154" + ] + } + ] + }, + "display_text_range": [ + "0", + "154" + ], + "favorite_count": "8", + "id_str": "951191776961769472", + "truncated": false, + "retweet_count": "1", + "id": "951191776961769472", + "possibly_sensitive": false, + "created_at": "Wed Jan 10 20:39:26 +0000 2018", + "favorited": false, + "full_text": "HarperDB is a fun new open-source DB and they are giving prizes for building stuff with it in a week-long competition in February: https://t.co/HySVC3m54q", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951190188411125761" + ], + "editableUntil": "2018-01-10T21:33:07.833Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "125" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "951187814372143104", + "id_str": "951190188411125761", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "951190188411125761", + "in_reply_to_status_id": "951187814372143104", + "created_at": "Wed Jan 10 20:33:07 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton The live stream when I opened it was a picture of somebody looking at a tweet on twitter. It was very Inception.", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "951184046096244736" + ], + "editableUntil": "2018-01-10T21:08:43.391Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "20", + "id_str": "951184046096244736", + "truncated": false, + "retweet_count": "1", + "id": "951184046096244736", + "created_at": "Wed Jan 10 20:08:43 +0000 2018", + "favorited": false, + "full_text": "OH: \"Acquisitions are how people in Silicon Valley take vacation.\"", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950982800114515968" + ], + "editableUntil": "2018-01-10T07:49:02.610Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "alexis", + "screen_name": "holyurl", + "indices": [ + "0", + "8" + ], + "id_str": "172227116", + "id": "172227116" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "32" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950951334118912000", + "id_str": "950982800114515968", + "in_reply_to_user_id": "172227116", + "truncated": false, + "retweet_count": "0", + "id": "950982800114515968", + "in_reply_to_status_id": "950951334118912000", + "created_at": "Wed Jan 10 06:49:02 +0000 2018", + "favorited": false, + "full_text": "@holyurl Isn't that just Canada?", + "lang": "en", + "in_reply_to_screen_name": "holyurl", + "in_reply_to_user_id_str": "172227116" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950980230193098752" + ], + "editableUntil": "2018-01-10T07:38:49.893Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan English (💉💉💉💉)", + "screen_name": "bengl", + "indices": [ + "0", + "6" + ], + "id_str": "14863971", + "id": "14863971" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950976260724875264", + "id_str": "950980230193098752", + "in_reply_to_user_id": "14863971", + "truncated": false, + "retweet_count": "0", + "id": "950980230193098752", + "in_reply_to_status_id": "950976260724875264", + "created_at": "Wed Jan 10 06:38:49 +0000 2018", + "favorited": false, + "full_text": "@bengl I don't hate it. It's really dark though.", + "lang": "en", + "in_reply_to_screen_name": "bengl", + "in_reply_to_user_id_str": "14863971" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950972644555341824" + ], + "editableUntil": "2018-01-10T07:08:41.336Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "laura i. gómez", + "screen_name": "laura", + "indices": [ + "0", + "6" + ], + "id_str": "17454341", + "id": "17454341" + }, + { + "name": "Atipica", + "screen_name": "GetAtipica", + "indices": [ + "7", + "18" + ], + "id_str": "2957802415", + "id": "2957802415" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950972182699556864", + "id_str": "950972644555341824", + "in_reply_to_user_id": "17454341", + "truncated": false, + "retweet_count": "0", + "id": "950972644555341824", + "in_reply_to_status_id": "950972182699556864", + "created_at": "Wed Jan 10 06:08:41 +0000 2018", + "favorited": false, + "full_text": "@laura @GetAtipica Congratulations!", + "lang": "en", + "in_reply_to_screen_name": "laura", + "in_reply_to_user_id_str": "17454341" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950971938700107776" + ], + "editableUntil": "2018-01-10T07:05:53.047Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Devon Govett", + "screen_name": "devongovett", + "indices": [ + "0", + "12" + ], + "id_str": "15687937", + "id": "15687937" + }, + { + "name": "Jason Miller 🦊⚛", + "screen_name": "_developit", + "indices": [ + "13", + "24" + ], + "id_str": "16495353", + "id": "16495353" + }, + { + "name": "Dominic Gannaway", + "screen_name": "trueadm", + "indices": [ + "25", + "33" + ], + "id_str": "39141147", + "id": "39141147" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "254" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950970753171652609", + "id_str": "950971938700107776", + "in_reply_to_user_id": "15687937", + "truncated": false, + "retweet_count": "0", + "id": "950971938700107776", + "in_reply_to_status_id": "950970753171652609", + "created_at": "Wed Jan 10 06:05:53 +0000 2018", + "favorited": false, + "full_text": "@devongovett @_developit @trueadm It was not generally true across npm (it was a significantly below-average day for most packages). I think somebody really did do 80k installs of something that day. Probably somebody's holiday hacking project had a bug.", + "lang": "en", + "in_reply_to_screen_name": "devongovett", + "in_reply_to_user_id_str": "15687937" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950970279081082881" + ], + "editableUntil": "2018-01-10T06:59:17.363Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "AJ Jordan #neveragain", + "screen_name": "strugee2", + "indices": [ + "0", + "9" + ], + "id_str": "369017201", + "id": "369017201" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950970001833410560", + "id_str": "950970279081082881", + "in_reply_to_user_id": "369017201", + "truncated": false, + "retweet_count": "0", + "id": "950970279081082881", + "in_reply_to_status_id": "950970001833410560", + "created_at": "Wed Jan 10 05:59:17 +0000 2018", + "favorited": false, + "full_text": "@strugee2 Mitigations are not the same as fixes.", + "lang": "en", + "in_reply_to_screen_name": "strugee2", + "in_reply_to_user_id_str": "369017201" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950961840170835970" + ], + "editableUntil": "2018-01-10T06:25:45.370Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/9bqZpGkg6n", + "expanded_url": "https://www.thedailybeast.com/this-is-the-data-snapchat-doesnt-want-you-to-see", + "display_url": "thedailybeast.com/this-is-the-da…", + "indices": [ + "140", + "163" + ] + } + ], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950961840170835970/photo/1", + "indices": [ + "164", + "187" + ], + "url": "https://t.co/e0ydXvUGZi", + "media_url": "http://pbs.twimg.com/media/DTJ-j5xV4AAJ-Wi.jpg", + "id_str": "950961626596892672", + "id": "950961626596892672", + "media_url_https": "https://pbs.twimg.com/media/DTJ-j5xV4AAJ-Wi.jpg", + "sizes": { + "large": { + "w": "668", + "h": "354", + "resize": "fit" + }, + "medium": { + "w": "668", + "h": "354", + "resize": "fit" + }, + "small": { + "w": "668", + "h": "354", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/e0ydXvUGZi" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "187" + ], + "favorite_count": "29", + "id_str": "950961840170835970", + "truncated": false, + "retweet_count": "11", + "id": "950961840170835970", + "possibly_sensitive": false, + "created_at": "Wed Jan 10 05:25:45 +0000 2018", + "favorited": false, + "full_text": "I have long suspected that Snap has been fudging its active user numbers because they suck, and a big leak appears to show that's the case: https://t.co/9bqZpGkg6n https://t.co/e0ydXvUGZi", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950961840170835970/photo/1", + "indices": [ + "164", + "187" + ], + "url": "https://t.co/e0ydXvUGZi", + "media_url": "http://pbs.twimg.com/media/DTJ-j5xV4AAJ-Wi.jpg", + "id_str": "950961626596892672", + "id": "950961626596892672", + "media_url_https": "https://pbs.twimg.com/media/DTJ-j5xV4AAJ-Wi.jpg", + "sizes": { + "large": { + "w": "668", + "h": "354", + "resize": "fit" + }, + "medium": { + "w": "668", + "h": "354", + "resize": "fit" + }, + "small": { + "w": "668", + "h": "354", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/e0ydXvUGZi" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950959235826774016" + ], + "editableUntil": "2018-01-10T06:15:24.446Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "50" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950958558794809344", + "id_str": "950959235826774016", + "in_reply_to_user_id": "4254951", + "truncated": false, + "retweet_count": "0", + "id": "950959235826774016", + "in_reply_to_status_id": "950958558794809344", + "created_at": "Wed Jan 10 05:15:24 +0000 2018", + "favorited": false, + "full_text": "@jef_poskanzer But what is your source of entropy?", + "lang": "en", + "in_reply_to_screen_name": "jefposk", + "in_reply_to_user_id_str": "4254951" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950958777099956224" + ], + "editableUntil": "2018-01-10T06:13:35.077Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mikel Jollett", + "screen_name": "Mikel_Jollett", + "indices": [ + "3", + "17" + ], + "id_str": "594175899", + "id": "594175899" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "950958777099956224", + "truncated": false, + "retweet_count": "0", + "id": "950958777099956224", + "created_at": "Wed Jan 10 05:13:35 +0000 2018", + "favorited": false, + "full_text": "RT @Mikel_Jollett: Bannonfreude is when you build a propaganda empire based on racist lies which then fires you the minute you tell the tru…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950955979406942208" + ], + "editableUntil": "2018-01-10T06:02:28.055Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "93" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "950954680246419456", + "id_str": "950955979406942208", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "950955979406942208", + "in_reply_to_status_id": "950954680246419456", + "created_at": "Wed Jan 10 05:02:28 +0000 2018", + "favorited": false, + "full_text": "If you saw my talk at @nodevember, this is the tool I was referring to as \"cipm\" at the time.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950955538434502657" + ], + "editableUntil": "2018-01-10T06:00:42.919Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "john curley", + "screen_name": "johncurley", + "indices": [ + "0", + "11" + ], + "id_str": "3719", + "id": "3719" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "109" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950952368786456576", + "id_str": "950955538434502657", + "in_reply_to_user_id": "3719", + "truncated": false, + "retweet_count": "0", + "id": "950955538434502657", + "in_reply_to_status_id": "950952368786456576", + "created_at": "Wed Jan 10 05:00:42 +0000 2018", + "favorited": false, + "full_text": "@johncurley @jef_poskanzer Beware! This is a well known pattern that brute-force attacks we are aware of use.", + "lang": "en", + "in_reply_to_screen_name": "johncurley", + "in_reply_to_user_id_str": "3719" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950955393223507968" + ], + "editableUntil": "2018-01-10T06:00:08.298Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "71" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950950852407132160", + "id_str": "950955393223507968", + "in_reply_to_user_id": "4254951", + "truncated": false, + "retweet_count": "0", + "id": "950955393223507968", + "in_reply_to_status_id": "950950852407132160", + "created_at": "Wed Jan 10 05:00:08 +0000 2018", + "favorited": false, + "full_text": "@jef_poskanzer How do you... write your own... random number generator?", + "lang": "en", + "in_reply_to_screen_name": "jefposk", + "in_reply_to_user_id_str": "4254951" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950954680246419456" + ], + "editableUntil": "2018-01-10T05:57:18.311Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/U9uMHrDAL1", + "expanded_url": "https://twitter.com/mikesherov/status/950935119287775232", + "display_url": "twitter.com/mikesherov/sta…", + "indices": [ + "89", + "112" + ] + } + ] + }, + "display_text_range": [ + "0", + "112" + ], + "favorite_count": "23", + "id_str": "950954680246419456", + "truncated": false, + "retweet_count": "4", + "id": "950954680246419456", + "possibly_sensitive": false, + "created_at": "Wed Jan 10 04:57:18 +0000 2018", + "favorited": false, + "full_text": "Coming soon to npm, `npm ci`, a bare-bones install that is extremely, unbelievably fast: https://t.co/U9uMHrDAL1", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950924954433765376" + ], + "editableUntil": "2018-01-10T03:59:11.125Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Emily Gorcenski", + "screen_name": "EmilyGorcenski", + "indices": [ + "0", + "15" + ], + "id_str": "1483064670", + "id": "1483064670" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "20" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950924791179022336", + "id_str": "950924954433765376", + "in_reply_to_user_id": "1483064670", + "truncated": false, + "retweet_count": "0", + "id": "950924954433765376", + "in_reply_to_status_id": "950924791179022336", + "created_at": "Wed Jan 10 02:59:11 +0000 2018", + "favorited": false, + "full_text": "@EmilyGorcenski Oof.", + "lang": "und", + "in_reply_to_screen_name": "EmilyGorcenski", + "in_reply_to_user_id_str": "1483064670" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950923878171254784" + ], + "editableUntil": "2018-01-10T03:54:54.524Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "135" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "950922102336503808", + "id_str": "950923878171254784", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950923878171254784", + "in_reply_to_status_id": "950922102336503808", + "created_at": "Wed Jan 10 02:54:54 +0000 2018", + "favorited": false, + "full_text": "I have stuffed the packaging of the new recycling bin into the twisted wreckage of the old recycling bin and thrown the whole bin away.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950922102336503808" + ], + "editableUntil": "2018-01-10T03:47:51.132Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "95" + ], + "favorite_count": "95", + "id_str": "950922102336503808", + "truncated": false, + "retweet_count": "13", + "id": "950922102336503808", + "created_at": "Wed Jan 10 02:47:51 +0000 2018", + "favorited": false, + "full_text": "I bought a new recycling bin but it isn't big enough to hold all the packaging that it came in.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950911152975826946" + ], + "editableUntil": "2018-01-10T03:04:20.601Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/EGd3bmaAwy", + "expanded_url": "https://twitter.com/hkanji/status/950906816854192128", + "display_url": "twitter.com/hkanji/status/…", + "indices": [ + "41", + "64" + ] + } + ] + }, + "display_text_range": [ + "0", + "64" + ], + "favorite_count": "29", + "id_str": "950911152975826946", + "truncated": false, + "retweet_count": "2", + "id": "950911152975826946", + "possibly_sensitive": false, + "created_at": "Wed Jan 10 02:04:20 +0000 2018", + "favorited": false, + "full_text": "I can't believe this is a real headline. https://t.co/EGd3bmaAwy", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950884944355602432" + ], + "editableUntil": "2018-01-10T01:20:11.979Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jason Miller 🦊⚛", + "screen_name": "_developit", + "indices": [ + "0", + "11" + ], + "id_str": "16495353", + "id": "16495353" + }, + { + "name": "Dominic Gannaway", + "screen_name": "trueadm", + "indices": [ + "12", + "20" + ], + "id_str": "39141147", + "id": "39141147" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "73" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950882205164883970", + "id_str": "950884944355602432", + "in_reply_to_user_id": "16495353", + "truncated": false, + "retweet_count": "0", + "id": "950884944355602432", + "in_reply_to_status_id": "950882205164883970", + "created_at": "Wed Jan 10 00:20:11 +0000 2018", + "favorited": false, + "full_text": "@_developit @trueadm 83,000 downloads on December 26th. How very strange!", + "lang": "en", + "in_reply_to_screen_name": "_developit", + "in_reply_to_user_id_str": "16495353" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950878943980150784" + ], + "editableUntil": "2018-01-10T00:56:21.378Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "32" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950877969240621056", + "id_str": "950878943980150784", + "in_reply_to_user_id": "154189594", + "truncated": false, + "retweet_count": "0", + "id": "950878943980150784", + "in_reply_to_status_id": "950877969240621056", + "created_at": "Tue Jan 09 23:56:21 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes Me all day every day", + "lang": "en", + "in_reply_to_screen_name": "tandemNuclei", + "in_reply_to_user_id_str": "154189594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950872903347724288" + ], + "editableUntil": "2018-01-10T00:32:21.179Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "live, laugh, @lawnsea@mastodon.social", + "screen_name": "lawnsea", + "indices": [ + "0", + "8" + ], + "id_str": "14132172", + "id": "14132172" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950872113988210688", + "id_str": "950872903347724288", + "in_reply_to_user_id": "14132172", + "truncated": false, + "retweet_count": "0", + "id": "950872903347724288", + "in_reply_to_status_id": "950872113988210688", + "created_at": "Tue Jan 09 23:32:21 +0000 2018", + "favorited": false, + "full_text": "@lawnsea Like this, only anonymous.", + "lang": "en", + "in_reply_to_screen_name": "lawnsea", + "in_reply_to_user_id_str": "14132172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950872396621164544" + ], + "editableUntil": "2018-01-10T00:30:20.366Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Chris Bannister - @devpanda@tech.lgbt", + "screen_name": "suddenmoves", + "indices": [ + "0", + "12" + ], + "id_str": "11791122", + "id": "11791122" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "78" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950872244313575432", + "id_str": "950872396621164544", + "in_reply_to_user_id": "11791122", + "truncated": false, + "retweet_count": "0", + "id": "950872396621164544", + "in_reply_to_status_id": "950872244313575432", + "created_at": "Tue Jan 09 23:30:20 +0000 2018", + "favorited": false, + "full_text": "@suddenmoves I dunno, it would be interesting to know how many people do that.", + "lang": "en", + "in_reply_to_screen_name": "suddenmoves", + "in_reply_to_user_id_str": "11791122" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950871244424933376" + ], + "editableUntil": "2018-01-10T00:25:45.661Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "104" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950871019849330689", + "id_str": "950871244424933376", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950871244424933376", + "in_reply_to_status_id": "950871019849330689", + "created_at": "Tue Jan 09 23:25:45 +0000 2018", + "favorited": false, + "full_text": "If I set up a Post Secret style anonymous place to describe your password system, would you participate?", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950871019849330689" + ], + "editableUntil": "2018-01-10T00:24:52.118Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "198" + ], + "favorite_count": "27", + "id_str": "950871019849330689", + "truncated": false, + "retweet_count": "1", + "id": "950871019849330689", + "created_at": "Tue Jan 09 23:24:52 +0000 2018", + "favorited": false, + "full_text": "I feel like everybody has a clever little system they use to generate new passwords, like \"I quote War and Peace and add the day\", but nobody can talk about them because that would make it insecure.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950868884961112064" + ], + "editableUntil": "2018-01-10T00:16:23.121Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nathan Fritz 🌯🤔", + "screen_name": "fritzy", + "indices": [ + "0", + "7" + ], + "id_str": "14498374", + "id": "14498374" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "16" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "950864883519700994", + "id_str": "950868884961112064", + "in_reply_to_user_id": "14498374", + "truncated": false, + "retweet_count": "0", + "id": "950868884961112064", + "in_reply_to_status_id": "950864883519700994", + "created_at": "Tue Jan 09 23:16:23 +0000 2018", + "favorited": false, + "full_text": "@fritzy Shhhhhhh", + "lang": "und", + "in_reply_to_screen_name": "fritzy", + "in_reply_to_user_id_str": "14498374" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950864486507806720" + ], + "editableUntil": "2018-01-09T23:58:54.448Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "122" + ], + "favorite_count": "64", + "id_str": "950864486507806720", + "truncated": false, + "retweet_count": "0", + "id": "950864486507806720", + "created_at": "Tue Jan 09 22:58:54 +0000 2018", + "favorited": false, + "full_text": "My master password for my password manager is an extremely long and profane sentence that I fuck up like 2 out of 3 times.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950841650313596928" + ], + "editableUntil": "2018-01-09T22:28:09.875Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nicolas", + "screen_name": "necolas", + "indices": [ + "0", + "8" + ], + "id_str": "24974216", + "id": "24974216" + }, + { + "name": "Peggy Rayzis", + "screen_name": "peggyrayzis", + "indices": [ + "9", + "21" + ], + "id_str": "711729626482081792", + "id": "711729626482081792" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "68" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950841515751784448", + "id_str": "950841650313596928", + "in_reply_to_user_id": "24974216", + "truncated": false, + "retweet_count": "0", + "id": "950841650313596928", + "in_reply_to_status_id": "950841515751784448", + "created_at": "Tue Jan 09 21:28:09 +0000 2018", + "favorited": false, + "full_text": "@necolas @peggyrayzis Yes, I shall think about how to talk about it.", + "lang": "en", + "in_reply_to_screen_name": "necolas", + "in_reply_to_user_id_str": "24974216" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950840504022859777" + ], + "editableUntil": "2018-01-09T22:23:36.578Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nicolas", + "screen_name": "necolas", + "indices": [ + "0", + "8" + ], + "id_str": "24974216", + "id": "24974216" + }, + { + "name": "Peggy Rayzis", + "screen_name": "peggyrayzis", + "indices": [ + "9", + "21" + ], + "id_str": "711729626482081792", + "id": "711729626482081792" + } + ], + "urls": [ + { + "url": "https://t.co/Lem9tNYT3I", + "expanded_url": "https://www.npmjs.com/package/react-native", + "display_url": "npmjs.com/package/react-…", + "indices": [ + "50", + "73" + ] + } + ] + }, + "display_text_range": [ + "0", + "131" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950823473072541696", + "id_str": "950840504022859777", + "in_reply_to_user_id": "24974216", + "truncated": false, + "retweet_count": "0", + "id": "950840504022859777", + "in_reply_to_status_id": "950823473072541696", + "possibly_sensitive": false, + "created_at": "Tue Jan 09 21:23:36 +0000 2018", + "favorited": false, + "full_text": "@necolas @peggyrayzis That's a fair criticism. Is https://t.co/Lem9tNYT3I the package I should be using as a proxy for RN activity?", + "lang": "en", + "in_reply_to_screen_name": "necolas", + "in_reply_to_user_id_str": "24974216" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950825609474670592" + ], + "editableUntil": "2018-01-09T21:24:25.441Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lin Clark", + "screen_name": "linclark", + "indices": [ + "0", + "9" + ], + "id_str": "21500149", + "id": "21500149" + }, + { + "name": "John C. Miller", + "screen_name": "melaniersumner", + "indices": [ + "10", + "25" + ], + "id_str": "1396895289470906368", + "id": "1396895289470906368" + }, + { + "name": "Kyle has moved to @kyleve@mastodon.online 🏳️🌈", + "screen_name": "kyleve", + "indices": [ + "26", + "33" + ], + "id_str": "14680556", + "id": "14680556" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "96" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950821494652850177", + "id_str": "950825609474670592", + "in_reply_to_user_id": "21500149", + "truncated": false, + "retweet_count": "0", + "id": "950825609474670592", + "in_reply_to_status_id": "950821494652850177", + "created_at": "Tue Jan 09 20:24:25 +0000 2018", + "favorited": false, + "full_text": "@linclark @melaniersumner @kyleve Omg I have a whole talk about that! That would be fun as hell.", + "lang": "en", + "in_reply_to_screen_name": "linclark", + "in_reply_to_user_id_str": "21500149" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950820326862045184" + ], + "editableUntil": "2018-01-09T21:03:25.968Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [ + { + "text": "hugops", + "indices": [ + "13", + "20" + ] + } + ], + "symbols": [], + "user_mentions": [ + { + "name": "ashley williams", + "screen_name": "ag_dubs", + "indices": [ + "3", + "11" + ], + "id_str": "304067888", + "id": "304067888" + }, + { + "name": "Slack", + "screen_name": "SlackHQ", + "indices": [ + "24", + "32" + ], + "id_str": "1305940272", + "id": "1305940272" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "103" + ], + "favorite_count": "0", + "id_str": "950820326862045184", + "truncated": false, + "retweet_count": "0", + "id": "950820326862045184", + "created_at": "Tue Jan 09 20:03:25 +0000 2018", + "favorited": false, + "full_text": "RT @ag_dubs: #hugops to @SlackHQ \n\ntrust me i know the feel, and it's not a great one. u got this tho 👊", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950820214832164866" + ], + "editableUntil": "2018-01-09T21:02:59.258Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nicolas", + "screen_name": "necolas", + "indices": [ + "0", + "8" + ], + "id_str": "24974216", + "id": "24974216" + }, + { + "name": "Peggy Rayzis", + "screen_name": "peggyrayzis", + "indices": [ + "9", + "21" + ], + "id_str": "711729626482081792", + "id": "711729626482081792" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "244" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950818816920989696", + "id_str": "950820214832164866", + "in_reply_to_user_id": "24974216", + "truncated": false, + "retweet_count": "0", + "id": "950820214832164866", + "in_reply_to_status_id": "950818816920989696", + "created_at": "Tue Jan 09 20:02:59 +0000 2018", + "favorited": false, + "full_text": "@necolas @peggyrayzis Oh for sure, react-native usage is definitely folded into the general usage. But native usage is only about 1-3% of React usage (by our best estimate) so it wasn't a big focus, though I personally think it's very exciting.", + "lang": "en", + "in_reply_to_screen_name": "necolas", + "in_reply_to_user_id_str": "24974216" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950817218811449344" + ], + "editableUntil": "2018-01-09T20:51:04.951Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "47" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950816177764249600", + "id_str": "950817218811449344", + "in_reply_to_user_id": "823484", + "truncated": false, + "retweet_count": "0", + "id": "950817218811449344", + "in_reply_to_status_id": "950816177764249600", + "created_at": "Tue Jan 09 19:51:04 +0000 2018", + "favorited": false, + "full_text": "@abritinthebay And yet here they are, doing it.", + "lang": "en", + "in_reply_to_screen_name": "GregWildSmith", + "in_reply_to_user_id_str": "823484" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950817092210606081" + ], + "editableUntil": "2018-01-09T20:50:34.767Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John C. Miller", + "screen_name": "melaniersumner", + "indices": [ + "0", + "15" + ], + "id_str": "1396895289470906368", + "id": "1396895289470906368" + }, + { + "name": "Kyle has moved to @kyleve@mastodon.online 🏳️🌈", + "screen_name": "kyleve", + "indices": [ + "16", + "23" + ], + "id_str": "14680556", + "id": "14680556" + }, + { + "name": "Lin Clark", + "screen_name": "linclark", + "indices": [ + "27", + "36" + ], + "id_str": "21500149", + "id": "21500149" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950816147527618560", + "id_str": "950817092210606081", + "in_reply_to_user_id": "177759800", + "truncated": false, + "retweet_count": "0", + "id": "950817092210606081", + "in_reply_to_status_id": "950816147527618560", + "created_at": "Tue Jan 09 19:50:34 +0000 2018", + "favorited": false, + "full_text": "@melaniersumner @kyleve CC @linclark", + "lang": "und", + "in_reply_to_screen_name": "a11yMel", + "in_reply_to_user_id_str": "177759800" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950817027119181824" + ], + "editableUntil": "2018-01-09T20:50:19.248Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nicolas", + "screen_name": "necolas", + "indices": [ + "0", + "8" + ], + "id_str": "24974216", + "id": "24974216" + }, + { + "name": "Peggy Rayzis", + "screen_name": "peggyrayzis", + "indices": [ + "9", + "21" + ], + "id_str": "711729626482081792", + "id": "711729626482081792" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "110" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950815952869797888", + "id_str": "950817027119181824", + "in_reply_to_user_id": "24974216", + "truncated": false, + "retweet_count": "0", + "id": "950817027119181824", + "in_reply_to_status_id": "950815952869797888", + "created_at": "Tue Jan 09 19:50:19 +0000 2018", + "favorited": false, + "full_text": "@necolas @peggyrayzis I didn't include a specific proxy for react native in this analysis, it was web focused.", + "lang": "en", + "in_reply_to_screen_name": "necolas", + "in_reply_to_user_id_str": "24974216" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950816715474198529" + ], + "editableUntil": "2018-01-09T20:49:04.946Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "test elsfa7", + "screen_name": "d3dvincent", + "indices": [ + "0", + "11" + ], + "id_str": "1559887182621458432", + "id": "1559887182621458432" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "141" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950813678118596608", + "id_str": "950816715474198529", + "in_reply_to_user_id": "388151045", + "truncated": false, + "retweet_count": "0", + "id": "950816715474198529", + "in_reply_to_status_id": "950813678118596608", + "created_at": "Tue Jan 09 19:49:04 +0000 2018", + "favorited": false, + "full_text": "@D3DVincent I really struggled to come up with a 2 or 3 word summary of what it does. If you've got a better suggestion I'll happily take it.", + "lang": "en", + "in_reply_to_user_id_str": "388151045" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950815584211513345" + ], + "editableUntil": "2018-01-09T20:44:35.232Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John C. Miller", + "screen_name": "melaniersumner", + "indices": [ + "0", + "15" + ], + "id_str": "1396895289470906368", + "id": "1396895289470906368" + }, + { + "name": "Kyle has moved to @kyleve@mastodon.online 🏳️🌈", + "screen_name": "kyleve", + "indices": [ + "16", + "23" + ], + "id_str": "14680556", + "id": "14680556" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "151" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "950815192681734146", + "id_str": "950815584211513345", + "in_reply_to_user_id": "177759800", + "truncated": false, + "retweet_count": "0", + "id": "950815584211513345", + "in_reply_to_status_id": "950815192681734146", + "created_at": "Tue Jan 09 19:44:35 +0000 2018", + "favorited": false, + "full_text": "@melaniersumner @kyleve People keep asking us to put npm on the blockchain and I patiently explain that that would make it worse in every possible way.", + "lang": "en", + "in_reply_to_screen_name": "a11yMel", + "in_reply_to_user_id_str": "177759800" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950815010804064256" + ], + "editableUntil": "2018-01-09T20:42:18.521Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kyle has moved to @kyleve@mastodon.online 🏳️🌈", + "screen_name": "kyleve", + "indices": [ + "3", + "10" + ], + "id_str": "14680556", + "id": "14680556" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "0", + "id_str": "950815010804064256", + "truncated": false, + "retweet_count": "0", + "id": "950815010804064256", + "created_at": "Tue Jan 09 19:42:18 +0000 2018", + "favorited": false, + "full_text": "RT @kyleve: What if we put Slack… On the blockchain", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950814873243467776" + ], + "editableUntil": "2018-01-09T20:41:45.724Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇧🇧🇹🇹🏳️🌈🌉 🚴🏿Ed says Yes on J, No on I", + "screen_name": "eparillon", + "indices": [ + "0", + "10" + ], + "id_str": "5818162", + "id": "5818162" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950814529876733952", + "id_str": "950814873243467776", + "in_reply_to_user_id": "5818162", + "truncated": false, + "retweet_count": "0", + "id": "950814873243467776", + "in_reply_to_status_id": "950814529876733952", + "created_at": "Tue Jan 09 19:41:45 +0000 2018", + "favorited": false, + "full_text": "@eparillon I did. It is still deeply horrifying.", + "lang": "en", + "in_reply_to_screen_name": "eparillon", + "in_reply_to_user_id_str": "5818162" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950814609346387973" + ], + "editableUntil": "2018-01-09T20:40:42.806Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dominic Gannaway", + "screen_name": "trueadm", + "indices": [ + "0", + "8" + ], + "id_str": "39141147", + "id": "39141147" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950814087038062592", + "id_str": "950814609346387973", + "in_reply_to_user_id": "39141147", + "truncated": false, + "retweet_count": "0", + "id": "950814609346387973", + "in_reply_to_status_id": "950814087038062592", + "created_at": "Tue Jan 09 19:40:42 +0000 2018", + "favorited": false, + "full_text": "@trueadm Good to know! I will definitely include it next time, especially if it's growing fast. Preact was an exception mostly because we use it ourselves.", + "lang": "en", + "in_reply_to_screen_name": "trueadm", + "in_reply_to_user_id_str": "39141147" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950814148660613120" + ], + "editableUntil": "2018-01-09T20:38:52.970Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/aAkKbOvWzu", + "expanded_url": "https://rewire.news/article/2018/01/09/justice-department-revokes-naturalized-citizenship-citing-fingerprint-issue/", + "display_url": "rewire.news/article/2018/0…", + "indices": [ + "112", + "135" + ] + } + ] + }, + "display_text_range": [ + "0", + "135" + ], + "favorite_count": "20", + "id_str": "950814148660613120", + "truncated": false, + "retweet_count": "35", + "id": "950814148660613120", + "possibly_sensitive": false, + "created_at": "Tue Jan 09 19:38:52 +0000 2018", + "favorited": false, + "full_text": "The USCIS has begun revoking the citizenship of thousands of people who naturalized to US citizens decades ago: https://t.co/aAkKbOvWzu", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950812801785724928" + ], + "editableUntil": "2018-01-09T20:33:31.850Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dominic Gannaway", + "screen_name": "trueadm", + "indices": [ + "0", + "8" + ], + "id_str": "39141147", + "id": "39141147" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "193" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950805226705047557", + "id_str": "950812801785724928", + "in_reply_to_user_id": "39141147", + "truncated": false, + "retweet_count": "0", + "id": "950812801785724928", + "in_reply_to_status_id": "950805226705047557", + "created_at": "Tue Jan 09 19:33:31 +0000 2018", + "favorited": false, + "full_text": "@trueadm I wasn't aware of it, but it's currently doing about 100k dls/month, which is below our threshold -- we weren't looking at anything that did less than half a million downloads a month.", + "lang": "en", + "in_reply_to_screen_name": "trueadm", + "in_reply_to_user_id_str": "39141147" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950794653908942849" + ], + "editableUntil": "2018-01-09T19:21:25.059Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tiago @trodrigues@icosahedron.website", + "screen_name": "trodrigues", + "indices": [ + "0", + "11" + ], + "id_str": "6477652", + "id": "6477652" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950794179420086273", + "id_str": "950794653908942849", + "in_reply_to_user_id": "6477652", + "truncated": false, + "retweet_count": "0", + "id": "950794653908942849", + "in_reply_to_status_id": "950794179420086273", + "created_at": "Tue Jan 09 18:21:25 +0000 2018", + "favorited": false, + "full_text": "@trodrigues My advice is \"live in fear\" right now. \"Replace your processor\" will be my advice the moment that becomes an option.", + "lang": "en", + "in_reply_to_screen_name": "trodrigues", + "in_reply_to_user_id_str": "6477652" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950794461235130368" + ], + "editableUntil": "2018-01-09T19:20:39.122Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950794461235130368/photo/1", + "indices": [ + "105", + "128" + ], + "url": "https://t.co/vn8mtzjHwP", + "media_url": "http://pbs.twimg.com/media/DTHmUCAU0AALfxQ.jpg", + "id_str": "950794228161892352", + "id": "950794228161892352", + "media_url_https": "https://pbs.twimg.com/media/DTHmUCAU0AALfxQ.jpg", + "sizes": { + "small": { + "w": "680", + "h": "545", + "resize": "fit" + }, + "large": { + "w": "768", + "h": "616", + "resize": "fit" + }, + "medium": { + "w": "768", + "h": "616", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/vn8mtzjHwP" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "140", + "in_reply_to_status_id_str": "950793406946590721", + "id_str": "950794461235130368", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "52", + "id": "950794461235130368", + "in_reply_to_status_id": "950793406946590721", + "possibly_sensitive": false, + "created_at": "Tue Jan 09 18:20:39 +0000 2018", + "favorited": false, + "full_text": "TLDR: React Router + Redux is the de facto standard, and 2018 is going to be a breakout year for Apollo. https://t.co/vn8mtzjHwP", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950794461235130368/photo/1", + "indices": [ + "105", + "128" + ], + "url": "https://t.co/vn8mtzjHwP", + "media_url": "http://pbs.twimg.com/media/DTHmUCAU0AALfxQ.jpg", + "id_str": "950794228161892352", + "id": "950794228161892352", + "media_url_https": "https://pbs.twimg.com/media/DTHmUCAU0AALfxQ.jpg", + "sizes": { + "small": { + "w": "680", + "h": "545", + "resize": "fit" + }, + "large": { + "w": "768", + "h": "616", + "resize": "fit" + }, + "medium": { + "w": "768", + "h": "616", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/vn8mtzjHwP" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950794026818576384" + ], + "editableUntil": "2018-01-09T19:18:55.549Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tiago @trodrigues@icosahedron.website", + "screen_name": "trodrigues", + "indices": [ + "0", + "11" + ], + "id_str": "6477652", + "id": "6477652" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "203" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950793796966592512", + "id_str": "950794026818576384", + "in_reply_to_user_id": "6477652", + "truncated": false, + "retweet_count": "0", + "id": "950794026818576384", + "in_reply_to_status_id": "950793796966592512", + "created_at": "Tue Jan 09 18:18:55 +0000 2018", + "favorited": false, + "full_text": "@trodrigues Not AFAIK. Presumably all the major vendors are hard at work trying to redesign their architectures, but it's a multi-year job as far as I can tell. We have to unwind 20 years of chip design.", + "lang": "en", + "in_reply_to_screen_name": "trodrigues", + "in_reply_to_user_id_str": "6477652" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950793836405534720" + ], + "editableUntil": "2018-01-09T19:18:10.151Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "KirinDave has left for elucidating@mastodon.social", + "screen_name": "KirinDave", + "indices": [ + "0", + "10" + ], + "id_str": "784519", + "id": "784519" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "176" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950792949687701504", + "id_str": "950793836405534720", + "in_reply_to_user_id": "784519", + "truncated": false, + "retweet_count": "0", + "id": "950793836405534720", + "in_reply_to_status_id": "950792949687701504", + "created_at": "Tue Jan 09 18:18:10 +0000 2018", + "favorited": false, + "full_text": "@KirinDave I have always been skeptical that type checking has significant security benefits over and above just having good tests. Type checking is just a kind of testing IMO.", + "lang": "en", + "in_reply_to_screen_name": "KirinDave", + "in_reply_to_user_id_str": "784519" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950793406946590721" + ], + "editableUntil": "2018-01-09T19:16:27.760Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/o49ZtOicZS", + "expanded_url": "https://www.npmjs.com/npm/the-state-of-javascript-frameworks-2017-part-2-the-react-ecosystem", + "display_url": "npmjs.com/npm/the-state-…", + "indices": [ + "115", + "138" + ] + } + ] + }, + "display_text_range": [ + "0", + "272" + ], + "favorite_count": "81", + "id_str": "950793406946590721", + "truncated": false, + "retweet_count": "32", + "id": "950793406946590721", + "possibly_sensitive": false, + "created_at": "Tue Jan 09 18:16:27 +0000 2018", + "favorited": false, + "full_text": "Part 2 of npm's analysis of the state of JavaScript frameworks is up. This time we zoom in on the React ecosystem: https://t.co/o49ZtOicZS\nAs before, if you think there are any errors or omissions in this analysis, please let me know! I spoke to as many people as I could.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950792460942311424" + ], + "editableUntil": "2018-01-09T19:12:42.215Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "KirinDave has left for elucidating@mastodon.social", + "screen_name": "KirinDave", + "indices": [ + "0", + "10" + ], + "id_str": "784519", + "id": "784519" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950791634211475456", + "id_str": "950792460942311424", + "in_reply_to_user_id": "784519", + "truncated": false, + "retweet_count": "0", + "id": "950792460942311424", + "in_reply_to_status_id": "950791634211475456", + "created_at": "Tue Jan 09 18:12:42 +0000 2018", + "favorited": false, + "full_text": "@KirinDave See, that was my working hypothesis. It's like a buffer overflow attack in that if you miss even one vulnerable spot, you lose the ball game.", + "lang": "en", + "in_reply_to_screen_name": "KirinDave", + "in_reply_to_user_id_str": "784519" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950791297475870721" + ], + "editableUntil": "2018-01-09T19:08:04.823Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "KirinDave has left for elucidating@mastodon.social", + "screen_name": "KirinDave", + "indices": [ + "0", + "10" + ], + "id_str": "784519", + "id": "784519" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950790758096887808", + "id_str": "950791297475870721", + "in_reply_to_user_id": "784519", + "truncated": false, + "retweet_count": "0", + "id": "950791297475870721", + "in_reply_to_status_id": "950790758096887808", + "created_at": "Tue Jan 09 18:08:04 +0000 2018", + "favorited": false, + "full_text": "@KirinDave Good to know! Got a link?", + "lang": "en", + "in_reply_to_screen_name": "KirinDave", + "in_reply_to_user_id_str": "784519" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950791190168838144" + ], + "editableUntil": "2018-01-09T19:07:39.239Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Drew Harry", + "screen_name": "drewwww", + "indices": [ + "0", + "8" + ], + "id_str": "15169938", + "id": "15169938" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "99" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "950790608104247296", + "id_str": "950791190168838144", + "in_reply_to_user_id": "15169938", + "truncated": false, + "retweet_count": "0", + "id": "950791190168838144", + "in_reply_to_status_id": "950790608104247296", + "created_at": "Tue Jan 09 18:07:39 +0000 2018", + "favorited": false, + "full_text": "@drewwww Jitter fuzzing can be defeated by statistical methods. It makes it slower, not impossible.", + "lang": "en", + "in_reply_to_screen_name": "drewwww", + "in_reply_to_user_id_str": "15169938" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950789489487527936" + ], + "editableUntil": "2018-01-09T19:00:53.765Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Evan Shortiss 🇮🇪 🇺🇸", + "screen_name": "evanshortiss", + "indices": [ + "0", + "13" + ], + "id_str": "15011401", + "id": "15011401" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "64" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "950789232183906307", + "id_str": "950789489487527936", + "in_reply_to_user_id": "15011401", + "truncated": false, + "retweet_count": "0", + "id": "950789489487527936", + "in_reply_to_status_id": "950789232183906307", + "created_at": "Tue Jan 09 18:00:53 +0000 2018", + "favorited": false, + "full_text": "@evanshortiss Sorry! We screwed the pooch. Computers are broken.", + "lang": "en", + "in_reply_to_screen_name": "evanshortiss", + "in_reply_to_user_id_str": "15011401" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950789408290230273" + ], + "editableUntil": "2018-01-09T19:00:34.406Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "184" + ], + "favorite_count": "17", + "in_reply_to_status_id_str": "950783578081697793", + "id_str": "950789408290230273", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "3", + "id": "950789408290230273", + "in_reply_to_status_id": "950783578081697793", + "created_at": "Tue Jan 09 18:00:34 +0000 2018", + "favorited": false, + "full_text": "Corollary: if a vendor tells me that their system is immune to Spectre and it doesn't rely on brand-new hardware I am going to assume they are lying until I see peer-reviewed research.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950784919940227072" + ], + "editableUntil": "2018-01-09T18:42:44.300Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🌻 Vortmax 🌻", + "screen_name": "Vortmax", + "indices": [ + "0", + "8" + ], + "id_str": "756196", + "id": "756196" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "161" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950784122254970887", + "id_str": "950784919940227072", + "in_reply_to_user_id": "756196", + "truncated": false, + "retweet_count": "0", + "id": "950784919940227072", + "in_reply_to_status_id": "950784122254970887", + "created_at": "Tue Jan 09 17:42:44 +0000 2018", + "favorited": false, + "full_text": "@Vortmax So far. I think it will be practical to escalate the read only exploit to arbitrary execution, I have seen plausible suggestions how to do this already.", + "lang": "en", + "in_reply_to_screen_name": "Vortmax", + "in_reply_to_user_id_str": "756196" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950784505433829376" + ], + "editableUntil": "2018-01-09T18:41:05.474Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Elijah Manor", + "screen_name": "elijahmanor", + "indices": [ + "0", + "12" + ], + "id_str": "9453872", + "id": "9453872" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "151" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950782859400359936", + "id_str": "950784505433829376", + "in_reply_to_user_id": "9453872", + "truncated": false, + "retweet_count": "0", + "id": "950784505433829376", + "in_reply_to_status_id": "950782859400359936", + "created_at": "Tue Jan 09 17:41:05 +0000 2018", + "favorited": false, + "full_text": "@elijahmanor What an interesting set of constraints. Have you looked at the Samsung a157? No contract, no camera (this is a good thing), feature phone.", + "lang": "en", + "in_reply_to_screen_name": "elijahmanor", + "in_reply_to_user_id_str": "9453872" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950783578081697793" + ], + "editableUntil": "2018-01-09T18:37:24.376Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "225" + ], + "favorite_count": "40", + "in_reply_to_status_id_str": "950782920448360448", + "id_str": "950783578081697793", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "20", + "id": "950783578081697793", + "in_reply_to_status_id": "950782920448360448", + "created_at": "Tue Jan 09 17:37:24 +0000 2018", + "favorited": false, + "full_text": "The next 12 months are going to see increasingly elaborate attacks based on Spectre that do increasingly large amounts of damage. The silence you hear right now is a frantic race to build exploits. It is going to be Very Bad.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950783153974624256" + ], + "editableUntil": "2018-01-09T18:35:43.261Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Beau Davenport", + "screen_name": "BeauLaBelle", + "indices": [ + "0", + "12" + ], + "id_str": "50584640", + "id": "50584640" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "65" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "950782906015694848", + "id_str": "950783153974624256", + "in_reply_to_user_id": "50584640", + "truncated": false, + "retweet_count": "0", + "id": "950783153974624256", + "in_reply_to_status_id": "950782906015694848", + "created_at": "Tue Jan 09 17:35:43 +0000 2018", + "favorited": false, + "full_text": "@BeauLaBelle I have Better on my phone and AdBlock on my desktop.", + "lang": "en", + "in_reply_to_screen_name": "BeauLaBelle", + "in_reply_to_user_id_str": "50584640" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950782920448360448" + ], + "editableUntil": "2018-01-09T18:34:47.584Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "172" + ], + "favorite_count": "27", + "in_reply_to_status_id_str": "950781363849801728", + "id_str": "950782920448360448", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "9", + "id": "950782920448360448", + "in_reply_to_status_id": "950781363849801728", + "created_at": "Tue Jan 09 17:34:47 +0000 2018", + "favorited": false, + "full_text": "Computers are all default unsafe right now. Your computer will not be safe until the chips are rearchitected and you buy a new computer and a new phone. It will take years.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950782442809434112" + ], + "editableUntil": "2018-01-09T18:32:53.706Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@aaronfriel@hachyderm.io", + "screen_name": "AaronFriel", + "indices": [ + "0", + "11" + ], + "id_str": "184674078", + "id": "184674078" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "97" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950781641198309378", + "id_str": "950782442809434112", + "in_reply_to_user_id": "184674078", + "truncated": false, + "retweet_count": "0", + "id": "950782442809434112", + "in_reply_to_status_id": "950781641198309378", + "created_at": "Tue Jan 09 17:32:53 +0000 2018", + "favorited": false, + "full_text": "@AaronFriel I'm not sure I ever believed that was true, but we sure moved the risk-reward needle.", + "lang": "en", + "in_reply_to_screen_name": "AaronFriel", + "in_reply_to_user_id_str": "184674078" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950781363849801728" + ], + "editableUntil": "2018-01-09T18:28:36.462Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "119", + "id_str": "950781363849801728", + "truncated": false, + "retweet_count": "23", + "id": "950781363849801728", + "created_at": "Tue Jan 09 17:28:36 +0000 2018", + "favorited": false, + "full_text": "Spectre and Meltdown have reversed my position on ad blockers. Block all the things.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950777661667778560" + ], + "editableUntil": "2018-01-09T18:13:53.793Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jasper 🌈", + "screen_name": "DaleJStephens", + "indices": [ + "0", + "14" + ], + "id_str": "84245958", + "id": "84245958" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "177" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950777368402042880", + "id_str": "950777661667778560", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950777661667778560", + "in_reply_to_status_id": "950777368402042880", + "created_at": "Tue Jan 09 17:13:53 +0000 2018", + "favorited": false, + "full_text": "@DaleJStephens Software that phones home is easy to spot because the tools web devs use to debug their own code would show up the malicious activity as part of normal debugging.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950777368402042880" + ], + "editableUntil": "2018-01-09T18:12:43.873Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jasper 🌈", + "screen_name": "DaleJStephens", + "indices": [ + "0", + "14" + ], + "id_str": "84245958", + "id": "84245958" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "205" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950776457499783168", + "id_str": "950777368402042880", + "in_reply_to_user_id": "84245958", + "truncated": false, + "retweet_count": "0", + "id": "950777368402042880", + "in_reply_to_status_id": "950776457499783168", + "created_at": "Tue Jan 09 17:12:43 +0000 2018", + "favorited": false, + "full_text": "@DaleJStephens It requires millions of people failing to notice something that is extremely easy to notice, for years, and also that the code never had any bugs from the start. It is extremely implausible.", + "lang": "en", + "in_reply_to_screen_name": "DaleJStephens", + "in_reply_to_user_id_str": "84245958" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950776136832712704" + ], + "editableUntil": "2018-01-09T18:07:50.244Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jasper 🌈", + "screen_name": "DaleJStephens", + "indices": [ + "0", + "14" + ], + "id_str": "84245958", + "id": "84245958" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "57" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950771542631186432", + "id_str": "950776136832712704", + "in_reply_to_user_id": "84245958", + "truncated": false, + "retweet_count": "0", + "id": "950776136832712704", + "in_reply_to_status_id": "950771542631186432", + "created_at": "Tue Jan 09 17:07:50 +0000 2018", + "favorited": false, + "full_text": "@DaleJStephens Yes. I do not agree with the threat model.", + "lang": "en", + "in_reply_to_screen_name": "DaleJStephens", + "in_reply_to_user_id_str": "84245958" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950775915700563968" + ], + "editableUntil": "2018-01-09T18:06:57.522Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Andreas Eldh", + "screen_name": "eldh", + "indices": [ + "12", + "17" + ], + "id_str": "15131982", + "id": "15131982" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "18", + "28" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "29", + "38" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "39", + "50" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "54" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950753094492504064", + "id_str": "950775915700563968", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "950775915700563968", + "in_reply_to_status_id": "950753094492504064", + "created_at": "Tue Jan 09 17:06:57 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @eldh @IgorMinar @ZChapple @robwormald TIL", + "lang": "und", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950742474254901248" + ], + "editableUntil": "2018-01-09T15:54:04.460Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Saeed, Or The Other One", + "screen_name": "theferocity", + "indices": [ + "0", + "12" + ], + "id_str": "15649438", + "id": "15649438" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "45" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950740403728379904", + "id_str": "950742474254901248", + "in_reply_to_user_id": "15649438", + "truncated": false, + "retweet_count": "0", + "id": "950742474254901248", + "in_reply_to_status_id": "950740403728379904", + "created_at": "Tue Jan 09 14:54:04 +0000 2018", + "favorited": false, + "full_text": "@theferocity Why do you hate democracy Saeed.", + "lang": "en", + "in_reply_to_screen_name": "theferocity", + "in_reply_to_user_id_str": "15649438" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950737290627657728" + ], + "editableUntil": "2018-01-09T15:33:28.587Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andreas Eldh", + "screen_name": "eldh", + "indices": [ + "0", + "5" + ], + "id_str": "15131982", + "id": "15131982" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "6", + "16" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "17", + "28" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "29", + "38" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "39", + "50" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "260" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950736152184737793", + "id_str": "950737290627657728", + "in_reply_to_user_id": "15131982", + "truncated": false, + "retweet_count": "0", + "id": "950737290627657728", + "in_reply_to_status_id": "950736152184737793", + "created_at": "Tue Jan 09 14:33:28 +0000 2018", + "favorited": false, + "full_text": "@eldh @IgorMinar @jeffbcross @ZChapple @robwormald Yes, so Angular 2 data starts in 2016 and Angular 1 data starts in 2015 because that is when they started using npm to distribute. So it's only really useful for trends since 2015, but that's 3 years of trend!", + "lang": "en", + "in_reply_to_screen_name": "eldh", + "in_reply_to_user_id_str": "15131982" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950735111527411712" + ], + "editableUntil": "2018-01-09T15:24:49.049Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andreas Eldh", + "screen_name": "eldh", + "indices": [ + "0", + "5" + ], + "id_str": "15131982", + "id": "15131982" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "6", + "16" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "17", + "28" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "29", + "38" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "39", + "50" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "210" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950734360432513024", + "id_str": "950735111527411712", + "in_reply_to_user_id": "15131982", + "truncated": false, + "retweet_count": "0", + "id": "950735111527411712", + "in_reply_to_status_id": "950734360432513024", + "created_at": "Tue Jan 09 14:24:49 +0000 2018", + "favorited": false, + "full_text": "@eldh @IgorMinar @jeffbcross @ZChapple @robwormald Oh! For Angular data is missing because it involves a scoped package and we only calculated stats for those back to October 2016. I explained this in the post.", + "lang": "en", + "in_reply_to_screen_name": "eldh", + "in_reply_to_user_id_str": "15131982" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950732104853176321" + ], + "editableUntil": "2018-01-09T15:12:52.202Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andreas Eldh", + "screen_name": "eldh", + "indices": [ + "0", + "5" + ], + "id_str": "15131982", + "id": "15131982" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "6", + "16" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "17", + "28" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "29", + "38" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "39", + "50" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "121" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950674967246655488", + "id_str": "950732104853176321", + "in_reply_to_user_id": "15131982", + "truncated": false, + "retweet_count": "0", + "id": "950732104853176321", + "in_reply_to_status_id": "950674967246655488", + "created_at": "Tue Jan 09 14:12:52 +0000 2018", + "favorited": false, + "full_text": "@eldh @IgorMinar @jeffbcross @ZChapple @robwormald They didn't always use npm as their primary distribution mechanism :-)", + "lang": "en", + "in_reply_to_screen_name": "eldh", + "in_reply_to_user_id_str": "15131982" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950594205012803585" + ], + "editableUntil": "2018-01-09T06:04:54.318Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "l a r s", + "screen_name": "larspeet", + "indices": [ + "0", + "9" + ], + "id_str": "174344258", + "id": "174344258" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "81" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950593544393125893", + "id_str": "950594205012803585", + "in_reply_to_user_id": "174344258", + "truncated": false, + "retweet_count": "0", + "id": "950594205012803585", + "in_reply_to_status_id": "950593544393125893", + "created_at": "Tue Jan 09 05:04:54 +0000 2018", + "favorited": false, + "full_text": "@larspeet It happens every year! It seems like this is a thing we could plan for.", + "lang": "en", + "in_reply_to_screen_name": "larspeet", + "in_reply_to_user_id_str": "174344258" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950594018622111746" + ], + "editableUntil": "2018-01-09T06:04:09.879Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "kenneth 🌞", + "screen_name": "kpk", + "indices": [ + "0", + "4" + ], + "id_str": "22915745", + "id": "22915745" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "31" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950593486968926209", + "id_str": "950594018622111746", + "in_reply_to_user_id": "22915745", + "truncated": false, + "retweet_count": "0", + "id": "950594018622111746", + "in_reply_to_status_id": "950593486968926209", + "created_at": "Tue Jan 09 05:04:09 +0000 2018", + "favorited": false, + "full_text": "@kpk It's called Airplane Mode.", + "lang": "en", + "in_reply_to_screen_name": "kpk", + "in_reply_to_user_id_str": "22915745" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950592438933991424" + ], + "editableUntil": "2018-01-09T05:57:53.252Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "14" + ], + "favorite_count": "2", + "id_str": "950592438933991424", + "truncated": false, + "retweet_count": "0", + "id": "950592438933991424", + "created_at": "Tue Jan 09 04:57:53 +0000 2018", + "favorited": false, + "full_text": "Star Trek: GOP", + "lang": "nl" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950591441197154304" + ], + "editableUntil": "2018-01-09T05:53:55.373Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tom Bielecki 𐃏", + "screen_name": "tombielecki", + "indices": [ + "0", + "12" + ], + "id_str": "13650782", + "id": "13650782" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "131" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "950590853025689601", + "id_str": "950591441197154304", + "in_reply_to_user_id": "13650782", + "truncated": false, + "retweet_count": "0", + "id": "950591441197154304", + "in_reply_to_status_id": "950590853025689601", + "created_at": "Tue Jan 09 04:53:55 +0000 2018", + "favorited": false, + "full_text": "@tombielecki One shouldn't need a goddamn code of conduct to know that having strippers at a professional event is a terrible idea.", + "lang": "en", + "in_reply_to_screen_name": "tombielecki", + "in_reply_to_user_id_str": "13650782" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950589245055410177" + ], + "editableUntil": "2018-01-09T05:45:11.772Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/mrvmCEpBH3", + "expanded_url": "https://twitter.com/taylorlorenz/status/950587082388406272", + "display_url": "twitter.com/taylorlorenz/s…", + "indices": [ + "25", + "48" + ] + } + ] + }, + "display_text_range": [ + "0", + "48" + ], + "favorite_count": "14", + "id_str": "950589245055410177", + "truncated": false, + "retweet_count": "1", + "id": "950589245055410177", + "possibly_sensitive": false, + "created_at": "Tue Jan 09 04:45:11 +0000 2018", + "favorited": false, + "full_text": "Why are people like this https://t.co/mrvmCEpBH3", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950587476548005888" + ], + "editableUntil": "2018-01-09T05:38:10.127Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/XHN7tX3k9G", + "expanded_url": "https://twitter.com/magsvisaggs/status/950429737813512192", + "display_url": "twitter.com/magsvisaggs/st…", + "indices": [ + "26", + "49" + ] + } + ] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "2", + "id_str": "950587476548005888", + "truncated": false, + "retweet_count": "0", + "id": "950587476548005888", + "possibly_sensitive": false, + "created_at": "Tue Jan 09 04:38:10 +0000 2018", + "favorited": false, + "full_text": "The Little Mermaid (1989) https://t.co/XHN7tX3k9G", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950579063285989376" + ], + "editableUntil": "2018-01-09T05:04:44.249Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Here Comes The Sun", + "screen_name": "SunOfSeldo", + "indices": [ + "3", + "14" + ], + "id_str": "456374925", + "id": "456374925" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "950579063285989376", + "truncated": false, + "retweet_count": "0", + "id": "950579063285989376", + "created_at": "Tue Jan 09 04:04:44 +0000 2018", + "favorited": false, + "full_text": "RT @SunOfSeldo: Today was one whole minute longer than yesterday! I know it’s still dark. I know it still sucks. But every day, a minute be…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950578992960061440" + ], + "editableUntil": "2018-01-09T05:04:27.482Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zach Cole", + "screen_name": "ZachACole", + "indices": [ + "0", + "10" + ], + "id_str": "17949007", + "id": "17949007" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "17" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950568753456070658", + "id_str": "950578992960061440", + "in_reply_to_user_id": "17949007", + "truncated": false, + "retweet_count": "0", + "id": "950578992960061440", + "in_reply_to_status_id": "950568753456070658", + "created_at": "Tue Jan 09 04:04:27 +0000 2018", + "favorited": false, + "full_text": "@ZachACole ☹️☹️☹️", + "lang": "qme", + "in_reply_to_screen_name": "ZachACole", + "in_reply_to_user_id_str": "17949007" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950576939302977536" + ], + "editableUntil": "2018-01-09T04:56:17.852Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nicholas Chappell", + "screen_name": "nickachappell", + "indices": [ + "0", + "14" + ], + "id_str": "2872411530", + "id": "2872411530" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "167" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "950576370253377536", + "id_str": "950576939302977536", + "in_reply_to_user_id": "2872411530", + "truncated": false, + "retweet_count": "0", + "id": "950576939302977536", + "in_reply_to_status_id": "950576370253377536", + "created_at": "Tue Jan 09 03:56:17 +0000 2018", + "favorited": false, + "full_text": "@nickachappell I'm told that's a contributing factor but also Californians just don't know how to drive in the rain. They go full speed and then smack into each other.", + "lang": "en", + "in_reply_to_screen_name": "nickachappell", + "in_reply_to_user_id_str": "2872411530" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950559781277716480" + ], + "editableUntil": "2018-01-09T03:48:07.060Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "92" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950559256314458112", + "id_str": "950559781277716480", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "950559781277716480", + "in_reply_to_status_id": "950559256314458112", + "created_at": "Tue Jan 09 02:48:07 +0000 2018", + "favorited": false, + "full_text": "@terronk I am reading this while getting dressed to go to the gym for the second time today.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950559493259067392" + ], + "editableUntil": "2018-01-09T03:46:58.391Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dvdgee", + "screen_name": "dvdgee", + "indices": [ + "0", + "7" + ], + "id_str": "1072782535225004032", + "id": "1072782535225004032" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "8", + "18" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Yarn", + "screen_name": "yarnpkg", + "indices": [ + "19", + "27" + ], + "id_str": "777232271484997632", + "id": "777232271484997632" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "28", + "34" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "203" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950558986520076288", + "id_str": "950559493259067392", + "in_reply_to_user_id": "562513", + "truncated": false, + "retweet_count": "0", + "id": "950559493259067392", + "in_reply_to_status_id": "950558986520076288", + "created_at": "Tue Jan 09 02:46:58 +0000 2018", + "favorited": false, + "full_text": "@dvdgee @IgorMinar @yarnpkg @npmjs I don't think including or excluding CI downloads would really change the picture as long as every framework has roughly the same amount of CI traffic, as seems likely.", + "lang": "en", + "in_reply_to_screen_name": "grumblestumble", + "in_reply_to_user_id_str": "562513" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950558934472904704" + ], + "editableUntil": "2018-01-09T03:44:45.166Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "54" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "950558524530028544", + "id_str": "950558934472904704", + "in_reply_to_user_id": "290549888", + "truncated": false, + "retweet_count": "0", + "id": "950558934472904704", + "in_reply_to_status_id": "950558524530028544", + "created_at": "Tue Jan 09 02:44:45 +0000 2018", + "favorited": false, + "full_text": "@sebmck They just have no idea, Seb. Shelter in place.", + "lang": "en", + "in_reply_to_screen_name": "sebmck", + "in_reply_to_user_id_str": "290549888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950556778789462016" + ], + "editableUntil": "2018-01-09T03:36:11.211Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mack, yes, That Mack", + "screen_name": "that_mc", + "indices": [ + "12", + "20" + ], + "id_str": "573162336", + "id": "573162336" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "950556640083718144", + "id_str": "950556778789462016", + "in_reply_to_user_id": "19753703", + "truncated": false, + "retweet_count": "0", + "id": "950556778789462016", + "in_reply_to_status_id": "950556640083718144", + "created_at": "Tue Jan 09 02:36:11 +0000 2018", + "favorited": false, + "full_text": "@back40feet @that_mc You've made good life choices.", + "lang": "en", + "in_reply_to_user_id_str": "19753703" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950556392800186368" + ], + "editableUntil": "2018-01-09T03:34:39.184Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Baptiste Laget", + "screen_name": "baptistelaget", + "indices": [ + "0", + "14" + ], + "id_str": "7284322", + "id": "7284322" + }, + { + "name": "Mack, yes, That Mack", + "screen_name": "that_mc", + "indices": [ + "15", + "23" + ], + "id_str": "573162336", + "id": "573162336" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "950556137270718465", + "id_str": "950556392800186368", + "in_reply_to_user_id": "7284322", + "truncated": false, + "retweet_count": "0", + "id": "950556392800186368", + "in_reply_to_status_id": "950556137270718465", + "created_at": "Tue Jan 09 02:34:39 +0000 2018", + "favorited": false, + "full_text": "@baptistelaget @that_mc I do not understand how Canada.", + "lang": "en", + "in_reply_to_screen_name": "baptistelaget", + "in_reply_to_user_id_str": "7284322" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950556293315534848" + ], + "editableUntil": "2018-01-09T03:34:15.465Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Yehuda Katz", + "screen_name": "wycats", + "indices": [ + "0", + "7" + ], + "id_str": "8526432", + "id": "8526432" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "153" + ], + "favorite_count": "18", + "in_reply_to_status_id_str": "950555634268647424", + "id_str": "950556293315534848", + "in_reply_to_user_id": "8526432", + "truncated": false, + "retweet_count": "0", + "id": "950556293315534848", + "in_reply_to_status_id": "950555634268647424", + "created_at": "Tue Jan 09 02:34:15 +0000 2018", + "favorited": false, + "full_text": "@wycats My mental model of Portland is that everyone is baked all the time so maybe it's just the percentage of people who drive stoned who get confused.", + "lang": "en", + "in_reply_to_screen_name": "wycats", + "in_reply_to_user_id_str": "8526432" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950555981385101312" + ], + "editableUntil": "2018-01-09T03:33:01.095Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "130" + ], + "favorite_count": "49", + "in_reply_to_status_id_str": "950554712205549568", + "id_str": "950555981385101312", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950555981385101312", + "in_reply_to_status_id": "950554712205549568", + "created_at": "Tue Jan 09 02:33:01 +0000 2018", + "favorited": false, + "full_text": "This tweet brought to you by the slip-n-slide conditions at the entrances to my house, my office, and both BART stations en route.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950555586764054528" + ], + "editableUntil": "2018-01-09T03:31:27.010Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mack, yes, That Mack", + "screen_name": "that_mc", + "indices": [ + "0", + "8" + ], + "id_str": "573162336", + "id": "573162336" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "109" + ], + "favorite_count": "12", + "in_reply_to_status_id_str": "950555254684176384", + "id_str": "950555586764054528", + "in_reply_to_user_id": "573162336", + "truncated": false, + "retweet_count": "0", + "id": "950555586764054528", + "in_reply_to_status_id": "950555254684176384", + "created_at": "Tue Jan 09 02:31:27 +0000 2018", + "favorited": false, + "full_text": "@that_mc I literally cannot imagine a snowstorm. I have only seen snow falling half a dozen times in my life.", + "lang": "en", + "in_reply_to_screen_name": "that_mc", + "in_reply_to_user_id_str": "573162336" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950554712205549568" + ], + "editableUntil": "2018-01-09T03:27:58.499Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "195" + ], + "favorite_count": "215", + "id_str": "950554712205549568", + "truncated": false, + "retweet_count": "20", + "id": "950554712205549568", + "created_at": "Tue Jan 09 02:27:58 +0000 2018", + "favorited": false, + "full_text": "It has been raining for 12 hours in San Francisco and the city is COMPLETELY UNPREPARED for this situation. Architecture in SF treats rain as an error condition and everything is a disaster area.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950552850093916160" + ], + "editableUntil": "2018-01-09T03:20:34.537Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashley", + "screen_name": "rabcyr", + "indices": [ + "0", + "7" + ], + "id_str": "26157562", + "id": "26157562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950168126708240384", + "id_str": "950552850093916160", + "in_reply_to_user_id": "26157562", + "truncated": false, + "retweet_count": "0", + "id": "950552850093916160", + "in_reply_to_status_id": "950168126708240384", + "created_at": "Tue Jan 09 02:20:34 +0000 2018", + "favorited": false, + "full_text": "@rabcyr Grace! Good Caribbean brand.", + "lang": "en", + "in_reply_to_screen_name": "rabcyr", + "in_reply_to_user_id_str": "26157562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950552081768722432" + ], + "editableUntil": "2018-01-09T03:17:31.354Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Yarn", + "screen_name": "yarnpkg", + "indices": [ + "11", + "19" + ], + "id_str": "777232271484997632", + "id": "777232271484997632" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "20", + "26" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "112" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "950551176310816768", + "id_str": "950552081768722432", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "950552081768722432", + "in_reply_to_status_id": "950551176310816768", + "created_at": "Tue Jan 09 02:17:31 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @yarnpkg @npmjs Yarn does not have its own registry. Downloads from yarn are included in these stats.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493985431527903234" + ], + "editableUntil": "2022-02-16T17:27:38.440Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Eleventy 🎈 v2.0.1", + "screen_name": "eleven_ty", + "indices": [ + "3", + "13" + ], + "id_str": "949639269433380864", + "id": "949639269433380864" + }, + { + "name": "Netlify", + "screen_name": "Netlify", + "indices": [ + "60", + "68" + ], + "id_str": "2571501973", + "id": "2571501973" + }, + { + "name": "Eleventy 🎈 v2.0.1", + "screen_name": "eleven_ty", + "indices": [ + "125", + "135" + ], + "id_str": "949639269433380864", + "id": "949639269433380864" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "0", + "id_str": "1493985431527903234", + "truncated": false, + "retweet_count": "0", + "id": "1493985431527903234", + "created_at": "Wed Feb 16 16:27:38 +0000 2022", + "favorited": false, + "full_text": "RT @eleven_ty: I won’t bury the lede, y’all—effective today @netlify is now sponsoring full time open source development for @eleven_ty! 🥳…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493981873126580228" + ], + "editableUntil": "2022-02-16T17:13:30.051Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jan Lehnardt is on Mastodon: @janl@narrativ.es", + "screen_name": "janl", + "indices": [ + "0", + "5" + ], + "id_str": "819606", + "id": "819606" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "79" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "1493966053063507971", + "id_str": "1493981873126580228", + "in_reply_to_user_id": "819606", + "truncated": false, + "retweet_count": "0", + "id": "1493981873126580228", + "in_reply_to_status_id": "1493966053063507971", + "created_at": "Wed Feb 16 16:13:30 +0000 2022", + "favorited": false, + "full_text": "@janl It's been a morning for things confusingly not related to me in the news.", + "lang": "en", + "in_reply_to_screen_name": "janl", + "in_reply_to_user_id_str": "819606" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493964684038316033" + ], + "editableUntil": "2022-02-16T16:05:11.853Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "46" + ], + "favorite_count": "53", + "in_reply_to_status_id_str": "1493964464747520001", + "id_str": "1493964684038316033", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1493964684038316033", + "in_reply_to_status_id": "1493964464747520001", + "created_at": "Wed Feb 16 15:05:11 +0000 2022", + "favorited": false, + "full_text": "IT'S NOT MY WATER I HAVE NOTHING TO DO WITH IT", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493964464747520001" + ], + "editableUntil": "2022-02-16T16:04:19.570Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493964464747520001/photo/1", + "indices": [ + "6", + "29" + ], + "url": "https://t.co/RmvVnTDLdd", + "media_url": "http://pbs.twimg.com/media/FLugtyMVcAEIbPB.png", + "id_str": "1493964409831518209", + "id": "1493964409831518209", + "media_url_https": "https://pbs.twimg.com/media/FLugtyMVcAEIbPB.png", + "sizes": { + "medium": { + "w": "342", + "h": "154", + "resize": "fit" + }, + "small": { + "w": "342", + "h": "154", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "342", + "h": "154", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/RmvVnTDLdd" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "90", + "id_str": "1493964464747520001", + "truncated": false, + "retweet_count": "0", + "id": "1493964464747520001", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 15:04:19 +0000 2022", + "favorited": false, + "full_text": "Oh no https://t.co/RmvVnTDLdd", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493964464747520001/photo/1", + "indices": [ + "6", + "29" + ], + "url": "https://t.co/RmvVnTDLdd", + "media_url": "http://pbs.twimg.com/media/FLugtyMVcAEIbPB.png", + "id_str": "1493964409831518209", + "id": "1493964409831518209", + "media_url_https": "https://pbs.twimg.com/media/FLugtyMVcAEIbPB.png", + "sizes": { + "medium": { + "w": "342", + "h": "154", + "resize": "fit" + }, + "small": { + "w": "342", + "h": "154", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "342", + "h": "154", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/RmvVnTDLdd" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493959364222152705" + ], + "editableUntil": "2022-02-16T15:44:03.510Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/XJUZqKkk6c", + "expanded_url": "https://spectrum.ieee.org/bionic-eye-obsolete", + "display_url": "spectrum.ieee.org/bionic-eye-obs…", + "indices": [ + "192", + "215" + ] + } + ] + }, + "display_text_range": [ + "0", + "215" + ], + "favorite_count": "130", + "id_str": "1493959364222152705", + "truncated": false, + "retweet_count": "47", + "id": "1493959364222152705", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 14:44:03 +0000 2022", + "favorited": false, + "full_text": "Imagine getting hardware implanted in your eyes but then the company goes bankrupt and shuts down so you literally go blind. Not a Black Mirror episode, a current reality for over 300 people. https://t.co/XJUZqKkk6c", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493954293090512899" + ], + "editableUntil": "2022-02-16T15:23:54.458Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "1493878911054147586", + "id_str": "1493954293090512899", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "1493954293090512899", + "in_reply_to_status_id": "1493878911054147586", + "created_at": "Wed Feb 16 14:23:54 +0000 2022", + "favorited": false, + "full_text": "@terronk That person is mentally ill.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493810865463726083" + ], + "editableUntil": "2022-02-16T05:53:58.647Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Josh Susser", + "screen_name": "joshsusser", + "indices": [ + "0", + "11" + ], + "id_str": "35954885", + "id": "35954885" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "20" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1493810583010828290", + "id_str": "1493810865463726083", + "in_reply_to_user_id": "35954885", + "truncated": false, + "retweet_count": "0", + "id": "1493810865463726083", + "in_reply_to_status_id": "1493810583010828290", + "created_at": "Wed Feb 16 04:53:58 +0000 2022", + "favorited": false, + "full_text": "@joshsusser In hell?", + "lang": "en", + "in_reply_to_screen_name": "joshsusser", + "in_reply_to_user_id_str": "35954885" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493808473376636931" + ], + "editableUntil": "2022-02-16T05:44:28.329Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "80", + "in_reply_to_status_id_str": "1493806423028813825", + "id_str": "1493808473376636931", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "11", + "id": "1493808473376636931", + "in_reply_to_status_id": "1493806423028813825", + "created_at": "Wed Feb 16 04:44:28 +0000 2022", + "favorited": false, + "full_text": "If a corporation asks you to sacrifice your interests for its interests, quit your job.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493808238810185729" + ], + "editableUntil": "2022-02-16T05:43:32.404Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Craig (find me at dice.camp/@foxxtrot)", + "screen_name": "foxxtrot", + "indices": [ + "0", + "9" + ], + "id_str": "14482107", + "id": "14482107" + }, + { + "name": "@anderson_jon@hachyderm.io", + "screen_name": "anderson_jon", + "indices": [ + "10", + "23" + ], + "id_str": "307676586", + "id": "307676586" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "102" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "1493808014310133766", + "id_str": "1493808238810185729", + "in_reply_to_user_id": "14482107", + "truncated": false, + "retweet_count": "0", + "id": "1493808238810185729", + "in_reply_to_status_id": "1493808014310133766", + "created_at": "Wed Feb 16 04:43:32 +0000 2022", + "favorited": false, + "full_text": "@foxxtrot @anderson_jon It's fucking grim in a military context too, but the military is fucking grim.", + "lang": "en", + "in_reply_to_screen_name": "foxxtrot", + "in_reply_to_user_id_str": "14482107" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493806423028813825" + ], + "editableUntil": "2022-02-16T05:36:19.488Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "246" + ], + "favorite_count": "87", + "in_reply_to_status_id_str": "1493805929791246337", + "id_str": "1493806423028813825", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "7", + "id": "1493806423028813825", + "in_reply_to_status_id": "1493805929791246337", + "created_at": "Wed Feb 16 04:36:19 +0000 2022", + "favorited": false, + "full_text": "\"I will put the interests of the corporation before my team, and those of my team before myself\" is believably a thing a CEO would want and would produce the kind of nightmarish outcomes Facebook has in fact created. It's honest, horribly honest.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493805929791246337" + ], + "editableUntil": "2022-02-16T05:34:21.891Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "198" + ], + "favorite_count": "199", + "id_str": "1493805929791246337", + "truncated": false, + "retweet_count": "10", + "id": "1493805929791246337", + "created_at": "Wed Feb 16 04:34:21 +0000 2022", + "favorited": false, + "full_text": "I only realized late in the day that \"Meta, Metamates, Me\" is an actual slogan from Facebook and not a joke. 1. How cringe but also 2. What a sinister, capitalist fever dream that phrase represents.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493805432871145473" + ], + "editableUntil": "2022-02-16T05:32:23.416Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "1493805229715832836", + "id_str": "1493805432871145473", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1493805432871145473", + "in_reply_to_status_id": "1493805229715832836", + "created_at": "Wed Feb 16 04:32:23 +0000 2022", + "favorited": false, + "full_text": "(The one with his ass to the camera is Ringo obv)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493805229715832836" + ], + "editableUntil": "2022-02-16T05:31:34.980Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493805229715832836/photo/1", + "indices": [ + "21", + "44" + ], + "url": "https://t.co/rAvZ76dRqU", + "media_url": "http://pbs.twimg.com/media/FLsP8CgVcAcBdOd.jpg", + "id_str": "1493805225542512647", + "id": "1493805225542512647", + "media_url_https": "https://pbs.twimg.com/media/FLsP8CgVcAcBdOd.jpg", + "sizes": { + "large": { + "w": "2048", + "h": "1536", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "900", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "510", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/rAvZ76dRqU" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "44" + ], + "favorite_count": "23", + "id_str": "1493805229715832836", + "truncated": false, + "retweet_count": "0", + "id": "1493805229715832836", + "possibly_sensitive": false, + "created_at": "Wed Feb 16 04:31:34 +0000 2022", + "favorited": false, + "full_text": "Arboreal Abbey Road. https://t.co/rAvZ76dRqU", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493805229715832836/photo/1", + "indices": [ + "21", + "44" + ], + "url": "https://t.co/rAvZ76dRqU", + "media_url": "http://pbs.twimg.com/media/FLsP8CgVcAcBdOd.jpg", + "id_str": "1493805225542512647", + "id": "1493805225542512647", + "media_url_https": "https://pbs.twimg.com/media/FLsP8CgVcAcBdOd.jpg", + "sizes": { + "large": { + "w": "2048", + "h": "1536", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "900", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "510", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/rAvZ76dRqU" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493777708509057027" + ], + "editableUntil": "2022-02-16T03:42:13.413Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ChrisArchitect", + "screen_name": "chrisarchitect", + "indices": [ + "0", + "15" + ], + "id_str": "121542889", + "id": "121542889" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "53" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1493764280646193174", + "id_str": "1493777708509057027", + "in_reply_to_user_id": "121542889", + "truncated": false, + "retweet_count": "0", + "id": "1493777708509057027", + "in_reply_to_status_id": "1493764280646193174", + "created_at": "Wed Feb 16 02:42:13 +0000 2022", + "favorited": false, + "full_text": "@chrisarchitect My browser had it cached, apparently.", + "lang": "en", + "in_reply_to_screen_name": "chrisarchitect", + "in_reply_to_user_id_str": "121542889" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493738653763334148" + ], + "editableUntil": "2022-02-16T01:07:02.036Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Josh Fruhlinger", + "screen_name": "jfruh", + "indices": [ + "3", + "9" + ], + "id_str": "39813162", + "id": "39813162" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "1493738653763334148", + "truncated": false, + "retweet_count": "0", + "id": "1493738653763334148", + "created_at": "Wed Feb 16 00:07:02 +0000 2022", + "favorited": false, + "full_text": "RT @jfruh: heather, your lawyers are going to tell you that you shouldn't do a rap about this. but it's very important that you ignore them…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493713206979686401" + ], + "editableUntil": "2022-02-15T23:25:55.050Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Will Wilkinson", + "screen_name": "willwilkinson", + "indices": [ + "0", + "14" + ], + "id_str": "2568461", + "id": "2568461" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "189" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "1493712116905242625", + "id_str": "1493713206979686401", + "in_reply_to_user_id": "2568461", + "truncated": false, + "retweet_count": "0", + "id": "1493713206979686401", + "in_reply_to_status_id": "1493712116905242625", + "created_at": "Tue Feb 15 22:25:55 +0000 2022", + "favorited": false, + "full_text": "@willwilkinson I believe her point is that the corporations don't have to make *bigger* profits during inflation; they could raise prices by less and make exactly the same profit as before.", + "lang": "en", + "in_reply_to_screen_name": "willwilkinson", + "in_reply_to_user_id_str": "2568461" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493693281003196418" + ], + "editableUntil": "2022-02-15T22:06:44.327Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "29", + "in_reply_to_status_id_str": "1493686091034943488", + "id_str": "1493693281003196418", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1493693281003196418", + "in_reply_to_status_id": "1493686091034943488", + "created_at": "Tue Feb 15 21:06:44 +0000 2022", + "favorited": false, + "full_text": "\"Introducing... the Marvellous Mister Metamates!\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493687804630495232" + ], + "editableUntil": "2022-02-15T21:44:58.658Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "215" + ], + "favorite_count": "43", + "id_str": "1493687804630495232", + "truncated": false, + "retweet_count": "1", + "id": "1493687804630495232", + "created_at": "Tue Feb 15 20:44:58 +0000 2022", + "favorited": false, + "full_text": "At some point Wordle started redirecting from the old PowerLanguage domain to the NYTimes site and the words on those site for today are *not the same word*, resulting in much consternation in the family group chat.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493686091034943488" + ], + "editableUntil": "2022-02-15T21:38:10.105Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Sy1dsgNMCH", + "expanded_url": "https://twitter.com/thedailybeast/status/1493676520270962694", + "display_url": "twitter.com/thedailybeast/…", + "indices": [ + "51", + "74" + ] + } + ] + }, + "display_text_range": [ + "0", + "74" + ], + "favorite_count": "260", + "id_str": "1493686091034943488", + "truncated": false, + "retweet_count": "15", + "id": "1493686091034943488", + "possibly_sensitive": false, + "created_at": "Tue Feb 15 20:38:10 +0000 2022", + "favorited": false, + "full_text": "I will be pronouncing \"metamates\" like \"Socrates\". https://t.co/Sy1dsgNMCH", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493682249698398208" + ], + "editableUntil": "2022-02-15T21:22:54.259Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "90" + ], + "favorite_count": "15", + "in_reply_to_status_id_str": "1493681871171256320", + "id_str": "1493682249698398208", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1493682249698398208", + "in_reply_to_status_id": "1493681871171256320", + "created_at": "Tue Feb 15 20:22:54 +0000 2022", + "favorited": false, + "full_text": "Related: I bet a lot of people owe me money but I would have absolutely no way to be sure.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950544312856584192" + ], + "editableUntil": "2018-01-09T02:46:39.101Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Becca Lee", + "screen_name": "the_becca_lee", + "indices": [ + "0", + "14" + ], + "id_str": "885211554647392256", + "id": "885211554647392256" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "20" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950543621471666176", + "id_str": "950544312856584192", + "in_reply_to_user_id": "885211554647392256", + "truncated": false, + "retweet_count": "0", + "id": "950544312856584192", + "in_reply_to_status_id": "950543621471666176", + "created_at": "Tue Jan 09 01:46:39 +0000 2018", + "favorited": false, + "full_text": "@the_becca_lee Same.", + "lang": "en", + "in_reply_to_screen_name": "the_becca_lee", + "in_reply_to_user_id_str": "885211554647392256" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950541091140354048" + ], + "editableUntil": "2018-01-09T02:33:50.984Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Chris Thielen", + "screen_name": "ChrisThielen", + "indices": [ + "0", + "13" + ], + "id_str": "107591013", + "id": "107591013" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950540819693383680", + "id_str": "950541091140354048", + "in_reply_to_user_id": "107591013", + "truncated": false, + "retweet_count": "0", + "id": "950541091140354048", + "in_reply_to_status_id": "950540819693383680", + "created_at": "Tue Jan 09 01:33:50 +0000 2018", + "favorited": false, + "full_text": "@ChrisThielen What will you use the extra data for?", + "lang": "en", + "in_reply_to_screen_name": "ChrisThielen", + "in_reply_to_user_id_str": "107591013" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950537060695252992" + ], + "editableUntil": "2018-01-09T02:17:50.051Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "0", + "11" + ], + "id_str": "14103865", + "id": "14103865" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "12", + "22" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "23", + "34" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "35", + "44" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "950536910761443330", + "id_str": "950537060695252992", + "in_reply_to_user_id": "14103865", + "truncated": false, + "retweet_count": "0", + "id": "950537060695252992", + "in_reply_to_status_id": "950536910761443330", + "created_at": "Tue Jan 09 01:17:50 +0000 2018", + "favorited": false, + "full_text": "@robwormald @IgorMinar @jeffbcross @ZChapple And there are twice as many of them as I thought!", + "lang": "en", + "in_reply_to_screen_name": "robwormald", + "in_reply_to_user_id_str": "14103865" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950536930025922560" + ], + "editableUntil": "2018-01-09T02:17:18.897Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "11", + "21" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "22", + "33" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "34", + "43" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "44", + "55" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "184" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950536638765191168", + "id_str": "950536930025922560", + "in_reply_to_user_id": "403075198", + "truncated": false, + "retweet_count": "0", + "id": "950536930025922560", + "in_reply_to_status_id": "950536638765191168", + "created_at": "Tue Jan 09 01:17:18 +0000 2018", + "favorited": false, + "full_text": "@mjforclaz @IgorMinar @jeffbcross @ZChapple @robwormald I agree, but jQuery folks, on the other hand, were upset it didn't get a full write-up in the blog post. Can't please everybody!", + "lang": "en", + "in_reply_to_user_id_str": "403075198" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950534699197202432" + ], + "editableUntil": "2018-01-09T02:08:27.026Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matt Stancliff", + "screen_name": "mattsta", + "indices": [ + "0", + "8" + ], + "id_str": "14825696", + "id": "14825696" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "950534302957166593", + "id_str": "950534699197202432", + "in_reply_to_user_id": "14825696", + "truncated": false, + "retweet_count": "0", + "id": "950534699197202432", + "in_reply_to_status_id": "950534302957166593", + "created_at": "Tue Jan 09 01:08:27 +0000 2018", + "favorited": false, + "full_text": "@mattsta I'm consistent, at least.", + "lang": "en", + "in_reply_to_screen_name": "mattsta", + "in_reply_to_user_id_str": "14825696" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950534595128078336" + ], + "editableUntil": "2018-01-09T02:08:02.214Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "11", + "22" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "23", + "32" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "33", + "44" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "176" + ], + "favorite_count": "24", + "in_reply_to_status_id_str": "950533961490489344", + "id_str": "950534595128078336", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950534595128078336", + "in_reply_to_status_id": "950533961490489344", + "created_at": "Tue Jan 09 01:08:02 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @jeffbcross @ZChapple @robwormald Many thanks to the polite but persistent folks in the Angular community who pointed out my oversight and helped me get it right :-)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950533961490489344" + ], + "editableUntil": "2018-01-09T02:05:31.143Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "158", + "168" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "169", + "180" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "181", + "190" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "191", + "202" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [ + { + "url": "https://t.co/rwIpUdB3a3", + "expanded_url": "https://www.npmjs.com/npm/state-of-javascript-frameworks-2017-part-1", + "display_url": "npmjs.com/npm/state-of-j…", + "indices": [ + "91", + "114" + ] + } + ], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950533961490489344/photo/1", + "indices": [ + "203", + "226" + ], + "url": "https://t.co/9G2U53dgOB", + "media_url": "http://pbs.twimg.com/media/DTD5Xh0VwAAKfZf.jpg", + "id_str": "950533703985381376", + "id": "950533703985381376", + "media_url_https": "https://pbs.twimg.com/media/DTD5Xh0VwAAKfZf.jpg", + "sizes": { + "large": { + "w": "751", + "h": "694", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "628", + "resize": "fit" + }, + "medium": { + "w": "751", + "h": "694", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/9G2U53dgOB" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "226" + ], + "favorite_count": "84", + "id_str": "950533961490489344", + "truncated": false, + "retweet_count": "46", + "id": "950533961490489344", + "possibly_sensitive": false, + "created_at": "Tue Jan 09 01:05:31 +0000 2018", + "favorited": false, + "full_text": "The State of JavaScript front-end Frameworks, 2017, has been updated to include Angular 2: https://t.co/rwIpUdB3a3 Angular 1+2 together are very popular! /cc @IgorMinar @jeffbcross @ZChapple @robwormald https://t.co/9G2U53dgOB", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950533961490489344/photo/1", + "indices": [ + "203", + "226" + ], + "url": "https://t.co/9G2U53dgOB", + "media_url": "http://pbs.twimg.com/media/DTD5Xh0VwAAKfZf.jpg", + "id_str": "950533703985381376", + "id": "950533703985381376", + "media_url_https": "https://pbs.twimg.com/media/DTD5Xh0VwAAKfZf.jpg", + "sizes": { + "large": { + "w": "751", + "h": "694", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "628", + "resize": "fit" + }, + "medium": { + "w": "751", + "h": "694", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/9G2U53dgOB" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950530938793897984" + ], + "editableUntil": "2018-01-09T01:53:30.476Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "12", + "22" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "23", + "32" + ], + "id_str": "17198118", + "id": "17198118" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950529576924454912", + "id_str": "950530938793897984", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "950530938793897984", + "in_reply_to_status_id": "950529576924454912", + "created_at": "Tue Jan 09 00:53:30 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @IgorMinar @samccone Yes.", + "lang": "und", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950525799416832001" + ], + "editableUntil": "2018-01-09T01:33:05.153Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "12", + "22" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "23", + "32" + ], + "id_str": "17198118", + "id": "17198118" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "950511527739637760", + "id_str": "950525799416832001", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "950525799416832001", + "in_reply_to_status_id": "950511527739637760", + "created_at": "Tue Jan 09 00:33:05 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @IgorMinar @samccone No, it's @angular/core", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950525398902759425" + ], + "editableUntil": "2018-01-09T01:31:29.663Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashusta", + "screen_name": "ashusta", + "indices": [ + "0", + "8" + ], + "id_str": "17636082", + "id": "17636082" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "44" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950524487836954624", + "id_str": "950525398902759425", + "in_reply_to_user_id": "17636082", + "truncated": false, + "retweet_count": "0", + "id": "950525398902759425", + "in_reply_to_status_id": "950524487836954624", + "created_at": "Tue Jan 09 00:31:29 +0000 2018", + "favorited": false, + "full_text": "@ashusta Pleased to have the mystery solved!", + "lang": "en", + "in_reply_to_screen_name": "ashusta", + "in_reply_to_user_id_str": "17636082" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950511271933198336" + ], + "editableUntil": "2018-01-09T00:35:21.531Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "262" + ], + "favorite_count": "21", + "id_str": "950511271933198336", + "truncated": false, + "retweet_count": "0", + "id": "950511271933198336", + "created_at": "Mon Jan 08 23:35:21 +0000 2018", + "favorited": false, + "full_text": "npm downloads stats fans: if for some reason you were sad that scoped packages didn't have download stats prior to March 2017, those stats now go back an additional 6 months, to October 2016. It's unlikely this will be helpful to anyone but me, but there you go!", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950510461450989569" + ], + "editableUntil": "2018-01-09T00:32:08.297Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "11", + "22" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "23", + "32" + ], + "id_str": "17198118", + "id": "17198118" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950510461450989569/photo/1", + "indices": [ + "109", + "132" + ], + "url": "https://t.co/FfqpY4gco0", + "media_url": "http://pbs.twimg.com/media/DTDkFFlVQAE1EMC.jpg", + "id_str": "950510297424412673", + "id": "950510297424412673", + "media_url_https": "https://pbs.twimg.com/media/DTDkFFlVQAE1EMC.jpg", + "sizes": { + "large": { + "w": "745", + "h": "668", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "745", + "h": "668", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "610", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/FfqpY4gco0" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "132" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950461344335126528", + "id_str": "950510461450989569", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950510461450989569", + "in_reply_to_status_id": "950461344335126528", + "possibly_sensitive": false, + "created_at": "Mon Jan 08 23:32:08 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @jeffbcross @samccone Graphs updated! I'm back in meetings but will update wordpress later today. https://t.co/FfqpY4gco0", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/950510461450989569/photo/1", + "indices": [ + "109", + "132" + ], + "url": "https://t.co/FfqpY4gco0", + "media_url": "http://pbs.twimg.com/media/DTDkFFlVQAE1EMC.jpg", + "id_str": "950510297424412673", + "id": "950510297424412673", + "media_url_https": "https://pbs.twimg.com/media/DTDkFFlVQAE1EMC.jpg", + "sizes": { + "large": { + "w": "745", + "h": "668", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "745", + "h": "668", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "610", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/FfqpY4gco0" + }, + { + "expanded_url": "https://twitter.com/seldo/status/950510461450989569/photo/1", + "indices": [ + "109", + "132" + ], + "url": "https://t.co/FfqpY4gco0", + "media_url": "http://pbs.twimg.com/media/DTDkIRvV4AAL7oT.jpg", + "id_str": "950510352227229696", + "id": "950510352227229696", + "media_url_https": "https://pbs.twimg.com/media/DTDkIRvV4AAL7oT.jpg", + "sizes": { + "large": { + "w": "751", + "h": "694", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "628", + "resize": "fit" + }, + "medium": { + "w": "751", + "h": "694", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/FfqpY4gco0" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950502615355334657" + ], + "editableUntil": "2018-01-09T00:00:57.642Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Luca Soldaini 🎀", + "screen_name": "soldni", + "indices": [ + "0", + "7" + ], + "id_str": "1865461842", + "id": "1865461842" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950501877959020544", + "id_str": "950502615355334657", + "in_reply_to_user_id": "1865461842", + "truncated": false, + "retweet_count": "0", + "id": "950502615355334657", + "in_reply_to_status_id": "950501877959020544", + "created_at": "Mon Jan 08 23:00:57 +0000 2018", + "favorited": false, + "full_text": "@soldni J'ACCUSE, MON PETIT FROMAGE", + "lang": "fr", + "in_reply_to_screen_name": "soldni", + "in_reply_to_user_id_str": "1865461842" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950502395523383296" + ], + "editableUntil": "2018-01-09T00:00:05.230Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JBaruch 🎩", + "screen_name": "jbaruch", + "indices": [ + "0", + "8" + ], + "id_str": "16887172", + "id": "16887172" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "9", + "20" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "21", + "30" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "31", + "40" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "41", + "48" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "49", + "62" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "63", + "69" + ], + "id_str": "38003146", + "id": "38003146" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "70", + "81" + ], + "id_str": "14103865", + "id": "14103865" + }, + { + "name": "Stephen Fluin", + "screen_name": "stephenfluin", + "indices": [ + "82", + "95" + ], + "id_str": "15313446", + "id": "15313446" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "333" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950471700600139777", + "id_str": "950502395523383296", + "in_reply_to_user_id": "16887172", + "truncated": false, + "retweet_count": "0", + "id": "950502395523383296", + "in_reply_to_status_id": "950471700600139777", + "created_at": "Mon Jan 08 23:00:05 +0000 2018", + "favorited": false, + "full_text": "@jbaruch @jeffbcross @ZChapple @samccone @sebmck @thejameskyle @jfrog @robwormald @stephenfluin No, but Angular, Ember and React are all large and well established frameworks with major corporate users. There's no reason to believe Angular has an edge over them in the enterprise that I can think of, but I'm willing to be persuaded.", + "lang": "en", + "in_reply_to_screen_name": "jbaruch", + "in_reply_to_user_id_str": "16887172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950501455491866624" + ], + "editableUntil": "2018-01-08T23:56:21.109Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "58" + ], + "favorite_count": "69", + "id_str": "950501455491866624", + "truncated": false, + "retweet_count": "4", + "id": "950501455491866624", + "created_at": "Mon Jan 08 22:56:21 +0000 2018", + "favorited": false, + "full_text": "Umbrellas are a plot by short people to blind tall people.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950483880854695936" + ], + "editableUntil": "2018-01-08T22:46:30.989Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "cara esten", + "screen_name": "esten", + "indices": [ + "0", + "6" + ], + "id_str": "1108462281237520384", + "id": "1108462281237520384" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "11" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950461470227152896", + "id_str": "950483880854695936", + "in_reply_to_user_id": "15374401", + "truncated": false, + "retweet_count": "0", + "id": "950483880854695936", + "in_reply_to_status_id": "950461470227152896", + "created_at": "Mon Jan 08 21:46:30 +0000 2018", + "favorited": false, + "full_text": "@esten WHAT", + "lang": "en", + "in_reply_to_screen_name": "caraesten", + "in_reply_to_user_id_str": "15374401" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950483757672230912" + ], + "editableUntil": "2018-01-08T22:46:01.620Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "ashley williams", + "screen_name": "ag_dubs", + "indices": [ + "0", + "8" + ], + "id_str": "304067888", + "id": "304067888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "126" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950453935478919169", + "id_str": "950483757672230912", + "in_reply_to_user_id": "304067888", + "truncated": false, + "retweet_count": "0", + "id": "950483757672230912", + "in_reply_to_status_id": "950453935478919169", + "created_at": "Mon Jan 08 21:46:01 +0000 2018", + "favorited": false, + "full_text": "@ag_dubs I think the opposite: the discovery process will reveal that white men are favored at Google and defeat his argument.", + "lang": "en", + "in_reply_to_screen_name": "ag_dubs", + "in_reply_to_user_id_str": "304067888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950461344335126528" + ], + "editableUntil": "2018-01-08T21:16:57.864Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "11", + "22" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "23", + "32" + ], + "id_str": "17198118", + "id": "17198118" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "154" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "950460195557195776", + "id_str": "950461344335126528", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "950461344335126528", + "in_reply_to_status_id": "950460195557195776", + "created_at": "Mon Jan 08 20:16:57 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @jeffbcross @samccone We are doing meetings about the weekend's operational incident as a higher priority, but still hoping to get to it today.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950461134531846144" + ], + "editableUntil": "2018-01-08T21:16:07.843Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JBaruch 🎩", + "screen_name": "jbaruch", + "indices": [ + "0", + "8" + ], + "id_str": "16887172", + "id": "16887172" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "9", + "20" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "21", + "30" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "31", + "40" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "41", + "48" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "49", + "62" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "63", + "69" + ], + "id_str": "38003146", + "id": "38003146" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "70", + "81" + ], + "id_str": "14103865", + "id": "14103865" + }, + { + "name": "Stephen Fluin", + "screen_name": "stephenfluin", + "indices": [ + "82", + "95" + ], + "id_str": "15313446", + "id": "15313446" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "111" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950454219701547008", + "id_str": "950461134531846144", + "in_reply_to_user_id": "16887172", + "truncated": false, + "retweet_count": "0", + "id": "950461134531846144", + "in_reply_to_status_id": "950454219701547008", + "created_at": "Mon Jan 08 20:16:07 +0000 2018", + "favorited": false, + "full_text": "@jbaruch @jeffbcross @ZChapple @samccone @sebmck @thejameskyle @jfrog @robwormald @stephenfluin Not really, no.", + "lang": "en", + "in_reply_to_screen_name": "jbaruch", + "in_reply_to_user_id_str": "16887172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950442898058747904" + ], + "editableUntil": "2018-01-08T20:03:39.929Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nathan Fritz 🌯🤔", + "screen_name": "fritzy", + "indices": [ + "0", + "7" + ], + "id_str": "14498374", + "id": "14498374" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "19" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950442512950312960", + "id_str": "950442898058747904", + "in_reply_to_user_id": "14498374", + "truncated": false, + "retweet_count": "0", + "id": "950442898058747904", + "in_reply_to_status_id": "950442512950312960", + "created_at": "Mon Jan 08 19:03:39 +0000 2018", + "favorited": false, + "full_text": "@fritzy Was it you?", + "lang": "en", + "in_reply_to_screen_name": "fritzy", + "in_reply_to_user_id_str": "14498374" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950421652621283329" + ], + "editableUntil": "2018-01-08T18:39:14.622Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "150" + ], + "favorite_count": "49", + "id_str": "950421652621283329", + "truncated": false, + "retweet_count": "2", + "id": "950421652621283329", + "created_at": "Mon Jan 08 17:39:14 +0000 2018", + "favorited": false, + "full_text": "It is dark and cold and wet today and I would like to make it clear that this is UNACCEPTABLE BULLSHIT and I will be lodging a complaint with physics.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950420663512133632" + ], + "editableUntil": "2018-01-08T18:35:18.800Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "166" + ], + "favorite_count": "20", + "id_str": "950420663512133632", + "truncated": false, + "retweet_count": "0", + "id": "950420663512133632", + "created_at": "Mon Jan 08 17:35:18 +0000 2018", + "favorited": false, + "full_text": "Whoever it is gesturing at me in a friendly way from the other end of this too-crowded-to-move bart train: hi! I don't recognize you, please don't take it personally.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950409102668148736" + ], + "editableUntil": "2018-01-08T17:49:22.480Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JBaruch 🎩", + "screen_name": "jbaruch", + "indices": [ + "0", + "8" + ], + "id_str": "16887172", + "id": "16887172" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "9", + "18" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "19", + "30" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "31", + "40" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "41", + "48" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "49", + "62" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "63", + "69" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "151" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950403712786227201", + "id_str": "950409102668148736", + "in_reply_to_user_id": "16887172", + "truncated": false, + "retweet_count": "0", + "id": "950409102668148736", + "in_reply_to_status_id": "950403712786227201", + "created_at": "Mon Jan 08 16:49:22 +0000 2018", + "favorited": false, + "full_text": "@jbaruch @ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog Yes, but why would corporate environments use Angular more than other frameworks?", + "lang": "en", + "in_reply_to_screen_name": "jbaruch", + "in_reply_to_user_id_str": "16887172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950385144224923648" + ], + "editableUntil": "2018-01-08T16:14:10.342Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Naval", + "screen_name": "naval", + "indices": [ + "3", + "9" + ], + "id_str": "745273", + "id": "745273" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "80" + ], + "favorite_count": "0", + "id_str": "950385144224923648", + "truncated": false, + "retweet_count": "0", + "id": "950385144224923648", + "created_at": "Mon Jan 08 15:14:10 +0000 2018", + "favorited": false, + "full_text": "RT @naval: \"Don't take yourself so seriously. You're just a monkey with a plan.\"", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950243566265102336" + ], + "editableUntil": "2018-01-08T06:51:35.526Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🏳️🌈🏳️⚧️👊Marco👊🏳️⚧️🏳️🌈", + "screen_name": "TheMarco", + "indices": [ + "0", + "9" + ], + "id_str": "6875652", + "id": "6875652" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "26" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950243387872985088", + "id_str": "950243566265102336", + "in_reply_to_user_id": "6875652", + "truncated": false, + "retweet_count": "0", + "id": "950243566265102336", + "in_reply_to_status_id": "950243387872985088", + "created_at": "Mon Jan 08 05:51:35 +0000 2018", + "favorited": false, + "full_text": "@TheMarco It's all upside.", + "lang": "en", + "in_reply_to_screen_name": "TheMarco", + "in_reply_to_user_id_str": "6875652" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950243191168557057" + ], + "editableUntil": "2018-01-08T06:50:06.096Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jake", + "screen_name": "jakezebear", + "indices": [ + "0", + "11" + ], + "id_str": "133907247", + "id": "133907247" + }, + { + "name": "anildash.com", + "screen_name": "anildash", + "indices": [ + "12", + "21" + ], + "id_str": "36823", + "id": "36823" + }, + { + "name": "Jason Goldman", + "screen_name": "goldman", + "indices": [ + "22", + "30" + ], + "id_str": "291", + "id": "291" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "190" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950242393474740225", + "id_str": "950243191168557057", + "in_reply_to_user_id": "133907247", + "truncated": false, + "retweet_count": "0", + "id": "950243191168557057", + "in_reply_to_status_id": "950242393474740225", + "created_at": "Mon Jan 08 05:50:06 +0000 2018", + "favorited": false, + "full_text": "@jakezebear @anildash @goldman In seriousness, I'd like Deval Patrick or Cory Booker to run, but Booker is probably too dirty. Or Warren, but I think she is too flawed to get the nomination.", + "lang": "en", + "in_reply_to_screen_name": "jakezebear", + "in_reply_to_user_id_str": "133907247" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950241777297997824" + ], + "editableUntil": "2018-01-08T06:44:29.003Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "anildash.com", + "screen_name": "anildash", + "indices": [ + "0", + "9" + ], + "id_str": "36823", + "id": "36823" + }, + { + "name": "Jason Goldman", + "screen_name": "goldman", + "indices": [ + "10", + "18" + ], + "id_str": "291", + "id": "291" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950240845109841920", + "id_str": "950241777297997824", + "in_reply_to_user_id": "36823", + "truncated": false, + "retweet_count": "0", + "id": "950241777297997824", + "in_reply_to_status_id": "950240845109841920", + "created_at": "Mon Jan 08 05:44:29 +0000 2018", + "favorited": false, + "full_text": "@anildash @goldman I think we have our candidate.", + "lang": "en", + "in_reply_to_screen_name": "anildash", + "in_reply_to_user_id_str": "36823" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950239557068337152" + ], + "editableUntil": "2018-01-08T06:35:39.659Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Burrito Justice", + "screen_name": "burritojustice", + "indices": [ + "0", + "15" + ], + "id_str": "16944165", + "id": "16944165" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "28" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950233207894519808", + "id_str": "950239557068337152", + "in_reply_to_user_id": "16944165", + "truncated": false, + "retweet_count": "0", + "id": "950239557068337152", + "in_reply_to_status_id": "950233207894519808", + "created_at": "Mon Jan 08 05:35:39 +0000 2018", + "favorited": false, + "full_text": "@burritojustice Hmmm. Speed?", + "lang": "en", + "in_reply_to_screen_name": "burritojustice", + "in_reply_to_user_id_str": "16944165" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950236610280357888" + ], + "editableUntil": "2018-01-08T06:23:57.090Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "241" + ], + "favorite_count": "21", + "in_reply_to_status_id_str": "950234996190490624", + "id_str": "950236610280357888", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "950236610280357888", + "in_reply_to_status_id": "950234996190490624", + "created_at": "Mon Jan 08 05:23:57 +0000 2018", + "favorited": false, + "full_text": "Okay, she didn't actually say anything about president. But she would be an interesting candidate. She's the liberal version of Trump: famous, rich, charismatic, popular, and totally unqualified. Only difference is she's liberal as all hell.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950235975581446144" + ], + "editableUntil": "2018-01-08T06:21:25.766Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇵🇹 snipe, lixo tóxico ⭑⭒⭒⭒⭒", + "screen_name": "snipeyhead", + "indices": [ + "0", + "11" + ], + "id_str": "14246782", + "id": "14246782" + }, + { + "name": "Owen Nelson", + "screen_name": "theomn", + "indices": [ + "12", + "19" + ], + "id_str": "37782427", + "id": "37782427" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "28" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950235917473660930", + "id_str": "950235975581446144", + "in_reply_to_user_id": "14246782", + "truncated": false, + "retweet_count": "0", + "id": "950235975581446144", + "in_reply_to_status_id": "950235917473660930", + "created_at": "Mon Jan 08 05:21:25 +0000 2018", + "favorited": false, + "full_text": "@snipeyhead @theomn Exactly.", + "lang": "en", + "in_reply_to_screen_name": "snipeyhead", + "in_reply_to_user_id_str": "14246782" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950235739165417472" + ], + "editableUntil": "2018-01-08T06:20:29.400Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🇵🇹 snipe, lixo tóxico ⭑⭒⭒⭒⭒", + "screen_name": "snipeyhead", + "indices": [ + "0", + "11" + ], + "id_str": "14246782", + "id": "14246782" + }, + { + "name": "Owen Nelson", + "screen_name": "theomn", + "indices": [ + "12", + "19" + ], + "id_str": "37782427", + "id": "37782427" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "108" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950235408561971200", + "id_str": "950235739165417472", + "in_reply_to_user_id": "14246782", + "truncated": false, + "retweet_count": "0", + "id": "950235739165417472", + "in_reply_to_status_id": "950235408561971200", + "created_at": "Mon Jan 08 05:20:29 +0000 2018", + "favorited": false, + "full_text": "@snipeyhead @theomn Ask yourself this: is she more qualified and a better person than the current president?", + "lang": "en", + "in_reply_to_screen_name": "snipeyhead", + "in_reply_to_user_id_str": "14246782" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950235250721882112" + ], + "editableUntil": "2018-01-08T06:18:32.946Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Owen Nelson", + "screen_name": "theomn", + "indices": [ + "0", + "7" + ], + "id_str": "37782427", + "id": "37782427" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "28" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950235180609896449", + "id_str": "950235250721882112", + "in_reply_to_user_id": "37782427", + "truncated": false, + "retweet_count": "0", + "id": "950235250721882112", + "in_reply_to_status_id": "950235180609896449", + "created_at": "Mon Jan 08 05:18:32 +0000 2018", + "favorited": false, + "full_text": "@theomn Me too, no question.", + "lang": "en", + "in_reply_to_screen_name": "theomn", + "in_reply_to_user_id_str": "37782427" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950234996190490624" + ], + "editableUntil": "2018-01-08T06:17:32.261Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "950233105444450304", + "id_str": "950234996190490624", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "950234996190490624", + "in_reply_to_status_id": "950233105444450304", + "created_at": "Mon Jan 08 05:17:32 +0000 2018", + "favorited": false, + "full_text": "Oprah is really great at making speeches.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950233594357690368" + ], + "editableUntil": "2018-01-08T06:11:58.038Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "49" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950233310126641152", + "id_str": "950233594357690368", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "950233594357690368", + "in_reply_to_status_id": "950233310126641152", + "created_at": "Mon Jan 08 05:11:58 +0000 2018", + "favorited": false, + "full_text": "@ohhoe I'll tell you in 9 minutes and 44 seconds.", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950233105444450304" + ], + "editableUntil": "2018-01-08T06:10:01.472Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "129" + ], + "favorite_count": "14", + "id_str": "950233105444450304", + "truncated": false, + "retweet_count": "1", + "id": "950233105444450304", + "created_at": "Mon Jan 08 05:10:01 +0000 2018", + "favorited": false, + "full_text": "Apparently while I was seeing a movie Oprah announced that she's running for president? I guess I have to watch this damn speech.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950172165009162240" + ], + "editableUntil": "2018-01-08T02:07:52.140Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "137" + ], + "favorite_count": "34", + "id_str": "950172165009162240", + "truncated": false, + "retweet_count": "0", + "id": "950172165009162240", + "created_at": "Mon Jan 08 01:07:52 +0000 2018", + "favorited": false, + "full_text": "\"We are digging underground to find puppies.\"\n\"Do puppies live underground?\"\n\"Yes.\"\n\nI am not sure how the 2.5yo came to this conclusion.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950150788138979329" + ], + "editableUntil": "2018-01-08T00:42:55.497Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Vlad Magdalin", + "screen_name": "callmevlad", + "indices": [ + "0", + "11" + ], + "id_str": "46446956", + "id": "46446956" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "12", + "20" + ], + "id_str": "78663", + "id": "78663" + }, + { + "name": "isaacs", + "screen_name": "izs", + "indices": [ + "21", + "25" + ], + "id_str": "8038312", + "id": "8038312" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "26", + "32" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "112" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "950116025088921600", + "id_str": "950150788138979329", + "in_reply_to_user_id": "46446956", + "truncated": false, + "retweet_count": "0", + "id": "950150788138979329", + "in_reply_to_status_id": "950116025088921600", + "created_at": "Sun Jan 07 23:42:55 +0000 2018", + "favorited": false, + "full_text": "@callmevlad @ceejbot @izs @npmjs We have in fact closed the vector as of this incident. We can give more detail.", + "lang": "en", + "in_reply_to_screen_name": "callmevlad", + "in_reply_to_user_id_str": "46446956" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950093448454979585" + ], + "editableUntil": "2018-01-07T20:55:04.651Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [ + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "3", + "9" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [ + { + "url": "https://t.co/3KZEyJ27Io", + "expanded_url": "http://blog.npmjs.org/post/169432444640/npm-operational-incident-6-jan-2018", + "display_url": "blog.npmjs.org/post/169432444…", + "indices": [ + "60", + "83" + ] + } + ], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/npmjs/status/950081394415316992/photo/1", + "source_status_id": "950081394415316992", + "indices": [ + "84", + "107" + ], + "url": "https://t.co/FvnHXKScM7", + "media_url": "http://pbs.twimg.com/media/DS9d_ZMU0AA-zER.jpg", + "id_str": "950081390074187776", + "source_user_id": "309528017", + "id": "950081390074187776", + "media_url_https": "https://pbs.twimg.com/media/DS9d_ZMU0AA-zER.jpg", + "source_user_id_str": "309528017", + "sizes": { + "large": { + "w": "1224", + "h": "1610", + "resize": "fit" + }, + "small": { + "w": "517", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "912", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "source_status_id_str": "950081394415316992", + "display_url": "pic.twitter.com/FvnHXKScM7" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "107" + ], + "favorite_count": "0", + "id_str": "950093448454979585", + "truncated": false, + "retweet_count": "0", + "id": "950093448454979585", + "possibly_sensitive": false, + "created_at": "Sun Jan 07 19:55:04 +0000 2018", + "favorited": false, + "full_text": "RT @npmjs: statement on saturday’s npm operational incident https://t.co/3KZEyJ27Io https://t.co/FvnHXKScM7", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/npmjs/status/950081394415316992/photo/1", + "source_status_id": "950081394415316992", + "indices": [ + "84", + "107" + ], + "url": "https://t.co/FvnHXKScM7", + "media_url": "http://pbs.twimg.com/media/DS9d_ZMU0AA-zER.jpg", + "id_str": "950081390074187776", + "source_user_id": "309528017", + "id": "950081390074187776", + "media_url_https": "https://pbs.twimg.com/media/DS9d_ZMU0AA-zER.jpg", + "source_user_id_str": "309528017", + "sizes": { + "large": { + "w": "1224", + "h": "1610", + "resize": "fit" + }, + "small": { + "w": "517", + "h": "680", + "resize": "fit" + }, + "medium": { + "w": "912", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "source_status_id_str": "950081394415316992", + "display_url": "pic.twitter.com/FvnHXKScM7" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950057928014233600" + ], + "editableUntil": "2018-01-07T18:33:55.918Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "psygnisfive", + "screen_name": "psygnisfive", + "indices": [ + "0", + "12" + ], + "id_str": "995543826801410049", + "id": "995543826801410049" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "45" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950057274948685827", + "id_str": "950057928014233600", + "in_reply_to_user_id": "3393781", + "truncated": false, + "retweet_count": "0", + "id": "950057928014233600", + "in_reply_to_status_id": "950057274948685827", + "created_at": "Sun Jan 07 17:33:55 +0000 2018", + "favorited": false, + "full_text": "@psygnisfive This article is extremely silly.", + "lang": "en", + "in_reply_to_screen_name": "beka_valentine", + "in_reply_to_user_id_str": "3393781" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950038946595069953" + ], + "editableUntil": "2018-01-07T17:18:30.395Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "256" + ], + "favorite_count": "33", + "in_reply_to_status_id_str": "950031569963556865", + "id_str": "950038946595069953", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "950038946595069953", + "in_reply_to_status_id": "950031569963556865", + "created_at": "Sun Jan 07 16:18:30 +0000 2018", + "favorited": false, + "full_text": "Berlin is just \"Swamp town\". \"Ber\" sounds like \"Bär\", German for \"bear\", so the coat of arms for Berlin has a bear on it, even though bears have nothing to do with the town. Apparently heraldry people really like puns and this kind of thing is very common.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950038150432215040" + ], + "editableUntil": "2018-01-07T17:15:20.575Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Alan", + "screen_name": "akgerber", + "indices": [ + "0", + "9" + ], + "id_str": "115095156", + "id": "115095156" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "25" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "950033013076889600", + "id_str": "950038150432215040", + "in_reply_to_user_id": "115095156", + "truncated": false, + "retweet_count": "0", + "id": "950038150432215040", + "in_reply_to_status_id": "950033013076889600", + "created_at": "Sun Jan 07 16:15:20 +0000 2018", + "favorited": false, + "full_text": "@akgerber No it's not :-p", + "lang": "en", + "in_reply_to_screen_name": "akgerber", + "in_reply_to_user_id_str": "115095156" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950032001121247232" + ], + "editableUntil": "2018-01-07T16:50:54.465Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Alan", + "screen_name": "akgerber", + "indices": [ + "0", + "9" + ], + "id_str": "115095156", + "id": "115095156" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950031743347757063", + "id_str": "950032001121247232", + "in_reply_to_user_id": "115095156", + "truncated": false, + "retweet_count": "1", + "id": "950032001121247232", + "in_reply_to_status_id": "950031743347757063", + "created_at": "Sun Jan 07 15:50:54 +0000 2018", + "favorited": false, + "full_text": "@akgerber San Francisco is \"Holy French Guy (in an insulting sense)\".", + "lang": "en", + "in_reply_to_screen_name": "akgerber", + "in_reply_to_user_id_str": "115095156" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950031569963556865" + ], + "editableUntil": "2018-01-07T16:49:11.669Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "280" + ], + "favorite_count": "18", + "in_reply_to_status_id_str": "950027931807465472", + "id_str": "950031569963556865", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950031569963556865", + "in_reply_to_status_id": "950027931807465472", + "created_at": "Sun Jan 07 15:49:11 +0000 2018", + "favorited": false, + "full_text": "Stockholm is literally \"log islet\". Sometime between 1000-1300 a series of forts were built to protect villages around the lake from invasion from the sea. They built the forts by driving logs into the sea bed to build on top of them. In 1978 they found some of these sunken logs.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950027931807465472" + ], + "editableUntil": "2018-01-07T16:34:44.265Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "31" + ], + "favorite_count": "23", + "in_reply_to_status_id_str": "950022109673152512", + "id_str": "950027931807465472", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "950027931807465472", + "in_reply_to_status_id": "950022109673152512", + "created_at": "Sun Jan 07 15:34:44 +0000 2018", + "favorited": false, + "full_text": "I could do this forever, folks.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950024947224555520" + ], + "editableUntil": "2018-01-07T16:22:52.685Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Alan Fleming 🏴🇪🇺🏳️🌈", + "screen_name": "alanfleming", + "indices": [ + "0", + "12" + ], + "id_str": "636263", + "id": "636263" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "21" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949936359258587141", + "id_str": "950024947224555520", + "in_reply_to_user_id": "636263", + "truncated": false, + "retweet_count": "0", + "id": "950024947224555520", + "in_reply_to_status_id": "949936359258587141", + "created_at": "Sun Jan 07 15:22:52 +0000 2018", + "favorited": false, + "full_text": "@alanfleming Amazing.", + "lang": "en", + "in_reply_to_screen_name": "alanfleming", + "in_reply_to_user_id_str": "636263" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950024012377178112" + ], + "editableUntil": "2018-01-07T16:19:09.800Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Michael Valentine", + "screen_name": "mv_whelpley", + "indices": [ + "0", + "12" + ], + "id_str": "706997260815454208", + "id": "706997260815454208" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "131" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "950023565805408256", + "id_str": "950024012377178112", + "in_reply_to_user_id": "706997260815454208", + "truncated": false, + "retweet_count": "0", + "id": "950024012377178112", + "in_reply_to_status_id": "950023565805408256", + "created_at": "Sun Jan 07 15:19:09 +0000 2018", + "favorited": false, + "full_text": "@mv_whelpley That's not appeared in any of the etymologies I looked at so I think he probably made it up. I'm not an expert though.", + "lang": "en", + "in_reply_to_screen_name": "mv_whelpley", + "in_reply_to_user_id_str": "706997260815454208" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950022109673152512" + ], + "editableUntil": "2018-01-07T16:11:36.160Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "180" + ], + "favorite_count": "23", + "in_reply_to_status_id_str": "950021506515451904", + "id_str": "950022109673152512", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "4", + "id": "950022109673152512", + "in_reply_to_status_id": "950021506515451904", + "created_at": "Sun Jan 07 15:11:36 +0000 2018", + "favorited": false, + "full_text": "Paris comes from Lutetia Parisorum, which is \"the swamps of the Parisii\". \"Par\" is Celtic for \"boat\", so Paris can be arguably translated as \"The Swamp Where The Boat People Live\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950021506515451904" + ], + "editableUntil": "2018-01-07T16:09:12.356Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "280" + ], + "favorite_count": "20", + "in_reply_to_status_id_str": "949851749107490816", + "id_str": "950021506515451904", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "3", + "id": "950021506515451904", + "in_reply_to_status_id": "949851749107490816", + "created_at": "Sun Jan 07 15:09:12 +0000 2018", + "favorited": false, + "full_text": "Continuing the \"village where <obvious geographical feature>\" theme: London's etymology is both obscure and contested, but I find most convincing the Celtic derivation of \"londinjon\", which means \"The Place That Floods Periodically Because Of Tides\", which it certainly was.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "950010881387020288" + ], + "editableUntil": "2018-01-07T15:26:59.128Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Max Stoiber", + "screen_name": "mxstbr", + "indices": [ + "0", + "7" + ], + "id_str": "2451223458", + "id": "2451223458" + }, + { + "name": "danabramov.bsky.social", + "screen_name": "dan_abramov", + "indices": [ + "8", + "20" + ], + "id_str": "70345946", + "id": "70345946" + }, + { + "name": "Riad Benguella", + "screen_name": "riadbenguella", + "indices": [ + "21", + "35" + ], + "id_str": "8595922", + "id": "8595922" + }, + { + "name": "Devon Govett", + "screen_name": "devongovett", + "indices": [ + "36", + "48" + ], + "id_str": "15687937", + "id": "15687937" + }, + { + "name": "Henry", + "screen_name": "left_pad", + "indices": [ + "49", + "58" + ], + "id_str": "138173132", + "id": "138173132" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "202" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "950010113795993603", + "id_str": "950010881387020288", + "in_reply_to_user_id": "2451223458", + "truncated": false, + "retweet_count": "0", + "id": "950010881387020288", + "in_reply_to_status_id": "950010113795993603", + "created_at": "Sun Jan 07 14:26:59 +0000 2018", + "favorited": false, + "full_text": "@mxstbr @dan_abramov @riadbenguella @devongovett @left_pad This strikes me as one of those things that looks simple but is in fact very tricky. The \"engines\" field is widely ignored for similar reasons.", + "lang": "en", + "in_reply_to_screen_name": "mxstbr", + "in_reply_to_user_id_str": "2451223458" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949872526070505472" + ], + "editableUntil": "2018-01-07T06:17:12.650Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "brianloveswords", + "screen_name": "brianloveswords", + "indices": [ + "0", + "16" + ], + "id_str": "17177251", + "id": "17177251" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "44" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "949870634905079808", + "id_str": "949872526070505472", + "in_reply_to_user_id": "17177251", + "truncated": false, + "retweet_count": "0", + "id": "949872526070505472", + "in_reply_to_status_id": "949870634905079808", + "created_at": "Sun Jan 07 05:17:12 +0000 2018", + "favorited": false, + "full_text": "@brianloveswords I thought you loved swords.", + "lang": "en", + "in_reply_to_screen_name": "brianloveswords", + "in_reply_to_user_id_str": "17177251" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949862432716947456" + ], + "editableUntil": "2018-01-07T05:37:06.207Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Phil Dokas", + "screen_name": "dokas", + "indices": [ + "0", + "6" + ], + "id_str": "635653", + "id": "635653" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "13" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949861666484772865", + "id_str": "949862432716947456", + "in_reply_to_user_id": "635653", + "truncated": false, + "retweet_count": "0", + "id": "949862432716947456", + "in_reply_to_status_id": "949861666484772865", + "created_at": "Sun Jan 07 04:37:06 +0000 2018", + "favorited": false, + "full_text": "@dokas Oooooh", + "lang": "und", + "in_reply_to_screen_name": "dokas", + "in_reply_to_user_id_str": "635653" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949857352244633602" + ], + "editableUntil": "2018-01-07T05:16:54.928Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Amelia Bellamy-Royds", + "screen_name": "AmeliasBrain", + "indices": [ + "0", + "13" + ], + "id_str": "3122402048", + "id": "3122402048" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "147" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "949855999208247296", + "id_str": "949857352244633602", + "in_reply_to_user_id": "3122402048", + "truncated": false, + "retweet_count": "0", + "id": "949857352244633602", + "in_reply_to_status_id": "949855999208247296", + "created_at": "Sun Jan 07 04:16:54 +0000 2018", + "favorited": false, + "full_text": "@AmeliasBrain I took a year off once and spent a week researching the etymology of every single street name in San Francisco and it was delightful.", + "lang": "en", + "in_reply_to_screen_name": "AmeliasBrain", + "in_reply_to_user_id_str": "3122402048" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949855139015245824" + ], + "editableUntil": "2018-01-07T05:08:07.253Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "21" + ], + "favorite_count": "30", + "id_str": "949855139015245824", + "truncated": false, + "retweet_count": "0", + "id": "949855139015245824", + "created_at": "Sun Jan 07 04:08:07 +0000 2018", + "favorited": false, + "full_text": "I love words so much.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949851749107490816" + ], + "editableUntil": "2018-01-07T04:54:39.036Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "226" + ], + "favorite_count": "43", + "in_reply_to_status_id_str": "949850353503055872", + "id_str": "949851749107490816", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "6", + "id": "949851749107490816", + "in_reply_to_status_id": "949850353503055872", + "created_at": "Sun Jan 07 03:54:39 +0000 2018", + "favorited": false, + "full_text": "Most \"Washington\"s are named after a town in northern England. It comes from Hwæsingatūn, meaning \"Estate of the family of Hwæsa\". Hwæsa means \"wheat sheaf\". So it's \"The village where the family who grow a lot of wheat live\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949850353503055872" + ], + "editableUntil": "2018-01-07T04:49:06.298Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "63", + "in_reply_to_status_id_str": "949841831457509376", + "id_str": "949850353503055872", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "3", + "id": "949850353503055872", + "in_reply_to_status_id": "949841831457509376", + "created_at": "Sun Jan 07 03:49:06 +0000 2018", + "favorited": false, + "full_text": "\"Amsterdam\" means \"Dam across the River Amstel\", Amstel means \"an area with lots of water\". So it's Dam Across The River In An Area With A Lot of Water.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949848477088935936" + ], + "editableUntil": "2018-01-07T04:41:38.926Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "A.J. Kandy", + "screen_name": "AJKandy", + "indices": [ + "0", + "8" + ], + "id_str": "1508831", + "id": "1508831" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "64" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949848284364914688", + "id_str": "949848477088935936", + "in_reply_to_user_id": "1508831", + "truncated": false, + "retweet_count": "0", + "id": "949848477088935936", + "in_reply_to_status_id": "949848284364914688", + "created_at": "Sun Jan 07 03:41:38 +0000 2018", + "favorited": false, + "full_text": "@AJKandy New York City is New Place With Lots of Yew Trees City.", + "lang": "en", + "in_reply_to_screen_name": "AJKandy", + "in_reply_to_user_id_str": "1508831" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949848048321966081" + ], + "editableUntil": "2018-01-07T04:39:56.700Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949848048321966081/photo/1", + "indices": [ + "14", + "37" + ], + "url": "https://t.co/M4Q2T952e5", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DS6JwilV4AEak6W.jpg", + "id_str": "949848038431907841", + "id": "949848038431907841", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DS6JwilV4AEak6W.jpg", + "sizes": { + "medium": { + "w": "534", + "h": "252", + "resize": "fit" + }, + "small": { + "w": "534", + "h": "252", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "534", + "h": "252", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/M4Q2T952e5" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949847529964949504", + "id_str": "949848048321966081", + "in_reply_to_user_id": "25119349", + "truncated": false, + "retweet_count": "1", + "id": "949848048321966081", + "in_reply_to_status_id": "949847529964949504", + "possibly_sensitive": false, + "created_at": "Sun Jan 07 03:39:56 +0000 2018", + "favorited": false, + "full_text": "@MizzCandy09 https://t.co/M4Q2T952e5", + "lang": "qme", + "in_reply_to_user_id_str": "25119349", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949848048321966081/photo/1", + "indices": [ + "14", + "37" + ], + "url": "https://t.co/M4Q2T952e5", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DS6JwilV4AEak6W.jpg", + "id_str": "949848038431907841", + "video_info": { + "aspect_ratio": [ + "89", + "42" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DS6JwilV4AEak6W.mp4" + } + ] + }, + "id": "949848038431907841", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DS6JwilV4AEak6W.jpg", + "sizes": { + "medium": { + "w": "534", + "h": "252", + "resize": "fit" + }, + "small": { + "w": "534", + "h": "252", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "534", + "h": "252", + "resize": "fit" + } + }, + "type": "animated_gif", + "display_url": "pic.twitter.com/M4Q2T952e5" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949847311340810240" + ], + "editableUntil": "2018-01-07T04:37:00.990Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jessica Rose", + "screen_name": "jesslynnrose", + "indices": [ + "0", + "13" + ], + "id_str": "1530096708", + "id": "1530096708" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "191" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "949846898902315009", + "id_str": "949847311340810240", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949847311340810240", + "in_reply_to_status_id": "949846898902315009", + "created_at": "Sun Jan 07 03:37:00 +0000 2018", + "favorited": false, + "full_text": "@jesslynnrose More specifically: the value of work life balance would not be so clear to me and so central to npm's values if I hadn't destroyed myself and my previous company by overworking.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949846898902315009" + ], + "editableUntil": "2018-01-07T04:35:22.657Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jessica Rose", + "screen_name": "jesslynnrose", + "indices": [ + "0", + "13" + ], + "id_str": "1530096708", + "id": "1530096708" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "145" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "949334086295916545", + "id_str": "949846898902315009", + "in_reply_to_user_id": "1530096708", + "truncated": false, + "retweet_count": "0", + "id": "949846898902315009", + "in_reply_to_status_id": "949334086295916545", + "created_at": "Sun Jan 07 03:35:22 +0000 2018", + "favorited": false, + "full_text": "@jesslynnrose I would have no idea how to run my current startup if I hadn't run my first one into the ground with dozens of boneheaded mistakes.", + "lang": "en", + "in_reply_to_screen_name": "jesslynnrose", + "in_reply_to_user_id_str": "1530096708" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949845534998540288" + ], + "editableUntil": "2018-01-07T04:29:57.477Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Pinboard", + "screen_name": "Pinboard", + "indices": [ + "0", + "9" + ], + "id_str": "55525953", + "id": "55525953" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "39" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "949844354272645120", + "id_str": "949845534998540288", + "in_reply_to_user_id": "55525953", + "truncated": false, + "retweet_count": "0", + "id": "949845534998540288", + "in_reply_to_status_id": "949844354272645120", + "created_at": "Sun Jan 07 03:29:57 +0000 2018", + "favorited": false, + "full_text": "@Pinboard They got infected by Spectre.", + "lang": "en", + "in_reply_to_screen_name": "Pinboard", + "in_reply_to_user_id_str": "55525953" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949843269134860289" + ], + "editableUntil": "2018-01-07T04:20:57.253Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "devesine", + "screen_name": "devesine", + "indices": [ + "0", + "9" + ], + "id_str": "1346022235664834561", + "id": "1346022235664834561" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949842693089144832", + "id_str": "949843269134860289", + "in_reply_to_user_id": "14703752", + "truncated": false, + "retweet_count": "0", + "id": "949843269134860289", + "in_reply_to_status_id": "949842693089144832", + "created_at": "Sun Jan 07 03:20:57 +0000 2018", + "favorited": false, + "full_text": "@devesine Thank you, this is amazing.", + "lang": "en", + "in_reply_to_screen_name": "devetangent", + "in_reply_to_user_id_str": "14703752" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949841831457509376" + ], + "editableUntil": "2018-01-07T04:15:14.484Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "141" + ], + "favorite_count": "94", + "in_reply_to_status_id_str": "949840112560455680", + "id_str": "949841831457509376", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "17", + "id": "949841831457509376", + "in_reply_to_status_id": "949840112560455680", + "created_at": "Sun Jan 07 03:15:14 +0000 2018", + "favorited": false, + "full_text": "Geographical etymology is discovering that every major city is, when translated literally, called something like \"village of townville city\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949841213590355970" + ], + "editableUntil": "2018-01-07T04:12:47.173Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Stefan du Fresne", + "screen_name": "_SCdF_", + "indices": [ + "0", + "7" + ], + "id_str": "148841857", + "id": "148841857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "102" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949840702443278336", + "id_str": "949841213590355970", + "in_reply_to_user_id": "148841857", + "truncated": false, + "retweet_count": "0", + "id": "949841213590355970", + "in_reply_to_status_id": "949840702443278336", + "created_at": "Sun Jan 07 03:12:47 +0000 2018", + "favorited": false, + "full_text": "@_SCdF_ I'm glad I'm not the only one who gets that mental image every time I hear about that company.", + "lang": "en", + "in_reply_to_screen_name": "_SCdF_", + "in_reply_to_user_id_str": "148841857" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949840112560455680" + ], + "editableUntil": "2018-01-07T04:08:24.667Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "260" + ], + "favorite_count": "36", + "in_reply_to_status_id_str": "949837613866758144", + "id_str": "949840112560455680", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "4", + "id": "949840112560455680", + "in_reply_to_status_id": "949837613866758144", + "created_at": "Sun Jan 07 03:08:24 +0000 2018", + "favorited": false, + "full_text": "Braintree the town is named after a town in England of that name. How it got that name is disputed but possibly a mis-spelling of \"Braintry\", which means \"Village near the river Brain\". \"Brain\" meant \"river\" in Celtic, so it's literally \"Village by the river\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949838569891250177" + ], + "editableUntil": "2018-01-07T04:02:16.866Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/rnPdw6nSiE", + "expanded_url": "https://twitter.com/ladybreec/status/949497213390123008", + "display_url": "twitter.com/ladybreec/stat…", + "indices": [ + "54", + "77" + ] + } + ] + }, + "display_text_range": [ + "0", + "77" + ], + "favorite_count": "10", + "id_str": "949838569891250177", + "truncated": false, + "retweet_count": "4", + "id": "949838569891250177", + "possibly_sensitive": false, + "created_at": "Sun Jan 07 03:02:16 +0000 2018", + "favorited": false, + "full_text": "Signal boosting because this is my fucking nightmare: https://t.co/rnPdw6nSiE", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949838100330508289" + ], + "editableUntil": "2018-01-07T04:00:24.914Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949820761904111616", + "id_str": "949838100330508289", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "949838100330508289", + "in_reply_to_status_id": "949820761904111616", + "created_at": "Sun Jan 07 03:00:24 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait And the sequel, \"I have adjusted the settings on your TV to stop it doing a thing you didn't notice it was doing.\"", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949837613866758144" + ], + "editableUntil": "2018-01-07T03:58:28.932Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "195" + ], + "favorite_count": "81", + "id_str": "949837613866758144", + "truncated": false, + "retweet_count": "4", + "id": "949837613866758144", + "created_at": "Sun Jan 07 02:58:28 +0000 2018", + "favorited": false, + "full_text": "I am reading a biography of John Adams, which is how I discovered that the payments company Braintree is named after the town where John Adams grew up, and they named the company for that reason.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949833823004499968" + ], + "editableUntil": "2018-01-07T03:43:25.120Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "whit", + "screen_name": "whitneyarner", + "indices": [ + "0", + "13" + ], + "id_str": "14213001", + "id": "14213001" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "89" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949493632377245696", + "id_str": "949833823004499968", + "in_reply_to_user_id": "14213001", + "truncated": false, + "retweet_count": "0", + "id": "949833823004499968", + "in_reply_to_status_id": "949493632377245696", + "created_at": "Sun Jan 07 02:43:25 +0000 2018", + "favorited": false, + "full_text": "@whitneyarner So you're allowed to eat pure protein and that's it? Bipolar = Atkins diet?", + "lang": "en", + "in_reply_to_screen_name": "whitneyarner", + "in_reply_to_user_id_str": "14213001" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949832619025252352" + ], + "editableUntil": "2018-01-07T03:38:38.069Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949831632621481984", + "id_str": "949832619025252352", + "in_reply_to_user_id": "290549888", + "truncated": false, + "retweet_count": "0", + "id": "949832619025252352", + "in_reply_to_status_id": "949831632621481984", + "created_at": "Sun Jan 07 02:38:38 +0000 2018", + "favorited": false, + "full_text": "@sebmck It's still better than that.", + "lang": "en", + "in_reply_to_screen_name": "sebmck", + "in_reply_to_user_id_str": "290549888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949831264260927488" + ], + "editableUntil": "2018-01-07T03:33:15.068Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "117" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "949829570848374784", + "id_str": "949831264260927488", + "in_reply_to_user_id": "290549888", + "truncated": false, + "retweet_count": "0", + "id": "949831264260927488", + "in_reply_to_status_id": "949829570848374784", + "created_at": "Sun Jan 07 02:33:15 +0000 2018", + "favorited": false, + "full_text": "@sebmck Have you heard the good news about Grilled Cheese (hint: it is nothing like what you'd expect given the name)", + "lang": "en", + "in_reply_to_screen_name": "sebmck", + "in_reply_to_user_id_str": "290549888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949805684266123264" + ], + "editableUntil": "2018-01-07T01:51:36.322Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "wil shipley", + "screen_name": "wilshipley", + "indices": [ + "3", + "14" + ], + "id_str": "2911221", + "id": "2911221" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "949805684266123264", + "truncated": false, + "retweet_count": "0", + "id": "949805684266123264", + "created_at": "Sun Jan 07 00:51:36 +0000 2018", + "favorited": false, + "full_text": "RT @wilshipley: Don’t buy the new biography of me—it’s full of salacious lies! Juicy, incredible stories that will make your arm hairs stan…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949775563228459009" + ], + "editableUntil": "2018-01-06T23:51:54.907Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "12", + "21" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "22", + "32" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [ + { + "url": "https://t.co/FALnIWgJsU", + "expanded_url": "https://www.npmjs.com/npm/state-of-javascript-frameworks-2017-part-1/?utm_content=buffer7837e&utm_medium=social&utm_source=twitter.com&utm_campaign=buffer", + "display_url": "npmjs.com/npm/state-of-j…", + "indices": [ + "125", + "148" + ] + } + ] + }, + "display_text_range": [ + "0", + "148" + ], + "favorite_count": "12", + "in_reply_to_status_id_str": "949752479708798976", + "id_str": "949775563228459009", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "4", + "id": "949775563228459009", + "in_reply_to_status_id": "949752479708798976", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 22:51:54 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @samccone @IgorMinar While the data crunching is ongoing I've added a note to the top of the post about Angular: https://t.co/FALnIWgJsU", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949772261308882944" + ], + "editableUntil": "2018-01-06T23:38:47.668Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "npm status", + "screen_name": "npmstatus", + "indices": [ + "3", + "13" + ], + "id_str": "745003433019772928", + "id": "745003433019772928" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "949772261308882944", + "truncated": false, + "retweet_count": "0", + "id": "949772261308882944", + "created_at": "Sat Jan 06 22:38:47 +0000 2018", + "favorited": false, + "full_text": "RT @npmstatus: [status] Monitoring: We believe all cleanup is complete, and all packages are back to the state they were in before… https:/…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949762292945649664" + ], + "editableUntil": "2018-01-06T22:59:11.025Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Tom Coates", + "screen_name": "tomcoates", + "indices": [ + "0", + "10" + ], + "id_str": "12514", + "id": "12514" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "58" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949761267102699520", + "id_str": "949762292945649664", + "in_reply_to_user_id": "12514", + "truncated": false, + "retweet_count": "0", + "id": "949762292945649664", + "in_reply_to_status_id": "949761267102699520", + "created_at": "Sat Jan 06 21:59:11 +0000 2018", + "favorited": false, + "full_text": "@tomcoates I keep expecting the robot to murder everybody.", + "lang": "en", + "in_reply_to_screen_name": "tomcoates", + "in_reply_to_user_id_str": "12514" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949760425934991360" + ], + "editableUntil": "2018-01-06T22:51:45.895Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rat king 🐀", + "screen_name": "MikeIsaac", + "indices": [ + "0", + "10" + ], + "id_str": "19040598", + "id": "19040598" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "114" + ], + "favorite_count": "27", + "in_reply_to_status_id_str": "949759659547611137", + "id_str": "949760425934991360", + "in_reply_to_user_id": "19040598", + "truncated": false, + "retweet_count": "0", + "id": "949760425934991360", + "in_reply_to_status_id": "949759659547611137", + "created_at": "Sat Jan 06 21:51:45 +0000 2018", + "favorited": false, + "full_text": "@MikeIsaac I got too deep with barista commitment and now I've been helping my barista learn to code for 6 months.", + "lang": "en", + "in_reply_to_screen_name": "MikeIsaac", + "in_reply_to_user_id_str": "19040598" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949754424380899328" + ], + "editableUntil": "2018-01-06T22:27:55.013Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "11", + "20" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "21", + "32" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "33", + "42" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "43", + "50" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "51", + "64" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "65", + "71" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "263" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "949753958406356992", + "id_str": "949754424380899328", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "1", + "id": "949754424380899328", + "in_reply_to_status_id": "949753958406356992", + "created_at": "Sat Jan 06 21:27:55 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog Is it okay if I refer to them as Angular 1.x and Angular 2.x? I do not think \"Angular\" vs. \"AngularJS\" is distinction understood outside of the Angular community (it is certainly news to me).", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949752479708798976" + ], + "editableUntil": "2018-01-06T22:20:11.367Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "12", + "21" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "22", + "32" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [ + { + "url": "https://t.co/olCltyhQdc", + "expanded_url": "https://twitter.com/seldo/status/949729181142679552", + "display_url": "twitter.com/seldo/status/9…", + "indices": [ + "43", + "66" + ] + } + ] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949752254856273920", + "id_str": "949752479708798976", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949752479708798976", + "in_reply_to_status_id": "949752254856273920", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 21:20:11 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @samccone @IgorMinar See also: https://t.co/olCltyhQdc", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949752254856273920" + ], + "editableUntil": "2018-01-06T22:19:17.758Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "12", + "21" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "22", + "32" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "276" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949751994473828352", + "id_str": "949752254856273920", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949752254856273920", + "in_reply_to_status_id": "949751994473828352", + "created_at": "Sat Jan 06 21:19:17 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @samccone @IgorMinar There's several hundred terabytes of data involved and the cluster that does this work is pretty expensive, so I've sized it to take about 24 hours to complete the run. So either tomorrow or Monday I can re-draw the graphs and update the post.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949751994473828352" + ], + "editableUntil": "2018-01-06T22:18:15.678Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "12", + "21" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "22", + "32" + ], + "id_str": "8300112", + "id": "8300112" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "278" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "949731552732131328", + "id_str": "949751994473828352", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "949751994473828352", + "in_reply_to_status_id": "949731552732131328", + "created_at": "Sat Jan 06 21:18:15 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @samccone @IgorMinar I'm genuinely sorry for the mistake. Scoped package download counts currently start in March 2017; I have a job running to calculate them back to October 2016, which will allow me to re-draw the bubble chart with Angular(1+2) fairly represented.", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949744630580461568" + ], + "editableUntil": "2018-01-06T21:48:59.989Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "10", + "21" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "22", + "31" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "32", + "39" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "40", + "53" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "54", + "60" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "179" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949744450015698944", + "id_str": "949744630580461568", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949744630580461568", + "in_reply_to_status_id": "949744450015698944", + "created_at": "Sat Jan 06 20:48:59 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog (It could go faster but the number of boxes I have to throw into the cluster begins to become prohibitively expensive)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949744450015698944" + ], + "editableUntil": "2018-01-06T21:48:16.939Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "10", + "21" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "22", + "31" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "32", + "39" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "40", + "53" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "54", + "60" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "245" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "949729181142679552", + "id_str": "949744450015698944", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949744450015698944", + "in_reply_to_status_id": "949729181142679552", + "created_at": "Sat Jan 06 20:48:16 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog I have now been nerd-sniped and have written the code necessary to fire up the supercomputer. It has to churn through several hundred terabytes of logs so it may take a couple of days.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949743904718389248" + ], + "editableUntil": "2018-01-06T21:46:06.930Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "123" + ], + "favorite_count": "14", + "in_reply_to_status_id_str": "949743337472339970", + "id_str": "949743904718389248", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949743904718389248", + "in_reply_to_status_id": "949743337472339970", + "created_at": "Sat Jan 06 20:46:06 +0000 2018", + "favorited": false, + "full_text": "I was in the ocean, on a surfboard-shaped device, a wave was involved... let's just call it a surfing accident and move on.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949743461195894784" + ], + "editableUntil": "2018-01-06T21:44:21.186Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "0", + "7" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "stanley", + "screen_name": "fivetanley", + "indices": [ + "8", + "19" + ], + "id_str": "306497372", + "id": "306497372" + }, + { + "name": "Horse JS", + "screen_name": "horse_js", + "indices": [ + "20", + "29" + ], + "id_str": "497617437", + "id": "497617437" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "72" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "949742960404410368", + "id_str": "949743461195894784", + "in_reply_to_user_id": "290549888", + "truncated": false, + "retweet_count": "0", + "id": "949743461195894784", + "in_reply_to_status_id": "949742960404410368", + "created_at": "Sat Jan 06 20:44:21 +0000 2018", + "favorited": false, + "full_text": "@sebmck @fivetanley @horse_js The horse knows. The horse is trolling me.", + "lang": "en", + "in_reply_to_screen_name": "sebmck", + "in_reply_to_user_id_str": "290549888" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949743337472339970" + ], + "editableUntil": "2018-01-06T21:43:51.688Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "109" + ], + "favorite_count": "15", + "id_str": "949743337472339970", + "truncated": false, + "retweet_count": "0", + "id": "949743337472339970", + "created_at": "Sat Jan 06 20:43:51 +0000 2018", + "favorited": false, + "full_text": "If anybody asks the cut on my face is from a \"surfing accident\" which is juuuuuuust on this side of accurate.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949742207493332992" + ], + "editableUntil": "2018-01-06T21:39:22.280Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Horse JS", + "screen_name": "horse_js", + "indices": [ + "0", + "9" + ], + "id_str": "497617437", + "id": "497617437" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "39" + ], + "favorite_count": "24", + "in_reply_to_status_id_str": "949738702485454848", + "id_str": "949742207493332992", + "in_reply_to_user_id": "497617437", + "truncated": false, + "retweet_count": "0", + "id": "949742207493332992", + "in_reply_to_status_id": "949738702485454848", + "created_at": "Sat Jan 06 20:39:22 +0000 2018", + "favorited": false, + "full_text": "@horse_js I'm being trolled by a horse.", + "lang": "en", + "in_reply_to_screen_name": "horse_js", + "in_reply_to_user_id_str": "497617437" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949729687231651840" + ], + "editableUntil": "2018-01-06T20:49:37.217Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "10", + "21" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "22", + "31" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "32", + "39" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "40", + "53" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "54", + "60" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "338" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949728420350648320", + "id_str": "949729687231651840", + "in_reply_to_user_id": "887912305", + "truncated": false, + "retweet_count": "0", + "id": "949729687231651840", + "in_reply_to_status_id": "949728420350648320", + "created_at": "Sat Jan 06 19:49:37 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog I appreciate that. I wouldn't want somebody spreading FUD about my framework either, so I appreciate your interest in seeing this corrected and it's totally reasonable. This was an honest mistake and the new data changes the picture considerably so I will broadcast the update.", + "lang": "en", + "in_reply_to_user_id_str": "887912305" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949729181142679552" + ], + "editableUntil": "2018-01-06T20:47:36.556Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "10", + "21" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "22", + "31" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "32", + "39" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "40", + "53" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "54", + "60" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949729181142679552/photo/1", + "indices": [ + "342", + "365" + ], + "url": "https://t.co/yQRL8RAqgx", + "media_url": "http://pbs.twimg.com/media/DS4c6oZVoAIqK6o.jpg", + "id_str": "949728365023436802", + "id": "949728365023436802", + "media_url_https": "https://pbs.twimg.com/media/DS4c6oZVoAIqK6o.jpg", + "sizes": { + "large": { + "w": "1474", + "h": "1274", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "1037", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "588", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/yQRL8RAqgx" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "365" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949724592377090050", + "id_str": "949729181142679552", + "in_reply_to_user_id": "887912305", + "truncated": false, + "retweet_count": "0", + "id": "949729181142679552", + "in_reply_to_status_id": "949724592377090050", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 19:47:36 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog Here's the graph for the last 9 months of data; I will fire up the supercomputer next week to crunch data for older scoped packages. Angular1+2 together are much more popular, so I will definitely update the post. The flat trend (but only 4 data points, so beware) looks the same. https://t.co/yQRL8RAqgx", + "lang": "en", + "in_reply_to_user_id_str": "887912305", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949729181142679552/photo/1", + "indices": [ + "342", + "365" + ], + "url": "https://t.co/yQRL8RAqgx", + "media_url": "http://pbs.twimg.com/media/DS4c6oZVoAIqK6o.jpg", + "id_str": "949728365023436802", + "id": "949728365023436802", + "media_url_https": "https://pbs.twimg.com/media/DS4c6oZVoAIqK6o.jpg", + "sizes": { + "large": { + "w": "1474", + "h": "1274", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "1037", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "588", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/yQRL8RAqgx" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949722035755732992" + ], + "editableUntil": "2018-01-06T20:19:12.963Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "10", + "21" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "22", + "31" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "32", + "39" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "40", + "53" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "54", + "60" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "192" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949720990224809984", + "id_str": "949722035755732992", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949722035755732992", + "in_reply_to_status_id": "949720990224809984", + "created_at": "Sat Jan 06 19:19:12 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog Private registries are quite popular but I can't think of a reason why they'd be more popular with angular users than anybody else.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949721368605544448" + ], + "editableUntil": "2018-01-06T20:16:33.902Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "32" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949707793480773632", + "id_str": "949721368605544448", + "in_reply_to_user_id": "102568309", + "truncated": false, + "retweet_count": "0", + "id": "949721368605544448", + "in_reply_to_status_id": "949707793480773632", + "created_at": "Sat Jan 06 19:16:33 +0000 2018", + "favorited": false, + "full_text": "@_austinfrey Yep, covered those.", + "lang": "en", + "in_reply_to_user_id_str": "102568309" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949721176787464192" + ], + "editableUntil": "2018-01-06T20:15:48.169Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "12", + "21" + ], + "id_str": "17198118", + "id": "17198118" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "67" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "949701153305980929", + "id_str": "949721176787464192", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "1", + "id": "949721176787464192", + "in_reply_to_status_id": "949701153305980929", + "created_at": "Sat Jan 06 19:15:48 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @samccone It's the weekend. We take weekends seriously.", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949720990224809984" + ], + "editableUntil": "2018-01-06T20:15:03.689Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "10", + "21" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "22", + "31" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "32", + "39" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "40", + "53" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + }, + { + "name": "JFrog", + "screen_name": "jfrog", + "indices": [ + "54", + "60" + ], + "id_str": "38003146", + "id": "38003146" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "320" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949702036613984256", + "id_str": "949720990224809984", + "in_reply_to_user_id": "887912305", + "truncated": false, + "retweet_count": "0", + "id": "949720990224809984", + "in_reply_to_status_id": "949702036613984256", + "created_at": "Sat Jan 06 19:15:03 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @jeffbcross @samccone @sebmck @thejameskyle @jfrog The thing about Artifactory is it doesn't really matter what the usage is unless there's some reason Artifactory users would disproportionately use Angular over other frameworks. Private registry stats would probably increase all numbers in equal proportions.", + "lang": "en", + "in_reply_to_user_id_str": "887912305" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949720497465339904" + ], + "editableUntil": "2018-01-06T20:13:06.206Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "12", + "21" + ], + "id_str": "17198118", + "id": "17198118" + }, + { + "name": "Sebastian", + "screen_name": "sebmck", + "indices": [ + "22", + "29" + ], + "id_str": "290549888", + "id": "290549888" + }, + { + "name": "Moved to @jamiebuilds", + "screen_name": "thejameskyle", + "indices": [ + "30", + "43" + ], + "id_str": "963017228940529665", + "id": "963017228940529665" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "119" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949700224674496512", + "id_str": "949720497465339904", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "949720497465339904", + "in_reply_to_status_id": "949700224674496512", + "created_at": "Sat Jan 06 19:13:06 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @samccone @sebmck @thejameskyle All yarn downloads are from npm's servers so we already have yarn stats :-)", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949698901694545921" + ], + "editableUntil": "2018-01-06T18:47:17.373Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sam Saccone", + "screen_name": "samccone", + "indices": [ + "0", + "9" + ], + "id_str": "17198118", + "id": "17198118" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "156" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "949697967023210496", + "id_str": "949698901694545921", + "in_reply_to_user_id": "17198118", + "truncated": false, + "retweet_count": "0", + "id": "949698901694545921", + "in_reply_to_status_id": "949697967023210496", + "created_at": "Sat Jan 06 17:47:17 +0000 2018", + "favorited": false, + "full_text": "@samccone I publicly acknowledged I made a mistake and promised to fix it when I am back from vacation which is Monday. People could be a little more chill.", + "lang": "en", + "in_reply_to_screen_name": "samccone", + "in_reply_to_user_id_str": "17198118" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949698253779382278" + ], + "editableUntil": "2018-01-06T18:44:42.898Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949674666049732608", + "id_str": "949698253779382278", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "949698253779382278", + "in_reply_to_status_id": "949674666049732608", + "created_at": "Sat Jan 06 17:44:42 +0000 2018", + "favorited": false, + "full_text": "@terronk A tuna of this size would require an enormous farm, tons of food, years to grow. I wonder if it's just fundamentally unsustainable.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949661632648458241" + ], + "editableUntil": "2018-01-06T16:19:11.740Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + }, + { + "name": "Adam Singer", + "screen_name": "AdamSinger", + "indices": [ + "14", + "25" + ], + "id_str": "14031032", + "id": "14031032" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "44" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949660749948792832", + "id_str": "949661632648458241", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "949661632648458241", + "in_reply_to_status_id": "949660749948792832", + "created_at": "Sat Jan 06 15:19:11 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait @AdamSinger Dam, I already do.", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949660438819618816" + ], + "editableUntil": "2018-01-06T16:14:27.109Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + }, + { + "name": "Adam Singer", + "screen_name": "AdamSinger", + "indices": [ + "14", + "25" + ], + "id_str": "14031032", + "id": "14031032" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "62" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949659293090947072", + "id_str": "949660438819618816", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "949660438819618816", + "in_reply_to_status_id": "949659293090947072", + "created_at": "Sat Jan 06 15:14:27 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait @AdamSinger Look, you can't buck this trend now.", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949659115516669953" + ], + "editableUntil": "2018-01-06T16:09:11.609Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + }, + { + "name": "Adam Singer", + "screen_name": "AdamSinger", + "indices": [ + "14", + "25" + ], + "id_str": "14031032", + "id": "14031032" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "92" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949658055922278400", + "id_str": "949659115516669953", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "949659115516669953", + "in_reply_to_status_id": "949658055922278400", + "created_at": "Sat Jan 06 15:09:11 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait @AdamSinger Don't worry about it, if I was annoyed I would have bridled at it.", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949657702740910081" + ], + "editableUntil": "2018-01-06T16:03:34.777Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + }, + { + "name": "Adam Singer", + "screen_name": "AdamSinger", + "indices": [ + "14", + "25" + ], + "id_str": "14031032", + "id": "14031032" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "40" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949656837304958979", + "id_str": "949657702740910081", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "949657702740910081", + "in_reply_to_status_id": "949656837304958979", + "created_at": "Sat Jan 06 15:03:34 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait @AdamSinger I canter even.", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949656721059753984" + ], + "editableUntil": "2018-01-06T15:59:40.726Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + }, + { + "name": "Adam Singer", + "screen_name": "AdamSinger", + "indices": [ + "14", + "25" + ], + "id_str": "14031032", + "id": "14031032" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949656238421192704", + "id_str": "949656721059753984", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "949656721059753984", + "in_reply_to_status_id": "949656238421192704", + "created_at": "Sat Jan 06 14:59:40 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait @AdamSinger Whoa there.", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949656635009515520" + ], + "editableUntil": "2018-01-06T15:59:20.210Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "101" + ], + "favorite_count": "51", + "id_str": "949656635009515520", + "truncated": false, + "retweet_count": "2", + "id": "949656635009515520", + "created_at": "Sat Jan 06 14:59:20 +0000 2018", + "favorited": false, + "full_text": "Nothing says \"like, really smart\" like being unable to come up with an adjective meaning \"extremely\".", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949656157576093696" + ], + "editableUntil": "2018-01-06T15:57:26.381Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@cowperthwait@sfba.social", + "screen_name": "cowperthwait", + "indices": [ + "0", + "13" + ], + "id_str": "15583257", + "id": "15583257" + }, + { + "name": "Adam Singer", + "screen_name": "AdamSinger", + "indices": [ + "14", + "25" + ], + "id_str": "14031032", + "id": "14031032" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "57" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949655846077718528", + "id_str": "949656157576093696", + "in_reply_to_user_id": "15583257", + "truncated": false, + "retweet_count": "0", + "id": "949656157576093696", + "in_reply_to_status_id": "949655846077718528", + "created_at": "Sat Jan 06 14:57:26 +0000 2018", + "favorited": false, + "full_text": "@cowperthwait @AdamSinger It's time to rein this in, Jon.", + "lang": "en", + "in_reply_to_screen_name": "cowperthwait", + "in_reply_to_user_id_str": "15583257" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949653889485127681" + ], + "editableUntil": "2018-01-06T15:48:25.626Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "42" + ], + "favorite_count": "58", + "id_str": "949653889485127681", + "truncated": false, + "retweet_count": "0", + "id": "949653889485127681", + "created_at": "Sat Jan 06 14:48:25 +0000 2018", + "favorited": false, + "full_text": "I regret to inform you that the president.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949649580022382592" + ], + "editableUntil": "2018-01-06T15:31:18.170Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Donald J. Trump", + "screen_name": "realDonaldTrump", + "indices": [ + "0", + "16" + ], + "id_str": "25073877", + "id": "25073877" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "89" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949619270631256064", + "id_str": "949649580022382592", + "in_reply_to_user_id": "25073877", + "truncated": false, + "retweet_count": "0", + "id": "949649580022382592", + "in_reply_to_status_id": "949619270631256064", + "created_at": "Sat Jan 06 14:31:18 +0000 2018", + "favorited": false, + "full_text": "@realDonaldTrump It wasn't your first try, you've been trying to get nominated for years.", + "lang": "en", + "in_reply_to_screen_name": "realDonaldTrump", + "in_reply_to_user_id_str": "25073877" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949649300220346368" + ], + "editableUntil": "2018-01-06T15:30:11.460Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Donald J. Trump", + "screen_name": "realDonaldTrump", + "indices": [ + "0", + "16" + ], + "id_str": "25073877", + "id": "25073877" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "949616329463615489", + "id_str": "949649300220346368", + "in_reply_to_user_id": "25073877", + "truncated": false, + "retweet_count": "0", + "id": "949649300220346368", + "in_reply_to_status_id": "949616329463615489", + "created_at": "Sat Jan 06 14:30:11 +0000 2018", + "favorited": false, + "full_text": "@realDonaldTrump Proven by who, when? That's not proven at all. There's tons of evidence your campaign collaborated with Russia.", + "lang": "en", + "in_reply_to_screen_name": "realDonaldTrump", + "in_reply_to_user_id_str": "25073877" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949544738012545025" + ], + "editableUntil": "2018-01-06T08:34:41.887Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "keith kurson", + "screen_name": "keithkurson", + "indices": [ + "0", + "12" + ], + "id_str": "3285511", + "id": "3285511" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "47" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "949544627215876097", + "id_str": "949544738012545025", + "in_reply_to_user_id": "3285511", + "truncated": false, + "retweet_count": "0", + "id": "949544738012545025", + "in_reply_to_status_id": "949544627215876097", + "created_at": "Sat Jan 06 07:34:41 +0000 2018", + "favorited": false, + "full_text": "@keithkurson Stop negating my self-image Keith.", + "lang": "en", + "in_reply_to_screen_name": "keithkurson", + "in_reply_to_user_id_str": "3285511" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949544110108557312" + ], + "editableUntil": "2018-01-06T08:32:12.183Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949544110108557312/photo/1", + "indices": [ + "12", + "35" + ], + "url": "https://t.co/ETpv8ZEtJS", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DS11UAmU0AMZ9cO.jpg", + "id_str": "949544083063623683", + "id": "949544083063623683", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DS11UAmU0AMZ9cO.jpg", + "sizes": { + "small": { + "w": "500", + "h": "204", + "resize": "fit" + }, + "medium": { + "w": "500", + "h": "204", + "resize": "fit" + }, + "large": { + "w": "500", + "h": "204", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/ETpv8ZEtJS" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "25", + "in_reply_to_status_id_str": "949544063056752640", + "id_str": "949544110108557312", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949544110108557312", + "in_reply_to_status_id": "949544063056752640", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 07:32:12 +0000 2018", + "favorited": false, + "full_text": "Me in 2018: https://t.co/ETpv8ZEtJS", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949544110108557312/photo/1", + "indices": [ + "12", + "35" + ], + "url": "https://t.co/ETpv8ZEtJS", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DS11UAmU0AMZ9cO.jpg", + "id_str": "949544083063623683", + "video_info": { + "aspect_ratio": [ + "125", + "51" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DS11UAmU0AMZ9cO.mp4" + } + ] + }, + "id": "949544083063623683", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DS11UAmU0AMZ9cO.jpg", + "sizes": { + "small": { + "w": "500", + "h": "204", + "resize": "fit" + }, + "medium": { + "w": "500", + "h": "204", + "resize": "fit" + }, + "large": { + "w": "500", + "h": "204", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "animated_gif", + "display_url": "pic.twitter.com/ETpv8ZEtJS" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949544063056752640" + ], + "editableUntil": "2018-01-06T08:32:00.965Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949544063056752640/photo/1", + "indices": [ + "12", + "35" + ], + "url": "https://t.co/PUMO1bnn2L", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DS11RLFVoAE3e3F.jpg", + "id_str": "949544034338447361", + "id": "949544034338447361", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DS11RLFVoAE3e3F.jpg", + "sizes": { + "medium": { + "w": "500", + "h": "214", + "resize": "fit" + }, + "small": { + "w": "500", + "h": "214", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "500", + "h": "214", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/PUMO1bnn2L" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "35" + ], + "favorite_count": "17", + "id_str": "949544063056752640", + "truncated": false, + "retweet_count": "0", + "id": "949544063056752640", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 07:32:00 +0000 2018", + "favorited": false, + "full_text": "Me in 2017: https://t.co/PUMO1bnn2L", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949544063056752640/photo/1", + "indices": [ + "12", + "35" + ], + "url": "https://t.co/PUMO1bnn2L", + "media_url": "http://pbs.twimg.com/tweet_video_thumb/DS11RLFVoAE3e3F.jpg", + "id_str": "949544034338447361", + "video_info": { + "aspect_ratio": [ + "250", + "107" + ], + "variants": [ + { + "bitrate": "0", + "content_type": "video/mp4", + "url": "https://video.twimg.com/tweet_video/DS11RLFVoAE3e3F.mp4" + } + ] + }, + "id": "949544034338447361", + "media_url_https": "https://pbs.twimg.com/tweet_video_thumb/DS11RLFVoAE3e3F.jpg", + "sizes": { + "medium": { + "w": "500", + "h": "214", + "resize": "fit" + }, + "small": { + "w": "500", + "h": "214", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "500", + "h": "214", + "resize": "fit" + } + }, + "type": "animated_gif", + "display_url": "pic.twitter.com/PUMO1bnn2L" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949525777061564424" + ], + "editableUntil": "2018-01-06T07:19:21.244Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🏳️🌈 Sam Kimbrel | @skimbrel@tech.lgbt", + "screen_name": "skimbrel", + "indices": [ + "0", + "9" + ], + "id_str": "17934129", + "id": "17934129" + }, + { + "name": "Ceej \"oh well\" Silverio", + "screen_name": "ceejbot", + "indices": [ + "10", + "18" + ], + "id_str": "78663", + "id": "78663" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "119" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949525329961402369", + "id_str": "949525777061564424", + "in_reply_to_user_id": "17934129", + "truncated": false, + "retweet_count": "0", + "id": "949525777061564424", + "in_reply_to_status_id": "949525329961402369", + "created_at": "Sat Jan 06 06:19:21 +0000 2018", + "favorited": false, + "full_text": "@skimbrel @ceejbot It's quite readable if you enjoy gossip that makes Trump look like an idiot and I most certainly do.", + "lang": "en", + "in_reply_to_screen_name": "skimbrel", + "in_reply_to_user_id_str": "17934129" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949520967541211136" + ], + "editableUntil": "2018-01-06T07:00:14.565Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "not here anymore / @besha@goblin.camp", + "screen_name": "besha", + "indices": [ + "0", + "6" + ], + "id_str": "14270043", + "id": "14270043" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "22" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949520788834598912", + "id_str": "949520967541211136", + "in_reply_to_user_id": "14270043", + "truncated": false, + "retweet_count": "0", + "id": "949520967541211136", + "in_reply_to_status_id": "949520788834598912", + "created_at": "Sat Jan 06 06:00:14 +0000 2018", + "favorited": false, + "full_text": "@besha It me every day", + "lang": "en", + "in_reply_to_screen_name": "besha", + "in_reply_to_user_id_str": "14270043" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949515645263253510" + ], + "editableUntil": "2018-01-06T06:39:05.635Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rat king 🐀", + "screen_name": "MikeIsaac", + "indices": [ + "0", + "10" + ], + "id_str": "19040598", + "id": "19040598" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "70" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "949515345169039360", + "id_str": "949515645263253510", + "in_reply_to_user_id": "19040598", + "truncated": false, + "retweet_count": "0", + "id": "949515645263253510", + "in_reply_to_status_id": "949515345169039360", + "created_at": "Sat Jan 06 05:39:05 +0000 2018", + "favorited": false, + "full_text": "@MikeIsaac I wish we would stop competing to be the best at bad ideas.", + "lang": "en", + "in_reply_to_screen_name": "MikeIsaac", + "in_reply_to_user_id_str": "19040598" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949515037923688448" + ], + "editableUntil": "2018-01-06T06:36:40.834Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rat king 🐀", + "screen_name": "MikeIsaac", + "indices": [ + "0", + "10" + ], + "id_str": "19040598", + "id": "19040598" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "79" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "949512069392433152", + "id_str": "949515037923688448", + "in_reply_to_user_id": "19040598", + "truncated": false, + "retweet_count": "0", + "id": "949515037923688448", + "in_reply_to_status_id": "949512069392433152", + "created_at": "Sat Jan 06 05:36:40 +0000 2018", + "favorited": false, + "full_text": "@MikeIsaac ...is there a need for a Coinbase competitor? Do we need that thing?", + "lang": "en", + "in_reply_to_screen_name": "MikeIsaac", + "in_reply_to_user_id_str": "19040598" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949514437169500160" + ], + "editableUntil": "2018-01-06T06:34:17.603Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kassian Wren", + "screen_name": "nodebotanist", + "indices": [ + "0", + "13" + ], + "id_str": "31204696", + "id": "31204696" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949513147479621632", + "id_str": "949514437169500160", + "in_reply_to_user_id": "31204696", + "truncated": false, + "retweet_count": "0", + "id": "949514437169500160", + "in_reply_to_status_id": "949513147479621632", + "created_at": "Sat Jan 06 05:34:17 +0000 2018", + "favorited": false, + "full_text": "@nodebotanist Programming! *laugh track, theme music plays*", + "lang": "en", + "in_reply_to_screen_name": "nodebotanist", + "in_reply_to_user_id_str": "31204696" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949512695065317376" + ], + "editableUntil": "2018-01-06T06:27:22.253Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "is_author_jack", + "screen_name": "developerjack", + "indices": [ + "0", + "14" + ], + "id_str": "969275161", + "id": "969275161" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949451992614649856", + "id_str": "949512695065317376", + "in_reply_to_user_id": "969275161", + "truncated": false, + "retweet_count": "0", + "id": "949512695065317376", + "in_reply_to_status_id": "949451992614649856", + "created_at": "Sat Jan 06 05:27:22 +0000 2018", + "favorited": false, + "full_text": "@developerjack They have a monopoly on routes in the Caribbean :-(", + "lang": "en", + "in_reply_to_screen_name": "developerjack", + "in_reply_to_user_id_str": "969275161" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949512484267986944" + ], + "editableUntil": "2018-01-06T06:26:31.995Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "85" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949511609369669637", + "id_str": "949512484267986944", + "in_reply_to_user_id": "2198738964", + "truncated": false, + "retweet_count": "0", + "id": "949512484267986944", + "in_reply_to_status_id": "949511609369669637", + "created_at": "Sat Jan 06 05:26:31 +0000 2018", + "favorited": false, + "full_text": "@_ugotsoul For a political book being loudly denounced is better than an ad campaign.", + "lang": "en", + "in_reply_to_screen_name": "u_got_soul", + "in_reply_to_user_id_str": "2198738964" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949510138771189760" + ], + "editableUntil": "2018-01-06T06:17:12.785Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/w9OsdDGY2S", + "expanded_url": "https://twitter.com/realdonaldtrump/status/949498795074736129", + "display_url": "twitter.com/realdonaldtrum…", + "indices": [ + "44", + "67" + ] + } + ] + }, + "display_text_range": [ + "0", + "67" + ], + "favorite_count": "40", + "id_str": "949510138771189760", + "truncated": false, + "retweet_count": "3", + "id": "949510138771189760", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 05:17:12 +0000 2018", + "favorited": false, + "full_text": "This book is going to sell infinity copies. https://t.co/w9OsdDGY2S", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949510129828888576" + ], + "editableUntil": "2018-01-06T06:17:10.653Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zeke Sikelianos", + "screen_name": "zeke", + "indices": [ + "0", + "5" + ], + "id_str": "2157621", + "id": "2157621" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "10" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949499914844758016", + "id_str": "949510129828888576", + "in_reply_to_user_id": "2157621", + "truncated": false, + "retweet_count": "0", + "id": "949510129828888576", + "in_reply_to_status_id": "949499914844758016", + "created_at": "Sat Jan 06 05:17:10 +0000 2018", + "favorited": false, + "full_text": "@zeke CJ 🙂", + "lang": "und", + "in_reply_to_screen_name": "zeke", + "in_reply_to_user_id_str": "2157621" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949466726240018432" + ], + "editableUntil": "2018-01-06T03:24:42.431Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "203" + ], + "favorite_count": "12", + "in_reply_to_status_id_str": "949464483218550785", + "id_str": "949466726240018432", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949466726240018432", + "in_reply_to_status_id": "949464483218550785", + "created_at": "Sat Jan 06 02:24:42 +0000 2018", + "favorited": false, + "full_text": "Policy making with Trump was “like trying to figure out what a child wants”. People would make policies, show them to Trump and see if he liked them, then convince him he’d come up with the idea himself.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949464483218550785" + ], + "editableUntil": "2018-01-06T03:15:47.653Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "238" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "949458087982829568", + "id_str": "949464483218550785", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949464483218550785", + "in_reply_to_status_id": "949458087982829568", + "created_at": "Sat Jan 06 02:15:47 +0000 2018", + "favorited": false, + "full_text": "“Everybody strove to be in every meeting ... Bannon invariably round some reason to study papers in the corner ... Priebus kept his eye on Bannon; Kushner kept his eye on both.” Hicks, Conway and Omarosa were also in nearly every meeting.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949458087982829568" + ], + "editableUntil": "2018-01-06T02:50:22.910Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "76" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "949457333289209858", + "id_str": "949458087982829568", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949458087982829568", + "in_reply_to_status_id": "949457333289209858", + "created_at": "Sat Jan 06 01:50:22 +0000 2018", + "favorited": false, + "full_text": "Trump on how the media is unfair to him: “my exaggerations are exaggerated.”", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949457333289209858" + ], + "editableUntil": "2018-01-06T02:47:22.977Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "246" + ], + "favorite_count": "31", + "in_reply_to_status_id_str": "949445786483425282", + "id_str": "949457333289209858", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949457333289209858", + "in_reply_to_status_id": "949445786483425282", + "created_at": "Sat Jan 06 01:47:22 +0000 2018", + "favorited": false, + "full_text": "The book makes pretty interesting case that the media’s obsession with taking down Trump is partly driven by self-loathing that they created him in the first place. It’s a surprisingly nuanced take given the gossipy tenor of the rest of the book.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949456763484606465" + ], + "editableUntil": "2018-01-06T02:45:07.125Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Daniel Bond", + "screen_name": "danielwbond", + "indices": [ + "0", + "12" + ], + "id_str": "2437305636", + "id": "2437305636" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "39" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949451797868920832", + "id_str": "949456763484606465", + "in_reply_to_user_id": "2437305636", + "truncated": false, + "retweet_count": "0", + "id": "949456763484606465", + "in_reply_to_status_id": "949451797868920832", + "created_at": "Sat Jan 06 01:45:07 +0000 2018", + "favorited": false, + "full_text": "@danielwbond I took a break for dinner.", + "lang": "en", + "in_reply_to_screen_name": "danielwbond", + "in_reply_to_user_id_str": "2437305636" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949451749152251904" + ], + "editableUntil": "2018-01-06T02:25:11.615Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "33" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949451359690088448", + "id_str": "949451749152251904", + "in_reply_to_user_id": "14789935", + "truncated": false, + "retweet_count": "0", + "id": "949451749152251904", + "in_reply_to_status_id": "949451359690088448", + "created_at": "Sat Jan 06 01:25:11 +0000 2018", + "favorited": false, + "full_text": "@brkattk No this is just a thing.", + "lang": "en", + "in_reply_to_screen_name": "erkattak", + "in_reply_to_user_id_str": "14789935" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949451551717953536" + ], + "editableUntil": "2018-01-06T02:24:24.543Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Patriotic Vet Meagan", + "screen_name": "1981meagan", + "indices": [ + "0", + "11" + ], + "id_str": "26657087", + "id": "26657087" + }, + { + "name": "Rain_nxght", + "screen_name": "NxghtRain", + "indices": [ + "12", + "22" + ], + "id_str": "1434550318805577731", + "id": "1434550318805577731" + }, + { + "name": "Target", + "screen_name": "Target", + "indices": [ + "23", + "30" + ], + "id_str": "89084561", + "id": "89084561" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "83" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949333574846767104", + "id_str": "949451551717953536", + "in_reply_to_user_id": "26657087", + "truncated": false, + "retweet_count": "0", + "id": "949451551717953536", + "in_reply_to_status_id": "949333574846767104", + "created_at": "Sat Jan 06 01:24:24 +0000 2018", + "favorited": false, + "full_text": "@1981meagan @NxghTrain @Target Trans people exist, Megun. You can’t wish them away.", + "lang": "en", + "in_reply_to_screen_name": "1981meagan", + "in_reply_to_user_id_str": "26657087" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949450979388329985" + ], + "editableUntil": "2018-01-06T02:22:08.089Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "246" + ], + "favorite_count": "36", + "id_str": "949450979388329985", + "truncated": false, + "retweet_count": "1", + "id": "949450979388329985", + "created_at": "Sat Jan 06 01:22:08 +0000 2018", + "favorited": false, + "full_text": "A malignant growth hacker has been at work at American Airlines. There is an obnoxious, live informercial spoken by cabin crew for their credit card on every flight, and the seat-back screen runs a video ad before it will give you the flight map.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949445786483425282" + ], + "editableUntil": "2018-01-06T02:01:30.004Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "151" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "949445384912494592", + "id_str": "949445786483425282", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949445786483425282", + "in_reply_to_status_id": "949445384912494592", + "created_at": "Sat Jan 06 01:01:30 +0000 2018", + "favorited": false, + "full_text": "Trump’s bedroom has 3 tv screens and by 6.30 if he’s not having dinner with Steve Bannon he’s in bed with a cheeseburger making phone calls to friends.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949445384912494592" + ], + "editableUntil": "2018-01-06T01:59:54.262Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "136" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "949392504650194946", + "id_str": "949445384912494592", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949445384912494592", + "in_reply_to_status_id": "949392504650194946", + "created_at": "Sat Jan 06 00:59:54 +0000 2018", + "favorited": false, + "full_text": "The book portrays Jared as a rich kid supremely unaware of his own privilege, oblivious to how out of touch he is with the normal world.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949444958964068352" + ], + "editableUntil": "2018-01-06T01:58:12.708Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "@chaosmonster@mastodon.online (Martin)", + "screen_name": "chaos_monster", + "indices": [ + "12", + "26" + ], + "id_str": "268960747", + "id": "268960747" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949441934782742529", + "id_str": "949444958964068352", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "949444958964068352", + "in_reply_to_status_id": "949441934782742529", + "created_at": "Sat Jan 06 00:58:12 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @chaos_monster If you have some numbers on how many I would be interested to know.", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949441780658909185" + ], + "editableUntil": "2018-01-06T01:45:34.941Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + }, + { + "name": "Grindr", + "screen_name": "Grindr", + "indices": [ + "13", + "20" + ], + "id_str": "28549816", + "id": "28549816" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "65" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949441575444103168", + "id_str": "949441780658909185", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "949441780658909185", + "in_reply_to_status_id": "949441575444103168", + "created_at": "Sat Jan 06 00:45:34 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton @Grindr Wow, Grindr is a lot smaller than I thought.", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949441560562847744" + ], + "editableUntil": "2018-01-06T01:44:42.466Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zeke Sikelianos", + "screen_name": "zeke", + "indices": [ + "0", + "5" + ], + "id_str": "2157621", + "id": "2157621" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "63" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949440019206254593", + "id_str": "949441560562847744", + "in_reply_to_user_id": "2157621", + "truncated": false, + "retweet_count": "0", + "id": "949441560562847744", + "in_reply_to_status_id": "949440019206254593", + "created_at": "Sat Jan 06 00:44:42 +0000 2018", + "favorited": false, + "full_text": "@zeke I honestly can’t remember for sure, but I don’t think so.", + "lang": "en", + "in_reply_to_screen_name": "zeke", + "in_reply_to_user_id_str": "2157621" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949441386004262913" + ], + "editableUntil": "2018-01-06T01:44:00.848Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + }, + { + "name": "Grindr", + "screen_name": "Grindr", + "indices": [ + "13", + "20" + ], + "id_str": "28549816", + "id": "28549816" + } + ], + "urls": [ + { + "url": "https://t.co/VaIUcrALxQ", + "expanded_url": "https://www.advocate.com/love-and-sex/2016/3/17/chinese-gays-have-grindr-little-else", + "display_url": "advocate.com/love-and-sex/2…", + "indices": [ + "81", + "104" + ] + } + ] + }, + "display_text_range": [ + "0", + "104" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "949439450597113856", + "id_str": "949441386004262913", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "1", + "id": "949441386004262913", + "in_reply_to_status_id": "949439450597113856", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 00:44:00 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton @Grindr TIL Grindr is not even the biggest gay dating app in China: https://t.co/VaIUcrALxQ", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949439249698476032" + ], + "editableUntil": "2018-01-06T01:35:31.513Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + }, + { + "name": "Grindr", + "screen_name": "Grindr", + "indices": [ + "13", + "20" + ], + "id_str": "28549816", + "id": "28549816" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "70" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "949438480379101185", + "id_str": "949439249698476032", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "949439249698476032", + "in_reply_to_status_id": "949438480379101185", + "created_at": "Sat Jan 06 00:35:31 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton @Grindr This was and continues to be such a strange deal.", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949438954645966850" + ], + "editableUntil": "2018-01-06T01:34:21.167Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/2k5B18BEXt", + "expanded_url": "https://twitter.com/tompodolec/status/949429223642554371", + "display_url": "twitter.com/tompodolec/sta…", + "indices": [ + "7", + "30" + ] + } + ] + }, + "display_text_range": [ + "0", + "30" + ], + "favorite_count": "5", + "id_str": "949438954645966850", + "truncated": false, + "retweet_count": "0", + "id": "949438954645966850", + "possibly_sensitive": false, + "created_at": "Sat Jan 06 00:34:21 +0000 2018", + "favorited": false, + "full_text": "Yikes. https://t.co/2k5B18BEXt", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949437415529250816" + ], + "editableUntil": "2018-01-06T01:28:14.213Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "BenEncodes", + "screen_name": "BenEncodes", + "indices": [ + "0", + "11" + ], + "id_str": "1065837607735545857", + "id": "1065837607735545857" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "27" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949436313064783872", + "id_str": "949437415529250816", + "in_reply_to_user_id": "154189594", + "truncated": false, + "retweet_count": "0", + "id": "949437415529250816", + "in_reply_to_status_id": "949436313064783872", + "created_at": "Sat Jan 06 00:28:14 +0000 2018", + "favorited": false, + "full_text": "@BenEncodes Get his number.", + "lang": "en", + "in_reply_to_screen_name": "tandemNuclei", + "in_reply_to_user_id_str": "154189594" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949429322208759813" + ], + "editableUntil": "2018-01-06T00:56:04.615Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "11", + "22" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "23", + "29" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "210" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949425628599562240", + "id_str": "949429322208759813", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "949429322208759813", + "in_reply_to_status_id": "949425628599562240", + "created_at": "Fri Jan 05 23:56:04 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @jeffbcross @npmjs From a glance at the numbers for the ng2 package I think the size will increase but the trend will probably be unchanged, FYI. I need to plug the numbers into the graph to be sure.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949428537634820096" + ], + "editableUntil": "2018-01-06T00:52:57.558Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sam Pullara", + "screen_name": "sampullara", + "indices": [ + "0", + "11" + ], + "id_str": "668473", + "id": "668473" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "18" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949425032744255488", + "id_str": "949428537634820096", + "in_reply_to_user_id": "668473", + "truncated": false, + "retweet_count": "0", + "id": "949428537634820096", + "in_reply_to_status_id": "949425032744255488", + "created_at": "Fri Jan 05 23:52:57 +0000 2018", + "favorited": false, + "full_text": "@sampullara Oh my.", + "lang": "en", + "in_reply_to_screen_name": "sampullara", + "in_reply_to_user_id_str": "668473" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949421926207934465" + ], + "editableUntil": "2018-01-06T00:26:41.271Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Igor Minar", + "screen_name": "IgorMinar", + "indices": [ + "0", + "10" + ], + "id_str": "8300112", + "id": "8300112" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "11", + "22" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "23", + "29" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "98" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949418685747183616", + "id_str": "949421926207934465", + "in_reply_to_user_id": "8300112", + "truncated": false, + "retweet_count": "0", + "id": "949421926207934465", + "in_reply_to_status_id": "949418685747183616", + "created_at": "Fri Jan 05 23:26:41 +0000 2018", + "favorited": false, + "full_text": "@IgorMinar @jeffbcross @npmjs I’m about to be on a plane for six hours but I’ll see what I can do.", + "lang": "en", + "in_reply_to_screen_name": "IgorMinar", + "in_reply_to_user_id_str": "8300112" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949396196329738240" + ], + "editableUntil": "2018-01-05T22:44:26.790Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@schuyler@metasocial.com", + "screen_name": "schuyler", + "indices": [ + "0", + "9" + ], + "id_str": "745213", + "id": "745213" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949378979584139264", + "id_str": "949396196329738240", + "in_reply_to_user_id": "745213", + "truncated": false, + "retweet_count": "0", + "id": "949396196329738240", + "in_reply_to_status_id": "949378979584139264", + "created_at": "Fri Jan 05 21:44:26 +0000 2018", + "favorited": false, + "full_text": "@schuyler In fairness it was never able to do that.", + "lang": "en", + "in_reply_to_screen_name": "schuyler", + "in_reply_to_user_id_str": "745213" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949392504650194946" + ], + "editableUntil": "2018-01-05T22:29:46.625Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "194" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "949372290965393409", + "id_str": "949392504650194946", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949392504650194946", + "in_reply_to_status_id": "949372290965393409", + "created_at": "Fri Jan 05 21:29:46 +0000 2018", + "favorited": false, + "full_text": "A former competitor on Bannon: \"He's mean, dishonest, and incapable of caring about other people. His eyes dart around like he's always looking for a weapon with which to bludgeon or gouge you.\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949385988685664256" + ], + "editableUntil": "2018-01-05T22:03:53.098Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Allie Richards", + "screen_name": "hpuxgirl", + "indices": [ + "0", + "9" + ], + "id_str": "712444010950832128", + "id": "712444010950832128" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "23" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949385837111889920", + "id_str": "949385988685664256", + "in_reply_to_user_id": "712444010950832128", + "truncated": false, + "retweet_count": "0", + "id": "949385988685664256", + "in_reply_to_status_id": "949385837111889920", + "created_at": "Fri Jan 05 21:03:53 +0000 2018", + "favorited": false, + "full_text": "@hpuxgirl It really is!", + "lang": "en", + "in_reply_to_screen_name": "hpuxgirl", + "in_reply_to_user_id_str": "712444010950832128" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949385096599101441" + ], + "editableUntil": "2018-01-05T22:00:20.408Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "", + "screen_name": "mspowahs", + "indices": [ + "3", + "12" + ], + "id_str": "-1", + "id": "-1" + } + ], + "urls": [ + { + "url": "https://t.co/7lNrn04mhC", + "expanded_url": "https://twitter.com/JennMUA/status/949050453974814720", + "display_url": "twitter.com/JennMUA/status…", + "indices": [ + "71", + "94" + ] + } + ] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "0", + "id_str": "949385096599101441", + "truncated": false, + "retweet_count": "0", + "id": "949385096599101441", + "possibly_sensitive": false, + "created_at": "Fri Jan 05 21:00:20 +0000 2018", + "favorited": false, + "full_text": "RT @mspowahs: Pictured: the difference between diversity and inclusion https://t.co/7lNrn04mhC", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949379707086262272" + ], + "editableUntil": "2018-01-05T21:38:55.448Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Shlomi Ben Haim", + "screen_name": "ShlomiBenHaim", + "indices": [ + "0", + "14" + ], + "id_str": "41995246", + "id": "41995246" + }, + { + "name": "JBaruch 🎩", + "screen_name": "jbaruch", + "indices": [ + "15", + "23" + ], + "id_str": "16887172", + "id": "16887172" + }, + { + "name": "@chaosmonster@mastodon.online (Martin)", + "screen_name": "chaos_monster", + "indices": [ + "24", + "38" + ], + "id_str": "268960747", + "id": "268960747" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "109" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949378481871179776", + "id_str": "949379707086262272", + "in_reply_to_user_id": "41995246", + "truncated": false, + "retweet_count": "0", + "id": "949379707086262272", + "in_reply_to_status_id": "949378481871179776", + "created_at": "Fri Jan 05 20:38:55 +0000 2018", + "favorited": false, + "full_text": "@ShlomiBenHaim @jbaruch @chaos_monster Well then I sincerely apologize, we remember that meeting differently.", + "lang": "en", + "in_reply_to_screen_name": "ShlomiBenHaim", + "in_reply_to_user_id_str": "41995246" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949376136135561217" + ], + "editableUntil": "2018-01-05T21:24:44.067Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@aaronfriel@hachyderm.io", + "screen_name": "AaronFriel", + "indices": [ + "0", + "11" + ], + "id_str": "184674078", + "id": "184674078" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "50" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949375560114896897", + "id_str": "949376136135561217", + "in_reply_to_user_id": "184674078", + "truncated": false, + "retweet_count": "0", + "id": "949376136135561217", + "in_reply_to_status_id": "949375560114896897", + "created_at": "Fri Jan 05 20:24:44 +0000 2018", + "favorited": false, + "full_text": "@AaronFriel You are quite close on the second one.", + "lang": "en", + "in_reply_to_screen_name": "AaronFriel", + "in_reply_to_user_id_str": "184674078" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949372290965393409" + ], + "editableUntil": "2018-01-05T21:09:27.307Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "29", + "in_reply_to_status_id_str": "949370019816886272", + "id_str": "949372290965393409", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "949372290965393409", + "in_reply_to_status_id": "949370019816886272", + "created_at": "Fri Jan 05 20:09:27 +0000 2018", + "favorited": false, + "full_text": "I don't often run into new words but this book has taught me two: \"hortatory\" and \"myrmidons\".", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949370019816886272" + ], + "editableUntil": "2018-01-05T21:00:25.823Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "230" + ], + "favorite_count": "23", + "in_reply_to_status_id_str": "949368643636342784", + "id_str": "949370019816886272", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949370019816886272", + "in_reply_to_status_id": "949368643636342784", + "created_at": "Fri Jan 05 20:00:25 +0000 2018", + "favorited": false, + "full_text": "\"If you fuck with the intel community,\" a senior republican warned Kushner, \"they will figure out a way to get back at you and you'll have two or three years of a Russian investigation, and every day something else will leak out.\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949368643636342784" + ], + "editableUntil": "2018-01-05T20:54:57.716Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/68VS8vNWy2", + "expanded_url": "http://nymag.com/daily/intelligencer/2018/01/michael-wolff-fire-and-fury-book-donald-trump.html", + "display_url": "nymag.com/daily/intellig…", + "indices": [ + "91", + "114" + ] + } + ] + }, + "display_text_range": [ + "0", + "114" + ], + "favorite_count": "16", + "in_reply_to_status_id_str": "949359711010414593", + "id_str": "949368643636342784", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "949368643636342784", + "in_reply_to_status_id": "949359711010414593", + "possibly_sensitive": false, + "created_at": "Fri Jan 05 19:54:57 +0000 2018", + "favorited": false, + "full_text": "A huge chunk of the best parts of this book are all in this article that I read yesterday: https://t.co/68VS8vNWy2", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949359711010414593" + ], + "editableUntil": "2018-01-05T20:19:28.012Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "238" + ], + "favorite_count": "21", + "in_reply_to_status_id_str": "949357052240986112", + "id_str": "949359711010414593", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "949359711010414593", + "in_reply_to_status_id": "949357052240986112", + "created_at": "Fri Jan 05 19:19:28 +0000 2018", + "favorited": false, + "full_text": "Trump attempts to persuade a friend and his model date to visit Atlantic City. The friend says Atlantic City is overrun by white trash.\n\"What is this 'white trash'?\" asks the model.\nTrump: \"They're people just like me, only they're poor.\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949357052240986112" + ], + "editableUntil": "2018-01-05T20:08:54.112Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "257" + ], + "favorite_count": "22", + "in_reply_to_status_id_str": "949343323759751168", + "id_str": "949357052240986112", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "5", + "id": "949357052240986112", + "in_reply_to_status_id": "949343323759751168", + "created_at": "Fri Jan 05 19:08:54 +0000 2018", + "favorited": false, + "full_text": "First insight: the reason they were so dirty -- money from Russia, no tax returns, nobody vetted -- is because they never thought they were going to win. None of that stuff was a problem because it was a Potemkin campaign right up until the moment they won.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949349515131346946" + ], + "editableUntil": "2018-01-05T19:38:57.125Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rat king 🐀", + "screen_name": "MikeIsaac", + "indices": [ + "0", + "10" + ], + "id_str": "19040598", + "id": "19040598" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "54" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "949348722948808705", + "id_str": "949349515131346946", + "in_reply_to_user_id": "19040598", + "truncated": false, + "retweet_count": "0", + "id": "949349515131346946", + "in_reply_to_status_id": "949348722948808705", + "created_at": "Fri Jan 05 18:38:57 +0000 2018", + "favorited": false, + "full_text": "@MikeIsaac I'm still gonna live tweet the book though.", + "lang": "en", + "in_reply_to_screen_name": "MikeIsaac", + "in_reply_to_user_id_str": "19040598" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949343323759751168" + ], + "editableUntil": "2018-01-05T19:14:20.987Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "195" + ], + "favorite_count": "36", + "in_reply_to_status_id_str": "949342507049078786", + "id_str": "949343323759751168", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "949343323759751168", + "in_reply_to_status_id": "949342507049078786", + "created_at": "Fri Jan 05 18:14:20 +0000 2018", + "favorited": false, + "full_text": "The magnitude of the fuckup the Trump administration made here can't be overstated. He treated every conversation as being on the record unless otherwise stated, and they never bothered to state.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949342507049078786" + ], + "editableUntil": "2018-01-05T19:11:06.268Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "263" + ], + "favorite_count": "69", + "in_reply_to_status_id_str": "949341884996079617", + "id_str": "949342507049078786", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "7", + "id": "949342507049078786", + "in_reply_to_status_id": "949341884996079617", + "created_at": "Fri Jan 05 18:11:06 +0000 2018", + "favorited": false, + "full_text": "Author's note, paraphrased: \"The White House was too disorganized to notice that I didn't really have permission to be there. Nobody remembered to lay down rules about what I could write, but everybody thought somebody else had, so they all spoke with no filter.\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949341884996079617" + ], + "editableUntil": "2018-01-05T19:08:37.959Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "157" + ], + "favorite_count": "64", + "in_reply_to_status_id_str": "949337475369132033", + "id_str": "949341884996079617", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "3", + "id": "949341884996079617", + "in_reply_to_status_id": "949337475369132033", + "created_at": "Fri Jan 05 18:08:37 +0000 2018", + "favorited": false, + "full_text": "Oh you bet your ass I am live tweeting this book I am trapped in an airport with literally nothing better to do. Mute this thread or forever hold your peace.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949341548080238593" + ], + "editableUntil": "2018-01-05T19:07:17.632Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Josh Thomas @ ChainReact", + "screen_name": "jthoms1", + "indices": [ + "0", + "8" + ], + "id_str": "15965108", + "id": "15965108" + }, + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "9", + "20" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "21", + "27" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "162" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949338942737920001", + "id_str": "949341548080238593", + "in_reply_to_user_id": "15965108", + "truncated": false, + "retweet_count": "0", + "id": "949341548080238593", + "in_reply_to_status_id": "949338942737920001", + "created_at": "Fri Jan 05 18:07:17 +0000 2018", + "favorited": false, + "full_text": "@jthoms1 @jeffbcross @npmjs Yes. Because every library is getting bigger in absolute terms, absolute growth is less meaningful in determining relative popularity.", + "lang": "en", + "in_reply_to_screen_name": "jthoms1", + "in_reply_to_user_id_str": "15965108" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949337957546319877" + ], + "editableUntil": "2018-01-05T18:53:01.582Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "12", + "18" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "190" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949336829706186752", + "id_str": "949337957546319877", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "949337957546319877", + "in_reply_to_status_id": "949336829706186752", + "created_at": "Fri Jan 05 17:53:01 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @npmjs That seems very much in line with my numbers. Share of registry is a metric it's taking everyone a while to get their head around. All absolute numbers go up all the time.", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949337475369132033" + ], + "editableUntil": "2018-01-05T18:51:06.622Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "91" + ], + "favorite_count": "126", + "id_str": "949337475369132033", + "truncated": false, + "retweet_count": "9", + "id": "949337475369132033", + "created_at": "Fri Jan 05 17:51:06 +0000 2018", + "favorited": false, + "full_text": "I have a 5 hour layover and a piping hot copy of Fire and Fury on my kindle. Let's do this.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949335169617551360" + ], + "editableUntil": "2018-01-05T18:41:56.888Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "130" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "949332457156988928", + "id_str": "949335169617551360", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "949335169617551360", + "in_reply_to_status_id": "949332457156988928", + "created_at": "Fri Jan 05 17:41:56 +0000 2018", + "favorited": false, + "full_text": "One time my stuff went through the machine on a bootleg SecureTray and my luggage caught fire so I’m glad they’re locking it down.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949334841807593473" + ], + "editableUntil": "2018-01-05T18:40:38.732Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "117" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949333399738646531", + "id_str": "949334841807593473", + "in_reply_to_user_id": "102568309", + "truncated": false, + "retweet_count": "0", + "id": "949334841807593473", + "in_reply_to_status_id": "949333399738646531", + "created_at": "Fri Jan 05 17:40:38 +0000 2018", + "favorited": false, + "full_text": "@_austinfrey I’m sure it won’t be in the least controversial! What back end frameworks would you hope to see covered?", + "lang": "en", + "in_reply_to_user_id_str": "102568309" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949334627361189888" + ], + "editableUntil": "2018-01-05T18:39:47.604Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jeff Cross", + "screen_name": "jeffbcross", + "indices": [ + "0", + "11" + ], + "id_str": "16616694", + "id": "16616694" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "12", + "18" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "147" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "949322892294041601", + "id_str": "949334627361189888", + "in_reply_to_user_id": "16616694", + "truncated": false, + "retweet_count": "0", + "id": "949334627361189888", + "in_reply_to_status_id": "949322892294041601", + "created_at": "Fri Jan 05 17:39:47 +0000 2018", + "favorited": false, + "full_text": "@jeffbcross @npmjs Yes, somebody already pointed this out. It’s only angular 1; I will update it to include angular 2 when I am back from vacation.", + "lang": "en", + "in_reply_to_screen_name": "jeffbcross", + "in_reply_to_user_id_str": "16616694" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949332457156988928" + ], + "editableUntil": "2018-01-05T18:31:10.187Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949332457156988928/photo/1", + "indices": [ + "158", + "181" + ], + "url": "https://t.co/Npyl2ibpBf", + "media_url": "http://pbs.twimg.com/media/DSy01L9U8AAzute.jpg", + "id_str": "949332447304413184", + "id": "949332447304413184", + "media_url_https": "https://pbs.twimg.com/media/DSy01L9U8AAzute.jpg", + "sizes": { + "large": { + "w": "2048", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/Npyl2ibpBf" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "181" + ], + "favorite_count": "4", + "id_str": "949332457156988928", + "truncated": false, + "retweet_count": "0", + "id": "949332457156988928", + "possibly_sensitive": false, + "created_at": "Fri Jan 05 17:31:10 +0000 2018", + "favorited": false, + "full_text": "Rest easy, folks. The people who sell the government plastic trays to hold your stuff as it goes through the x-ray machine have registered it as a trademark. https://t.co/Npyl2ibpBf", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949332457156988928/photo/1", + "indices": [ + "158", + "181" + ], + "url": "https://t.co/Npyl2ibpBf", + "media_url": "http://pbs.twimg.com/media/DSy01L9U8AAzute.jpg", + "id_str": "949332447304413184", + "id": "949332447304413184", + "media_url_https": "https://pbs.twimg.com/media/DSy01L9U8AAzute.jpg", + "sizes": { + "large": { + "w": "2048", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/Npyl2ibpBf" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949328167898030080" + ], + "editableUntil": "2018-01-05T18:14:07.548Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JBaruch 🎩", + "screen_name": "jbaruch", + "indices": [ + "0", + "8" + ], + "id_str": "16887172", + "id": "16887172" + }, + { + "name": "@chaosmonster@mastodon.online (Martin)", + "screen_name": "chaos_monster", + "indices": [ + "9", + "23" + ], + "id_str": "268960747", + "id": "268960747" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "71" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949327799743004672", + "id_str": "949328167898030080", + "in_reply_to_user_id": "16887172", + "truncated": false, + "retweet_count": "0", + "id": "949328167898030080", + "in_reply_to_status_id": "949327799743004672", + "created_at": "Fri Jan 05 17:14:07 +0000 2018", + "favorited": false, + "full_text": "@jbaruch @chaos_monster I mean the CEO of jFrog, makers of Artifactory.", + "lang": "en", + "in_reply_to_screen_name": "jbaruch", + "in_reply_to_user_id_str": "16887172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949327968756752384" + ], + "editableUntil": "2018-01-05T18:13:20.069Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@RickyRomero@mstdn.social", + "screen_name": "RickyRomero", + "indices": [ + "0", + "12" + ], + "id_str": "6271872", + "id": "6271872" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "58" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949325116697067520", + "id_str": "949327968756752384", + "in_reply_to_user_id": "6271872", + "truncated": false, + "retweet_count": "0", + "id": "949327968756752384", + "in_reply_to_status_id": "949325116697067520", + "created_at": "Fri Jan 05 17:13:20 +0000 2018", + "favorited": false, + "full_text": "@RickyRomero I have applied! I may get it later this year.", + "lang": "en", + "in_reply_to_screen_name": "RickyRomero", + "in_reply_to_user_id_str": "6271872" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949324871657558016" + ], + "editableUntil": "2018-01-05T18:01:01.663Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Mikeal Rogers", + "screen_name": "mikeal", + "indices": [ + "3", + "10" + ], + "id_str": "668423", + "id": "668423" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "949324871657558016", + "truncated": false, + "retweet_count": "0", + "id": "949324871657558016", + "created_at": "Fri Jan 05 17:01:01 +0000 2018", + "favorited": false, + "full_text": "RT @mikeal: Ripple creating rumors to inflate their price would only make sense if each rumor made them millions of dollars because their t…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949320624081686528" + ], + "editableUntil": "2018-01-05T17:44:08.962Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "19" + ], + "favorite_count": "49", + "in_reply_to_status_id_str": "949308418933837824", + "id_str": "949320624081686528", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949320624081686528", + "in_reply_to_status_id": "949308418933837824", + "created_at": "Fri Jan 05 16:44:08 +0000 2018", + "favorited": false, + "full_text": "They let me in! 🎉🎉🎉", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949320276520644610" + ], + "editableUntil": "2018-01-05T17:42:46.097Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "JBaruch 🎩", + "screen_name": "jbaruch", + "indices": [ + "0", + "8" + ], + "id_str": "16887172", + "id": "16887172" + }, + { + "name": "@chaosmonster@mastodon.online (Martin)", + "screen_name": "chaos_monster", + "indices": [ + "9", + "23" + ], + "id_str": "268960747", + "id": "268960747" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "74" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949318530297556993", + "id_str": "949320276520644610", + "in_reply_to_user_id": "16887172", + "truncated": false, + "retweet_count": "0", + "id": "949320276520644610", + "in_reply_to_status_id": "949318530297556993", + "created_at": "Fri Jan 05 16:42:46 +0000 2018", + "favorited": false, + "full_text": "@jbaruch @chaos_monster We met with the CEO of Artifactory and he told us.", + "lang": "en", + "in_reply_to_screen_name": "jbaruch", + "in_reply_to_user_id_str": "16887172" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949319666534625280" + ], + "editableUntil": "2018-01-05T17:40:20.665Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949315964687998978", + "id_str": "949319666534625280", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "949319666534625280", + "in_reply_to_status_id": "949315964687998978", + "created_at": "Fri Jan 05 16:40:20 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton A dangerous combination.", + "lang": "fr", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949310990843301888" + ], + "editableUntil": "2018-01-05T17:05:52.219Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "michael", + "screen_name": "mpchlets", + "indices": [ + "0", + "9" + ], + "id_str": "1170686755", + "id": "1170686755" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949310367154475008", + "id_str": "949310990843301888", + "in_reply_to_user_id": "1170686755", + "truncated": false, + "retweet_count": "0", + "id": "949310990843301888", + "in_reply_to_status_id": "949310367154475008", + "created_at": "Fri Jan 05 16:05:52 +0000 2018", + "favorited": false, + "full_text": "@mpchlets Houston decided that green card holders don't get to use the permanent residents line so I hate going via Houston.", + "lang": "en", + "in_reply_to_screen_name": "mpchlets", + "in_reply_to_user_id_str": "1170686755" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949309707063316480" + ], + "editableUntil": "2018-01-05T17:00:46.142Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andrew Betts", + "screen_name": "triblondon", + "indices": [ + "0", + "11" + ], + "id_str": "7311232", + "id": "7311232" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949309600016183296", + "id_str": "949309707063316480", + "in_reply_to_user_id": "7311232", + "truncated": false, + "retweet_count": "0", + "id": "949309707063316480", + "in_reply_to_status_id": "949309600016183296", + "created_at": "Fri Jan 05 16:00:46 +0000 2018", + "favorited": false, + "full_text": "@triblondon It is complicated to do mid-naturalization.", + "lang": "en", + "in_reply_to_screen_name": "triblondon", + "in_reply_to_user_id_str": "7311232" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949308418933837824" + ], + "editableUntil": "2018-01-05T16:55:39.028Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "22", + "id_str": "949308418933837824", + "truncated": false, + "retweet_count": "0", + "id": "949308418933837824", + "created_at": "Fri Jan 05 15:55:39 +0000 2018", + "favorited": false, + "full_text": "I am on the ground in Miami, waiting for a gate. Commence gut-churning fear as to whether immigration will respect my green card or decide they hate me.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949307313776680961" + ], + "editableUntil": "2018-01-05T16:51:15.538Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sarah Drasner", + "screen_name": "sarah_edo", + "indices": [ + "0", + "10" + ], + "id_str": "813333008", + "id": "813333008" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "112" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "949306705749291008", + "id_str": "949307313776680961", + "in_reply_to_user_id": "813333008", + "truncated": false, + "retweet_count": "0", + "id": "949307313776680961", + "in_reply_to_status_id": "949306705749291008", + "created_at": "Fri Jan 05 15:51:15 +0000 2018", + "favorited": false, + "full_text": "@sarah_edo @_jwerner_ I've recently done a small project with nuxt.js (like next.js but Vue) and liked it a lot.", + "lang": "en", + "in_reply_to_screen_name": "sarah_edo", + "in_reply_to_user_id_str": "813333008" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949304999103942656" + ], + "editableUntil": "2018-01-05T16:42:03.677Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@chaosmonster@mastodon.online (Martin)", + "screen_name": "chaos_monster", + "indices": [ + "0", + "14" + ], + "id_str": "268960747", + "id": "268960747" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "121" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "949304606416408576", + "id_str": "949304999103942656", + "in_reply_to_user_id": "268960747", + "truncated": false, + "retweet_count": "0", + "id": "949304999103942656", + "in_reply_to_status_id": "949304606416408576", + "created_at": "Fri Jan 05 15:42:03 +0000 2018", + "favorited": false, + "full_text": "@chaos_monster I know roughly how many global users artifactory has and they are less than half a percent of npm's users.", + "lang": "en", + "in_reply_to_screen_name": "chaos_monster", + "in_reply_to_user_id_str": "268960747" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949304658849337347" + ], + "editableUntil": "2018-01-05T16:40:42.554Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Metaprompter 🇺🇦", + "screen_name": "metapgmr", + "indices": [ + "0", + "9" + ], + "id_str": "216668208", + "id": "216668208" + }, + { + "name": "☄︎", + "screen_name": "0xca0a", + "indices": [ + "10", + "17" + ], + "id_str": "835209520200699909", + "id": "835209520200699909" + }, + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "18", + "29" + ], + "id_str": "68567860", + "id": "68567860" + }, + { + "name": "Jason Miller 🦊⚛", + "screen_name": "_developit", + "indices": [ + "30", + "41" + ], + "id_str": "16495353", + "id": "16495353" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "252" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949259423150518272", + "id_str": "949304658849337347", + "in_reply_to_user_id": "216668208", + "truncated": false, + "retweet_count": "0", + "id": "949304658849337347", + "in_reply_to_status_id": "949259423150518272", + "created_at": "Fri Jan 05 15:40:42 +0000 2018", + "favorited": false, + "full_text": "@metapgmr @0xca0a @AdamRackis @_developit I'm sorry I left jQuery out of the time graph but I promise it was oversight and not malice. jQuery isn't really a framework, so I didn't include it in my first draft and forgot to include it in all the graphs.", + "lang": "en", + "in_reply_to_screen_name": "metapgmr", + "in_reply_to_user_id_str": "216668208" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949303976457134081" + ], + "editableUntil": "2018-01-05T16:37:59.859Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@chaosmonster@mastodon.online (Martin)", + "screen_name": "chaos_monster", + "indices": [ + "0", + "14" + ], + "id_str": "268960747", + "id": "268960747" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "96" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949196335042957312", + "id_str": "949303976457134081", + "in_reply_to_user_id": "268960747", + "truncated": false, + "retweet_count": "0", + "id": "949303976457134081", + "in_reply_to_status_id": "949196335042957312", + "created_at": "Fri Jan 05 15:37:59 +0000 2018", + "favorited": false, + "full_text": "@chaos_monster They aren't, but that usage is pretty negligible relative to the global registry.", + "lang": "en", + "in_reply_to_screen_name": "chaos_monster", + "in_reply_to_user_id_str": "268960747" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949303810094182401" + ], + "editableUntil": "2018-01-05T16:37:20.195Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kevin Marks 🏠kevinmarks.com xoxo.zone/@KevinMarks", + "screen_name": "kevinmarks", + "indices": [ + "0", + "11" + ], + "id_str": "57203", + "id": "57203" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "36" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949245065867689984", + "id_str": "949303810094182401", + "in_reply_to_user_id": "57203", + "truncated": false, + "retweet_count": "0", + "id": "949303810094182401", + "in_reply_to_status_id": "949245065867689984", + "created_at": "Fri Jan 05 15:37:20 +0000 2018", + "favorited": false, + "full_text": "@kevinmarks An editing oversight :-)", + "lang": "en", + "in_reply_to_screen_name": "kevinmarks", + "in_reply_to_user_id_str": "57203" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949111158140792837" + ], + "editableUntil": "2018-01-05T03:51:48.390Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "10", + "21" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "156" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949110931967049728", + "id_str": "949111158140792837", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949111158140792837", + "in_reply_to_status_id": "949110931967049728", + "created_at": "Fri Jan 05 02:51:48 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @robwormald (We always stored stats for scoped packages, we just didn't have a way to safely share them until recently as some scopes are private)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949110931967049728" + ], + "editableUntil": "2018-01-05T03:50:54.466Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Zed Chapple", + "screen_name": "ZChapple", + "indices": [ + "0", + "9" + ], + "id_str": "1290959646505594880", + "id": "1290959646505594880" + }, + { + "name": "robwormald", + "screen_name": "robwormald", + "indices": [ + "10", + "21" + ], + "id_str": "14103865", + "id": "14103865" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "150" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "949086540818509824", + "id_str": "949110931967049728", + "in_reply_to_user_id": "887912305", + "truncated": false, + "retweet_count": "0", + "id": "949110931967049728", + "in_reply_to_status_id": "949086540818509824", + "created_at": "Fri Jan 05 02:50:54 +0000 2018", + "favorited": false, + "full_text": "@ZChapple @robwormald These stats are for 'angular'. If I should have been combining angular with @angular/core that's a big mistake I should correct!", + "lang": "en", + "in_reply_to_user_id_str": "887912305" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949052757247438848" + ], + "editableUntil": "2018-01-04T23:59:44.532Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jason Miller 🦊⚛", + "screen_name": "_developit", + "indices": [ + "0", + "11" + ], + "id_str": "16495353", + "id": "16495353" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949051309637894144", + "id_str": "949052757247438848", + "in_reply_to_user_id": "16495353", + "truncated": false, + "retweet_count": "0", + "id": "949052757247438848", + "in_reply_to_status_id": "949051309637894144", + "created_at": "Thu Jan 04 22:59:44 +0000 2018", + "favorited": false, + "full_text": "@_developit Downloads as a percentage of all downloads, per the post.", + "lang": "en", + "in_reply_to_screen_name": "_developit", + "in_reply_to_user_id_str": "16495353" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949052535125544961" + ], + "editableUntil": "2018-01-04T23:58:51.574Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "📦🛠👷🏻♂️Sean Larkin", + "screen_name": "TheLarkInn", + "indices": [ + "0", + "11" + ], + "id_str": "17607249", + "id": "17607249" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949048491354898432", + "id_str": "949052535125544961", + "in_reply_to_user_id": "17607249", + "truncated": false, + "retweet_count": "0", + "id": "949052535125544961", + "in_reply_to_status_id": "949048491354898432", + "created_at": "Thu Jan 04 22:58:51 +0000 2018", + "favorited": false, + "full_text": "@TheLarkInn Coming in part 3!", + "lang": "en", + "in_reply_to_screen_name": "TheLarkInn", + "in_reply_to_user_id_str": "17607249" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949047131356237824" + ], + "editableUntil": "2018-01-04T23:37:23.215Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "19" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949045082623066112", + "id_str": "949047131356237824", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "949047131356237824", + "in_reply_to_status_id": "949045082623066112", + "created_at": "Thu Jan 04 22:37:23 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu *hearts*", + "lang": "en", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949046936228810752" + ], + "editableUntil": "2018-01-04T23:36:36.693Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "171" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "949040322167877632", + "id_str": "949046936228810752", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949046936228810752", + "in_reply_to_status_id": "949040322167877632", + "created_at": "Thu Jan 04 22:36:36 +0000 2018", + "favorited": false, + "full_text": "Growing up, the green flash was a mythical thing like Santa Claus that everybody talked about but you doubted was real. The first time I saw it I was very, very surprised.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949046410439208960" + ], + "editableUntil": "2018-01-04T23:34:31.335Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Rob Marquardt @sometoast@mstdn.social", + "screen_name": "someToast", + "indices": [ + "0", + "10" + ], + "id_str": "669033", + "id": "669033" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "92" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949044986858762240", + "id_str": "949046410439208960", + "in_reply_to_user_id": "669033", + "truncated": false, + "retweet_count": "0", + "id": "949046410439208960", + "in_reply_to_status_id": "949044986858762240", + "created_at": "Thu Jan 04 22:34:31 +0000 2018", + "favorited": false, + "full_text": "@someToast It’s only the second time for me and I grew up in the tropics looking at sunsets.", + "lang": "en", + "in_reply_to_screen_name": "someToast", + "in_reply_to_user_id_str": "669033" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949044628887662592" + ], + "editableUntil": "2018-01-04T23:27:26.580Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "dtex@fosstodon.org", + "screen_name": "dtex", + "indices": [ + "0", + "5" + ], + "id_str": "12980562", + "id": "12980562" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "71" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949044397118771200", + "id_str": "949044628887662592", + "in_reply_to_user_id": "12980562", + "truncated": false, + "retweet_count": "0", + "id": "949044628887662592", + "in_reply_to_status_id": "949044397118771200", + "created_at": "Thu Jan 04 22:27:26 +0000 2018", + "favorited": false, + "full_text": "@dtex I've seen it twice in my life, the conditions are extremely rare.", + "lang": "en", + "in_reply_to_screen_name": "dtex", + "in_reply_to_user_id_str": "12980562" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949040322167877632" + ], + "editableUntil": "2018-01-04T23:10:19.778Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949040322167877632/photo/1", + "indices": [ + "158", + "181" + ], + "url": "https://t.co/pIXVrM8sbC", + "media_url": "http://pbs.twimg.com/media/DSurIpqV4AASfHh.jpg", + "id_str": "949040311602372608", + "id": "949040311602372608", + "media_url_https": "https://pbs.twimg.com/media/DSurIpqV4AASfHh.jpg", + "sizes": { + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/pIXVrM8sbC" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "181" + ], + "favorite_count": "25", + "id_str": "949040322167877632", + "truncated": false, + "retweet_count": "0", + "id": "949040322167877632", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 22:10:19 +0000 2018", + "favorited": false, + "full_text": "Saw the green flash today, very unexpectedly, since there were lots of clouds in the foreground but none on the horizon. (This is not a picture of the flash) https://t.co/pIXVrM8sbC", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949040322167877632/photo/1", + "indices": [ + "158", + "181" + ], + "url": "https://t.co/pIXVrM8sbC", + "media_url": "http://pbs.twimg.com/media/DSurIpqV4AASfHh.jpg", + "id_str": "949040311602372608", + "id": "949040311602372608", + "media_url_https": "https://pbs.twimg.com/media/DSurIpqV4AASfHh.jpg", + "sizes": { + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/pIXVrM8sbC" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949034243556102144" + ], + "editableUntil": "2018-01-04T22:46:10.524Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam Rackis", + "screen_name": "AdamRackis", + "indices": [ + "0", + "11" + ], + "id_str": "68567860", + "id": "68567860" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949033632773140485", + "id_str": "949034243556102144", + "in_reply_to_user_id": "68567860", + "truncated": false, + "retweet_count": "0", + "id": "949034243556102144", + "in_reply_to_status_id": "949033632773140485", + "created_at": "Thu Jan 04 21:46:10 +0000 2018", + "favorited": false, + "full_text": "@AdamRackis Also popularity, it just makes it easier to read.", + "lang": "en", + "in_reply_to_screen_name": "AdamRackis", + "in_reply_to_user_id_str": "68567860" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949032941400788992" + ], + "editableUntil": "2018-01-04T22:41:00.066Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Hugo Campos", + "screen_name": "hugoccampos", + "indices": [ + "0", + "12" + ], + "id_str": "1411743176", + "id": "1411743176" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "146" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "949032253765636097", + "id_str": "949032941400788992", + "in_reply_to_user_id": "1411743176", + "truncated": false, + "retweet_count": "0", + "id": "949032941400788992", + "in_reply_to_status_id": "949032253765636097", + "created_at": "Thu Jan 04 21:41:00 +0000 2018", + "favorited": false, + "full_text": "@hugoccampos Not by any means. In absolute terms it gets more users every day. But relative to the growth of other frameworks it is losing ground.", + "lang": "en", + "in_reply_to_screen_name": "hugoccampos", + "in_reply_to_user_id_str": "1411743176" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949030641806561280" + ], + "editableUntil": "2018-01-04T22:31:51.800Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "CNN", + "screen_name": "CNN", + "indices": [ + "3", + "7" + ], + "id_str": "759251", + "id": "759251" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "949030641806561280", + "truncated": false, + "retweet_count": "0", + "id": "949030641806561280", + "created_at": "Thu Jan 04 21:31:51 +0000 2018", + "favorited": false, + "full_text": "RT @CNN: Hours after a personal attorney for President Trump sent a cease and desist letter to the publisher and author of a new book, dema…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949028611021033472" + ], + "editableUntil": "2018-01-04T22:23:47.623Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sarah Drasner", + "screen_name": "sarah_edo", + "indices": [ + "0", + "10" + ], + "id_str": "813333008", + "id": "813333008" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "157" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "949028456943247365", + "id_str": "949028611021033472", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "949028611021033472", + "in_reply_to_status_id": "949028456943247365", + "created_at": "Thu Jan 04 21:23:47 +0000 2018", + "favorited": false, + "full_text": "@sarah_edo @griff_js We selected it as a metric because everybody's absolute download numbers always go up, because npm is getting more popular all the time.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949028456943247365" + ], + "editableUntil": "2018-01-04T22:23:10.888Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sarah Drasner", + "screen_name": "sarah_edo", + "indices": [ + "0", + "10" + ], + "id_str": "813333008", + "id": "813333008" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "155" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "949027567528427520", + "id_str": "949028456943247365", + "in_reply_to_user_id": "813333008", + "truncated": false, + "retweet_count": "0", + "id": "949028456943247365", + "in_reply_to_status_id": "949027567528427520", + "created_at": "Thu Jan 04 21:23:10 +0000 2018", + "favorited": false, + "full_text": "@sarah_edo @griff_js Per the post, it's \"download counts for a package as a percentage of the download count for all packages in the registry at that time\"", + "lang": "en", + "in_reply_to_screen_name": "sarah_edo", + "in_reply_to_user_id_str": "813333008" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949028172309454850" + ], + "editableUntil": "2018-01-04T22:22:03.026Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com\" rel=\"nofollow\">Twitter Web Client</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Rich Harris", + "screen_name": "Rich_Harris", + "indices": [ + "0", + "12" + ], + "id_str": "19487837", + "id": "19487837" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "143" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949025968592687105", + "id_str": "949028172309454850", + "in_reply_to_user_id": "19487837", + "truncated": false, + "retweet_count": "0", + "id": "949028172309454850", + "in_reply_to_status_id": "949025968592687105", + "created_at": "Thu Jan 04 21:22:03 +0000 2018", + "favorited": false, + "full_text": "@Rich_Harris I thought that was fascinating, but also to some extent it reflects that npm was not the primary source of distribution back then.", + "lang": "en", + "in_reply_to_screen_name": "Rich_Harris", + "in_reply_to_user_id_str": "19487837" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949023202243743747" + ], + "editableUntil": "2018-01-04T22:02:18.070Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "0", + "11" + ], + "id_str": "622960227", + "id": "622960227" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "75" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949022941064384519", + "id_str": "949023202243743747", + "in_reply_to_user_id": "622960227", + "truncated": false, + "retweet_count": "0", + "id": "949023202243743747", + "in_reply_to_status_id": "949022941064384519", + "created_at": "Thu Jan 04 21:02:18 +0000 2018", + "favorited": false, + "full_text": "@bitandbang Yes. Per the post, Ember in particular is very hard to measure.", + "lang": "en", + "in_reply_to_screen_name": "bitandbang", + "in_reply_to_user_id_str": "622960227" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949021945592451072" + ], + "editableUntil": "2018-01-04T21:57:18.461Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949021945592451072/photo/1", + "indices": [ + "35", + "58" + ], + "url": "https://t.co/QHqIY9pO6E", + "media_url": "http://pbs.twimg.com/media/DSuabHGU8AAsA3r.jpg", + "id_str": "949021937044353024", + "id": "949021937044353024", + "media_url_https": "https://pbs.twimg.com/media/DSuabHGU8AAsA3r.jpg", + "sizes": { + "medium": { + "w": "740", + "h": "697", + "resize": "fit" + }, + "large": { + "w": "740", + "h": "697", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "640", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/QHqIY9pO6E" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "58" + ], + "favorite_count": "213", + "in_reply_to_status_id_str": "949020917040144384", + "id_str": "949021945592451072", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "86", + "id": "949021945592451072", + "in_reply_to_status_id": "949020917040144384", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 20:57:18 +0000 2018", + "favorited": false, + "full_text": "TLDR: React is very, very popular. https://t.co/QHqIY9pO6E", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949021945592451072/photo/1", + "indices": [ + "35", + "58" + ], + "url": "https://t.co/QHqIY9pO6E", + "media_url": "http://pbs.twimg.com/media/DSuabHGU8AAsA3r.jpg", + "id_str": "949021937044353024", + "id": "949021937044353024", + "media_url_https": "https://pbs.twimg.com/media/DSuabHGU8AAsA3r.jpg", + "sizes": { + "medium": { + "w": "740", + "h": "697", + "resize": "fit" + }, + "large": { + "w": "740", + "h": "697", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "680", + "h": "640", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/QHqIY9pO6E" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949021444960342017" + ], + "editableUntil": "2018-01-04T21:55:19.101Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "0", + "11" + ], + "id_str": "622960227", + "id": "622960227" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "153" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "949021125811621890", + "id_str": "949021444960342017", + "in_reply_to_user_id": "622960227", + "truncated": false, + "retweet_count": "0", + "id": "949021444960342017", + "in_reply_to_status_id": "949021125811621890", + "created_at": "Thu Jan 04 20:55:19 +0000 2018", + "favorited": false, + "full_text": "@bitandbang Just the main React module. React native usage is very small relative to web usage, but if you have a proxy for it I can track it separately.", + "lang": "en", + "in_reply_to_screen_name": "bitandbang", + "in_reply_to_user_id_str": "622960227" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949020917040144384" + ], + "editableUntil": "2018-01-04T21:53:13.235Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/rwIpUdjsiv", + "expanded_url": "https://www.npmjs.com/npm/state-of-javascript-frameworks-2017-part-1", + "display_url": "npmjs.com/npm/state-of-j…", + "indices": [ + "100", + "123" + ] + } + ] + }, + "display_text_range": [ + "0", + "123" + ], + "favorite_count": "111", + "id_str": "949020917040144384", + "truncated": false, + "retweet_count": "50", + "id": "949020917040144384", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 20:53:13 +0000 2018", + "favorited": false, + "full_text": "An analysis of npm's data to show the relative popularity and growth of major front end frameworks: https://t.co/rwIpUdjsiv", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949020691793408001" + ], + "editableUntil": "2018-01-04T21:52:19.532Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "antony ", + "screen_name": "antony", + "indices": [ + "0", + "7" + ], + "id_str": "818570", + "id": "818570" + }, + { + "name": "npm", + "screen_name": "npmjs", + "indices": [ + "8", + "14" + ], + "id_str": "309528017", + "id": "309528017" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "84" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "949019449109204992", + "id_str": "949020691793408001", + "in_reply_to_user_id": "818570", + "truncated": false, + "retweet_count": "0", + "id": "949020691793408001", + "in_reply_to_status_id": "949019449109204992", + "created_at": "Thu Jan 04 20:52:19 +0000 2018", + "favorited": false, + "full_text": "@antony @npmjs Hence the huge disclaimer saying exactly that at the top of the post.", + "lang": "en", + "in_reply_to_screen_name": "antony", + "in_reply_to_user_id_str": "818570" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949016145272672257" + ], + "editableUntil": "2018-01-04T21:34:15.557Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/JAQ687afOA", + "expanded_url": "https://twitter.com/gsuberland/status/948907452786933762", + "display_url": "twitter.com/gsuberland/sta…", + "indices": [ + "131", + "154" + ] + } + ] + }, + "display_text_range": [ + "0", + "154" + ], + "favorite_count": "73", + "id_str": "949016145272672257", + "truncated": false, + "retweet_count": "43", + "id": "949016145272672257", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 20:34:15 +0000 2018", + "favorited": false, + "full_text": "This is an excellent explainer of Meltdown and Spectre that I found comprehensible even without any knowledge of OS level details: https://t.co/JAQ687afOA", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949012235170582529" + ], + "editableUntil": "2018-01-04T21:18:43.316Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Y7xrPmFBQF", + "expanded_url": "https://twitter.com/gameofthrones/status/948993347963715584", + "display_url": "twitter.com/gameofthrones/…", + "indices": [ + "81", + "104" + ] + } + ] + }, + "display_text_range": [ + "0", + "104" + ], + "favorite_count": "22", + "id_str": "949012235170582529", + "truncated": false, + "retweet_count": "3", + "id": "949012235170582529", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 20:18:43 +0000 2018", + "favorited": false, + "full_text": "Money saving tip for 2018: you can cancel your HBO subscription until next year. https://t.co/Y7xrPmFBQF", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949010524834017280" + ], + "editableUntil": "2018-01-04T21:11:55.540Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949010524834017280/photo/1", + "indices": [ + "11", + "34" + ], + "url": "https://t.co/iOPi2YKnoc", + "media_url": "http://pbs.twimg.com/media/DSuQCMlUMAAMzFF.jpg", + "id_str": "949010513903497216", + "id": "949010513903497216", + "media_url_https": "https://pbs.twimg.com/media/DSuQCMlUMAAMzFF.jpg", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/iOPi2YKnoc" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "7", + "id_str": "949010524834017280", + "truncated": false, + "retweet_count": "0", + "id": "949010524834017280", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 20:11:55 +0000 2018", + "favorited": false, + "full_text": "Final day. https://t.co/iOPi2YKnoc", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/949010524834017280/photo/1", + "indices": [ + "11", + "34" + ], + "url": "https://t.co/iOPi2YKnoc", + "media_url": "http://pbs.twimg.com/media/DSuQCMlUMAAMzFF.jpg", + "id_str": "949010513903497216", + "id": "949010513903497216", + "media_url_https": "https://pbs.twimg.com/media/DSuQCMlUMAAMzFF.jpg", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/iOPi2YKnoc" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493681871171256320" + ], + "editableUntil": "2022-02-15T21:21:24.011Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "60", + "id_str": "1493681871171256320", + "truncated": false, + "retweet_count": "1", + "id": "1493681871171256320", + "created_at": "Tue Feb 15 20:21:24 +0000 2022", + "favorited": false, + "full_text": "My primary route to serenity through forgiveness is forgetting things happened and usually that the people involved even exist.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493648626576285696" + ], + "editableUntil": "2022-02-15T19:09:17.882Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/zocSTKOCLb", + "expanded_url": "https://www.bbc.com/news/uk-60393843", + "display_url": "bbc.com/news/uk-603938…", + "indices": [ + "243", + "266" + ] + } + ] + }, + "display_text_range": [ + "0", + "266" + ], + "favorite_count": "19", + "id_str": "1493648626576285696", + "truncated": false, + "retweet_count": "2", + "id": "1493648626576285696", + "possibly_sensitive": false, + "created_at": "Tue Feb 15 18:09:17 +0000 2022", + "favorited": false, + "full_text": "Andrew has settled out of court, admitting *in the statement of the settlement* that Giuffre \"suffered both as an established victim of abuse and as a result of unfair public attacks\"; you don't get closer to \"he definitely did it\" than that. https://t.co/zocSTKOCLb", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493608721515167744" + ], + "editableUntil": "2022-02-15T16:30:43.774Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "144" + ], + "favorite_count": "47", + "id_str": "1493608721515167744", + "truncated": false, + "retweet_count": "0", + "id": "1493608721515167744", + "created_at": "Tue Feb 15 15:30:43 +0000 2022", + "favorited": false, + "full_text": "I wonder if the bouyant market for tech people buying weird ergonomic shoes has fallen off a cliff since nobody can see anybody's feet any more.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493605297088352262" + ], + "editableUntil": "2022-02-15T16:17:07.327Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "167" + ], + "favorite_count": "21", + "in_reply_to_status_id_str": "1493604922482384899", + "id_str": "1493605297088352262", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1493605297088352262", + "in_reply_to_status_id": "1493604922482384899", + "created_at": "Tue Feb 15 15:17:07 +0000 2022", + "favorited": false, + "full_text": "\"Valentine's plants!\" (Same 5 plants, plus a teddy bear)\n\"Christmas plants!\" (Same 5 plants, snowflake background)\n\"Halloween plants!\" (Same 5 plants, spooky lighting)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493604922482384899" + ], + "editableUntil": "2022-02-15T16:15:38.014Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/ZwsmeRBwuJ", + "expanded_url": "http://plants.com", + "display_url": "plants.com", + "indices": [ + "55", + "78" + ] + } + ] + }, + "display_text_range": [ + "0", + "182" + ], + "favorite_count": "69", + "id_str": "1493604922482384899", + "truncated": false, + "retweet_count": "2", + "id": "1493604922482384899", + "possibly_sensitive": false, + "created_at": "Tue Feb 15 15:15:38 +0000 2022", + "favorited": false, + "full_text": "My personal hero is the copywriter for the emails from https://t.co/ZwsmeRBwuJ, who has been finding new things to say about the same 5 basic plants every single day for 2 years now.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493594640951521292" + ], + "editableUntil": "2022-02-15T15:34:46.706Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/3XbTgAsUaw", + "expanded_url": "https://twitter.com/memeorandum/status/1493591220882317312", + "display_url": "twitter.com/memeorandum/st…", + "indices": [ + "97", + "120" + ] + } + ] + }, + "display_text_range": [ + "0", + "120" + ], + "favorite_count": "31", + "id_str": "1493594640951521292", + "truncated": false, + "retweet_count": "5", + "id": "1493594640951521292", + "possibly_sensitive": false, + "created_at": "Tue Feb 15 14:34:46 +0000 2022", + "favorited": false, + "full_text": "The remaining 3 in 4 were prevented from answering by the threat of a filibuster by Joe Manchin. https://t.co/3XbTgAsUaw", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493594286515908608" + ], + "editableUntil": "2022-02-15T15:33:22.202Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Kapetaneas", + "screen_name": "JohnKapetaneas", + "indices": [ + "3", + "18" + ], + "id_str": "444725879", + "id": "444725879" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "1493594286515908608", + "truncated": false, + "retweet_count": "0", + "id": "1493594286515908608", + "created_at": "Tue Feb 15 14:33:22 +0000 2022", + "favorited": false, + "full_text": "RT @JohnKapetaneas: NYT: No, we did not make Wordle harder. We promise. \n\nAlso NYT: Today’s Wordle is KHYBX — which everyone knows is a pop…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493446225227489282" + ], + "editableUntil": "2022-02-15T05:45:01.640Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@snotskie@queer.party", + "screen_name": "snotskie", + "indices": [ + "0", + "9" + ], + "id_str": "173448317", + "id": "173448317" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "34" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "1493446008507969536", + "id_str": "1493446225227489282", + "in_reply_to_user_id": "173448317", + "truncated": false, + "retweet_count": "0", + "id": "1493446225227489282", + "in_reply_to_status_id": "1493446008507969536", + "created_at": "Tue Feb 15 04:45:01 +0000 2022", + "favorited": false, + "full_text": "@snotskie I love magic eye posters", + "lang": "en", + "in_reply_to_screen_name": "snotskie", + "in_reply_to_user_id_str": "173448317" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493432708583673856" + ], + "editableUntil": "2022-02-15T04:51:19.021Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493432708583673856/photo/1", + "indices": [ + "43", + "66" + ], + "url": "https://t.co/miGMKa4kBo", + "media_url": "http://pbs.twimg.com/media/FLm9IhPUYAM4Nq1.jpg", + "id_str": "1493432705509253123", + "id": "1493432705509253123", + "media_url_https": "https://pbs.twimg.com/media/FLm9IhPUYAM4Nq1.jpg", + "sizes": { + "small": { + "w": "680", + "h": "510", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "900", + "resize": "fit" + }, + "large": { + "w": "2048", + "h": "1536", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/miGMKa4kBo" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "66" + ], + "favorite_count": "43", + "id_str": "1493432708583673856", + "truncated": false, + "retweet_count": "0", + "id": "1493432708583673856", + "possibly_sensitive": false, + "created_at": "Tue Feb 15 03:51:19 +0000 2022", + "favorited": false, + "full_text": "Sunsets are getting later and that's good. https://t.co/miGMKa4kBo", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493432708583673856/photo/1", + "indices": [ + "43", + "66" + ], + "url": "https://t.co/miGMKa4kBo", + "media_url": "http://pbs.twimg.com/media/FLm9IhPUYAM4Nq1.jpg", + "id_str": "1493432705509253123", + "id": "1493432705509253123", + "media_url_https": "https://pbs.twimg.com/media/FLm9IhPUYAM4Nq1.jpg", + "sizes": { + "small": { + "w": "680", + "h": "510", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "medium": { + "w": "1200", + "h": "900", + "resize": "fit" + }, + "large": { + "w": "2048", + "h": "1536", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/miGMKa4kBo" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493431255437758465" + ], + "editableUntil": "2022-02-15T04:45:32.564Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "253" + ], + "favorite_count": "13", + "id_str": "1493431255437758465", + "truncated": false, + "retweet_count": "1", + "id": "1493431255437758465", + "created_at": "Tue Feb 15 03:45:32 +0000 2022", + "favorited": false, + "full_text": "The thing about a Minard diagram is that while it's a very clever visualization of that specific event it is really not generalizable to any other kind of event, and believe me I have tried to come up with excuses for Minard diagrams all over the place.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493419254758064131" + ], + "editableUntil": "2022-02-15T03:57:51.379Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493419254758064131/photo/1", + "indices": [ + "200", + "223" + ], + "url": "https://t.co/HYaOQvBQmE", + "media_url": "http://pbs.twimg.com/media/FLmwmWWVIAU6DVk.jpg", + "id_str": "1493418924330786821", + "id": "1493418924330786821", + "media_url_https": "https://pbs.twimg.com/media/FLmwmWWVIAU6DVk.jpg", + "sizes": { + "small": { + "w": "680", + "h": "509", + "resize": "fit" + }, + "large": { + "w": "2003", + "h": "1500", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "899", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/HYaOQvBQmE" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "223" + ], + "favorite_count": "34", + "in_reply_to_status_id_str": "1493048429869604866", + "id_str": "1493419254758064131", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1493419254758064131", + "in_reply_to_status_id": "1493048429869604866", + "possibly_sensitive": false, + "created_at": "Tue Feb 15 02:57:51 +0000 2022", + "favorited": false, + "full_text": "P.S. I, data person that I am, somehow managed to talk about Napoleon's disastrous march on Moscow without including the world's most famous data visualization, the Minard Diagram, which is about it. https://t.co/HYaOQvBQmE", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493419254758064131/photo/1", + "indices": [ + "200", + "223" + ], + "url": "https://t.co/HYaOQvBQmE", + "media_url": "http://pbs.twimg.com/media/FLmwmWWVIAU6DVk.jpg", + "id_str": "1493418924330786821", + "id": "1493418924330786821", + "media_url_https": "https://pbs.twimg.com/media/FLmwmWWVIAU6DVk.jpg", + "sizes": { + "small": { + "w": "680", + "h": "509", + "resize": "fit" + }, + "large": { + "w": "2003", + "h": "1500", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "899", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/HYaOQvBQmE" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493406687138516993" + ], + "editableUntil": "2022-02-15T03:07:55.025Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/WokvSX0vxk", + "expanded_url": "https://twitter.com/tarstarr/status/1493395983128014857", + "display_url": "twitter.com/tarstarr/statu…", + "indices": [ + "107", + "130" + ] + } + ] + }, + "display_text_range": [ + "0", + "130" + ], + "favorite_count": "38", + "id_str": "1493406687138516993", + "truncated": false, + "retweet_count": "4", + "id": "1493406687138516993", + "possibly_sensitive": false, + "created_at": "Tue Feb 15 02:07:55 +0000 2022", + "favorited": false, + "full_text": "You can call it We're All Going To Make It, which will also be the catchphrase and the name of the finale. https://t.co/WokvSX0vxk", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493358401509740546" + ], + "editableUntil": "2022-02-14T23:56:02.834Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "emily freeman", + "screen_name": "editingemily", + "indices": [ + "0", + "13" + ], + "id_str": "1066151600", + "id": "1066151600" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "143" + ], + "favorite_count": "27", + "in_reply_to_status_id_str": "1493357946151055364", + "id_str": "1493358401509740546", + "in_reply_to_user_id": "1066151600", + "truncated": false, + "retweet_count": "0", + "id": "1493358401509740546", + "in_reply_to_status_id": "1493357946151055364", + "created_at": "Mon Feb 14 22:56:02 +0000 2022", + "favorited": false, + "full_text": "@editingemily This is one of those situations where I've arbitrarily decided the spelling is correct but we are all pronouncing it incorrectly.", + "lang": "en", + "in_reply_to_screen_name": "editingemily", + "in_reply_to_user_id_str": "1066151600" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493348014802432000" + ], + "editableUntil": "2022-02-14T23:14:46.450Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Fayyad AL Hadaad", + "screen_name": "hadaad", + "indices": [ + "0", + "7" + ], + "id_str": "1602789309299531789", + "id": "1602789309299531789" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "20" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1493347828185264128", + "id_str": "1493348014802432000", + "in_reply_to_user_id": "16041639", + "truncated": false, + "retweet_count": "0", + "id": "1493348014802432000", + "in_reply_to_status_id": "1493347828185264128", + "created_at": "Mon Feb 14 22:14:46 +0000 2022", + "favorited": false, + "full_text": "@hadaad 337 million!", + "lang": "en", + "in_reply_to_user_id_str": "16041639" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493347862465310722" + ], + "editableUntil": "2022-02-14T23:14:10.130Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sarah Emerson", + "screen_name": "_loveallthis", + "indices": [ + "0", + "13" + ], + "id_str": "64853040", + "id": "64853040" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "37" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "1493346222475661312", + "id_str": "1493347862465310722", + "in_reply_to_user_id": "64853040", + "truncated": false, + "retweet_count": "0", + "id": "1493347862465310722", + "in_reply_to_status_id": "1493346222475661312", + "created_at": "Mon Feb 14 22:14:10 +0000 2022", + "favorited": false, + "full_text": "@_loveallthis I love that newsletter.", + "lang": "en", + "in_reply_to_screen_name": "_loveallthis", + "in_reply_to_user_id_str": "64853040" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493345882242125824" + ], + "editableUntil": "2022-02-14T23:06:18.008Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Philip Renich - mastodon.nz/@mez", + "screen_name": "philiprenich", + "indices": [ + "0", + "13" + ], + "id_str": "13443702", + "id": "13443702" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "50" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "1493344352239697922", + "id_str": "1493345882242125824", + "in_reply_to_user_id": "13443702", + "truncated": false, + "retweet_count": "0", + "id": "1493345882242125824", + "in_reply_to_status_id": "1493344352239697922", + "created_at": "Mon Feb 14 22:06:18 +0000 2022", + "favorited": false, + "full_text": "@philiprenich Vegas? You mean the capital of Utah?", + "lang": "en", + "in_reply_to_screen_name": "philiprenich", + "in_reply_to_user_id_str": "13443702" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493345624674029571" + ], + "editableUntil": "2022-02-14T23:05:16.599Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493345624674029571/photo/1", + "indices": [ + "68", + "91" + ], + "url": "https://t.co/9n6pO7fSFm", + "media_url": "http://pbs.twimg.com/media/FLlt3YhVgAAeMOs.png", + "id_str": "1493345549692534784", + "id": "1493345549692534784", + "media_url_https": "https://pbs.twimg.com/media/FLlt3YhVgAAeMOs.png", + "sizes": { + "large": { + "w": "1254", + "h": "210", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "201", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "114", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/9n6pO7fSFm" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "91" + ], + "favorite_count": "23", + "in_reply_to_status_id_str": "1493330503365136386", + "id_str": "1493345624674029571", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "1493345624674029571", + "in_reply_to_status_id": "1493330503365136386", + "possibly_sensitive": false, + "created_at": "Mon Feb 14 22:05:16 +0000 2022", + "favorited": false, + "full_text": "I'm sorry, is it give, or is it take? I feel like that's important. https://t.co/9n6pO7fSFm", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/1493345624674029571/photo/1", + "indices": [ + "68", + "91" + ], + "url": "https://t.co/9n6pO7fSFm", + "media_url": "http://pbs.twimg.com/media/FLlt3YhVgAAeMOs.png", + "id_str": "1493345549692534784", + "id": "1493345549692534784", + "media_url_https": "https://pbs.twimg.com/media/FLlt3YhVgAAeMOs.png", + "sizes": { + "large": { + "w": "1254", + "h": "210", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "201", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "114", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/9n6pO7fSFm" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493339932441526274" + ], + "editableUntil": "2022-02-14T22:42:39.465Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "31", + "in_reply_to_status_id_str": "1493339812173996033", + "id_str": "1493339932441526274", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "1493339932441526274", + "in_reply_to_status_id": "1493339812173996033", + "created_at": "Mon Feb 14 21:42:39 +0000 2022", + "favorited": false, + "full_text": "\"We DEMAND the FREEDOM to SWINDLE RUBES!\"", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493339812173996033" + ], + "editableUntil": "2022-02-14T22:42:10.791Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/q3AirdbiFL", + "expanded_url": "https://twitter.com/ErikVoorhees/status/1493295793150726144", + "display_url": "twitter.com/ErikVoorhees/s…", + "indices": [ + "162", + "185" + ] + } + ] + }, + "display_text_range": [ + "0", + "185" + ], + "favorite_count": "55", + "id_str": "1493339812173996033", + "truncated": false, + "retweet_count": "10", + "id": "1493339812173996033", + "possibly_sensitive": false, + "created_at": "Mon Feb 14 21:42:10 +0000 2022", + "favorited": false, + "full_text": "BlockFi has been fined $100m for misleadingly marketing a speculative, goes-to-zero financial product as a \"savings account\" and the bitcoin people are VERY MAD. https://t.co/q3AirdbiFL", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "1493337723561598977" + ], + "editableUntil": "2022-02-14T22:33:52.827Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"https://mobile.twitter.com\" rel=\"nofollow\">Twitter Web App</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "99" + ], + "favorite_count": "11", + "in_reply_to_status_id_str": "1493336679863623686", + "id_str": "1493337723561598977", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "1493337723561598977", + "in_reply_to_status_id": "1493336679863623686", + "created_at": "Mon Feb 14 21:33:52 +0000 2022", + "favorited": false, + "full_text": "Arkansas should extend down to the border and take that little bit of extra Texas, just to be sure.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "949010315177594880" + ], + "editableUntil": "2018-01-04T21:11:05.554Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lindsay Goldwert 👑", + "screen_name": "lindsaygoldwert", + "indices": [ + "0", + "16" + ], + "id_str": "196540524", + "id": "196540524" + }, + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "17", + "29" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "46" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "949008750073077760", + "id_str": "949010315177594880", + "in_reply_to_user_id": "196540524", + "truncated": false, + "retweet_count": "0", + "id": "949010315177594880", + "in_reply_to_status_id": "949008750073077760", + "created_at": "Thu Jan 04 20:11:05 +0000 2018", + "favorited": false, + "full_text": "@lindsaygoldwert @CaseyNewton This is so dark.", + "lang": "en", + "in_reply_to_screen_name": "lindsaygoldwert", + "in_reply_to_user_id_str": "196540524" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948996712294682626" + ], + "editableUntil": "2018-01-04T20:17:02.374Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/Vi2sN9xRaX", + "expanded_url": "https://twitter.com/cosendem/status/948948921694302209", + "display_url": "twitter.com/cosendem/statu…", + "indices": [ + "29", + "52" + ] + } + ] + }, + "display_text_range": [ + "0", + "52" + ], + "favorite_count": "12", + "id_str": "948996712294682626", + "truncated": false, + "retweet_count": "2", + "id": "948996712294682626", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 19:17:02 +0000 2018", + "favorited": false, + "full_text": "2018 is already pretty wild. https://t.co/Vi2sN9xRaX", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948995182887886849" + ], + "editableUntil": "2018-01-04T20:10:57.735Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "OLYMPIANS", + "screen_name": "onwardolympians", + "indices": [ + "0", + "16" + ], + "id_str": "118893267", + "id": "118893267" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "43" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948664226373095426", + "id_str": "948995182887886849", + "in_reply_to_user_id": "118893267", + "truncated": false, + "retweet_count": "0", + "id": "948995182887886849", + "in_reply_to_status_id": "948664226373095426", + "created_at": "Thu Jan 04 19:10:57 +0000 2018", + "favorited": false, + "full_text": "@onwardolympians Pretty sure that's Sum 41.", + "lang": "en", + "in_reply_to_screen_name": "onwardolympians", + "in_reply_to_user_id_str": "118893267" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948994972711256064" + ], + "editableUntil": "2018-01-04T20:10:07.625Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "bletchley punk", + "screen_name": "alicegoldfuss", + "indices": [ + "0", + "14" + ], + "id_str": "163154809", + "id": "163154809" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "83" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948994108013494272", + "id_str": "948994972711256064", + "in_reply_to_user_id": "163154809", + "truncated": false, + "retweet_count": "0", + "id": "948994972711256064", + "in_reply_to_status_id": "948994108013494272", + "created_at": "Thu Jan 04 19:10:07 +0000 2018", + "favorited": false, + "full_text": "@alicegoldfuss To an exciting week to be having anything at all to do with infosec.", + "lang": "en", + "in_reply_to_screen_name": "alicegoldfuss", + "in_reply_to_user_id_str": "163154809" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948991913394360323" + ], + "editableUntil": "2018-01-04T19:57:58.227Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "123" + ], + "favorite_count": "26", + "id_str": "948991913394360323", + "truncated": false, + "retweet_count": "9", + "id": "948991913394360323", + "created_at": "Thu Jan 04 18:57:58 +0000 2018", + "favorited": false, + "full_text": "I predict there will be a rogue ad that exploits either Meltdown or Spectre to steal credentials in the wild within 7 days.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948991674730139649" + ], + "editableUntil": "2018-01-04T19:57:01.325Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Louis Virtel", + "screen_name": "louisvirtel", + "indices": [ + "3", + "15" + ], + "id_str": "16245840", + "id": "16245840" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "948991674730139649", + "truncated": false, + "retweet_count": "0", + "id": "948991674730139649", + "created_at": "Thu Jan 04 18:57:01 +0000 2018", + "favorited": false, + "full_text": "RT @louisvirtel: Dear Academy voters who are resistant to Call Me By Your Name \"because we picked [a gay story] last year\": You'll be blown…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948991538067070976" + ], + "editableUntil": "2018-01-04T19:56:28.742Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Nick Sweeting @ DWebCamp", + "screen_name": "thesquashSH", + "indices": [ + "0", + "12" + ], + "id_str": "262147093", + "id": "262147093" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "68" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948990320695435264", + "id_str": "948991538067070976", + "in_reply_to_user_id": "262147093", + "truncated": false, + "retweet_count": "0", + "id": "948991538067070976", + "in_reply_to_status_id": "948990320695435264", + "created_at": "Thu Jan 04 18:56:28 +0000 2018", + "favorited": false, + "full_text": "@thesquashSH Not enough for remote execution, so bad but not a worm.", + "lang": "en", + "in_reply_to_screen_name": "thesquashSH", + "in_reply_to_user_id_str": "262147093" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948980494502432769" + ], + "editableUntil": "2018-01-04T19:12:35.751Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Rey Bango 🇺🇦🌻", + "screen_name": "reybango", + "indices": [ + "3", + "12" + ], + "id_str": "1589691", + "id": "1589691" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "948980494502432769", + "truncated": false, + "retweet_count": "0", + "id": "948980494502432769", + "created_at": "Thu Jan 04 18:12:35 +0000 2018", + "favorited": false, + "full_text": "RT @reybango: Serious security PSA: everyone regardless of OS should be applying patches to the Meltdown and Spectre Intel CPU Security iss…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948976472852779008" + ], + "editableUntil": "2018-01-04T18:56:36.915Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "michael", + "screen_name": "mpchlets", + "indices": [ + "0", + "9" + ], + "id_str": "1170686755", + "id": "1170686755" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "111" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948975774610132993", + "id_str": "948976472852779008", + "in_reply_to_user_id": "1170686755", + "truncated": false, + "retweet_count": "0", + "id": "948976472852779008", + "in_reply_to_status_id": "948975774610132993", + "created_at": "Thu Jan 04 17:56:36 +0000 2018", + "favorited": false, + "full_text": "@mpchlets I tried my very best but 8 redirects and a pointless web UI later google will not show me that video.", + "lang": "en", + "in_reply_to_screen_name": "mpchlets", + "in_reply_to_user_id_str": "1170686755" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948975269334876161" + ], + "editableUntil": "2018-01-04T18:51:49.974Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "196" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948974807592271872", + "id_str": "948975269334876161", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "948975269334876161", + "in_reply_to_status_id": "948974807592271872", + "created_at": "Thu Jan 04 17:51:49 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton I never actually empty my inbox. If an email is unread I’ve not dealt with it, if it’s read it is effectively archived. There is no in between state. My “inbox” == my unread messages.", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948974857651400704" + ], + "editableUntil": "2018-01-04T18:50:11.821Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sargun Dhillon", + "screen_name": "sargun", + "indices": [ + "0", + "7" + ], + "id_str": "981701", + "id": "981701" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "169" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948974505829044226", + "id_str": "948974857651400704", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "948974857651400704", + "in_reply_to_status_id": "948974505829044226", + "created_at": "Thu Jan 04 17:50:11 +0000 2018", + "favorited": false, + "full_text": "@sargun If it can steal your SSH key it can execute arbitrary commands on remote machines but only ones you have access to. A worm requires a much broader vulnerability.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948974505829044226" + ], + "editableUntil": "2018-01-04T18:48:47.940Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sargun Dhillon", + "screen_name": "sargun", + "indices": [ + "0", + "7" + ], + "id_str": "981701", + "id": "981701" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948973591298695168", + "id_str": "948974505829044226", + "in_reply_to_user_id": "981701", + "truncated": false, + "retweet_count": "0", + "id": "948974505829044226", + "in_reply_to_status_id": "948973591298695168", + "created_at": "Thu Jan 04 17:48:47 +0000 2018", + "favorited": false, + "full_text": "@sargun That’s not enough for remote command execution, no.", + "lang": "en", + "in_reply_to_screen_name": "sargun", + "in_reply_to_user_id_str": "981701" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948974130493317121" + ], + "editableUntil": "2018-01-04T18:47:18.453Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "207" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "948971603085242368", + "id_str": "948974130493317121", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "948974130493317121", + "in_reply_to_status_id": "948971603085242368", + "created_at": "Thu Jan 04 17:47:18 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton I have been inbox zero religiously for literally 2 decades. It’s a matter of being extremely willing to say “I will never get around to this” and, as you say, keeping to-dos separate from email.", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948973831561142272" + ], + "editableUntil": "2018-01-04T18:46:07.182Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dan Levy", + "screen_name": "justsml", + "indices": [ + "0", + "8" + ], + "id_str": "34569742", + "id": "34569742" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "106" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948971527558615040", + "id_str": "948973831561142272", + "in_reply_to_user_id": "34569742", + "truncated": false, + "retweet_count": "0", + "id": "948973831561142272", + "in_reply_to_status_id": "948971527558615040", + "created_at": "Thu Jan 04 17:46:07 +0000 2018", + "favorited": false, + "full_text": "@justsml Sure, but that would be a new bug, and not universally applicable. Not good but limited in scope.", + "lang": "en", + "in_reply_to_screen_name": "justsml", + "in_reply_to_user_id_str": "34569742" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948971301120761867" + ], + "editableUntil": "2018-01-04T18:36:03.878Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Casey Newton", + "screen_name": "CaseyNewton", + "indices": [ + "0", + "12" + ], + "id_str": "69426451", + "id": "69426451" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "50" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "948970611530874880", + "id_str": "948971301120761867", + "in_reply_to_user_id": "69426451", + "truncated": false, + "retweet_count": "0", + "id": "948971301120761867", + "in_reply_to_status_id": "948970611530874880", + "created_at": "Thu Jan 04 17:36:03 +0000 2018", + "favorited": false, + "full_text": "@CaseyNewton I’m with you except for the last one.", + "lang": "en", + "in_reply_to_screen_name": "CaseyNewton", + "in_reply_to_user_id_str": "69426451" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948970473827831808" + ], + "editableUntil": "2018-01-04T18:32:46.636Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "@aaronfriel@hachyderm.io", + "screen_name": "AaronFriel", + "indices": [ + "0", + "11" + ], + "id_str": "184674078", + "id": "184674078" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "142" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948970101763661824", + "id_str": "948970473827831808", + "in_reply_to_user_id": "184674078", + "truncated": false, + "retweet_count": "0", + "id": "948970473827831808", + "in_reply_to_status_id": "948970101763661824", + "created_at": "Thu Jan 04 17:32:46 +0000 2018", + "favorited": false, + "full_text": "@AaronFriel Fundamentally Spectre is one-way with no mechanism for injecting code into memory so I don't see it turning into that kind of bug.", + "lang": "en", + "in_reply_to_screen_name": "AaronFriel", + "in_reply_to_user_id_str": "184674078" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948970123142025217" + ], + "editableUntil": "2018-01-04T18:31:23.026Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Emily Gorcenski", + "screen_name": "EmilyGorcenski", + "indices": [ + "0", + "15" + ], + "id_str": "1483064670", + "id": "1483064670" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "29" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "948969633683558401", + "id_str": "948970123142025217", + "in_reply_to_user_id": "1483064670", + "truncated": false, + "retweet_count": "0", + "id": "948970123142025217", + "in_reply_to_status_id": "948969633683558401", + "created_at": "Thu Jan 04 17:31:23 +0000 2018", + "favorited": false, + "full_text": "@EmilyGorcenski Good summary.", + "lang": "en", + "in_reply_to_screen_name": "EmilyGorcenski", + "in_reply_to_user_id_str": "1483064670" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948969910948024320" + ], + "editableUntil": "2018-01-04T18:30:32.435Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "rachel", + "screen_name": "ohhoe", + "indices": [ + "0", + "6" + ], + "id_str": "2141321", + "id": "2141321" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "30" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948953083001925632", + "id_str": "948969910948024320", + "in_reply_to_user_id": "2141321", + "truncated": false, + "retweet_count": "0", + "id": "948969910948024320", + "in_reply_to_status_id": "948953083001925632", + "created_at": "Thu Jan 04 17:30:32 +0000 2018", + "favorited": false, + "full_text": "@ohhoe Dat bombogenesis action", + "lang": "en", + "in_reply_to_screen_name": "ohhoe", + "in_reply_to_user_id_str": "2141321" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948968542703144963" + ], + "editableUntil": "2018-01-04T18:25:06.220Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "138" + ], + "favorite_count": "10", + "id_str": "948968542703144963", + "truncated": false, + "retweet_count": "1", + "id": "948968542703144963", + "created_at": "Thu Jan 04 17:25:06 +0000 2018", + "favorited": false, + "full_text": "The only good news about Spectre is that it allows data inspection, not command execution. That means you can't make a worm/virus with it.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948966301296480258" + ], + "editableUntil": "2018-01-04T18:16:11.827Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🏳️🌈 Sam Kimbrel | @skimbrel@tech.lgbt", + "screen_name": "skimbrel", + "indices": [ + "0", + "9" + ], + "id_str": "17934129", + "id": "17934129" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "107" + ], + "favorite_count": "0", + "id_str": "948966301296480258", + "in_reply_to_user_id": "17934129", + "truncated": false, + "retweet_count": "0", + "id": "948966301296480258", + "created_at": "Thu Jan 04 17:16:11 +0000 2018", + "favorited": false, + "full_text": "@skimbrel btw th Intel CEO sold many more shares than I realized, so I think it probably is actionable now.", + "lang": "en", + "in_reply_to_screen_name": "skimbrel", + "in_reply_to_user_id_str": "17934129" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948963334606540800" + ], + "editableUntil": "2018-01-04T18:04:24.513Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Subhasish Das | ভুতো | bhuto@mastodon.social", + "screen_name": "bhuto", + "indices": [ + "0", + "6" + ], + "id_str": "10652272", + "id": "10652272" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "12" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948962822200877056", + "id_str": "948963334606540800", + "in_reply_to_user_id": "10652272", + "truncated": false, + "retweet_count": "0", + "id": "948963334606540800", + "in_reply_to_status_id": "948962822200877056", + "created_at": "Thu Jan 04 17:04:24 +0000 2018", + "favorited": false, + "full_text": "@bhuto 😭😭😭😭😭", + "lang": "qme", + "in_reply_to_screen_name": "bhuto", + "in_reply_to_user_id_str": "10652272" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948963115424800768" + ], + "editableUntil": "2018-01-04T18:03:32.256Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948963115424800768/photo/1", + "indices": [ + "51", + "74" + ], + "url": "https://t.co/z0xjGq4ws8", + "media_url": "http://pbs.twimg.com/media/DStk6yjVoAAkZYC.jpg", + "id_str": "948963107656802304", + "id": "948963107656802304", + "media_url_https": "https://pbs.twimg.com/media/DStk6yjVoAAkZYC.jpg", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/z0xjGq4ws8" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "74" + ], + "favorite_count": "50", + "id_str": "948963115424800768", + "truncated": false, + "retweet_count": "0", + "id": "948963115424800768", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 17:03:32 +0000 2018", + "favorited": false, + "full_text": "Hello to everyone in New York tweeting about snow. https://t.co/z0xjGq4ws8", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948963115424800768/photo/1", + "indices": [ + "51", + "74" + ], + "url": "https://t.co/z0xjGq4ws8", + "media_url": "http://pbs.twimg.com/media/DStk6yjVoAAkZYC.jpg", + "id_str": "948963107656802304", + "id": "948963107656802304", + "media_url_https": "https://pbs.twimg.com/media/DStk6yjVoAAkZYC.jpg", + "sizes": { + "medium": { + "w": "900", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "1536", + "h": "2048", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/z0xjGq4ws8" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948958894176587777" + ], + "editableUntil": "2018-01-04T17:46:45.832Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dr. Bluman* (also @drbluman@mstdn.social)", + "screen_name": "drbluman", + "indices": [ + "0", + "9" + ], + "id_str": "8389142", + "id": "8389142" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "32" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948956076069785601", + "id_str": "948958894176587777", + "in_reply_to_user_id": "8389142", + "truncated": false, + "retweet_count": "0", + "id": "948958894176587777", + "in_reply_to_status_id": "948956076069785601", + "created_at": "Thu Jan 04 16:46:45 +0000 2018", + "favorited": false, + "full_text": "@drbluman I would take that bet.", + "lang": "en", + "in_reply_to_screen_name": "drbluman", + "in_reply_to_user_id_str": "8389142" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948958557592006656" + ], + "editableUntil": "2018-01-04T17:45:25.584Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Subhasish Das | ভুতো | bhuto@mastodon.social", + "screen_name": "bhuto", + "indices": [ + "0", + "6" + ], + "id_str": "10652272", + "id": "10652272" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948951661749260288", + "id_str": "948958557592006656", + "in_reply_to_user_id": "10652272", + "truncated": false, + "retweet_count": "0", + "id": "948958557592006656", + "in_reply_to_status_id": "948951661749260288", + "created_at": "Thu Jan 04 16:45:25 +0000 2018", + "favorited": false, + "full_text": "@bhuto WHERE IT IS VITAL THAT YOU TELL ME", + "lang": "en", + "in_reply_to_screen_name": "bhuto", + "in_reply_to_user_id_str": "10652272" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948949714564796416" + ], + "editableUntil": "2018-01-04T17:10:17.242Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948949714564796416/photo/1", + "indices": [ + "105", + "128" + ], + "url": "https://t.co/EePDeIQyVH", + "media_url": "http://pbs.twimg.com/media/DStYufdUMAA-9hQ.jpg", + "id_str": "948949702233305088", + "id": "948949702233305088", + "media_url_https": "https://pbs.twimg.com/media/DStYufdUMAA-9hQ.jpg", + "sizes": { + "medium": { + "w": "899", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1535", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/EePDeIQyVH" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "128" + ], + "favorite_count": "41", + "id_str": "948949714564796416", + "truncated": false, + "retweet_count": "0", + "id": "948949714564796416", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 16:10:17 +0000 2018", + "favorited": false, + "full_text": "🎵 It's beef and curry roti time \n🎵 beef and curry roti time\n\n(To the tune of \"peanut butter jelly time\") https://t.co/EePDeIQyVH", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948949714564796416/photo/1", + "indices": [ + "105", + "128" + ], + "url": "https://t.co/EePDeIQyVH", + "media_url": "http://pbs.twimg.com/media/DStYufdUMAA-9hQ.jpg", + "id_str": "948949702233305088", + "id": "948949702233305088", + "media_url_https": "https://pbs.twimg.com/media/DStYufdUMAA-9hQ.jpg", + "sizes": { + "medium": { + "w": "899", + "h": "1200", + "resize": "fit" + }, + "large": { + "w": "1535", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "small": { + "w": "510", + "h": "680", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/EePDeIQyVH" + }, + { + "expanded_url": "https://twitter.com/seldo/status/948949714564796416/photo/1", + "indices": [ + "105", + "128" + ], + "url": "https://t.co/EePDeIQyVH", + "media_url": "http://pbs.twimg.com/media/DStYufcUQAAHR6J.jpg", + "id_str": "948949702229114880", + "id": "948949702229114880", + "media_url_https": "https://pbs.twimg.com/media/DStYufcUQAAHR6J.jpg", + "sizes": { + "small": { + "w": "680", + "h": "621", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "2048", + "h": "1871", + "resize": "fit" + }, + "medium": { + "w": "1200", + "h": "1096", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/EePDeIQyVH" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948947894878572544" + ], + "editableUntil": "2018-01-04T17:03:03.395Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/ooJURgJkRS", + "expanded_url": "https://twitter.com/find_evil/status/948921096522358784", + "display_url": "twitter.com/find_evil/stat…", + "indices": [ + "64", + "87" + ] + } + ] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "5", + "in_reply_to_status_id_str": "948303644281200640", + "id_str": "948947894878572544", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "948947894878572544", + "in_reply_to_status_id": "948303644281200640", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 16:03:03 +0000 2018", + "favorited": false, + "full_text": "More of that collaborative, blameless retro from the Linux guy: https://t.co/ooJURgJkRS", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948946479577739265" + ], + "editableUntil": "2018-01-04T16:57:25.961Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Peter Schamerhorn", + "screen_name": "RandChange", + "indices": [ + "0", + "11" + ], + "id_str": "88464884", + "id": "88464884" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "99" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948945579744399360", + "id_str": "948946479577739265", + "in_reply_to_user_id": "88464884", + "truncated": false, + "retweet_count": "0", + "id": "948946479577739265", + "in_reply_to_status_id": "948945579744399360", + "created_at": "Thu Jan 04 15:57:25 +0000 2018", + "favorited": false, + "full_text": "@RandChange Yes, but there's a lot of shit in there like saved passwords and stuff. Still very bad.", + "lang": "en", + "in_reply_to_screen_name": "RandChange", + "in_reply_to_user_id_str": "88464884" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948942178235150337" + ], + "editableUntil": "2018-01-04T16:40:20.441Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948942178235150337/photo/1", + "indices": [ + "45", + "68" + ], + "url": "https://t.co/AfmplOu0U9", + "media_url": "http://pbs.twimg.com/media/DStR4MZU0AE0Fld.jpg", + "id_str": "948942172333592577", + "id": "948942172333592577", + "media_url_https": "https://pbs.twimg.com/media/DStR4MZU0AE0Fld.jpg", + "sizes": { + "medium": { + "w": "784", + "h": "455", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "395", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "784", + "h": "455", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/AfmplOu0U9" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "68" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "948941883945996291", + "id_str": "948942178235150337", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "948942178235150337", + "in_reply_to_status_id": "948941883945996291", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 15:40:20 +0000 2018", + "favorited": false, + "full_text": "This is your brain on Sports. Any questions? https://t.co/AfmplOu0U9", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948942178235150337/photo/1", + "indices": [ + "45", + "68" + ], + "url": "https://t.co/AfmplOu0U9", + "media_url": "http://pbs.twimg.com/media/DStR4MZU0AE0Fld.jpg", + "id_str": "948942172333592577", + "id": "948942172333592577", + "media_url_https": "https://pbs.twimg.com/media/DStR4MZU0AE0Fld.jpg", + "sizes": { + "medium": { + "w": "784", + "h": "455", + "resize": "fit" + }, + "small": { + "w": "680", + "h": "395", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + }, + "large": { + "w": "784", + "h": "455", + "resize": "fit" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/AfmplOu0U9" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948941883945996291" + ], + "editableUntil": "2018-01-04T16:39:10.277Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "22" + ], + "favorite_count": "19", + "in_reply_to_status_id_str": "948941799929929728", + "id_str": "948941883945996291", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "948941883945996291", + "in_reply_to_status_id": "948941799929929728", + "created_at": "Thu Jan 04 15:39:10 +0000 2018", + "favorited": false, + "full_text": "Sports: Not Even Once.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948941799929929728" + ], + "editableUntil": "2018-01-04T16:38:50.246Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "32" + ], + "favorite_count": "7", + "in_reply_to_status_id_str": "948941225230561281", + "id_str": "948941799929929728", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "948941799929929728", + "in_reply_to_status_id": "948941225230561281", + "created_at": "Thu Jan 04 15:38:50 +0000 2018", + "favorited": false, + "full_text": "Remember, kids: don't do Sports.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948941225230561281" + ], + "editableUntil": "2018-01-04T16:36:33.227Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "205" + ], + "favorite_count": "21", + "id_str": "948941225230561281", + "truncated": false, + "retweet_count": "0", + "id": "948941225230561281", + "created_at": "Thu Jan 04 15:36:33 +0000 2018", + "favorited": false, + "full_text": "Today I engaged in exactly 60 seconds of ocean sporting activity and then faceplanted into a rock. Luckily it was a glancing blow so I'm only a little scraped up. I return to my usual sitting on a lounger.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948940268115517440" + ], + "editableUntil": "2018-01-04T16:32:45.033Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Dr. Bluman* (also @drbluman@mstdn.social)", + "screen_name": "drbluman", + "indices": [ + "0", + "9" + ], + "id_str": "8389142", + "id": "8389142" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "45" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948932200526942209", + "id_str": "948940268115517440", + "in_reply_to_user_id": "8389142", + "truncated": false, + "retweet_count": "0", + "id": "948940268115517440", + "in_reply_to_status_id": "948932200526942209", + "created_at": "Thu Jan 04 15:32:45 +0000 2018", + "favorited": false, + "full_text": "@drbluman Pretty different court in 2005, no?", + "lang": "en", + "in_reply_to_screen_name": "drbluman", + "in_reply_to_user_id_str": "8389142" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948931685441245184" + ], + "editableUntil": "2018-01-04T15:58:38.764Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/3R77uIZP0o", + "expanded_url": "https://twitter.com/edkrassen/status/948916306908205056", + "display_url": "twitter.com/edkrassen/stat…", + "indices": [ + "152", + "175" + ] + } + ] + }, + "display_text_range": [ + "0", + "175" + ], + "favorite_count": "31", + "id_str": "948931685441245184", + "truncated": false, + "retweet_count": "4", + "id": "948931685441245184", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 14:58:38 +0000 2018", + "favorited": false, + "full_text": "This is going to be the usual kind of rearguard action stupidity on the right that triggers a Supreme Court case that makes marijuana legal nationwide. https://t.co/3R77uIZP0o", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948915566072430592" + ], + "editableUntil": "2018-01-04T14:54:35.607Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "", + "screen_name": "alexburnsNYT", + "indices": [ + "3", + "16" + ], + "id_str": "-1", + "id": "-1" + } + ], + "urls": [ + { + "url": "https://t.co/NBqRrFLaQ0", + "expanded_url": "https://twitter.com/JakeSherman/status/948912370029559808", + "display_url": "twitter.com/JakeSherman/st…", + "indices": [ + "57", + "80" + ] + } + ] + }, + "display_text_range": [ + "0", + "80" + ], + "favorite_count": "0", + "id_str": "948915566072430592", + "truncated": false, + "retweet_count": "0", + "id": "948915566072430592", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 13:54:35 +0000 2018", + "favorited": false, + "full_text": "RT @alexburnsNYT: Dem youth turnout strategy for 2018 ✔️ https://t.co/NBqRrFLaQ0", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948911053429264389" + ], + "editableUntil": "2018-01-04T14:36:39.709Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Bryan Liles", + "screen_name": "bryanl", + "indices": [ + "0", + "7" + ], + "id_str": "659933", + "id": "659933" + }, + { + "name": "Visual Studio Code", + "screen_name": "code", + "indices": [ + "8", + "13" + ], + "id_str": "3167734591", + "id": "3167734591" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "69" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "948909851744358401", + "id_str": "948911053429264389", + "in_reply_to_user_id": "659933", + "truncated": false, + "retweet_count": "0", + "id": "948911053429264389", + "in_reply_to_status_id": "948909851744358401", + "created_at": "Thu Jan 04 13:36:39 +0000 2018", + "favorited": false, + "full_text": "@bryanl @code Save your money to buy a new computer without Spectre 💀", + "lang": "en", + "in_reply_to_screen_name": "bryanl", + "in_reply_to_user_id_str": "659933" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948907670584676353" + ], + "editableUntil": "2018-01-04T14:23:13.176Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Chad", + "screen_name": "kitation", + "indices": [ + "0", + "9" + ], + "id_str": "17732267", + "id": "17732267" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "127" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948906657278582784", + "id_str": "948907670584676353", + "in_reply_to_user_id": "17732267", + "truncated": false, + "retweet_count": "0", + "id": "948907670584676353", + "in_reply_to_status_id": "948906657278582784", + "created_at": "Thu Jan 04 13:23:13 +0000 2018", + "favorited": false, + "full_text": "@kitation Mine used to break at the cable so I'm hoping my AirPods will be more reliable simply by not having a cable to break.", + "lang": "en", + "in_reply_to_screen_name": "kitation", + "in_reply_to_user_id_str": "17732267" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948903813758537730" + ], + "editableUntil": "2018-01-04T14:07:53.637Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/6zuixRID2M", + "expanded_url": "https://twitter.com/josephfcox/status/948846916133117953", + "display_url": "twitter.com/josephfcox/sta…", + "indices": [ + "103", + "126" + ] + } + ] + }, + "display_text_range": [ + "0", + "126" + ], + "favorite_count": "36", + "in_reply_to_status_id_str": "948740045577576448", + "id_str": "948903813758537730", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "21", + "id": "948903813758537730", + "in_reply_to_status_id": "948740045577576448", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 13:07:53 +0000 2018", + "favorited": false, + "full_text": "🎵 Remotely exploitable if you visit a malicious web page 🎵 this truly is the worst bug I've ever seen. https://t.co/6zuixRID2M", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948876562732060672" + ], + "editableUntil": "2018-01-04T12:19:36.486Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/eDJsEbVk1W", + "expanded_url": "https://mobile.nytimes.com/2018/01/03/us/politics/trump-voter-fraud-commission.html?mc_cid=2590536fc5&mc_eid=0a91fadb73&_r=0&referer=", + "display_url": "mobile.nytimes.com/2018/01/03/us/…", + "indices": [ + "136", + "159" + ] + } + ] + }, + "display_text_range": [ + "0", + "159" + ], + "favorite_count": "5", + "id_str": "948876562732060672", + "truncated": false, + "retweet_count": "0", + "id": "948876562732060672", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 11:19:36 +0000 2018", + "favorited": false, + "full_text": "Maybe this is why he was so grumpy: Trump's commission on voter fraud found no evidence of voter fraud anywhere and has been shut down: https://t.co/eDJsEbVk1W", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948874417534373888" + ], + "editableUntil": "2018-01-04T12:11:05.031Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/NeMWvDrsJC", + "expanded_url": "https://twitter.com/bradheath/status/948333473332432896", + "display_url": "twitter.com/bradheath/stat…", + "indices": [ + "76", + "99" + ] + } + ] + }, + "display_text_range": [ + "0", + "99" + ], + "favorite_count": "21", + "id_str": "948874417534373888", + "truncated": false, + "retweet_count": "6", + "id": "948874417534373888", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 11:11:05 +0000 2018", + "favorited": false, + "full_text": "Remember kids, only white men are capable of delivering impartial verdicts. https://t.co/NeMWvDrsJC", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948802262259916800" + ], + "editableUntil": "2018-01-04T07:24:21.873Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Gab-o 🚀", + "screen_name": "gaboesquivel", + "indices": [ + "0", + "13" + ], + "id_str": "44968138", + "id": "44968138" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "59" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948789831089434624", + "id_str": "948802262259916800", + "in_reply_to_user_id": "44968138", + "truncated": false, + "retweet_count": "0", + "id": "948802262259916800", + "in_reply_to_status_id": "948789831089434624", + "created_at": "Thu Jan 04 06:24:21 +0000 2018", + "favorited": false, + "full_text": "@gaboesquivel Yes, just email support@npmjs.com and ask :-)", + "lang": "en", + "in_reply_to_screen_name": "gaboesquivel", + "in_reply_to_user_id_str": "44968138" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948746503669108737" + ], + "editableUntil": "2018-01-04T03:42:47.989Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "💥 Marco Stipek", + "screen_name": "codeprophet", + "indices": [ + "0", + "12" + ], + "id_str": "1464495715", + "id": "1464495715" + }, + { + "name": "Firefox 🔥", + "screen_name": "firefox", + "indices": [ + "13", + "21" + ], + "id_str": "2142731", + "id": "2142731" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "157" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948745635615903745", + "id_str": "948746503669108737", + "in_reply_to_user_id": "1464495715", + "truncated": false, + "retweet_count": "0", + "id": "948746503669108737", + "in_reply_to_status_id": "948745635615903745", + "created_at": "Thu Jan 04 02:42:47 +0000 2018", + "favorited": false, + "full_text": "@codeprophet @firefox We are about to slow every computer in the world down by a third. The fact that browsers are slightly slower will hardly be noticeable.", + "lang": "en", + "in_reply_to_screen_name": "codeprophet", + "in_reply_to_user_id_str": "1464495715" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948744741226733569" + ], + "editableUntil": "2018-01-04T03:35:47.790Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "💥 Marco Stipek", + "screen_name": "codeprophet", + "indices": [ + "0", + "12" + ], + "id_str": "1464495715", + "id": "1464495715" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "88" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948743209634713600", + "id_str": "948744741226733569", + "in_reply_to_user_id": "1464495715", + "truncated": false, + "retweet_count": "0", + "id": "948744741226733569", + "in_reply_to_status_id": "948743209634713600", + "created_at": "Thu Jan 04 02:35:47 +0000 2018", + "favorited": false, + "full_text": "@codeprophet Ho Ho Ho fucked. Chrome and Firefox have already released patches at least.", + "lang": "en", + "in_reply_to_screen_name": "codeprophet", + "in_reply_to_user_id_str": "1464495715" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948741461109035008" + ], + "editableUntil": "2018-01-04T03:22:45.749Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Félix Saparelli", + "screen_name": "passcod", + "indices": [ + "0", + "8" + ], + "id_str": "92200252", + "id": "92200252" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "179" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948741023424892928", + "id_str": "948741461109035008", + "in_reply_to_user_id": "92200252", + "truncated": false, + "retweet_count": "0", + "id": "948741461109035008", + "in_reply_to_status_id": "948741023424892928", + "created_at": "Thu Jan 04 02:22:45 +0000 2018", + "favorited": false, + "full_text": "@passcod Intel, AMD and ARM. I do not know nearly enough about processors to say for certain but anything with speculative execution (i.e. almost everything) seems to be affected.", + "lang": "en", + "in_reply_to_screen_name": "passcod", + "in_reply_to_user_id_str": "92200252" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948740202268446721" + ], + "editableUntil": "2018-01-04T03:17:45.618Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "meat.io on bluesky", + "screen_name": "meat", + "indices": [ + "0", + "5" + ], + "id_str": "21006515", + "id": "21006515" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "9" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948739764215209985", + "id_str": "948740202268446721", + "in_reply_to_user_id": "21006515", + "truncated": false, + "retweet_count": "0", + "id": "948740202268446721", + "in_reply_to_status_id": "948739764215209985", + "created_at": "Thu Jan 04 02:17:45 +0000 2018", + "favorited": false, + "full_text": "@meat Oy.", + "lang": "und", + "in_reply_to_screen_name": "meat", + "in_reply_to_user_id_str": "21006515" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948740045577576448" + ], + "editableUntil": "2018-01-04T03:17:08.260Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [ + { + "text": "spectre", + "indices": [ + "26", + "34" + ] + } + ], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "137" + ], + "favorite_count": "13", + "in_reply_to_status_id_str": "948736470768025600", + "id_str": "948740045577576448", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "948740045577576448", + "in_reply_to_status_id": "948736470768025600", + "created_at": "Thu Jan 04 02:17:08 +0000 2018", + "favorited": false, + "full_text": "All of the above is about #spectre. Meltdown is already being patched and will probably not be too big a deal. Spectre is huge and scary.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948739770447998977" + ], + "editableUntil": "2018-01-04T03:16:02.664Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "meat.io on bluesky", + "screen_name": "meat", + "indices": [ + "0", + "5" + ], + "id_str": "21006515", + "id": "21006515" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "41" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948739474627870721", + "id_str": "948739770447998977", + "in_reply_to_user_id": "21006515", + "truncated": false, + "retweet_count": "0", + "id": "948739770447998977", + "in_reply_to_status_id": "948739474627870721", + "created_at": "Thu Jan 04 02:16:02 +0000 2018", + "favorited": false, + "full_text": "@meat Somebody is going to figure it out.", + "lang": "en", + "in_reply_to_screen_name": "meat", + "in_reply_to_user_id_str": "21006515" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948739124940374016" + ], + "editableUntil": "2018-01-04T03:13:28.763Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "meat.io on bluesky", + "screen_name": "meat", + "indices": [ + "0", + "5" + ], + "id_str": "21006515", + "id": "21006515" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "87" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948737027083612166", + "id_str": "948739124940374016", + "in_reply_to_user_id": "21006515", + "truncated": false, + "retweet_count": "0", + "id": "948739124940374016", + "in_reply_to_status_id": "948737027083612166", + "created_at": "Thu Jan 04 02:13:28 +0000 2018", + "favorited": false, + "full_text": "@meat Everything I'm reading suggests Spectre allows the same thing but is much harder.", + "lang": "en", + "in_reply_to_screen_name": "meat", + "in_reply_to_user_id_str": "21006515" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948737603309854720" + ], + "editableUntil": "2018-01-04T03:07:25.978Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sacha Sayan", + "screen_name": "sachasayan", + "indices": [ + "0", + "11" + ], + "id_str": "48093353", + "id": "48093353" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "47" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948736685252096006", + "id_str": "948737603309854720", + "in_reply_to_user_id": "48093353", + "truncated": false, + "retweet_count": "0", + "id": "948737603309854720", + "in_reply_to_status_id": "948736685252096006", + "created_at": "Thu Jan 04 02:07:25 +0000 2018", + "favorited": false, + "full_text": "@sachasayan Spectre affects Intel, AMD and ARM.", + "lang": "en", + "in_reply_to_screen_name": "sachasayan", + "in_reply_to_user_id_str": "48093353" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948737373441019904" + ], + "editableUntil": "2018-01-04T03:06:31.173Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "💥 Marco Stipek", + "screen_name": "codeprophet", + "indices": [ + "0", + "12" + ], + "id_str": "1464495715", + "id": "1464495715" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "162" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948736168924991493", + "id_str": "948737373441019904", + "in_reply_to_user_id": "1464495715", + "truncated": false, + "retweet_count": "0", + "id": "948737373441019904", + "in_reply_to_status_id": "948736168924991493", + "created_at": "Thu Jan 04 02:06:31 +0000 2018", + "favorited": false, + "full_text": "@codeprophet JS can do meltdown but I don't *think* JS can do Spectre, which is the longer term threat. Meltdown is being patched as we speak; Spectre has no fix.", + "lang": "en", + "in_reply_to_screen_name": "codeprophet", + "in_reply_to_user_id_str": "1464495715" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948736470768025600" + ], + "editableUntil": "2018-01-04T03:02:55.959Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "217" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "948736091863044097", + "id_str": "948736470768025600", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "948736470768025600", + "in_reply_to_status_id": "948736091863044097", + "created_at": "Thu Jan 04 02:02:55 +0000 2018", + "favorited": false, + "full_text": "In the medium term, say the next 12 months, things are going to be very bumpy security wise. A lot of systems are going to need to be redesigned to account for this and some may not be fixed before they are exploited.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948736091863044097" + ], + "editableUntil": "2018-01-04T03:01:25.621Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "222" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "948735598579404800", + "id_str": "948736091863044097", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "948736091863044097", + "in_reply_to_status_id": "948735598579404800", + "created_at": "Thu Jan 04 02:01:25 +0000 2018", + "favorited": false, + "full_text": "In the short term: nothing is going to happen. Your laptop will still boot, your email will work. Long term, the problem will be fixed. Everyone will buy new hardware that doesn't have this bug (once somebody builds some).", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948735598579404800" + ], + "editableUntil": "2018-01-04T02:59:28.013Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "168" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948735077458079744", + "id_str": "948735598579404800", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "948735598579404800", + "in_reply_to_status_id": "948735077458079744", + "created_at": "Thu Jan 04 01:59:28 +0000 2018", + "favorited": false, + "full_text": "This is an even bigger problem because there is no fix anyone knows of yet short of redesigning nearly all computer chips in the world and everyone buying new hardware.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948735077458079744" + ], + "editableUntil": "2018-01-04T02:57:23.768Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "227" + ], + "favorite_count": "8", + "in_reply_to_status_id_str": "948734711379251201", + "id_str": "948735077458079744", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "948735077458079744", + "in_reply_to_status_id": "948734711379251201", + "created_at": "Thu Jan 04 01:57:23 +0000 2018", + "favorited": false, + "full_text": "This is especially a problem for cloud computing, serverless, etc where your software is running on hardware shared by many strangers. They can see everything on the machine, not just in their VM. They can steal *your* secrets.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948734711379251201" + ], + "editableUntil": "2018-01-04T02:55:56.488Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "171" + ], + "favorite_count": "14", + "in_reply_to_status_id_str": "948720087204290560", + "id_str": "948734711379251201", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "2", + "id": "948734711379251201", + "in_reply_to_status_id": "948720087204290560", + "created_at": "Thu Jan 04 01:55:56 +0000 2018", + "favorited": false, + "full_text": "TLDR: all modern computers -- your phone, your laptop, your server -- are vulnerable to data theft if untrustworthy software runs on them. This is not supposed to be true.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948723617898131456" + ], + "editableUntil": "2018-01-04T02:11:51.596Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Sasha Aickin", + "screen_name": "xander76", + "indices": [ + "0", + "9" + ], + "id_str": "5837912", + "id": "5837912" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "72" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948722128433463296", + "id_str": "948723617898131456", + "in_reply_to_user_id": "5837912", + "truncated": false, + "retweet_count": "0", + "id": "948723617898131456", + "in_reply_to_status_id": "948722128433463296", + "created_at": "Thu Jan 04 01:11:51 +0000 2018", + "favorited": false, + "full_text": "@xander76 Not just new hardware but entirely new processor architecture.", + "lang": "en", + "in_reply_to_screen_name": "xander76", + "in_reply_to_user_id_str": "5837912" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948720087204290560" + ], + "editableUntil": "2018-01-04T01:57:49.813Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/PKAZ5r0A2J", + "expanded_url": "https://twitter.com/marknca/status/948706918591287296", + "display_url": "twitter.com/marknca/status…", + "indices": [ + "62", + "85" + ] + } + ] + }, + "display_text_range": [ + "0", + "85" + ], + "favorite_count": "84", + "id_str": "948720087204290560", + "truncated": false, + "retweet_count": "47", + "id": "948720087204290560", + "possibly_sensitive": false, + "created_at": "Thu Jan 04 00:57:49 +0000 2018", + "favorited": false, + "full_text": "So it turns out all computers in the world are broken. Oh my. https://t.co/PKAZ5r0A2J", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948687639737192448" + ], + "editableUntil": "2018-01-03T23:48:53.734Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Andrew Betts", + "screen_name": "triblondon", + "indices": [ + "0", + "11" + ], + "id_str": "7311232", + "id": "7311232" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "47" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948687260421148673", + "id_str": "948687639737192448", + "in_reply_to_user_id": "7311232", + "truncated": false, + "retweet_count": "0", + "id": "948687639737192448", + "in_reply_to_status_id": "948687260421148673", + "created_at": "Wed Jan 03 22:48:53 +0000 2018", + "favorited": false, + "full_text": "@triblondon I'm close to nature. Very... close.", + "lang": "en", + "in_reply_to_screen_name": "triblondon", + "in_reply_to_user_id_str": "7311232" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948683180592201728" + ], + "editableUntil": "2018-01-03T23:31:10.591Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "lauraolin dot com slash newsletter", + "screen_name": "lauraolin", + "indices": [ + "0", + "10" + ], + "id_str": "14069365", + "id": "14069365" + }, + { + "name": "sarah jeong", + "screen_name": "sarahjeong", + "indices": [ + "11", + "22" + ], + "id_str": "47509268", + "id": "47509268" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "9", + "in_reply_to_status_id_str": "948679606923616256", + "id_str": "948683180592201728", + "in_reply_to_user_id": "14069365", + "truncated": false, + "retweet_count": "0", + "id": "948683180592201728", + "in_reply_to_status_id": "948679606923616256", + "created_at": "Wed Jan 03 22:31:10 +0000 2018", + "favorited": false, + "full_text": "@lauraolin @sarahjeong - ban handguns\n- use the metric system", + "lang": "en", + "in_reply_to_screen_name": "lauraolin", + "in_reply_to_user_id_str": "14069365" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948676690938679296" + ], + "editableUntil": "2018-01-03T23:05:23.337Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "zeddy", + "screen_name": "Zeddary", + "indices": [ + "3", + "11" + ], + "id_str": "322735335", + "id": "322735335" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "948676690938679296", + "truncated": false, + "retweet_count": "0", + "id": "948676690938679296", + "created_at": "Wed Jan 03 22:05:23 +0000 2018", + "favorited": false, + "full_text": "RT @Zeddary: If the 25th Amendment wasn't created to stop a sundowning rageaholic currently jerking off in public to visions of a nuclear h…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948661497705705472" + ], + "editableUntil": "2018-01-03T22:05:00.988Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "136" + ], + "favorite_count": "16", + "in_reply_to_status_id_str": "948629834229567489", + "id_str": "948661497705705472", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "948661497705705472", + "in_reply_to_status_id": "948629834229567489", + "created_at": "Wed Jan 03 21:05:00 +0000 2018", + "favorited": false, + "full_text": "True story: I tried taking this selfie with iPhone X portrait filter and it cannot work out where my hair begins and ends so it gave up.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948661276372361218" + ], + "editableUntil": "2018-01-03T22:04:08.218Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Revin Guillen", + "screen_name": "revin", + "indices": [ + "0", + "6" + ], + "id_str": "14496796", + "id": "14496796" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "119" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948659876644896768", + "id_str": "948661276372361218", + "in_reply_to_user_id": "14496796", + "truncated": false, + "retweet_count": "0", + "id": "948661276372361218", + "in_reply_to_status_id": "948659876644896768", + "created_at": "Wed Jan 03 21:04:08 +0000 2018", + "favorited": false, + "full_text": "@revin No joke I took like 40 selfies and this was the only one where I didn’t hate my expression so neck fronds it is.", + "lang": "en", + "in_reply_to_screen_name": "revin", + "in_reply_to_user_id_str": "14496796" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948651819202416640" + ], + "editableUntil": "2018-01-03T21:26:33.453Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "tierney cyren", + "screen_name": "bitandbang", + "indices": [ + "0", + "11" + ], + "id_str": "622960227", + "id": "622960227" + }, + { + "name": "@brianleroux@indieweb.social 💙", + "screen_name": "brianleroux", + "indices": [ + "12", + "24" + ], + "id_str": "676363", + "id": "676363" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "94" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "948651266787463168", + "id_str": "948651819202416640", + "in_reply_to_user_id": "622960227", + "truncated": false, + "retweet_count": "0", + "id": "948651819202416640", + "in_reply_to_status_id": "948651266787463168", + "created_at": "Wed Jan 03 20:26:33 +0000 2018", + "favorited": false, + "full_text": "@bitandbang @brianleroux I do but I’m not digging data until I am back from vacation (Monday).", + "lang": "en", + "in_reply_to_screen_name": "bitandbang", + "in_reply_to_user_id_str": "622960227" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948649956327526401" + ], + "editableUntil": "2018-01-03T21:19:09.309Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "51" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948646712754683904", + "id_str": "948649956327526401", + "in_reply_to_user_id": "633793", + "truncated": false, + "retweet_count": "0", + "id": "948649956327526401", + "in_reply_to_status_id": "948646712754683904", + "created_at": "Wed Jan 03 20:19:09 +0000 2018", + "favorited": false, + "full_text": "@flipzagging Not past tense. He continues to do so.", + "lang": "en", + "in_reply_to_screen_name": "NeilKNet", + "in_reply_to_user_id_str": "633793" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948641354854420482" + ], + "editableUntil": "2018-01-03T20:44:58.558Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "melanie ehrenkranz", + "screen_name": "MelanieHannah", + "indices": [ + "0", + "14" + ], + "id_str": "182171680", + "id": "182171680" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "45" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948640934912241664", + "id_str": "948641354854420482", + "in_reply_to_user_id": "182171680", + "truncated": false, + "retweet_count": "0", + "id": "948641354854420482", + "in_reply_to_status_id": "948640934912241664", + "created_at": "Wed Jan 03 19:44:58 +0000 2018", + "favorited": false, + "full_text": "@MelanieHannah Who buys a DVD player in 2018?", + "lang": "en", + "in_reply_to_screen_name": "MelanieHannah", + "in_reply_to_user_id_str": "182171680" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948640279774531584" + ], + "editableUntil": "2018-01-03T20:40:42.239Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/#!/download/ipad\" rel=\"nofollow\">Twitter for iPad</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Glockymolo Enjoyer", + "screen_name": "ysaw", + "indices": [ + "0", + "5" + ], + "id_str": "8340382", + "id": "8340382" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "11" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948639830790963200", + "id_str": "948640279774531584", + "in_reply_to_user_id": "8340382", + "truncated": false, + "retweet_count": "0", + "id": "948640279774531584", + "in_reply_to_status_id": "948639830790963200", + "created_at": "Wed Jan 03 19:40:42 +0000 2018", + "favorited": false, + "full_text": "@ysaw Oh no", + "lang": "en", + "in_reply_to_screen_name": "ysaw", + "in_reply_to_user_id_str": "8340382" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948633234438582272" + ], + "editableUntil": "2018-01-03T20:12:42.500Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Kelly Sommers", + "screen_name": "kellabyte", + "indices": [ + "0", + "10" + ], + "id_str": "47494539", + "id": "47494539" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "133" + ], + "favorite_count": "6", + "in_reply_to_status_id_str": "948632313042104320", + "id_str": "948633234438582272", + "in_reply_to_user_id": "47494539", + "truncated": false, + "retweet_count": "0", + "id": "948633234438582272", + "in_reply_to_status_id": "948632313042104320", + "created_at": "Wed Jan 03 19:12:42 +0000 2018", + "favorited": false, + "full_text": "@kellabyte You'd think anybody selling a machine without this bug would be shouting it to the heavens but I haven't seen any ads yet.", + "lang": "en", + "in_reply_to_screen_name": "kellabyte", + "in_reply_to_user_id_str": "47494539" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948632328535986176" + ], + "editableUntil": "2018-01-03T20:09:06.516Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "206" + ], + "favorite_count": "19", + "id_str": "948632328535986176", + "truncated": false, + "retweet_count": "4", + "id": "948632328535986176", + "created_at": "Wed Jan 03 19:09:06 +0000 2018", + "favorited": false, + "full_text": "Trump's favorite tactic when somebody turns on him is to pretend he doesn't know them (he did this with Tiffany). Trying to do it with Bannon is going to make him look like an idiot, but that's nothing new.", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948630075238506496" + ], + "editableUntil": "2018-01-03T20:00:09.288Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "AJ+", + "screen_name": "ajplus", + "indices": [ + "3", + "10" + ], + "id_str": "110396781", + "id": "110396781" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "139" + ], + "favorite_count": "0", + "id_str": "948630075238506496", + "truncated": false, + "retweet_count": "0", + "id": "948630075238506496", + "created_at": "Wed Jan 03 19:00:09 +0000 2018", + "favorited": false, + "full_text": "RT @ajplus: President Trump released this official statement on his former chief strategist: “Steve Bannon has nothing to do with me or my…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948629834229567489" + ], + "editableUntil": "2018-01-03T19:59:11.827Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "user_mentions": [], + "urls": [], + "symbols": [], + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948629834229567489/photo/1", + "indices": [ + "32", + "55" + ], + "url": "https://t.co/2Dg0pSGSps", + "media_url": "http://pbs.twimg.com/media/DSo1zJoVQAAK2Xr.jpg", + "id_str": "948629824389595136", + "id": "948629824389595136", + "media_url_https": "https://pbs.twimg.com/media/DSo1zJoVQAAK2Xr.jpg", + "sizes": { + "medium": { + "w": "901", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "511", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "1538", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/2Dg0pSGSps" + } + ], + "hashtags": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "80", + "id_str": "948629834229567489", + "truncated": false, + "retweet_count": "0", + "id": "948629834229567489", + "possibly_sensitive": false, + "created_at": "Wed Jan 03 18:59:11 +0000 2018", + "favorited": false, + "full_text": "Island selfie feat. beach hair. https://t.co/2Dg0pSGSps", + "lang": "en", + "extended_entities": { + "media": [ + { + "expanded_url": "https://twitter.com/seldo/status/948629834229567489/photo/1", + "indices": [ + "32", + "55" + ], + "url": "https://t.co/2Dg0pSGSps", + "media_url": "http://pbs.twimg.com/media/DSo1zJoVQAAK2Xr.jpg", + "id_str": "948629824389595136", + "id": "948629824389595136", + "media_url_https": "https://pbs.twimg.com/media/DSo1zJoVQAAK2Xr.jpg", + "sizes": { + "medium": { + "w": "901", + "h": "1200", + "resize": "fit" + }, + "small": { + "w": "511", + "h": "680", + "resize": "fit" + }, + "large": { + "w": "1538", + "h": "2048", + "resize": "fit" + }, + "thumb": { + "w": "150", + "h": "150", + "resize": "crop" + } + }, + "type": "photo", + "display_url": "pic.twitter.com/2Dg0pSGSps" + } + ] + } + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948619960401752065" + ], + "editableUntil": "2018-01-03T19:19:57.723Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Harshal Mehra", + "screen_name": "Harshal_Mehra", + "indices": [ + "0", + "14" + ], + "id_str": "43594984", + "id": "43594984" + }, + { + "name": "Pranay Gupta", + "screen_name": "PranayG", + "indices": [ + "15", + "23" + ], + "id_str": "19174226", + "id": "19174226" + }, + { + "name": "Mukund Mohan", + "screen_name": "mukund", + "indices": [ + "24", + "31" + ], + "id_str": "893431", + "id": "893431" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "125" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948615769604018176", + "id_str": "948619960401752065", + "in_reply_to_user_id": "43594984", + "truncated": false, + "retweet_count": "1", + "id": "948619960401752065", + "in_reply_to_status_id": "948615769604018176", + "created_at": "Wed Jan 03 18:19:57 +0000 2018", + "favorited": false, + "full_text": "@Harshal_Mehra @PranayG @mukund With the huge caveat that I used the term \"unit economics\" incorrectly for that whole thread.", + "lang": "en", + "in_reply_to_screen_name": "Harshal_Mehra", + "in_reply_to_user_id_str": "43594984" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948607361056477185" + ], + "editableUntil": "2018-01-03T18:29:53.805Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "parker", + "screen_name": "pt", + "indices": [ + "0", + "3" + ], + "id_str": "9571702", + "id": "9571702" + }, + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "4", + "12" + ], + "id_str": "14829286", + "id": "14829286" + }, + { + "name": "moonmaster9000", + "screen_name": "moonmaster9000", + "indices": [ + "13", + "28" + ], + "id_str": "14391298", + "id": "14391298" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "183" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948605952869085184", + "id_str": "948607361056477185", + "in_reply_to_user_id": "9571702", + "truncated": false, + "retweet_count": "0", + "id": "948607361056477185", + "in_reply_to_status_id": "948605952869085184", + "created_at": "Wed Jan 03 17:29:53 +0000 2018", + "favorited": false, + "full_text": "@pt @terronk @moonmaster9000 I wasn't really thinking in the context of Twitter, but more broadly. Kicking Trump off Twitter or any other changes at Twitter would not fix the problem.", + "lang": "en", + "in_reply_to_screen_name": "pt", + "in_reply_to_user_id_str": "9571702" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948604834147717120" + ], + "editableUntil": "2018-01-03T18:19:51.343Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Lee Edwards", + "screen_name": "terronk", + "indices": [ + "0", + "8" + ], + "id_str": "14829286", + "id": "14829286" + }, + { + "name": "parker", + "screen_name": "pt", + "indices": [ + "9", + "12" + ], + "id_str": "9571702", + "id": "9571702" + }, + { + "name": "moonmaster9000", + "screen_name": "moonmaster9000", + "indices": [ + "13", + "28" + ], + "id_str": "14391298", + "id": "14391298" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "184" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948601757373902853", + "id_str": "948604834147717120", + "in_reply_to_user_id": "14829286", + "truncated": false, + "retweet_count": "0", + "id": "948604834147717120", + "in_reply_to_status_id": "948601757373902853", + "created_at": "Wed Jan 03 17:19:51 +0000 2018", + "favorited": false, + "full_text": "@terronk @pt @moonmaster9000 What should they do instead? The thing that actually stopped Hitler was a gigantic war, so if you've got a better suggestion now is the fucking time buddy.", + "lang": "en", + "in_reply_to_screen_name": "terronk", + "in_reply_to_user_id_str": "14829286" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948601270646005761" + ], + "editableUntil": "2018-01-03T18:05:41.738Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "John Collison", + "screen_name": "collision", + "indices": [ + "0", + "10" + ], + "id_str": "5418912", + "id": "5418912" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "55" + ], + "favorite_count": "48", + "in_reply_to_status_id_str": "948575483624505344", + "id_str": "948601270646005761", + "in_reply_to_user_id": "5418912", + "truncated": false, + "retweet_count": "1", + "id": "948601270646005761", + "in_reply_to_status_id": "948575483624505344", + "created_at": "Wed Jan 03 17:05:41 +0000 2018", + "favorited": false, + "full_text": "@collision Finance jokes are like next-level dad jokes.", + "lang": "en", + "in_reply_to_screen_name": "collision", + "in_reply_to_user_id_str": "5418912" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948600744663486464" + ], + "editableUntil": "2018-01-03T18:03:36.334Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "parker", + "screen_name": "pt", + "indices": [ + "0", + "3" + ], + "id_str": "9571702", + "id": "9571702" + }, + { + "name": "moonmaster9000", + "screen_name": "moonmaster9000", + "indices": [ + "4", + "19" + ], + "id_str": "14391298", + "id": "14391298" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "120" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948598929683173376", + "id_str": "948600744663486464", + "in_reply_to_user_id": "9571702", + "truncated": false, + "retweet_count": "0", + "id": "948600744663486464", + "in_reply_to_status_id": "948598929683173376", + "created_at": "Wed Jan 03 17:03:36 +0000 2018", + "favorited": false, + "full_text": "@pt @moonmaster9000 I agree. I certainly am not spending a lot of time on getting them to ban Trump vs the other things.", + "lang": "en", + "in_reply_to_screen_name": "pt", + "in_reply_to_user_id_str": "9571702" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948597998795284481" + ], + "editableUntil": "2018-01-03T17:52:41.668Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "parker", + "screen_name": "pt", + "indices": [ + "0", + "3" + ], + "id_str": "9571702", + "id": "9571702" + }, + { + "name": "moonmaster9000", + "screen_name": "moonmaster9000", + "indices": [ + "4", + "19" + ], + "id_str": "14391298", + "id": "14391298" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "72" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948597814178828288", + "id_str": "948597998795284481", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "948597998795284481", + "in_reply_to_status_id": "948597814178828288", + "created_at": "Wed Jan 03 16:52:41 +0000 2018", + "favorited": false, + "full_text": "@pt @moonmaster9000 (He'd go to FB too but it would work much less well)", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948597814178828288" + ], + "editableUntil": "2018-01-03T17:51:57.652Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "parker", + "screen_name": "pt", + "indices": [ + "0", + "3" + ], + "id_str": "9571702", + "id": "9571702" + }, + { + "name": "moonmaster9000", + "screen_name": "moonmaster9000", + "indices": [ + "4", + "19" + ], + "id_str": "14391298", + "id": "14391298" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "101" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948597586423943169", + "id_str": "948597814178828288", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "948597814178828288", + "in_reply_to_status_id": "948597586423943169", + "created_at": "Wed Jan 03 16:51:57 +0000 2018", + "favorited": false, + "full_text": "@pt @moonmaster9000 If you banned Trump from Twitter he'd just shut the fuck up. That's the positive.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948597586423943169" + ], + "editableUntil": "2018-01-03T17:51:03.351Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "parker", + "screen_name": "pt", + "indices": [ + "0", + "3" + ], + "id_str": "9571702", + "id": "9571702" + }, + { + "name": "moonmaster9000", + "screen_name": "moonmaster9000", + "indices": [ + "4", + "19" + ], + "id_str": "14391298", + "id": "14391298" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "173" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "948597073368178688", + "id_str": "948597586423943169", + "in_reply_to_user_id": "9571702", + "truncated": false, + "retweet_count": "0", + "id": "948597586423943169", + "in_reply_to_status_id": "948597073368178688", + "created_at": "Wed Jan 03 16:51:03 +0000 2018", + "favorited": false, + "full_text": "@pt @moonmaster9000 Trump will not go to Gab, and if he did Gab would collapse immediately. They're not very good at engineering, which is why they had to pivot into racism.", + "lang": "en", + "in_reply_to_screen_name": "pt", + "in_reply_to_user_id_str": "9571702" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948595920773570561" + ], + "editableUntil": "2018-01-03T17:44:26.229Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "parker", + "screen_name": "pt", + "indices": [ + "0", + "3" + ], + "id_str": "9571702", + "id": "9571702" + }, + { + "name": "moonmaster9000", + "screen_name": "moonmaster9000", + "indices": [ + "4", + "19" + ], + "id_str": "14391298", + "id": "14391298" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "152" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948595098257731584", + "id_str": "948595920773570561", + "in_reply_to_user_id": "9571702", + "truncated": false, + "retweet_count": "1", + "id": "948595920773570561", + "in_reply_to_status_id": "948595098257731584", + "created_at": "Wed Jan 03 16:44:26 +0000 2018", + "favorited": false, + "full_text": "@pt @moonmaster9000 Strongly disagree. Preventing broadcast of extremists prevents the vulnerable from being radicalized. Lots of precedent on this one.", + "lang": "en", + "in_reply_to_screen_name": "pt", + "in_reply_to_user_id_str": "9571702" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948568625476263938" + ], + "editableUntil": "2018-01-03T15:55:58.523Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "There must be a pony in here somewhere", + "screen_name": "abmartinson", + "indices": [ + "0", + "12" + ], + "id_str": "15591476", + "id": "15591476" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "45" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948564830734114817", + "id_str": "948568625476263938", + "in_reply_to_user_id": "15591476", + "truncated": false, + "retweet_count": "0", + "id": "948568625476263938", + "in_reply_to_status_id": "948564830734114817", + "created_at": "Wed Jan 03 14:55:58 +0000 2018", + "favorited": false, + "full_text": "@abmartinson That's the iPhone app scaled up.", + "lang": "en", + "in_reply_to_screen_name": "abmartinson", + "in_reply_to_user_id_str": "15591476" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948557555999092736" + ], + "editableUntil": "2018-01-03T15:11:59.354Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🏳️🌈 Sam Kimbrel | @skimbrel@tech.lgbt", + "screen_name": "skimbrel", + "indices": [ + "0", + "9" + ], + "id_str": "17934129", + "id": "17934129" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "230" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948554442046980096", + "id_str": "948557555999092736", + "in_reply_to_user_id": "17934129", + "truncated": false, + "retweet_count": "0", + "id": "948557555999092736", + "in_reply_to_status_id": "948554442046980096", + "created_at": "Wed Jan 03 14:11:59 +0000 2018", + "favorited": false, + "full_text": "@skimbrel I looked at this story but I don't think there's anything there. The minimum required is quite high; he sold less than half of his holdings. It shows a lack of confidence in Intel but he's not bailing out before a crash.", + "lang": "en", + "in_reply_to_screen_name": "skimbrel", + "in_reply_to_user_id_str": "17934129" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948544234424098816" + ], + "editableUntil": "2018-01-03T14:19:03.243Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jdecked", + "screen_name": "jdecked", + "indices": [ + "0", + "8" + ], + "id_str": "190799800", + "id": "190799800" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "17" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948543333193859072", + "id_str": "948544234424098816", + "in_reply_to_user_id": "190799800", + "truncated": false, + "retweet_count": "0", + "id": "948544234424098816", + "in_reply_to_status_id": "948543333193859072", + "created_at": "Wed Jan 03 13:19:03 +0000 2018", + "favorited": false, + "full_text": "@jdecked My word.", + "lang": "en", + "in_reply_to_screen_name": "jdecked", + "in_reply_to_user_id_str": "190799800" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948540588286148608" + ], + "editableUntil": "2018-01-03T14:04:33.936Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "jdecked", + "screen_name": "jdecked", + "indices": [ + "0", + "8" + ], + "id_str": "190799800", + "id": "190799800" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "61" + ], + "favorite_count": "0", + "in_reply_to_status_id_str": "948539229537124353", + "id_str": "948540588286148608", + "in_reply_to_user_id": "190799800", + "truncated": false, + "retweet_count": "0", + "id": "948540588286148608", + "in_reply_to_status_id": "948539229537124353", + "created_at": "Wed Jan 03 13:04:33 +0000 2018", + "favorited": false, + "full_text": "@jdecked They are teaching you scrum development in college??", + "lang": "en", + "in_reply_to_screen_name": "jdecked", + "in_reply_to_user_id_str": "190799800" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948540318449917952" + ], + "editableUntil": "2018-01-03T14:03:29.602Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Joshua Cohen", + "screen_name": "heyjoshua", + "indices": [ + "0", + "10" + ], + "id_str": "14203080", + "id": "14203080" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "83" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948536478287753216", + "id_str": "948540318449917952", + "in_reply_to_user_id": "14203080", + "truncated": false, + "retweet_count": "0", + "id": "948540318449917952", + "in_reply_to_status_id": "948536478287753216", + "created_at": "Wed Jan 03 13:03:29 +0000 2018", + "favorited": false, + "full_text": "@heyjoshua I mean, let's not get started on all the opportunities missed by Flickr.", + "lang": "en", + "in_reply_to_screen_name": "heyjoshua", + "in_reply_to_user_id_str": "14203080" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948516288669896704" + ], + "editableUntil": "2018-01-03T12:28:00.456Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Leszek Karlik 🇵🇱 🇺🇦🇪🇺", + "screen_name": "Leszek_Karlik", + "indices": [ + "0", + "14" + ], + "id_str": "715825871693733889", + "id": "715825871693733889" + }, + { + "name": "@LittleMxSurly@yharnam.singles", + "screen_name": "LittleMxSurly", + "indices": [ + "15", + "29" + ], + "id_str": "22009627", + "id": "22009627" + } + ], + "urls": [ + { + "url": "https://t.co/GA3PrUWL0t", + "expanded_url": "https://twitter.com/seldo/status/921912048564371456", + "display_url": "twitter.com/seldo/status/9…", + "indices": [ + "55", + "78" + ] + } + ] + }, + "display_text_range": [ + "0", + "78" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948496458927484928", + "id_str": "948516288669896704", + "in_reply_to_user_id": "715825871693733889", + "truncated": false, + "retweet_count": "0", + "id": "948516288669896704", + "in_reply_to_status_id": "948496458927484928", + "possibly_sensitive": false, + "created_at": "Wed Jan 03 11:28:00 +0000 2018", + "favorited": false, + "full_text": "@Leszek_Karlik @LittleMxSurly As I've said previously: https://t.co/GA3PrUWL0t", + "lang": "en", + "in_reply_to_screen_name": "Leszek_Karlik", + "in_reply_to_user_id_str": "715825871693733889" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948515245336793088" + ], + "editableUntil": "2018-01-03T12:23:51.706Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Adam", + "screen_name": "adamadzp", + "indices": [ + "0", + "9" + ], + "id_str": "21006323", + "id": "21006323" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "1", + "in_reply_to_status_id_str": "948312209767137280", + "id_str": "948515245336793088", + "in_reply_to_user_id": "21006323", + "truncated": false, + "retweet_count": "0", + "id": "948515245336793088", + "in_reply_to_status_id": "948312209767137280", + "created_at": "Wed Jan 03 11:23:51 +0000 2018", + "favorited": false, + "full_text": "@adamadzp The whole series is \"the dysfunctional Skywalker family fucks up the entire galaxy in their attempts to get laid\".", + "lang": "en", + "in_reply_to_screen_name": "adamadzp", + "in_reply_to_user_id_str": "21006323" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948370622060683264" + ], + "editableUntil": "2018-01-03T02:49:10.830Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Jake Tapper", + "screen_name": "jaketapper", + "indices": [ + "3", + "14" + ], + "id_str": "14529929", + "id": "14529929" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "140" + ], + "favorite_count": "0", + "id_str": "948370622060683264", + "truncated": false, + "retweet_count": "0", + "id": "948370622060683264", + "created_at": "Wed Jan 03 01:49:10 +0000 2018", + "favorited": false, + "full_text": "RT @jaketapper: \"Every man, woman and child lives under a nuclear sword of Damocles, hanging by the slenderest of threads, capable of being…", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948367131803922432" + ], + "editableUntil": "2018-01-03T02:35:18.688Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Burrito Justice", + "screen_name": "burritojustice", + "indices": [ + "3", + "18" + ], + "id_str": "16944165", + "id": "16944165" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "70" + ], + "favorite_count": "0", + "id_str": "948367131803922432", + "truncated": false, + "retweet_count": "0", + "id": "948367131803922432", + "created_at": "Wed Jan 03 01:35:18 +0000 2018", + "favorited": false, + "full_text": "RT @burritojustice: so basically substitute \"Penis\" for \"Button\" right", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948367109410652161" + ], + "editableUntil": "2018-01-03T02:35:13.349Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Burrito Justice", + "screen_name": "burritojustice", + "indices": [ + "0", + "15" + ], + "id_str": "16944165", + "id": "16944165" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "32" + ], + "favorite_count": "3", + "in_reply_to_status_id_str": "948367003986767872", + "id_str": "948367109410652161", + "in_reply_to_user_id": "16944165", + "truncated": false, + "retweet_count": "0", + "id": "948367109410652161", + "in_reply_to_status_id": "948367003986767872", + "created_at": "Wed Jan 03 01:35:13 +0000 2018", + "favorited": false, + "full_text": "@burritojustice It's not subtle.", + "lang": "en", + "in_reply_to_screen_name": "burritojustice", + "in_reply_to_user_id_str": "16944165" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948362071896461312" + ], + "editableUntil": "2018-01-03T02:15:12.312Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Olivia Computer", + "screen_name": "oliviacpu", + "indices": [ + "0", + "10" + ], + "id_str": "861116848686809088", + "id": "861116848686809088" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "23" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948361444180897792", + "id_str": "948362071896461312", + "in_reply_to_user_id": "861116848686809088", + "truncated": false, + "retweet_count": "0", + "id": "948362071896461312", + "in_reply_to_status_id": "948361444180897792", + "created_at": "Wed Jan 03 01:15:12 +0000 2018", + "favorited": false, + "full_text": "@oliviacpu Damn guuuurl", + "lang": "tl", + "in_reply_to_screen_name": "oliviacpu", + "in_reply_to_user_id_str": "861116848686809088" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948360380551782400" + ], + "editableUntil": "2018-01-03T02:08:29.064Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "🏳️🌈🏳️⚧️👊Marco👊🏳️⚧️🏳️🌈", + "screen_name": "TheMarco", + "indices": [ + "0", + "9" + ], + "id_str": "6875652", + "id": "6875652" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "124" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948360023347900416", + "id_str": "948360380551782400", + "in_reply_to_user_id": "6875652", + "truncated": false, + "retweet_count": "0", + "id": "948360380551782400", + "in_reply_to_status_id": "948360023347900416", + "created_at": "Wed Jan 03 01:08:29 +0000 2018", + "favorited": false, + "full_text": "@TheMarco I started thinking carefully about non-US concerned parties and voting adults etc and gave up and picked a number.", + "lang": "en", + "in_reply_to_screen_name": "TheMarco", + "in_reply_to_user_id_str": "6875652" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948359245786992640" + ], + "editableUntil": "2018-01-03T02:03:58.515Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [ + { + "url": "https://t.co/f1i4S4iUKX", + "expanded_url": "https://twitter.com/realdonaldtrump/status/948355557022420992", + "display_url": "twitter.com/realdonaldtrum…", + "indices": [ + "82", + "105" + ] + } + ] + }, + "display_text_range": [ + "0", + "105" + ], + "favorite_count": "56", + "id_str": "948359245786992640", + "truncated": false, + "retweet_count": "9", + "id": "948359245786992640", + "possibly_sensitive": false, + "created_at": "Wed Jan 03 01:03:58 +0000 2018", + "favorited": false, + "full_text": "That noise you just heard was 300 million people all facepalming at the same time https://t.co/f1i4S4iUKX", + "lang": "en" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948352227122524161" + ], + "editableUntil": "2018-01-03T01:36:05.135Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "Matthew Green", + "screen_name": "matthew_d_green", + "indices": [ + "0", + "16" + ], + "id_str": "106234268", + "id": "106234268" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "177" + ], + "favorite_count": "2", + "in_reply_to_status_id_str": "948351505761030149", + "id_str": "948352227122524161", + "in_reply_to_user_id": "106234268", + "truncated": false, + "retweet_count": "1", + "id": "948352227122524161", + "in_reply_to_status_id": "948351505761030149", + "created_at": "Wed Jan 03 00:36:05 +0000 2018", + "favorited": false, + "full_text": "@matthew_d_green There's overhead in each city, and not all rides are profitable. Especially for Uberpool, you need a density of customers to make the thing worth anyone's time.", + "lang": "en", + "in_reply_to_screen_name": "matthew_d_green", + "in_reply_to_user_id_str": "106234268" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948341074262667264" + ], + "editableUntil": "2018-01-03T00:51:46.086Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [ + { + "name": "kenneth 🌞", + "screen_name": "kpk", + "indices": [ + "0", + "4" + ], + "id_str": "22915745", + "id": "22915745" + } + ], + "urls": [] + }, + "display_text_range": [ + "0", + "169" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "948340637333622784", + "id_str": "948341074262667264", + "in_reply_to_user_id": "22915745", + "truncated": false, + "retweet_count": "0", + "id": "948341074262667264", + "in_reply_to_status_id": "948340637333622784", + "created_at": "Tue Jan 02 23:51:46 +0000 2018", + "favorited": false, + "full_text": "@kpk Uber is a very, very poorly run company. I do not think they can pull off something this complicated unless Dara manages to change the fundamental DNA of the place.", + "lang": "en", + "in_reply_to_screen_name": "kpk", + "in_reply_to_user_id_str": "22915745" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948338658997923840" + ], + "editableUntil": "2018-01-03T00:42:10.242Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "240" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "948337520735150080", + "id_str": "948338658997923840", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "948338658997923840", + "in_reply_to_status_id": "948337520735150080", + "created_at": "Tue Jan 02 23:42:10 +0000 2018", + "favorited": false, + "full_text": "If profitability does require self-driving cars then it's unlikely the high fidelity mapping needed will be profitable outside of, yes, large, dense cities. So the self-driving car outcome is my \"smaller, profitable, lower valuation\" model.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948337520735150080" + ], + "editableUntil": "2018-01-03T00:37:38.859Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "273" + ], + "favorite_count": "10", + "in_reply_to_status_id_str": "948337158183628800", + "id_str": "948337520735150080", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "1", + "id": "948337520735150080", + "in_reply_to_status_id": "948337158183628800", + "created_at": "Tue Jan 02 23:37:38 +0000 2018", + "favorited": false, + "full_text": "An even more pessimistic model would be that the service can only be profitable if Uber invents self-driving cars. I don't think they know how to do this -- they fired the guy who did and it turns out he stole the tech anyway. Uber is not going to invent self-driving cars.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + }, + { + "edit_info": { + "initial": { + "editTweetIds": [ + "948337158183628800" + ], + "editableUntil": "2018-01-03T00:36:12.420Z", + "editsRemaining": "5", + "isEditEligible": true + } + }, + "retweeted": false, + "source": "<a href=\"http://twitter.com/download/iphone\" rel=\"nofollow\">Twitter for iPhone</a>", + "entities": { + "hashtags": [], + "symbols": [], + "user_mentions": [], + "urls": [] + }, + "display_text_range": [ + "0", + "277" + ], + "favorite_count": "4", + "in_reply_to_status_id_str": "948336620138352645", + "id_str": "948337158183628800", + "in_reply_to_user_id": "15453", + "truncated": false, + "retweet_count": "0", + "id": "948337158183628800", + "in_reply_to_status_id": "948336620138352645", + "created_at": "Tue Jan 02 23:36:12 +0000 2018", + "favorited": false, + "full_text": "This model means Uber matures into a real, steady, profitable service available in major cities around the world. It's a good outcome but it doesn't justify their current massive valuation - they better IPO before that reality becomes apparent, and buying at IPO would be dumb.", + "lang": "en", + "in_reply_to_screen_name": "seldo", + "in_reply_to_user_id_str": "15453" + } +] diff --git a/apps/simple/CHANGELOG.md b/apps/simple/CHANGELOG.md index 4e6452ff5e3b3d5de89e4282205f9c723b235787..d0cbd0053235b3ef3a5203164a474dcb6503d3ed 100644 --- a/apps/simple/CHANGELOG.md +++ b/apps/simple/CHANGELOG.md @@ -1,5 +1,34 @@ # simple +## 0.0.33 + +### Patch Changes + +- Updated dependencies [63f2108] + - llamaindex@0.0.35 + +## 0.0.32 + +### Patch Changes + +- Updated dependencies [2a27e21] + - llamaindex@0.0.34 + +## 0.0.31 + +### Patch Changes + +- Updated dependencies [5e2e92c] + - llamaindex@0.0.33 + +## 0.0.30 + +### Patch Changes + +- Updated dependencies [90c0b83] +- Updated dependencies [dfd22aa] + - llamaindex@0.0.32 + ## 0.0.29 ### Patch Changes diff --git a/apps/simple/anthropic.ts b/apps/simple/anthropic.ts index ae4eab14be13006b9f5b40987254c431ec663539..ee12d722740d680aea6640cb36653b50fcfa7c10 100644 --- a/apps/simple/anthropic.ts +++ b/apps/simple/anthropic.ts @@ -4,8 +4,6 @@ import { Anthropic } from "llamaindex"; const anthropic = new Anthropic(); const result = await anthropic.chat([ { content: "You want to talk in rhymes.", role: "system" }, - { content: "Hello, world!", role: "user" }, - { content: "Hello!", role: "assistant" }, { content: "How much wood would a woodchuck chuck if a woodchuck could chuck wood?", diff --git a/apps/simple/llmStream.ts b/apps/simple/llmStream.ts deleted file mode 100644 index e9ebce4441cb2849d534947061114999a5e3a980..0000000000000000000000000000000000000000 --- a/apps/simple/llmStream.ts +++ /dev/null @@ -1,47 +0,0 @@ -import { ChatMessage, OpenAI, SimpleChatEngine } from "llamaindex"; -import {Anthropic} from "../../packages/core/src/llm/LLM"; -import { stdin as input, stdout as output } from "node:process"; -import readline from "node:readline/promises"; - -async function main() { - const query: string = ` -Where is Istanbul? - `; - - // const llm = new OpenAI({ model: "gpt-3.5-turbo", temperature: 0.1 }); - const llm = new Anthropic(); - const message: ChatMessage = { content: query, role: "user" }; - - //TODO: Add callbacks later - - //Stream Complete - //Note: Setting streaming flag to true or false will auto-set your return type to - //either an AsyncGenerator or a Response. - // Omitting the streaming flag automatically sets streaming to false - - const chatEngine: SimpleChatEngine = new SimpleChatEngine({ - chatHistory: undefined, - llm: llm, - }); - - const rl = readline.createInterface({ input, output }); - while (true) { - const query = await rl.question("Query: "); - - if (!query) { - break; - } - - //Case 1: .chat(query, undefined, true) => Stream - //Case 2: .chat(query, undefined, false) => Response object - //Case 3: .chat(query, undefined) => Response object - const chatStream = await chatEngine.chat(query, undefined, true); - var accumulated_result = ""; - for await (const part of chatStream) { - accumulated_result += part; - process.stdout.write(part); - } - } -} - -main(); diff --git a/apps/simple/openai.ts b/apps/simple/openai.ts index 4c7856be0ab9e5912cac3ca119416c6157c750ad..61acb5edd7c7af27a0f38b3a87786f6f0296593d 100644 --- a/apps/simple/openai.ts +++ b/apps/simple/openai.ts @@ -1,7 +1,7 @@ import { OpenAI } from "llamaindex"; (async () => { - const llm = new OpenAI({ model: "gpt-3.5-turbo", temperature: 0.0 }); + const llm = new OpenAI({ model: "gpt-4-1106-preview", temperature: 0.1 }); // complete api const response1 = await llm.complete("How are you?"); @@ -9,7 +9,7 @@ import { OpenAI } from "llamaindex"; // chat api const response2 = await llm.chat([ - { content: "Tell me a joke!", role: "user" }, + { content: "Tell me a joke.", role: "user" }, ]); console.log(response2.message.content); })(); diff --git a/apps/simple/package.json b/apps/simple/package.json index 3eed79be918db9335a8caa5b28d8380335b31204..30e41c57338df351f30878b9bf095e0a4b333ef3 100644 --- a/apps/simple/package.json +++ b/apps/simple/package.json @@ -1,5 +1,5 @@ { - "version": "0.0.29", + "version": "0.0.33", "private": true, "name": "simple", "dependencies": { diff --git a/apps/simple/pg-vector-store/README.md b/apps/simple/pg-vector-store/README.md new file mode 100644 index 0000000000000000000000000000000000000000..fc0316896e004fd0618787bcb68a619bf1cb07b5 --- /dev/null +++ b/apps/simple/pg-vector-store/README.md @@ -0,0 +1,33 @@ +# Postgres Vector Store + +There are two scripts available here: load-docs.ts and query.ts + +## Prerequisites + +You'll need a postgres database instance against which to run these scripts. A simple docker command would look like this: + +> `docker run -d --rm --name vector-db -p 5432:5432 -e "POSTGRES_HOST_AUTH_METHOD=trust" ankane/pgvector` + +Set the PGHOST and PGUSER (and PGPASSWORD) environment variables to match your database setup. + +You'll also need a value for OPENAI_API_KEY in your environment. + +**NOTE:** Using `--rm` in the example docker command above means that the vector store will be deleted every time the container is stopped. For production purposes, use a volume to ensure persistence across restarts. + +## Setup and Loading Docs + +Read and follow the instructions in the README.md file located one directory up to make sure your JS/TS dependencies are set up. The commands listed below are also run from that parent directory. + +To import documents and save the embedding vectors to your database: + +> `npx ts-node pg-vector-store/load-docs.ts data` + +where data is the directory containing your input files. Using the _data_ directory in the example above will read all of the files in that directory using the llamaindexTS default readers for each file type. + +## RAG Querying + +To query using the resulting vector store: + +> `npx ts-node pg-vector-store/query.ts` + +The script will prompt for a question, then process and present the answer using the PGVectorStore data and your OpenAI API key. It will continue to prompt until you enter `q`, `quit` or `exit` as the next query. diff --git a/apps/simple/pg-vector-store/load-docs.ts b/apps/simple/pg-vector-store/load-docs.ts new file mode 100755 index 0000000000000000000000000000000000000000..81e2ccc472b3f01835fc5ae98c3ca1628dc2877b --- /dev/null +++ b/apps/simple/pg-vector-store/load-docs.ts @@ -0,0 +1,68 @@ +// load-docs.ts +import fs from "fs/promises"; +import { + SimpleDirectoryReader, + storageContextFromDefaults, + VectorStoreIndex, +} from "llamaindex"; +import { PGVectorStore } from "../../../packages/core/src/storage/vectorStore/PGVectorStore"; + +async function getSourceFilenames(sourceDir: string) { + return await fs + .readdir(sourceDir) + .then((fileNames) => fileNames.map((file) => sourceDir + "/" + file)); +} + +function callback( + category: string, + name: string, + status: any, + message: string = "", +): boolean { + console.log(category, name, status, message); + return true; +} + +async function main(args: any) { + const sourceDir: string = args.length > 2 ? args[2] : "../data"; + + console.log(`Finding documents in ${sourceDir}`); + const fileList = await getSourceFilenames(sourceDir); + const count = fileList.length; + console.log(`Found ${count} files`); + + console.log(`Importing contents from ${count} files in ${sourceDir}`); + var fileName = ""; + try { + // Passing callback fn to the ctor here + // will enable looging to console. + // See callback fn, defined above. + const rdr = new SimpleDirectoryReader(callback); + const docs = await rdr.loadData({ directoryPath: sourceDir }); + + const pgvs = new PGVectorStore(); + pgvs.setCollection(sourceDir); + pgvs.clearCollection(); + + const ctx = await storageContextFromDefaults({ vectorStore: pgvs }); + + console.debug(" - creating vector store"); + const index = await VectorStoreIndex.fromDocuments(docs, { + storageContext: ctx, + }); + console.debug(" - done."); + } catch (err) { + console.error(fileName, err); + console.log( + "If your PGVectorStore init failed, make sure to set env vars for PGUSER or USER, PGHOST, PGPORT and PGPASSWORD as needed.", + ); + process.exit(1); + } + + console.log( + "Done. Try running query.ts to ask questions against the imported embeddings.", + ); + process.exit(0); +} + +main(process.argv).catch((err) => console.error(err)); diff --git a/apps/simple/pg-vector-store/query.ts b/apps/simple/pg-vector-store/query.ts new file mode 100755 index 0000000000000000000000000000000000000000..bfda4dd1954d75e9a340d3f90b70002c5f215345 --- /dev/null +++ b/apps/simple/pg-vector-store/query.ts @@ -0,0 +1,67 @@ +import { VectorStoreIndex } from "../../../packages/core/src/indices/vectorStore/VectorStoreIndex"; +import { serviceContextFromDefaults } from "../../../packages/core/src/ServiceContext"; +import { PGVectorStore } from "../../../packages/core/src/storage/vectorStore/PGVectorStore"; + +async function main() { + const readline = require("readline").createInterface({ + input: process.stdin, + output: process.stdout, + }); + + try { + const pgvs = new PGVectorStore(); + // Optional - set your collection name, default is no filter on this field. + // pgvs.setCollection(); + + const ctx = serviceContextFromDefaults(); + const index = await VectorStoreIndex.fromVectorStore(pgvs, ctx); + + // Query the index + const queryEngine = await index.asQueryEngine(); + + let question = ""; + while (!isQuit(question)) { + question = await getUserInput(readline); + + if (isQuit(question)) { + readline.close(); + process.exit(0); + } + + try { + const answer = await queryEngine.query(question); + console.log(answer.response); + } catch (error) { + console.error("Error:", error); + } + } + } catch (err) { + console.error(err); + console.log( + "If your PGVectorStore init failed, make sure to set env vars for PGUSER or USER, PGHOST, PGPORT and PGPASSWORD as needed.", + ); + process.exit(1); + } +} + +function isQuit(question: string) { + return ["q", "quit", "exit"].includes(question.trim().toLowerCase()); +} + +// Function to get user input as a promise +function getUserInput(readline: any): Promise<string> { + return new Promise((resolve) => { + readline.question( + "What would you like to know?\n>", + (userInput: string) => { + resolve(userInput); + }, + ); + }); +} + +main() + .catch(console.error) + .finally(() => { + process.exit(1); + }); diff --git a/apps/simple/portkey.ts b/apps/simple/portkey.ts index 4221b4b16650ea0ca1cf122c84fcbc20f23fba70..f5dfff2e8f50ebca340812f0f62c48344b46ebd3 100644 --- a/apps/simple/portkey.ts +++ b/apps/simple/portkey.ts @@ -1,23 +1,23 @@ import { Portkey } from "llamaindex"; (async () => { - const llms = [{ - - }] + const llms = [{}]; const portkey = new Portkey({ mode: "single", - llms: [{ - provider:"anyscale", - virtual_key:"anyscale-3b3c04", - model: "meta-llama/Llama-2-13b-chat-hf", - max_tokens: 2000 - }] + llms: [ + { + provider: "anyscale", + virtual_key: "anyscale-3b3c04", + model: "meta-llama/Llama-2-13b-chat-hf", + max_tokens: 2000, + }, + ], }); const result = portkey.stream_chat([ { role: "system", content: "You are a helpful assistant." }, - { role: "user", content: "Tell me a joke." } + { role: "user", content: "Tell me a joke." }, ]); for await (const res of result) { - process.stdout.write(res) + process.stdout.write(res); } })(); diff --git a/apps/simple/vectorIndexAnthropic.ts b/apps/simple/vectorIndexAnthropic.ts index 6dc807cd012d9ec53c109fd2061cfa86b586b474..c979900b285d6807c2dd6f8f030810973be70c70 100644 --- a/apps/simple/vectorIndexAnthropic.ts +++ b/apps/simple/vectorIndexAnthropic.ts @@ -2,7 +2,10 @@ import fs from "node:fs/promises"; import { Anthropic, + anthropicTextQaPrompt, + CompactAndRefine, Document, + ResponseSynthesizer, serviceContextFromDefaults, VectorStoreIndex, } from "llamaindex"; @@ -18,12 +21,20 @@ async function main() { // Split text and create embeddings. Store them in a VectorStoreIndex const serviceContext = serviceContextFromDefaults({ llm: new Anthropic() }); + + const responseSynthesizer = new ResponseSynthesizer({ + responseBuilder: new CompactAndRefine( + serviceContext, + anthropicTextQaPrompt, + ), + }); + const index = await VectorStoreIndex.fromDocuments([document], { serviceContext, }); // Query the index - const queryEngine = index.asQueryEngine(); + const queryEngine = index.asQueryEngine({ responseSynthesizer }); const response = await queryEngine.query( "What did the author do in college?", ); diff --git a/apps/simple/vision.ts b/apps/simple/vision.ts new file mode 100644 index 0000000000000000000000000000000000000000..27797d00dbc1e40ebc9e696747ab5d92fa58e31d --- /dev/null +++ b/apps/simple/vision.ts @@ -0,0 +1,15 @@ +import { OpenAI } from "llamaindex"; + +(async () => { + const llm = new OpenAI({ model: "gpt-4-vision-preview", temperature: 0.1 }); + + // complete api + const response1 = await llm.complete("How are you?"); + console.log(response1.message.content); + + // chat api + const response2 = await llm.chat([ + { content: "Tell me a joke!", role: "user" }, + ]); + console.log(response2.message.content); +})(); diff --git a/examples/anthropic.ts b/examples/anthropic.ts index ae4eab14be13006b9f5b40987254c431ec663539..ee12d722740d680aea6640cb36653b50fcfa7c10 100644 --- a/examples/anthropic.ts +++ b/examples/anthropic.ts @@ -4,8 +4,6 @@ import { Anthropic } from "llamaindex"; const anthropic = new Anthropic(); const result = await anthropic.chat([ { content: "You want to talk in rhymes.", role: "system" }, - { content: "Hello, world!", role: "user" }, - { content: "Hello!", role: "assistant" }, { content: "How much wood would a woodchuck chuck if a woodchuck could chuck wood?", diff --git a/examples/clip.ts b/examples/clip.ts new file mode 100644 index 0000000000000000000000000000000000000000..6d02b7ea9622c40de6eac9f599666df26daddef5 --- /dev/null +++ b/examples/clip.ts @@ -0,0 +1,33 @@ +import { ClipEmbedding, similarity, SimilarityType } from "llamaindex"; + +async function main() { + const clip = new ClipEmbedding(); + + // Get text embeddings + const text1 = "a car"; + const textEmbedding1 = await clip.getTextEmbedding(text1); + const text2 = "a football match"; + const textEmbedding2 = await clip.getTextEmbedding(text2); + + // Get image embedding + const image = + "https://huggingface.co/datasets/Xenova/transformers.js-docs/resolve/main/football-match.jpg"; + const imageEmbedding = await clip.getImageEmbedding(image); + + // Calc similarity + const sim1 = similarity( + textEmbedding1, + imageEmbedding, + SimilarityType.DEFAULT, + ); + const sim2 = similarity( + textEmbedding2, + imageEmbedding, + SimilarityType.DEFAULT, + ); + + console.log(`Similarity between "${text1}" and the image is ${sim1}`); + console.log(`Similarity between "${text2}" and the image is ${sim2}`); +} + +main(); diff --git a/examples/directory.ts b/examples/directory.ts new file mode 100644 index 0000000000000000000000000000000000000000..bc4dd592b88c78bf3de53f552108a8b2977aa540 --- /dev/null +++ b/examples/directory.ts @@ -0,0 +1,24 @@ +import { SimpleDirectoryReader } from "llamaindex"; + +function callback( + category: string, + name: string, + status: any, + message?: string, +): boolean { + console.log(category, name, status, message); + if (name.endsWith(".pdf")) { + console.log("I DON'T WANT PDF FILES!"); + return false; + } + return true; +} + +async function main() { + // Load page + const reader = new SimpleDirectoryReader(callback); + const params = { directoryPath: "./data" }; + await reader.loadData(params); +} + +main().catch(console.error); diff --git a/examples/html.ts b/examples/html.ts new file mode 100644 index 0000000000000000000000000000000000000000..76672986180590d13a4b42c9912428ffe7598bb1 --- /dev/null +++ b/examples/html.ts @@ -0,0 +1,21 @@ +import { HTMLReader, VectorStoreIndex } from "llamaindex"; + +async function main() { + // Load page + const reader = new HTMLReader(); + const documents = await reader.loadData("data/18-1_Changelog.html"); + + // Split text and create embeddings. Store them in a VectorStoreIndex + const index = await VectorStoreIndex.fromDocuments(documents); + + // Query the index + const queryEngine = index.asQueryEngine(); + const response = await queryEngine.query( + "What were the notable changes in 18.1?", + ); + + // Output response + console.log(response.toString()); +} + +main().catch(console.error); diff --git a/examples/mongo.ts b/examples/mongo.ts new file mode 100644 index 0000000000000000000000000000000000000000..5b5f735ffb3f0ada9906d29fc429afa10deedf4c --- /dev/null +++ b/examples/mongo.ts @@ -0,0 +1,68 @@ +import { MongoClient } from "mongodb"; +import { Document } from "../../packages/core/src/Node"; +import { VectorStoreIndex } from "../../packages/core/src/indices"; +import { SimpleMongoReader } from "../../packages/core/src/readers/SimpleMongoReader"; + +import { stdin as input, stdout as output } from "node:process"; +import readline from "node:readline/promises"; + +async function main() { + //Dummy test code + const query: object = { _id: "waldo" }; + const options: object = {}; + const projections: object = { embedding: 0 }; + const limit: number = Infinity; + const uri: string = process.env.MONGODB_URI ?? "fake_uri"; + const client: MongoClient = new MongoClient(uri); + + //Where the real code starts + const MR = new SimpleMongoReader(client); + const documents: Document[] = await MR.loadData( + "data", + "posts", + 1, + {}, + options, + projections, + ); + + // + //If you need to look at low-level details of + // a queryEngine (for example, needing to check each individual node) + // + + // Split text and create embeddings. Store them in a VectorStoreIndex + // var storageContext = await storageContextFromDefaults({}); + // var serviceContext = serviceContextFromDefaults({}); + // const docStore = storageContext.docStore; + + // for (const doc of documents) { + // docStore.setDocumentHash(doc.id_, doc.hash); + // } + // const nodes = serviceContext.nodeParser.getNodesFromDocuments(documents); + // console.log(nodes); + + // + //Making Vector Store from documents + // + + const index = await VectorStoreIndex.fromDocuments(documents); + // Create query engine + const queryEngine = index.asQueryEngine(); + + const rl = readline.createInterface({ input, output }); + while (true) { + const query = await rl.question("Query: "); + + if (!query) { + break; + } + + const response = await queryEngine.query(query); + + // Output response + console.log(response.toString()); + } +} + +main(); diff --git a/examples/openai.ts b/examples/openai.ts index 4c7856be0ab9e5912cac3ca119416c6157c750ad..61acb5edd7c7af27a0f38b3a87786f6f0296593d 100644 --- a/examples/openai.ts +++ b/examples/openai.ts @@ -1,7 +1,7 @@ import { OpenAI } from "llamaindex"; (async () => { - const llm = new OpenAI({ model: "gpt-3.5-turbo", temperature: 0.0 }); + const llm = new OpenAI({ model: "gpt-4-1106-preview", temperature: 0.1 }); // complete api const response1 = await llm.complete("How are you?"); @@ -9,7 +9,7 @@ import { OpenAI } from "llamaindex"; // chat api const response2 = await llm.chat([ - { content: "Tell me a joke!", role: "user" }, + { content: "Tell me a joke.", role: "user" }, ]); console.log(response2.message.content); })(); diff --git a/examples/portkey.ts b/examples/portkey.ts index 4221b4b16650ea0ca1cf122c84fcbc20f23fba70..f5dfff2e8f50ebca340812f0f62c48344b46ebd3 100644 --- a/examples/portkey.ts +++ b/examples/portkey.ts @@ -1,23 +1,23 @@ import { Portkey } from "llamaindex"; (async () => { - const llms = [{ - - }] + const llms = [{}]; const portkey = new Portkey({ mode: "single", - llms: [{ - provider:"anyscale", - virtual_key:"anyscale-3b3c04", - model: "meta-llama/Llama-2-13b-chat-hf", - max_tokens: 2000 - }] + llms: [ + { + provider: "anyscale", + virtual_key: "anyscale-3b3c04", + model: "meta-llama/Llama-2-13b-chat-hf", + max_tokens: 2000, + }, + ], }); const result = portkey.stream_chat([ { role: "system", content: "You are a helpful assistant." }, - { role: "user", content: "Tell me a joke." } + { role: "user", content: "Tell me a joke." }, ]); for await (const res of result) { - process.stdout.write(res) + process.stdout.write(res); } })(); diff --git a/examples/vectorIndexAnthropic.ts b/examples/vectorIndexAnthropic.ts index 6dc807cd012d9ec53c109fd2061cfa86b586b474..c979900b285d6807c2dd6f8f030810973be70c70 100644 --- a/examples/vectorIndexAnthropic.ts +++ b/examples/vectorIndexAnthropic.ts @@ -2,7 +2,10 @@ import fs from "node:fs/promises"; import { Anthropic, + anthropicTextQaPrompt, + CompactAndRefine, Document, + ResponseSynthesizer, serviceContextFromDefaults, VectorStoreIndex, } from "llamaindex"; @@ -18,12 +21,20 @@ async function main() { // Split text and create embeddings. Store them in a VectorStoreIndex const serviceContext = serviceContextFromDefaults({ llm: new Anthropic() }); + + const responseSynthesizer = new ResponseSynthesizer({ + responseBuilder: new CompactAndRefine( + serviceContext, + anthropicTextQaPrompt, + ), + }); + const index = await VectorStoreIndex.fromDocuments([document], { serviceContext, }); // Query the index - const queryEngine = index.asQueryEngine(); + const queryEngine = index.asQueryEngine({ responseSynthesizer }); const response = await queryEngine.query( "What did the author do in college?", ); diff --git a/examples/vectorIndexCustomize.ts b/examples/vectorIndexCustomize.ts index 5ad55cff6c50defaca130c1e1cefe43857564741..b24e91416b0de23f97feb2659af0c9b55fbe57e7 100644 --- a/examples/vectorIndexCustomize.ts +++ b/examples/vectorIndexCustomize.ts @@ -3,6 +3,7 @@ import { OpenAI, RetrieverQueryEngine, serviceContextFromDefaults, + SimilarityPostprocessor, VectorStoreIndex, } from "llamaindex"; import essay from "./essay"; @@ -21,8 +22,16 @@ async function main() { const retriever = index.asRetriever(); retriever.similarityTopK = 5; + const nodePostprocessor = new SimilarityPostprocessor({ + similarityCutoff: 0.7, + }); // TODO: cannot pass responseSynthesizer into retriever query engine - const queryEngine = new RetrieverQueryEngine(retriever); + const queryEngine = new RetrieverQueryEngine( + retriever, + undefined, + undefined, + [nodePostprocessor], + ); const response = await queryEngine.query( "What did the author do growing up?", diff --git a/examples/vectorIndexFromVectorStore.ts b/examples/vectorIndexFromVectorStore.ts new file mode 100644 index 0000000000000000000000000000000000000000..311bc8c72225e73b1b2cc6f116b1899de22ed796 --- /dev/null +++ b/examples/vectorIndexFromVectorStore.ts @@ -0,0 +1,197 @@ +import { + OpenAI, + ResponseSynthesizer, + RetrieverQueryEngine, + serviceContextFromDefaults, + TextNode, + TreeSummarize, + VectorIndexRetriever, + VectorStore, + VectorStoreIndex, + VectorStoreQuery, + VectorStoreQueryResult, +} from "llamaindex"; + +import { Index, Pinecone, RecordMetadata } from "@pinecone-database/pinecone"; + +/** + * Please do not use this class in production; it's only for demonstration purposes. + */ +class PineconeVectorStore<T extends RecordMetadata = RecordMetadata> + implements VectorStore +{ + storesText = true; + isEmbeddingQuery = false; + + indexName!: string; + pineconeClient!: Pinecone; + index!: Index<T>; + + constructor({ indexName, client }: { indexName: string; client: Pinecone }) { + this.indexName = indexName; + this.pineconeClient = client; + this.index = client.index<T>(indexName); + } + + client() { + return this.pineconeClient; + } + + async query( + query: VectorStoreQuery, + kwargs?: any, + ): Promise<VectorStoreQueryResult> { + let queryEmbedding: number[] = []; + if (query.queryEmbedding) { + if (typeof query.alpha === "number") { + const alpha = query.alpha; + queryEmbedding = query.queryEmbedding.map((v) => v * alpha); + } else { + queryEmbedding = query.queryEmbedding; + } + } + + // Current LlamaIndexTS implementation only support exact match filter, so we use kwargs instead. + const filter = kwargs?.filter || {}; + + const response = await this.index.query({ + filter, + vector: queryEmbedding, + topK: query.similarityTopK, + includeValues: true, + includeMetadata: true, + }); + + console.log( + `Numbers of vectors returned by Pinecone after preFilters are applied: ${ + response?.matches?.length || 0 + }.`, + ); + + const topKIds: string[] = []; + const topKNodes: TextNode[] = []; + const topKScores: number[] = []; + + const metadataToNode = (metadata?: T): Partial<TextNode> => { + if (!metadata) { + throw new Error("metadata is undefined."); + } + + const nodeContent = metadata["_node_content"]; + if (!nodeContent) { + throw new Error("nodeContent is undefined."); + } + + if (typeof nodeContent !== "string") { + throw new Error("nodeContent is not a string."); + } + + return JSON.parse(nodeContent); + }; + + if (response.matches) { + for (const match of response.matches) { + const node = new TextNode({ + ...metadataToNode(match.metadata), + embedding: match.values, + }); + + topKIds.push(match.id); + topKNodes.push(node); + topKScores.push(match.score ?? 0); + } + } + + const result = { + ids: topKIds, + nodes: topKNodes, + similarities: topKScores, + }; + + return result; + } + + add(): Promise<string[]> { + return Promise.resolve([]); + } + + delete(): Promise<void> { + throw new Error("Method `delete` not implemented."); + } + + persist(): Promise<void> { + throw new Error("Method `persist` not implemented."); + } +} + +/** + * The goal of this example is to show how to use Pinecone as a vector store + * for LlamaIndexTS with(out) preFilters. + * + * It should not be used in production like that, + * as you might want to find a proper PineconeVectorStore implementation. + */ +async function main() { + process.env.PINECONE_API_KEY = "Your Pinecone API Key."; + process.env.PINECONE_ENVIRONMENT = "Your Pinecone Environment."; + process.env.PINECONE_PROJECT_ID = "Your Pinecone Project ID."; + process.env.PINECONE_INDEX_NAME = "Your Pinecone Index Name."; + process.env.OPENAI_API_KEY = "Your OpenAI API Key."; + process.env.OPENAI_API_ORGANIZATION = "Your OpenAI API Organization."; + + const getPineconeVectorStore = async () => { + return new PineconeVectorStore({ + indexName: process.env.PINECONE_INDEX_NAME || "index-name", + client: new Pinecone(), + }); + }; + + const getServiceContext = () => { + const openAI = new OpenAI({ + model: "gpt-4", + apiKey: process.env.OPENAI_API_KEY, + }); + + return serviceContextFromDefaults({ + llm: openAI, + }); + }; + + const getQueryEngine = async (filter: unknown) => { + const vectorStore = await getPineconeVectorStore(); + const serviceContext = getServiceContext(); + + const vectorStoreIndex = await VectorStoreIndex.fromVectorStore( + vectorStore, + serviceContext, + ); + + const retriever = new VectorIndexRetriever({ + index: vectorStoreIndex, + similarityTopK: 500, + }); + + const responseSynthesizer = new ResponseSynthesizer({ + serviceContext, + responseBuilder: new TreeSummarize(serviceContext), + }); + + return new RetrieverQueryEngine(retriever, responseSynthesizer, { + filter, + }); + }; + + // whatever is a key from your metadata + const queryEngine = await getQueryEngine({ + whatever: { + $gte: 1, + $lte: 100, + }, + }); + + const response = await queryEngine.query("How many results do you have?"); + + console.log(response.toString()); +} + +main().catch(console.error); diff --git a/examples/vision.ts b/examples/vision.ts new file mode 100644 index 0000000000000000000000000000000000000000..27797d00dbc1e40ebc9e696747ab5d92fa58e31d --- /dev/null +++ b/examples/vision.ts @@ -0,0 +1,15 @@ +import { OpenAI } from "llamaindex"; + +(async () => { + const llm = new OpenAI({ model: "gpt-4-vision-preview", temperature: 0.1 }); + + // complete api + const response1 = await llm.complete("How are you?"); + console.log(response1.message.content); + + // chat api + const response2 = await llm.chat([ + { content: "Tell me a joke!", role: "user" }, + ]); + console.log(response2.message.content); +})(); diff --git a/package.json b/package.json index a882f74689a12df77ac52d03347be24aab4dfdbb..bad62f6d2f87ce5dafec03cfa55693c30d12a163 100644 --- a/package.json +++ b/package.json @@ -3,7 +3,7 @@ "scripts": { "build": "turbo run build", "dev": "turbo run dev", - "format": "prettier --write \"**/*.{ts,tsx,md}\"", + "format": "prettier --write \"**/*.{js,jsx,ts,tsx,md}\"", "lint": "turbo run lint", "prepare": "husky install", "test": "turbo run test", @@ -11,25 +11,27 @@ "publish-snapshot": "turbo run build lint test && changeset version --snapshot && changeset publish" }, "devDependencies": { + "@changesets/cli": "^2.26.2", "@turbo/gen": "^1.10.16", - "@types/jest": "^29.5.6", - "eslint": "^8.52.0", + "@types/jest": "^29.5.10", + "eslint": "^8.54.0", "eslint-config-custom": "workspace:*", "husky": "^8.0.3", "jest": "^29.7.0", - "prettier": "^3.0.3", - "prettier-plugin-organize-imports": "^3.2.3", + "lint-staged": "^15.1.0", + "prettier": "^3.1.0", + "prettier-plugin-organize-imports": "^3.2.4", "ts-jest": "^29.1.1", "turbo": "^1.10.16" }, - "packageManager": "pnpm@8.10.0", - "dependencies": { - "@changesets/cli": "^2.26.2" - }, + "packageManager": "pnpm@8.10.5+sha256.a4bd9bb7b48214bbfcd95f264bd75bb70d100e5d4b58808f5cd6ab40c6ac21c5", "pnpm": { "overrides": { "trim": "1.0.1", "@babel/traverse": "7.23.2" } + }, + "lint-staged": { + "*.{js,jsx,ts,tsx,md}": "prettier --write" } } diff --git a/packages/core/CHANGELOG.md b/packages/core/CHANGELOG.md index 1f667df47b5268fa498eaae671b86d995bfe7100..3744f43c8c0f9b2b6c5cc893f729c03617cbf543 100644 --- a/packages/core/CHANGELOG.md +++ b/packages/core/CHANGELOG.md @@ -1,5 +1,30 @@ # llamaindex +## 0.0.35 + +### Patch Changes + +- 63f2108: Add multimodal support (thanks @marcusschiesser) + +## 0.0.34 + +### Patch Changes + +- 2a27e21: Add support for gpt-3.5-turbo-1106 + +## 0.0.33 + +### Patch Changes + +- 5e2e92c: gpt-4-1106-preview and gpt-4-vision-preview from OpenAI dev day + +## 0.0.32 + +### Patch Changes + +- 90c0b83: Add HTMLReader (thanks @mtutty) +- dfd22aa: Add observer/filter to the SimpleDirectoryReader (thanks @mtutty) + ## 0.0.31 ### Patch Changes diff --git a/packages/core/package.json b/packages/core/package.json index a2f51e97f7baf625862fa5e9771bf8b119b3de21..db6e81e7242daa19ce95958550e1e1458a16b526 100644 --- a/packages/core/package.json +++ b/packages/core/package.json @@ -1,36 +1,42 @@ { "name": "llamaindex", - "version": "0.0.31", + "version": "0.0.35", "license": "MIT", "dependencies": { - "@anthropic-ai/sdk": "^0.8.1", + "@anthropic-ai/sdk": "^0.9.1", "@notionhq/client": "^2.2.13", + "@xenova/transformers": "^2.8.0", "assemblyai": "^3.0.1", - "js-tiktoken": "^1.0.7", + "crypto-js": "^4.2.0", + "js-tiktoken": "^1.0.8", "lodash": "^4.17.21", "mammoth": "^1.6.0", "md-utils-ts": "^2.0.0", - "mongodb": "^6.2.0", + "mongodb": "^6.3.0", "notion-md-crawler": "^0.0.2", - "openai": "^4.14.0", + "openai": "^4.19.1", "papaparse": "^5.4.1", "pdf-parse": "^1.1.1", - "portkey-ai": "^0.1.13", + "pg": "^8.11.3", + "pgvector": "^0.1.5", + "portkey-ai": "^0.1.16", "rake-modified": "^1.0.8", - "replicate": "^0.20.1", + "replicate": "^0.21.1", "string-strip-html": "^13.4.3", "uuid": "^9.0.1", "wink-nlp": "^1.14.3" }, "devDependencies": { - "@types/lodash": "^4.14.200", - "@types/node": "^18.18.7", - "@types/papaparse": "^5.3.10", - "@types/pdf-parse": "^1.1.3", - "@types/uuid": "^9.0.6", + "@types/crypto-js": "^4.2.1", + "@types/lodash": "^4.14.202", + "@types/node": "^18.18.12", + "@types/papaparse": "^5.3.13", + "@types/pdf-parse": "^1.1.4", + "@types/pg": "^8.10.7", + "@types/uuid": "^9.0.7", "node-stdlib-browser": "^1.2.0", "tsup": "^7.2.0", - "typescript": "^5.2.2" + "typescript": "^5.3.2" }, "engines": { "node": ">=18.0.0" @@ -44,5 +50,12 @@ "test": "jest", "build": "tsup src/index.ts --format esm,cjs --dts", "dev": "tsup src/index.ts --format esm,cjs --dts --watch" + }, + "exports": { + ".": { + "require": "./dist/index.js", + "import": "./dist/index.mjs", + "types": "./dist/index.d.ts" + } } -} +} \ No newline at end of file diff --git a/packages/core/src/ChatEngine.ts b/packages/core/src/ChatEngine.ts index be28e9be8d475998568b7513352384a0080fe3fc..6089a4ac4c4bb052b22e80113bc4801c6085094a 100644 --- a/packages/core/src/ChatEngine.ts +++ b/packages/core/src/ChatEngine.ts @@ -1,8 +1,5 @@ import { v4 as uuidv4 } from "uuid"; -import { Event } from "./callbacks/CallbackManager"; import { ChatHistory } from "./ChatHistory"; -import { BaseNodePostprocessor } from "./indices/BaseNodePostprocessor"; -import { ChatMessage, LLM, OpenAI } from "./llm/LLM"; import { NodeWithScore, TextNode } from "./Node"; import { CondenseQuestionPrompt, @@ -15,6 +12,9 @@ import { BaseQueryEngine } from "./QueryEngine"; import { Response } from "./Response"; import { BaseRetriever } from "./Retriever"; import { ServiceContext, serviceContextFromDefaults } from "./ServiceContext"; +import { Event } from "./callbacks/CallbackManager"; +import { BaseNodePostprocessor } from "./indices/BaseNodePostprocessor"; +import { ChatMessage, LLM, OpenAI } from "./llm/LLM"; /** * A ChatEngine is used to handle back and forth chats between the application and the LLM. @@ -328,6 +328,17 @@ export class ContextChatEngine implements ChatEngine { } } +export interface MessageContentDetail { + type: "text" | "image_url"; + text: string; + image_url: { url: string }; +} + +/** + * Extended type for the content of a message that allows for multi-modal messages. + */ +export type MessageContent = string | MessageContentDetail[]; + /** * HistoryChatEngine is a ChatEngine that uses a `ChatHistory` object * to keeps track of chat's message history. @@ -347,38 +358,34 @@ export class HistoryChatEngine { async chat< T extends boolean | undefined = undefined, R = T extends true ? AsyncGenerator<string, void, unknown> : Response, - >(message: string, chatHistory: ChatHistory, streaming?: T): Promise<R> { + >( + message: MessageContent, + chatHistory: ChatHistory, + streaming?: T, + ): Promise<R> { //Streaming option if (streaming) { return this.streamChat(message, chatHistory) as R; } - const context = await this.contextGenerator?.generate(message); - chatHistory.addMessage({ - content: message, - role: "user", - }); - const response = await this.llm.chat( - await chatHistory.requestMessages( - context ? [context.message] : undefined, - ), + const requestMessages = await this.prepareRequestMessages( + message, + chatHistory, ); + const response = await this.llm.chat(requestMessages); chatHistory.addMessage(response.message); return new Response(response.message.content) as R; } protected async *streamChat( - message: string, + message: MessageContent, chatHistory: ChatHistory, ): AsyncGenerator<string, void, unknown> { - const context = await this.contextGenerator?.generate(message); - chatHistory.addMessage({ - content: message, - role: "user", - }); + const requestMessages = await this.prepareRequestMessages( + message, + chatHistory, + ); const response_stream = await this.llm.chat( - await chatHistory.requestMessages( - context ? [context.message] : undefined, - ), + requestMessages, undefined, true, ); @@ -394,4 +401,31 @@ export class HistoryChatEngine { }); return; } + + private async prepareRequestMessages( + message: MessageContent, + chatHistory: ChatHistory, + ) { + chatHistory.addMessage({ + content: message, + role: "user", + }); + let requestMessages; + let context; + if (this.contextGenerator) { + if (Array.isArray(message)) { + // message is of type MessageContentDetail[] - retrieve just the text parts and concatenate them + // so we can pass them to the context generator + message = (message as MessageContentDetail[]) + .filter((c) => c.type === "text") + .map((c) => c.text) + .join("\n\n"); + } + context = await this.contextGenerator.generate(message); + } + requestMessages = await chatHistory.requestMessages( + context ? [context.message] : undefined, + ); + return requestMessages; + } } diff --git a/packages/core/src/GlobalsHelper.ts b/packages/core/src/GlobalsHelper.ts index 3e57a274f03021f9d41e3e33f48b528de0621226..d1d82280d35234575d681d770b74284cc1aae332 100644 --- a/packages/core/src/GlobalsHelper.ts +++ b/packages/core/src/GlobalsHelper.ts @@ -1,4 +1,4 @@ -import { encodingForModel, TiktokenModel } from "js-tiktoken"; +import { encodingForModel } from "js-tiktoken"; import { v4 as uuidv4 } from "uuid"; import { Event, EventTag, EventType } from "./callbacks/CallbackManager"; @@ -27,7 +27,7 @@ class GlobalsHelper { const numberArray = Array.from(tokens); const text = encoding.decode(numberArray); const uint8Array = new TextEncoder().encode(text); - return new TextDecoder().decode(uint8Array); + return new TextDecoder().decode(uint8Array); }, }; } @@ -39,10 +39,10 @@ class GlobalsHelper { if (!this.defaultTokenizer) { this.initDefaultTokenizer(); } - + return this.defaultTokenizer!.encode.bind(this.defaultTokenizer); } - + tokenizerDecoder(encoding?: string) { if (encoding && encoding !== Tokenizers.CL100K_BASE) { throw new Error(`Tokenizer encoding ${encoding} not yet supported`); @@ -50,7 +50,7 @@ class GlobalsHelper { if (!this.defaultTokenizer) { this.initDefaultTokenizer(); } - + return this.defaultTokenizer!.decode.bind(this.defaultTokenizer); } diff --git a/packages/core/src/Node.ts b/packages/core/src/Node.ts index 1908e67248a6945774b2e0728583ecd3ac676f8b..d60f358e4bc364e52d9a15b8ee27adaac0535e12 100644 --- a/packages/core/src/Node.ts +++ b/packages/core/src/Node.ts @@ -1,4 +1,4 @@ -import crypto from "crypto"; // TODO Node dependency +import CryptoJS from "crypto-js"; import { v4 as uuidv4 } from "uuid"; export enum NodeRelationship { @@ -175,13 +175,13 @@ export class TextNode<T extends Metadata = Metadata> extends BaseNode<T> { * @returns */ generateHash() { - const hashFunction = crypto.createHash("sha256"); + const hashFunction = CryptoJS.algo.SHA256.create(); hashFunction.update(`type=${this.getType()}`); hashFunction.update( `startCharIdx=${this.startCharIdx} endCharIdx=${this.endCharIdx}`, ); hashFunction.update(this.getContent(MetadataMode.ALL)); - return hashFunction.digest("base64"); + return hashFunction.finalize().toString(CryptoJS.enc.Base64); } getType(): ObjectType { @@ -272,12 +272,13 @@ export class Document<T extends Metadata = Metadata> extends TextNode<T> { } } -export function jsonToNode(json: any) { - if (!json.type) { +export function jsonToNode(json: any, type?: ObjectType) { + if (!json.type && !type) { throw new Error("Node type not found"); } + const nodeType = type || json.type; - switch (json.type) { + switch (nodeType) { case ObjectType.TEXT: return new TextNode(json); case ObjectType.INDEX: @@ -285,7 +286,7 @@ export function jsonToNode(json: any) { case ObjectType.DOCUMENT: return new Document(json); default: - throw new Error(`Invalid node type: ${json.type}`); + throw new Error(`Invalid node type: ${nodeType}`); } } diff --git a/packages/core/src/Prompt.ts b/packages/core/src/Prompt.ts index ef0ff0845f28a78c1e0f71e63806ae943f602c60..be03ef76c775d21cbbcb900a21d0e6118cc774d7 100644 --- a/packages/core/src/Prompt.ts +++ b/packages/core/src/Prompt.ts @@ -36,6 +36,15 @@ Answer:`; export type TextQaPrompt = typeof defaultTextQaPrompt; +export const anthropicTextQaPrompt = ({ context = "", query = "" }) => { + return `Context information: +<context> +${context} +</context> +Given the context information and not prior knowledge, answer the query. +Query: ${query}`; +}; + /* DEFAULT_SUMMARY_PROMPT_TMPL = ( "Write a summary of the following. Try to use only the " diff --git a/packages/core/src/ServiceContext.ts b/packages/core/src/ServiceContext.ts index efefd319b268af54f279b25dde3af2b1ce4980a7..e1490a1995f8dd699f4dcb09cb37a5d968b86ecb 100644 --- a/packages/core/src/ServiceContext.ts +++ b/packages/core/src/ServiceContext.ts @@ -1,8 +1,8 @@ -import { BaseEmbedding, OpenAIEmbedding } from "./Embedding"; -import { NodeParser, SimpleNodeParser } from "./NodeParser"; -import { PromptHelper } from "./PromptHelper"; import { CallbackManager } from "./callbacks/CallbackManager"; +import { BaseEmbedding, OpenAIEmbedding } from "./embeddings"; import { LLM, OpenAI } from "./llm/LLM"; +import { NodeParser, SimpleNodeParser } from "./NodeParser"; +import { PromptHelper } from "./PromptHelper"; /** * The ServiceContext is a collection of components that are used in different parts of the application. diff --git a/packages/core/src/callbacks/CallbackManager.ts b/packages/core/src/callbacks/CallbackManager.ts index 266058261ecaa2024cf55ecc792ee5ccce606c33..56219b3205887207356cfbfce302ad3312535330 100644 --- a/packages/core/src/callbacks/CallbackManager.ts +++ b/packages/core/src/callbacks/CallbackManager.ts @@ -30,7 +30,7 @@ export interface DefaultStreamToken { index: number; delta: { content?: string | null; - role?: "user" | "assistant" | "system" | "function"; + role?: "user" | "assistant" | "system" | "function" | "tool"; }; finish_reason: string | null; }[]; diff --git a/packages/core/src/embeddings/ClipEmbedding.ts b/packages/core/src/embeddings/ClipEmbedding.ts new file mode 100644 index 0000000000000000000000000000000000000000..b75b4b879c502b9f255b719985f3c0392e49f027 --- /dev/null +++ b/packages/core/src/embeddings/ClipEmbedding.ts @@ -0,0 +1,78 @@ +import { MultiModalEmbedding } from "./MultiModalEmbedding"; +import { ImageType, readImage } from "./utils"; + +export enum ClipEmbeddingModelType { + XENOVA_CLIP_VIT_BASE_PATCH32 = "Xenova/clip-vit-base-patch32", + XENOVA_CLIP_VIT_BASE_PATCH16 = "Xenova/clip-vit-base-patch16", +} + +export class ClipEmbedding extends MultiModalEmbedding { + modelType: ClipEmbeddingModelType = + ClipEmbeddingModelType.XENOVA_CLIP_VIT_BASE_PATCH16; + + private tokenizer: any; + private processor: any; + private visionModel: any; + private textModel: any; + + async getTokenizer() { + if (!this.tokenizer) { + const { AutoTokenizer } = await import("@xenova/transformers"); + this.tokenizer = await AutoTokenizer.from_pretrained(this.modelType); + } + return this.tokenizer; + } + + async getProcessor() { + if (!this.processor) { + const { AutoProcessor } = await import("@xenova/transformers"); + this.processor = await AutoProcessor.from_pretrained(this.modelType); + } + return this.processor; + } + + async getVisionModel() { + if (!this.visionModel) { + const { CLIPVisionModelWithProjection } = await import( + "@xenova/transformers" + ); + this.visionModel = await CLIPVisionModelWithProjection.from_pretrained( + this.modelType, + ); + } + + return this.visionModel; + } + + async getTextModel() { + if (!this.textModel) { + const { CLIPTextModelWithProjection } = await import( + "@xenova/transformers" + ); + this.textModel = await CLIPTextModelWithProjection.from_pretrained( + this.modelType, + ); + } + + return this.textModel; + } + + async getImageEmbedding(image: ImageType): Promise<number[]> { + const loadedImage = await readImage(image); + const imageInputs = await (await this.getProcessor())(loadedImage); + const { image_embeds } = await (await this.getVisionModel())(imageInputs); + return image_embeds.data; + } + + async getTextEmbedding(text: string): Promise<number[]> { + const textInputs = await ( + await this.getTokenizer() + )([text], { padding: true, truncation: true }); + const { text_embeds } = await (await this.getTextModel())(textInputs); + return text_embeds.data; + } + + async getQueryEmbedding(query: string): Promise<number[]> { + return this.getTextEmbedding(query); + } +} diff --git a/packages/core/src/embeddings/MultiModalEmbedding.ts b/packages/core/src/embeddings/MultiModalEmbedding.ts new file mode 100644 index 0000000000000000000000000000000000000000..c86ba07211ba54b157b043252324270549889502 --- /dev/null +++ b/packages/core/src/embeddings/MultiModalEmbedding.ts @@ -0,0 +1,17 @@ +import { BaseEmbedding } from "./types"; +import { ImageType } from "./utils"; + +/* + * Base class for Multi Modal embeddings. + */ + +export abstract class MultiModalEmbedding extends BaseEmbedding { + abstract getImageEmbedding(images: ImageType): Promise<number[]>; + + async getImageEmbeddings(images: ImageType[]): Promise<number[][]> { + // Embed the input sequence of images asynchronously. + return Promise.all( + images.map((imgFilePath) => this.getImageEmbedding(imgFilePath)), + ); + } +} diff --git a/packages/core/src/embeddings/OpenAIEmbedding.ts b/packages/core/src/embeddings/OpenAIEmbedding.ts new file mode 100644 index 0000000000000000000000000000000000000000..106c6cbff294d49bf87d912676e3656339b1b4c8 --- /dev/null +++ b/packages/core/src/embeddings/OpenAIEmbedding.ts @@ -0,0 +1,92 @@ +import { ClientOptions as OpenAIClientOptions } from "openai"; +import { + AzureOpenAIConfig, + getAzureBaseUrl, + getAzureConfigFromEnv, + getAzureModel, + shouldUseAzure, +} from "../llm/azure"; +import { OpenAISession, getOpenAISession } from "../llm/openai"; +import { BaseEmbedding } from "./types"; + +export enum OpenAIEmbeddingModelType { + TEXT_EMBED_ADA_002 = "text-embedding-ada-002", +} + +export class OpenAIEmbedding extends BaseEmbedding { + model: OpenAIEmbeddingModelType; + + // OpenAI session params + apiKey?: string = undefined; + maxRetries: number; + timeout?: number; + additionalSessionOptions?: Omit< + Partial<OpenAIClientOptions>, + "apiKey" | "maxRetries" | "timeout" + >; + + session: OpenAISession; + + constructor(init?: Partial<OpenAIEmbedding> & { azure?: AzureOpenAIConfig }) { + super(); + + this.model = OpenAIEmbeddingModelType.TEXT_EMBED_ADA_002; + + this.maxRetries = init?.maxRetries ?? 10; + this.timeout = init?.timeout ?? 60 * 1000; // Default is 60 seconds + this.additionalSessionOptions = init?.additionalSessionOptions; + + if (init?.azure || shouldUseAzure()) { + const azureConfig = getAzureConfigFromEnv({ + ...init?.azure, + model: getAzureModel(this.model), + }); + + if (!azureConfig.apiKey) { + throw new Error( + "Azure API key is required for OpenAI Azure models. Please set the AZURE_OPENAI_KEY environment variable.", + ); + } + + this.apiKey = azureConfig.apiKey; + this.session = + init?.session ?? + getOpenAISession({ + azure: true, + apiKey: this.apiKey, + baseURL: getAzureBaseUrl(azureConfig), + maxRetries: this.maxRetries, + timeout: this.timeout, + defaultQuery: { "api-version": azureConfig.apiVersion }, + ...this.additionalSessionOptions, + }); + } else { + this.apiKey = init?.apiKey ?? undefined; + this.session = + init?.session ?? + getOpenAISession({ + apiKey: this.apiKey, + maxRetries: this.maxRetries, + timeout: this.timeout, + ...this.additionalSessionOptions, + }); + } + } + + private async getOpenAIEmbedding(input: string) { + const { data } = await this.session.openai.embeddings.create({ + model: this.model, + input, + }); + + return data[0].embedding; + } + + async getTextEmbedding(text: string): Promise<number[]> { + return this.getOpenAIEmbedding(text); + } + + async getQueryEmbedding(query: string): Promise<number[]> { + return this.getOpenAIEmbedding(query); + } +} diff --git a/packages/core/src/embeddings/index.ts b/packages/core/src/embeddings/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..1a6a4df04ef2225f44049e2819660afbc0e2b836 --- /dev/null +++ b/packages/core/src/embeddings/index.ts @@ -0,0 +1,5 @@ +export * from "./ClipEmbedding"; +export * from "./MultiModalEmbedding"; +export * from "./OpenAIEmbedding"; +export * from "./types"; +export * from "./utils"; diff --git a/packages/core/src/embeddings/types.ts b/packages/core/src/embeddings/types.ts new file mode 100644 index 0000000000000000000000000000000000000000..e500f94522a4b729a47650f0d6c21099fc79d0e1 --- /dev/null +++ b/packages/core/src/embeddings/types.ts @@ -0,0 +1,24 @@ +import { similarity } from "./utils"; + +/** + * Similarity type + * Default is cosine similarity. Dot product and negative Euclidean distance are also supported. + */ +export enum SimilarityType { + DEFAULT = "cosine", + DOT_PRODUCT = "dot_product", + EUCLIDEAN = "euclidean", +} + +export abstract class BaseEmbedding { + similarity( + embedding1: number[], + embedding2: number[], + mode: SimilarityType = SimilarityType.DEFAULT, + ): number { + return similarity(embedding1, embedding2, mode); + } + + abstract getTextEmbedding(text: string): Promise<number[]>; + abstract getQueryEmbedding(query: string): Promise<number[]>; +} diff --git a/packages/core/src/Embedding.ts b/packages/core/src/embeddings/utils.ts similarity index 63% rename from packages/core/src/Embedding.ts rename to packages/core/src/embeddings/utils.ts index 5723f888cbeb1d746e80da3d99b6566a4c77d21b..cd192c3d4faa08a5b4f81c6a796de1e89233ca45 100644 --- a/packages/core/src/Embedding.ts +++ b/packages/core/src/embeddings/utils.ts @@ -1,33 +1,16 @@ -import { ClientOptions as OpenAIClientOptions } from "openai"; - -import { DEFAULT_SIMILARITY_TOP_K } from "./constants"; -import { - AzureOpenAIConfig, - getAzureBaseUrl, - getAzureConfigFromEnv, - getAzureModel, - shouldUseAzure, -} from "./llm/azure"; -import { OpenAISession, getOpenAISession } from "./llm/openai"; -import { VectorStoreQueryMode } from "./storage/vectorStore/types"; - -/** - * Similarity type - * Default is cosine similarity. Dot product and negative Euclidean distance are also supported. - */ -export enum SimilarityType { - DEFAULT = "cosine", - DOT_PRODUCT = "dot_product", - EUCLIDEAN = "euclidean", -} +import _ from "lodash"; +import { DEFAULT_SIMILARITY_TOP_K } from "../constants"; +import { VectorStoreQueryMode } from "../storage"; +import { SimilarityType } from "./types"; /** * The similarity between two embeddings. * @param embedding1 * @param embedding2 * @param mode - * @returns similartiy score with higher numbers meaning the two embeddings are more similar + * @returns similarity score with higher numbers meaning the two embeddings are more similar */ + export function similarity( embedding1: number[], embedding2: number[], @@ -42,7 +25,6 @@ export function similarity( // will probably cause some avoidable loss of floating point precision // ml-distance is worth watching although they currently also use the naive // formulas - function norm(x: number[]): number { let result = 0; for (let i = 0; i < x.length; i++) { @@ -201,98 +183,14 @@ export function getTopKMMREmbeddings( return [resultSimilarities, resultIds]; } - -export abstract class BaseEmbedding { - similarity( - embedding1: number[], - embedding2: number[], - mode: SimilarityType = SimilarityType.DEFAULT, - ): number { - return similarity(embedding1, embedding2, mode); - } - - abstract getTextEmbedding(text: string): Promise<number[]>; - abstract getQueryEmbedding(query: string): Promise<number[]>; -} - -enum OpenAIEmbeddingModelType { - TEXT_EMBED_ADA_002 = "text-embedding-ada-002", -} - -export class OpenAIEmbedding extends BaseEmbedding { - model: OpenAIEmbeddingModelType; - - // OpenAI session params - apiKey?: string = undefined; - maxRetries: number; - timeout?: number; - additionalSessionOptions?: Omit< - Partial<OpenAIClientOptions>, - "apiKey" | "maxRetries" | "timeout" - >; - - session: OpenAISession; - - constructor(init?: Partial<OpenAIEmbedding> & { azure?: AzureOpenAIConfig }) { - super(); - - this.model = OpenAIEmbeddingModelType.TEXT_EMBED_ADA_002; - - this.maxRetries = init?.maxRetries ?? 10; - this.timeout = init?.timeout ?? 60 * 1000; // Default is 60 seconds - this.additionalSessionOptions = init?.additionalSessionOptions; - - if (init?.azure || shouldUseAzure()) { - const azureConfig = getAzureConfigFromEnv({ - ...init?.azure, - model: getAzureModel(this.model), - }); - - if (!azureConfig.apiKey) { - throw new Error( - "Azure API key is required for OpenAI Azure models. Please set the AZURE_OPENAI_KEY environment variable.", - ); - } - - this.apiKey = azureConfig.apiKey; - this.session = - init?.session ?? - getOpenAISession({ - azure: true, - apiKey: this.apiKey, - baseURL: getAzureBaseUrl(azureConfig), - maxRetries: this.maxRetries, - timeout: this.timeout, - defaultQuery: { "api-version": azureConfig.apiVersion }, - ...this.additionalSessionOptions, - }); - } else { - this.apiKey = init?.apiKey ?? undefined; - this.session = - init?.session ?? - getOpenAISession({ - apiKey: this.apiKey, - maxRetries: this.maxRetries, - timeout: this.timeout, - ...this.additionalSessionOptions, - }); - } - } - - private async getOpenAIEmbedding(input: string) { - const { data } = await this.session.openai.embeddings.create({ - model: this.model, - input, - }); - - return data[0].embedding; - } - - async getTextEmbedding(text: string): Promise<number[]> { - return this.getOpenAIEmbedding(text); - } - - async getQueryEmbedding(query: string): Promise<number[]> { - return this.getOpenAIEmbedding(query); +export async function readImage(input: ImageType) { + const { RawImage } = await import("@xenova/transformers"); + if (input instanceof Blob) { + return await RawImage.fromBlob(input); + } else if (_.isString(input) || input instanceof URL) { + return await RawImage.fromURL(input); + } else { + throw new Error(`Unsupported input type: ${typeof input}`); } } +export type ImageType = string | Blob | URL; diff --git a/packages/core/src/index.ts b/packages/core/src/index.ts index fa1758bc7b75db86f5f070f442fffa7f103a4cc0..c049a0710edd6b362be6784a3579850f3d1957c7 100644 --- a/packages/core/src/index.ts +++ b/packages/core/src/index.ts @@ -1,11 +1,6 @@ -export * from "./callbacks/CallbackManager"; export * from "./ChatEngine"; export * from "./ChatHistory"; -export * from "./constants"; -export * from "./Embedding"; export * from "./GlobalsHelper"; -export * from "./indices"; -export * from "./llm/LLM"; export * from "./Node"; export * from "./NodeParser"; export * from "./OutputParser"; @@ -13,18 +8,24 @@ export * from "./Prompt"; export * from "./PromptHelper"; export * from "./QueryEngine"; export * from "./QuestionGenerator"; -export * from "./readers/base"; -export * from "./readers/CSVReader"; -export * from "./readers/AssemblyAI"; -export * from "./readers/MarkdownReader"; -export * from "./readers/NotionReader"; -export * from "./readers/PDFReader"; -export * from "./readers/HTMLReader"; -export * from "./readers/SimpleDirectoryReader"; export * from "./Response"; export * from "./ResponseSynthesizer"; export * from "./Retriever"; export * from "./ServiceContext"; -export * from "./storage"; export * from "./TextSplitter"; export * from "./Tool"; +export * from "./callbacks/CallbackManager"; +export * from "./constants"; +export * from "./embeddings"; +export * from "./indices"; +export * from "./llm/LLM"; +export * from "./readers/AssemblyAI"; +export * from "./readers/CSVReader"; +export * from "./readers/HTMLReader"; +export * from "./readers/MarkdownReader"; +export * from "./readers/NotionReader"; +export * from "./readers/PDFReader"; +export * from "./readers/SimpleDirectoryReader"; +export * from "./readers/SimpleMongoReader"; +export * from "./readers/base"; +export * from "./storage"; diff --git a/packages/core/src/indices/vectorStore/VectorIndexRetriever.ts b/packages/core/src/indices/vectorStore/VectorIndexRetriever.ts index 8e3bff9270c42b1a4e89a678a21beb4ce2959c35..1cfa454e1482e1e8268e9fb1e0ca469e6dfcd551 100644 --- a/packages/core/src/indices/vectorStore/VectorIndexRetriever.ts +++ b/packages/core/src/indices/vectorStore/VectorIndexRetriever.ts @@ -32,7 +32,11 @@ export class VectorIndexRetriever implements BaseRetriever { this.similarityTopK = similarityTopK ?? DEFAULT_SIMILARITY_TOP_K; } - async retrieve(query: string, parentEvent?: Event, preFilters?: unknown): Promise<NodeWithScore[]> { + async retrieve( + query: string, + parentEvent?: Event, + preFilters?: unknown, + ): Promise<NodeWithScore[]> { const queryEmbedding = await this.serviceContext.embedModel.getQueryEmbedding(query); diff --git a/packages/core/src/llm/LLM.ts b/packages/core/src/llm/LLM.ts index 9d69743f577141b5aff793dc07faf9497bc7f0d8..7ebc7bca5333f2a182d1dfa2e90d6c5783ea69ab 100644 --- a/packages/core/src/llm/LLM.ts +++ b/packages/core/src/llm/LLM.ts @@ -8,12 +8,13 @@ import { StreamCallbackResponse, } from "../callbacks/CallbackManager"; +import { ChatCompletionMessageParam } from "openai/resources"; import { LLMOptions } from "portkey-ai"; import { globalsHelper, Tokenizers } from "../GlobalsHelper"; import { - AnthropicSession, ANTHROPIC_AI_PROMPT, ANTHROPIC_HUMAN_PROMPT, + AnthropicSession, getAnthropicSession, } from "./anthropic"; import { @@ -36,7 +37,7 @@ export type MessageType = | "memory"; export interface ChatMessage { - content: string; + content: any; role: MessageType; } @@ -102,11 +103,14 @@ export interface LLM { export const GPT4_MODELS = { "gpt-4": { contextWindow: 8192 }, "gpt-4-32k": { contextWindow: 32768 }, + "gpt-4-1106-preview": { contextWindow: 128000 }, + "gpt-4-vision-preview": { contextWindow: 8192 }, }; -export const TURBO_MODELS = { +export const GPT35_MODELS = { "gpt-3.5-turbo": { contextWindow: 4096 }, "gpt-3.5-turbo-16k": { contextWindow: 16384 }, + "gpt-3.5-turbo-1106": { contextWindow: 16384 }, }; /** @@ -114,7 +118,7 @@ export const TURBO_MODELS = { */ export const ALL_AVAILABLE_OPENAI_MODELS = { ...GPT4_MODELS, - ...TURBO_MODELS, + ...GPT35_MODELS, }; /** @@ -250,10 +254,13 @@ export class OpenAI implements LLM { model: this.model, temperature: this.temperature, max_tokens: this.maxTokens, - messages: messages.map((message) => ({ - role: this.mapMessageType(message.role), - content: message.content, - })), + messages: messages.map( + (message) => + ({ + role: this.mapMessageType(message.role), + content: message.content, + }) as ChatCompletionMessageParam, + ), top_p: this.topP, ...this.additionalChatOptions, }; @@ -298,10 +305,13 @@ export class OpenAI implements LLM { model: this.model, temperature: this.temperature, max_tokens: this.maxTokens, - messages: messages.map((message) => ({ - role: this.mapMessageType(message.role), - content: message.content, - })), + messages: messages.map( + (message) => + ({ + role: this.mapMessageType(message.role), + content: message.content, + }) as ChatCompletionMessageParam, + ), top_p: this.topP, ...this.additionalChatOptions, }; @@ -367,10 +377,10 @@ export const ALL_AVAILABLE_LLAMADEUCE_MODELS = { "Llama-2-70b-chat-4bit": { contextWindow: 4096, replicateApi: - "replicate/llama70b-v2-chat:2c1608e18606fad2812020dc541930f2d0495ce32eee50074220b87300bc16e1", + "meta/llama-2-70b-chat:02e509c789964a7ea8736978a43525956ef40397be9033abf9fd2badfe68c9e3", //^ Model is based off of exllama 4bit. }, - "Llama-2-13b-chat": { + "Llama-2-13b-chat-old": { contextWindow: 4096, replicateApi: "a16z-infra/llama13b-v2-chat:df7690f1994d94e96ad9d568eac121aecf50684a0b0963b25a41cc40061269e5", @@ -379,9 +389,9 @@ export const ALL_AVAILABLE_LLAMADEUCE_MODELS = { "Llama-2-13b-chat-4bit": { contextWindow: 4096, replicateApi: - "a16z-infra/llama13b-v2-chat:2a7f981751ec7fdf87b5b91ad4db53683a98082e9ff7bfd12c8cd5ea85980a52", + "meta/llama-2-13b-chat:f4e2de70d66816a838a89eeeb621910adffb0dd0baba3976c96980970978018d", }, - "Llama-2-7b-chat": { + "Llama-2-7b-chat-old": { contextWindow: 4096, replicateApi: "a16z-infra/llama7b-v2-chat:4f0a4744c7295c024a1de15e1a63c880d3da035fa1f49bfd344fe076074c8eea", @@ -393,7 +403,7 @@ export const ALL_AVAILABLE_LLAMADEUCE_MODELS = { "Llama-2-7b-chat-4bit": { contextWindow: 4096, replicateApi: - "a16z-infra/llama7b-v2-chat:4f0b260b6a13eb53a6b1891f089d57c08f41003ae79458be5011303d81a394dc", + "meta/llama-2-7b-chat:13c3cdee13ee059ab779f0291d29054dab00a47dad8261375654de5540165fb0", }, }; @@ -405,6 +415,8 @@ export enum DeuceChatStrategy { // Unfortunately any string only API won't support these properly. REPLICATE4BIT = "replicate4bit", //^ To satisfy Replicate's 4 bit models' requirements where they also insert some INST tags + REPLICATE4BITWNEWLINES = "replicate4bitwnewlines", + //^ Replicate's documentation recommends using newlines: https://replicate.com/blog/how-to-prompt-llama } /** @@ -424,7 +436,7 @@ export class LlamaDeuce implements LLM { this.chatStrategy = init?.chatStrategy ?? (this.model.endsWith("4bit") - ? DeuceChatStrategy.REPLICATE4BIT // With the newer A16Z/Replicate models they do the system message themselves. + ? DeuceChatStrategy.REPLICATE4BITWNEWLINES // With the newer Replicate models they do the system message themselves. : DeuceChatStrategy.METAWBOS); // With BOS and EOS seems to work best, although they all have problems past a certain point this.temperature = init?.temperature ?? 0.1; // minimum temperature is 0.01 for Replicate endpoint this.topP = init?.topP ?? 1; @@ -458,7 +470,15 @@ export class LlamaDeuce implements LLM { } else if (this.chatStrategy === DeuceChatStrategy.METAWBOS) { return this.mapMessagesToPromptMeta(messages, { withBos: true }); } else if (this.chatStrategy === DeuceChatStrategy.REPLICATE4BIT) { - return this.mapMessagesToPromptMeta(messages, { replicate4Bit: true }); + return this.mapMessagesToPromptMeta(messages, { + replicate4Bit: true, + withNewlines: true, + }); + } else if (this.chatStrategy === DeuceChatStrategy.REPLICATE4BITWNEWLINES) { + return this.mapMessagesToPromptMeta(messages, { + replicate4Bit: true, + withNewlines: true, + }); } else { return this.mapMessagesToPromptMeta(messages); } @@ -493,9 +513,17 @@ export class LlamaDeuce implements LLM { mapMessagesToPromptMeta( messages: ChatMessage[], - opts?: { withBos?: boolean; replicate4Bit?: boolean }, + opts?: { + withBos?: boolean; + replicate4Bit?: boolean; + withNewlines?: boolean; + }, ) { - const { withBos = false, replicate4Bit = false } = opts ?? {}; + const { + withBos = false, + replicate4Bit = false, + withNewlines = false, + } = opts ?? {}; const DEFAULT_SYSTEM_PROMPT = `You are a helpful, respectful and honest assistant. Always answer as helpfully as possible, while being safe. Your answers should not include any harmful, unethical, racist, sexist, toxic, dangerous, or illegal content. Please ensure that your responses are socially unbiased and positive in nature. If a question does not make any sense, or is not factually coherent, explain why instead of answering something not correct. If you don't know the answer to a question, please don't share false information.`; @@ -543,11 +571,18 @@ If a question does not make any sense, or is not factually coherent, explain why return { prompt: messages.reduce((acc, message, index) => { if (index % 2 === 0) { - return `${acc}${ - withBos ? BOS : "" - }${B_INST} ${message.content.trim()} ${E_INST}`; + return ( + `${acc}${ + withBos ? BOS : "" + }${B_INST} ${message.content.trim()} ${E_INST}` + + (withNewlines ? "\n" : "") + ); } else { - return `${acc} ${message.content.trim()} ` + (withBos ? EOS : ""); // Yes, the EOS comes after the space. This is not a mistake. + return ( + `${acc} ${message.content.trim()}` + + (withNewlines ? "\n" : " ") + + (withBos ? EOS : "") + ); // Yes, the EOS comes after the space. This is not a mistake. } }, ""), systemPrompt, @@ -604,7 +639,7 @@ If a question does not make any sense, or is not factually coherent, explain why export const ALL_AVAILABLE_ANTHROPIC_MODELS = { // both models have 100k context window, see https://docs.anthropic.com/claude/reference/selecting-a-model - "claude-2": { contextWindow: 100000 }, + "claude-2": { contextWindow: 200000 }, "claude-instant-1": { contextWindow: 100000 }, }; @@ -648,7 +683,7 @@ export class Anthropic implements LLM { this.callbackManager = init?.callbackManager; } - + tokens(messages: ChatMessage[]): number { throw new Error("Method not implemented."); } @@ -670,10 +705,12 @@ export class Anthropic implements LLM { return ( acc + `${ - message.role === "assistant" - ? ANTHROPIC_AI_PROMPT - : ANTHROPIC_HUMAN_PROMPT - } ${message.content} ` + message.role === "system" + ? "" + : message.role === "assistant" + ? ANTHROPIC_AI_PROMPT + " " + : ANTHROPIC_HUMAN_PROMPT + " " + }${message.content.trim()}` ); }, "") + ANTHROPIC_AI_PROMPT ); @@ -694,6 +731,7 @@ export class Anthropic implements LLM { } return this.streamChat(messages, parentEvent) as R; } + //Non-streaming const response = await this.session.anthropic.completions.create({ model: this.model, diff --git a/packages/core/src/llm/openai.ts b/packages/core/src/llm/openai.ts index 2f1cb2c60da9706bcf95d0c89aae97a6feede08c..e7a6795f583c268f31983fc41a0a5c7fee49c690 100644 --- a/packages/core/src/llm/openai.ts +++ b/packages/core/src/llm/openai.ts @@ -24,7 +24,10 @@ export class OpenAISession { if (options.azure) { this.openai = new AzureOpenAI(options); } else { - this.openai = new OpenAI(options); + this.openai = new OpenAI({ + ...options, + // defaultHeaders: { "OpenAI-Beta": "assistants=v1" }, + }); } } } diff --git a/packages/core/src/llm/portkey.ts b/packages/core/src/llm/portkey.ts index b4a5a326a2eda760572a22324b55818f8b8a5b55..92e65b1a3ebcfebc1d464578687f4705f35ead68 100644 --- a/packages/core/src/llm/portkey.ts +++ b/packages/core/src/llm/portkey.ts @@ -1,9 +1,12 @@ import _ from "lodash"; import { LLMOptions, Portkey } from "portkey-ai"; -export const readEnv = (env: string, default_val?: string): string | undefined => { - if (typeof process !== 'undefined') { - return process.env?.[env] ?? default_val; +export const readEnv = ( + env: string, + default_val?: string, +): string | undefined => { + if (typeof process !== "undefined") { + return process.env?.[env] ?? default_val; } return default_val; }; @@ -12,23 +15,23 @@ interface PortkeyOptions { apiKey?: string; baseURL?: string; mode?: string; - llms?: [LLMOptions] | null + llms?: [LLMOptions] | null; } export class PortkeySession { portkey: Portkey; - constructor(options:PortkeyOptions = {}) { + constructor(options: PortkeyOptions = {}) { if (!options.apiKey) { - options.apiKey = readEnv('PORTKEY_API_KEY') + options.apiKey = readEnv("PORTKEY_API_KEY"); } if (!options.baseURL) { - options.baseURL = readEnv('PORTKEY_BASE_URL', "https://api.portkey.ai") + options.baseURL = readEnv("PORTKEY_BASE_URL", "https://api.portkey.ai"); } this.portkey = new Portkey({}); - this.portkey.llms = [{}] + this.portkey.llms = [{}]; if (!options.apiKey) { throw new Error("Set Portkey ApiKey in PORTKEY_API_KEY env variable"); } @@ -59,4 +62,3 @@ export function getPortkeySession(options: PortkeyOptions = {}) { } return session; } - diff --git a/packages/core/src/readers/SimpleMongoReader.ts b/packages/core/src/readers/SimpleMongoReader.ts index 90ecf4d036bbf18c5b673722e4d577e1690257b4..1c2b0dc76f4c59c7aa6a8ad3749d02e0aa89d5fa 100644 --- a/packages/core/src/readers/SimpleMongoReader.ts +++ b/packages/core/src/readers/SimpleMongoReader.ts @@ -1,5 +1,5 @@ import { MongoClient } from "mongodb"; -import { Document } from "../Node"; +import { Document, Metadata } from "../Node"; import { BaseReader } from "./base"; /** @@ -12,40 +12,71 @@ export class SimpleMongoReader implements BaseReader { this.client = client; } + /** + * Flattens an array of strings or string arrays into a single-dimensional array of strings. + * @param texts - The array of strings or string arrays to flatten. + * @returns The flattened array of strings. + */ + private flatten(texts: Array<string | string[]>): string[] { + return texts.reduce<string[]>( + (result, text) => result.concat(text instanceof Array ? text : [text]), + [], + ); + } + /** * Loads data from MongoDB collection - * @param {string} db_name - The name of the database to load. - * @param {string} collection_name - The name of the collection to load. - * @param {Number} [max_docs = 0] - Maximum number of documents to return. 0 means no limit. - * @param {Record<string, any>} [query_dict={}] - Specific query, as specified by MongoDB NodeJS documentation. - * @param {Record<string, any>} [query_options={}] - Specific query options, as specified by MongoDB NodeJS documentation. - * @param {Record<string, any>} [projection = {}] - Projection options, as specified by MongoDB NodeJS documentation. + * @param {string} dbName - The name of the database to load. + * @param {string} collectionName - The name of the collection to load. + * @param {string[]} fieldNames - An array of field names to retrieve from each document. Defaults to ["text"]. + * @param {string} separator - The separator to join multiple field values. Defaults to an empty string. + * @param {Record<string, any>} filterQuery - Specific query, as specified by MongoDB NodeJS documentation. + * @param {Number} maxDocs - The maximum number of documents to retrieve. Defaults to 0 (retrieve all documents). + * @param {string[]} metadataNames - An optional array of metadata field names. If specified extracts this information as metadata. * @returns {Promise<Document[]>} + * @throws If a field specified in fieldNames or metadataNames is not found in a MongoDB document. */ - async loadData( - db_name: string, - collection_name: string, - max_docs = 0, - //For later: Think about whether we want to pass generic objects in... - query_dict: Record<string, any> = {}, - query_options: Record<string, any> = {}, - projection: Record<string, any> = {}, + public async loadData( + dbName: string, + collectionName: string, + fieldNames: string[] = ["text"], + separator: string = "", + filterQuery: Record<string, any> = {}, + maxDocs: number = 0, + metadataNames?: string[], ): Promise<Document[]> { - //Get items from collection using built-in functions - const cursor: Partial<Document>[] = await this.client - .db(db_name) - .collection(collection_name) - .find(query_dict, query_options) - .limit(max_docs) - .project(projection) - .toArray(); - - //Aggregate results and return + const db = this.client.db(dbName); + // Get items from collection + const cursor = db + .collection(collectionName) + .find(filterQuery) + .limit(maxDocs); + const documents: Document[] = []; - cursor.forEach((element: Partial<Document>) => { - //For later: Metadata filtering - documents.push(new Document({ text: JSON.stringify(element) })); - }); + + for await (const item of cursor) { + try { + const texts: Array<string | string[]> = fieldNames.map( + (name) => item[name], + ); + const flattenedTexts = this.flatten(texts); + const text = flattenedTexts.join(separator); + + let metadata: Metadata = {}; + if (metadataNames) { + // extract metadata if fields are specified + metadata = Object.fromEntries( + metadataNames.map((name) => [name, item[name]]), + ); + } + + documents.push(new Document({ text, metadata })); + } catch (err) { + throw new Error( + `Field not found in Mongo document: ${(err as Error).message}`, + ); + } + } return documents; } } diff --git a/packages/core/src/storage/index.ts b/packages/core/src/storage/index.ts index b97ba04116f05926c607491e00a5764401258b05..96f8743be6e564594ba4c1d662d536d8f33a6edc 100644 --- a/packages/core/src/storage/index.ts +++ b/packages/core/src/storage/index.ts @@ -7,5 +7,6 @@ export { SimpleIndexStore } from "./indexStore/SimpleIndexStore"; export * from "./indexStore/types"; export { SimpleKVStore } from "./kvStore/SimpleKVStore"; export * from "./kvStore/types"; +export { MongoDBAtlasVectorSearch } from "./vectorStore/MongoDBAtlasVectorStore"; export { SimpleVectorStore } from "./vectorStore/SimpleVectorStore"; export * from "./vectorStore/types"; diff --git a/packages/core/src/storage/vectorStore/MongoDBAtlasVectorStore.ts b/packages/core/src/storage/vectorStore/MongoDBAtlasVectorStore.ts new file mode 100644 index 0000000000000000000000000000000000000000..6f2ec478ba3da60eee3dfbd3c8042af77c9217f8 --- /dev/null +++ b/packages/core/src/storage/vectorStore/MongoDBAtlasVectorStore.ts @@ -0,0 +1,164 @@ +import { BulkWriteOptions, Collection, MongoClient } from "mongodb"; +import { BaseNode, MetadataMode } from "../../Node"; +import { + MetadataFilters, + VectorStore, + VectorStoreQuery, + VectorStoreQueryResult, +} from "./types"; +import { metadataDictToNode, nodeToMetadata } from "./utils"; + +// Utility function to convert metadata filters to MongoDB filter +function toMongoDBFilter( + standardFilters: MetadataFilters, +): Record<string, any> { + const filters: Record<string, any> = {}; + for (const filter of standardFilters.filters) { + filters[filter.key] = filter.value; + } + return filters; +} + +// MongoDB Atlas Vector Store class implementing VectorStore +export class MongoDBAtlasVectorSearch implements VectorStore { + storesText: boolean = true; + flatMetadata: boolean = true; + + mongodbClient: MongoClient; + indexName: string; + embeddingKey: string; + idKey: string; + textKey: string; + metadataKey: string; + insertOptions?: BulkWriteOptions; + private collection: Collection; + + constructor( + init: Partial<MongoDBAtlasVectorSearch> & { + dbName: string; + collectionName: string; + }, + ) { + if (init.mongodbClient) { + this.mongodbClient = init.mongodbClient; + } else { + const mongoUri = process.env.MONGODB_URI; + if (!mongoUri) { + throw new Error( + "Must specify MONGODB_URI via env variable if not directly passing in client.", + ); + } + this.mongodbClient = new MongoClient(mongoUri); + } + + this.collection = this.mongodbClient + .db(init.dbName ?? "default_db") + .collection(init.collectionName ?? "default_collection"); + this.indexName = init.indexName ?? "default"; + this.embeddingKey = init.embeddingKey ?? "embedding"; + this.idKey = init.idKey ?? "id"; + this.textKey = init.textKey ?? "text"; + this.metadataKey = init.metadataKey ?? "metadata"; + this.insertOptions = init.insertOptions; + } + + async add(nodes: BaseNode[]): Promise<string[]> { + if (!nodes || nodes.length === 0) { + return []; + } + const dataToInsert = nodes.map((node) => { + const metadata = nodeToMetadata( + node, + true, + this.textKey, + this.flatMetadata, + ); + + return { + [this.idKey]: node.id_, + [this.embeddingKey]: node.getEmbedding(), + [this.textKey]: node.getContent(MetadataMode.NONE) || "", + [this.metadataKey]: metadata, + }; + }); + + console.debug("Inserting data into MongoDB: ", dataToInsert); + const insertResult = await this.collection.insertMany( + dataToInsert, + this.insertOptions, + ); + console.debug("Result of insert: ", insertResult); + return nodes.map((node) => node.id_); + } + + async delete(refDocId: string, deleteOptions?: any): Promise<void> { + await this.collection.deleteOne( + { + [`${this.metadataKey}.ref_doc_id`]: refDocId, + }, + deleteOptions, + ); + } + + get client(): any { + return this.mongodbClient; + } + + async query( + query: VectorStoreQuery, + options?: any, + ): Promise<VectorStoreQueryResult> { + const params: any = { + queryVector: query.queryEmbedding, + path: this.embeddingKey, + numCandidates: query.similarityTopK * 10, + limit: query.similarityTopK, + index: this.indexName, + }; + + if (query.filters) { + params.filter = toMongoDBFilter(query.filters); + } + + const queryField = { $vectorSearch: params }; + const pipeline = [ + queryField, + { + $project: { + score: { $meta: "vectorSearchScore" }, + [this.embeddingKey]: 0, + }, + }, + ]; + + console.debug("Running query pipeline: ", pipeline); + const cursor = await this.collection.aggregate(pipeline); + + const nodes: BaseNode[] = []; + const ids: string[] = []; + const similarities: number[] = []; + + for await (const res of await cursor) { + const text = res[this.textKey]; + const score = res.score; + const id = res[this.idKey]; + const metadata = res[this.metadataKey]; + + const node = metadataDictToNode(metadata); + node.setContent(text); + + ids.push(id); + nodes.push(node); + similarities.push(score); + } + + const result = { + nodes, + similarities, + ids, + }; + + console.debug("Result of query (ids):", ids); + return result; + } +} diff --git a/packages/core/src/storage/vectorStore/PGVectorStore.ts b/packages/core/src/storage/vectorStore/PGVectorStore.ts new file mode 100644 index 0000000000000000000000000000000000000000..f116f10347a1a3e34013638c9f9edc515d99b130 --- /dev/null +++ b/packages/core/src/storage/vectorStore/PGVectorStore.ts @@ -0,0 +1,266 @@ +import pg from "pg"; +import pgvector from "pgvector/pg"; + +import { VectorStore, VectorStoreQuery, VectorStoreQueryResult } from "./types"; + +import { BaseNode, Document, Metadata, MetadataMode } from "../../Node"; +import { GenericFileSystem } from "../FileSystem"; + +export const PGVECTOR_SCHEMA = "public"; +export const PGVECTOR_TABLE = "llamaindex_embedding"; + +/** + * Provides support for writing and querying vector data in Postgres. + */ +export class PGVectorStore implements VectorStore { + storesText: boolean = true; + + private collection: string = ""; + + /* + FROM pg LIBRARY: + type Config = { + user?: string, // default process.env.PGUSER || process.env.USER + password?: string or function, //default process.env.PGPASSWORD + host?: string, // default process.env.PGHOST + database?: string, // default process.env.PGDATABASE || user + port?: number, // default process.env.PGPORT + connectionString?: string, // e.g. postgres://user:password@host:5432/database + ssl?: any, // passed directly to node.TLSSocket, supports all tls.connect options + types?: any, // custom type parsers + statement_timeout?: number, // number of milliseconds before a statement in query will time out, default is no timeout + query_timeout?: number, // number of milliseconds before a query call will timeout, default is no timeout + application_name?: string, // The name of the application that created this Client instance + connectionTimeoutMillis?: number, // number of milliseconds to wait for connection, default is no timeout + idle_in_transaction_session_timeout?: number // number of milliseconds before terminating any session with an open idle transaction, default is no timeout + } + */ + db?: pg.Client; + + constructor() {} + + /** + * Setter for the collection property. + * Using a collection allows for simple segregation of vector data, + * e.g. by user, source, or access-level. + * Leave/set blank to ignore the collection value when querying. + * @param coll Name for the collection. + */ + setCollection(coll: string) { + this.collection = coll; + } + + /** + * Getter for the collection property. + * Using a collection allows for simple segregation of vector data, + * e.g. by user, source, or access-level. + * Leave/set blank to ignore the collection value when querying. + * @returns The currently-set collection value. Default is empty string. + */ + getCollection(): string { + return this.collection; + } + + private async getDb(): Promise<pg.Client> { + if (!this.db) { + try { + // Create DB connection + // Read connection params from env - see comment block above + const db = new pg.Client(); + await db.connect(); + + // Check vector extension + db.query("CREATE EXTENSION IF NOT EXISTS vector"); + await pgvector.registerType(db); + + // Check schema, table(s), index(es) + await this.checkSchema(db); + + // All good? Keep the connection reference + this.db = db; + } catch (err: any) { + console.error(err); + return Promise.reject(err); + } + } + + return Promise.resolve(this.db); + } + + private async checkSchema(db: pg.Client) { + await db.query(`CREATE SCHEMA IF NOT EXISTS ${PGVECTOR_SCHEMA}`); + + const tbl = `CREATE TABLE IF NOT EXISTS ${PGVECTOR_SCHEMA}.${PGVECTOR_TABLE}( + id uuid DEFAULT gen_random_uuid() PRIMARY KEY, + external_id VARCHAR, + collection VARCHAR, + document TEXT, + metadata JSONB DEFAULT '{}', + embeddings VECTOR(1536) + )`; + await db.query(tbl); + + const idxs = `CREATE INDEX IF NOT EXISTS idx_${PGVECTOR_TABLE}_external_id ON ${PGVECTOR_SCHEMA}.${PGVECTOR_TABLE} (external_id); + CREATE INDEX IF NOT EXISTS idx_${PGVECTOR_TABLE}_collection ON ${PGVECTOR_SCHEMA}.${PGVECTOR_TABLE} (collection);`; + await db.query(idxs); + + // TODO add IVFFlat or HNSW indexing? + return db; + } + + // isEmbeddingQuery?: boolean | undefined; + + /** + * Connects to the database specified in environment vars. + * This method also checks and creates the vector extension, + * the destination table and indexes if not found. + * @returns A connection to the database, or the error encountered while connecting/setting up. + */ + client() { + return this.getDb(); + } + + /** + * Delete all vector records for the specified collection. + * NOTE: Uses the collection property controlled by setCollection/getCollection. + * @returns The result of the delete query. + */ + async clearCollection() { + const sql: string = `DELETE FROM ${PGVECTOR_SCHEMA}.${PGVECTOR_TABLE} + WHERE collection = $1`; + + const db = (await this.getDb()) as pg.Client; + const ret = await db.query(sql, [this.collection]); + + return ret; + } + + /** + * Adds vector record(s) to the table. + * NOTE: Uses the collection property controlled by setCollection/getCollection. + * @param embeddingResults The Nodes to be inserted, optionally including metadata tuples. + * @returns A list of zero or more id values for the created records. + */ + async add(embeddingResults: BaseNode<Metadata>[]): Promise<string[]> { + const sql: string = `INSERT INTO ${PGVECTOR_SCHEMA}.${PGVECTOR_TABLE} + (id, external_id, collection, document, metadata, embeddings) + VALUES ($1, $2, $3, $4, $5, $6)`; + + const db = (await this.getDb()) as pg.Client; + + let ret: string[] = []; + for (let index = 0; index < embeddingResults.length; index++) { + const row = embeddingResults[index]; + + let id: any = row.id_.length ? row.id_ : null; + let meta = row.metadata || {}; + meta.create_date = new Date(); + + const params = [ + id, + "", + this.collection, + row.getContent(MetadataMode.EMBED), + meta, + "[" + row.getEmbedding().join(",") + "]", + ]; + + try { + const result = await db.query(sql, params); + + if (result.rows.length) { + id = result.rows[0].id as string; + ret.push(id); + } + } catch (err) { + const msg = `${err}`; + console.log(msg, err); + } + } + + return Promise.resolve(ret); + } + + /** + * Deletes a single record from the database by id. + * NOTE: Uses the collection property controlled by setCollection/getCollection. + * @param refDocId Unique identifier for the record to delete. + * @param deleteKwargs Required by VectorStore interface. Currently ignored. + * @returns Promise that resolves if the delete query did not throw an error. + */ + async delete(refDocId: string, deleteKwargs?: any): Promise<void> { + const collectionCriteria = this.collection.length + ? "AND collection = $2" + : ""; + const sql: string = `DELETE FROM ${PGVECTOR_SCHEMA}.${PGVECTOR_TABLE} + WHERE id = $1 ${collectionCriteria}`; + + const db = (await this.getDb()) as pg.Client; + const params = this.collection.length + ? [refDocId, this.collection] + : [refDocId]; + await db.query(sql, params); + return Promise.resolve(); + } + + /** + * Query the vector store for the closest matching data to the query embeddings + * @param query The VectorStoreQuery to be used + * @param options Required by VectorStore interface. Currently ignored. + * @returns Zero or more Document instances with data from the vector store. + */ + async query( + query: VectorStoreQuery, + options?: any, + ): Promise<VectorStoreQueryResult> { + // TODO QUERY TYPES: + // Distance: SELECT embedding <-> $1 AS distance FROM items; + // Inner Product: SELECT (embedding <#> $1) * -1 AS inner_product FROM items; + // Cosine Sim: SELECT 1 - (embedding <=> $1) AS cosine_similarity FROM items; + + const embedding = "[" + query.queryEmbedding?.join(",") + "]"; + const max = query.similarityTopK ?? 2; + const where = this.collection.length ? "WHERE collection = $2" : ""; + // TODO Add collection filter if set + const sql = `SELECT * FROM ${PGVECTOR_SCHEMA}.${PGVECTOR_TABLE} + ${where} + ORDER BY embeddings <-> $1 LIMIT ${max} + `; + + const db = (await this.getDb()) as pg.Client; + const params = this.collection.length + ? [embedding, this.collection] + : [embedding]; + const results = await db.query(sql, params); + + const nodes = results.rows.map((row) => { + return new Document({ + id_: row.id, + text: row.document, + metadata: row.metadata, + embedding: row.embeddings, + }); + }); + + const ret = { + nodes: nodes, + similarities: results.rows.map((row) => row.embeddings), + ids: results.rows.map((row) => row.id), + }; + + return Promise.resolve(ret); + } + + /** + * Required by VectorStore interface. Currently ignored. + * @param persistPath + * @param fs + * @returns Resolved Promise. + */ + persist( + persistPath: string, + fs?: GenericFileSystem | undefined, + ): Promise<void> { + return Promise.resolve(); + } +} diff --git a/packages/core/src/storage/vectorStore/SimpleVectorStore.ts b/packages/core/src/storage/vectorStore/SimpleVectorStore.ts index 1bccf12ff0579f1985d2ecd873b6e037b4497c80..929ebe2c24b3cf9b7cc074902280d89785651b0d 100644 --- a/packages/core/src/storage/vectorStore/SimpleVectorStore.ts +++ b/packages/core/src/storage/vectorStore/SimpleVectorStore.ts @@ -1,11 +1,11 @@ import _ from "lodash"; import * as path from "path"; +import { BaseNode } from "../../Node"; import { getTopKEmbeddings, getTopKEmbeddingsLearner, getTopKMMREmbeddings, -} from "../../Embedding"; -import { BaseNode } from "../../Node"; +} from "../../embeddings"; import { GenericFileSystem, exists } from "../FileSystem"; import { DEFAULT_FS, DEFAULT_PERSIST_DIR } from "../constants"; import { diff --git a/packages/core/src/storage/vectorStore/types.ts b/packages/core/src/storage/vectorStore/types.ts index cf98afbbb763e16636774ac91d044fe36c974808..be4bb0968607f2626f0868bcd4ded9428a575ecc 100644 --- a/packages/core/src/storage/vectorStore/types.ts +++ b/packages/core/src/storage/vectorStore/types.ts @@ -1,5 +1,4 @@ import { BaseNode } from "../../Node"; -import { GenericFileSystem } from "../FileSystem"; export interface VectorStoreQueryResult { nodes?: BaseNode[]; @@ -62,10 +61,9 @@ export interface VectorStore { isEmbeddingQuery?: boolean; client(): any; add(embeddingResults: BaseNode[]): Promise<string[]>; - delete(refDocId: string, deleteKwargs?: any): Promise<void>; + delete(refDocId: string, deleteOptions?: any): Promise<void>; query( query: VectorStoreQuery, options?: any, ): Promise<VectorStoreQueryResult>; - persist(persistPath: string, fs?: GenericFileSystem): Promise<void>; } diff --git a/packages/core/src/storage/vectorStore/utils.ts b/packages/core/src/storage/vectorStore/utils.ts new file mode 100644 index 0000000000000000000000000000000000000000..3ad1685888c993094a6525c11a3feccecc68b96d --- /dev/null +++ b/packages/core/src/storage/vectorStore/utils.ts @@ -0,0 +1,59 @@ +import { BaseNode, jsonToNode, Metadata, ObjectType } from "../../Node"; + +const DEFAULT_TEXT_KEY = "text"; + +export function validateIsFlat(obj: { [key: string]: any }): void { + for (let key in obj) { + if (typeof obj[key] === "object" && obj[key] !== null) { + throw new Error(`Value for metadata ${key} must not be another object`); + } + } +} + +export function nodeToMetadata( + node: BaseNode, + removeText: boolean = false, + textField: string = DEFAULT_TEXT_KEY, + flatMetadata: boolean = false, +): Metadata { + const nodeObj = node.toJSON(); + const metadata = node.metadata; + + if (flatMetadata) { + validateIsFlat(node.metadata); + } + + if (removeText) { + nodeObj[textField] = ""; + } + + nodeObj["embedding"] = null; + + metadata["_node_content"] = JSON.stringify(nodeObj); + metadata["_node_type"] = node.constructor.name.replace("_", ""); // remove leading underscore to be compatible with Python + + metadata["document_id"] = node.sourceNode?.nodeId || "None"; + metadata["doc_id"] = node.sourceNode?.nodeId || "None"; + metadata["ref_doc_id"] = node.sourceNode?.nodeId || "None"; + + return metadata; +} + +export function metadataDictToNode(metadata: Metadata): BaseNode { + const nodeContent = metadata["_node_content"]; + if (!nodeContent) { + throw new Error("Node content not found in metadata."); + } + const nodeObj = JSON.parse(nodeContent); + + // Note: we're using the name of the class stored in `_node_type` + // and not the type attribute to reconstruct + // the node. This way we're compatible with LlamaIndex Python + const node_type = metadata["_node_type"]; + switch (node_type) { + case "IndexNode": + return jsonToNode(nodeObj, ObjectType.INDEX); + default: + return jsonToNode(nodeObj, ObjectType.TEXT); + } +} diff --git a/packages/core/src/tests/CallbackManager.test.ts b/packages/core/src/tests/CallbackManager.test.ts index c3d9a98d4ac1f0f49ec64a638acea0941c9aae6f..8d1e1648a9babed0a061b6b4e8d97efb5ae98ec6 100644 --- a/packages/core/src/tests/CallbackManager.test.ts +++ b/packages/core/src/tests/CallbackManager.test.ts @@ -1,18 +1,18 @@ -import { OpenAIEmbedding } from "../Embedding"; -import { Document } from "../Node"; -import { - ResponseSynthesizer, - SimpleResponseBuilder, -} from "../ResponseSynthesizer"; -import { ServiceContext, serviceContextFromDefaults } from "../ServiceContext"; import { CallbackManager, RetrievalCallbackResponse, StreamCallbackResponse, } from "../callbacks/CallbackManager"; +import { OpenAIEmbedding } from "../embeddings"; import { SummaryIndex } from "../indices/summary"; import { VectorStoreIndex } from "../indices/vectorStore/VectorStoreIndex"; import { OpenAI } from "../llm/LLM"; +import { Document } from "../Node"; +import { + ResponseSynthesizer, + SimpleResponseBuilder, +} from "../ResponseSynthesizer"; +import { ServiceContext, serviceContextFromDefaults } from "../ServiceContext"; import { mockEmbeddingModel, mockLlmGeneration } from "./utility/mockOpenAI"; // Mock the OpenAI getOpenAISession function during testing diff --git a/packages/core/src/tests/Embedding.test.ts b/packages/core/src/tests/Embedding.test.ts index 492a48be1a39877b28af06736f41c0e8a2266128..132c7bfa98fb11ce1e1b220ce263a0ab6168dfbf 100644 --- a/packages/core/src/tests/Embedding.test.ts +++ b/packages/core/src/tests/Embedding.test.ts @@ -1,4 +1,4 @@ -import { SimilarityType, similarity } from "../Embedding"; +import { similarity, SimilarityType } from "../embeddings"; describe("similarity", () => { test("throws error on mismatched lengths", () => { diff --git a/packages/core/src/tests/Node.test.ts b/packages/core/src/tests/Node.test.ts new file mode 100644 index 0000000000000000000000000000000000000000..656ad7d7cdf883839921af66db8956cb04c65543 --- /dev/null +++ b/packages/core/src/tests/Node.test.ts @@ -0,0 +1,15 @@ +import { TextNode } from "../Node"; + +describe("TextNode", () => { + let node: TextNode; + + beforeEach(() => { + node = new TextNode({ text: "Hello World" }); + }); + + describe("generateHash", () => { + it("should generate a hash", () => { + expect(node.hash).toBe("nTSKdUTYqR52MPv/brvb4RTGeqedTEqG9QN8KSAj2Do="); + }); + }); +}); diff --git a/packages/core/src/tests/utility/mockOpenAI.ts b/packages/core/src/tests/utility/mockOpenAI.ts index 04d6cdd40d50d13e377e14a09c65023b602eace0..90976ea7b24540f084810e9533a8e6374061736f 100644 --- a/packages/core/src/tests/utility/mockOpenAI.ts +++ b/packages/core/src/tests/utility/mockOpenAI.ts @@ -1,6 +1,6 @@ -import { OpenAIEmbedding } from "../../Embedding"; -import { globalsHelper } from "../../GlobalsHelper"; import { CallbackManager, Event } from "../../callbacks/CallbackManager"; +import { OpenAIEmbedding } from "../../embeddings"; +import { globalsHelper } from "../../GlobalsHelper"; import { ChatMessage, OpenAI } from "../../llm/LLM"; export function mockLlmGeneration({ diff --git a/packages/create-llama/CHANGELOG.md b/packages/create-llama/CHANGELOG.md new file mode 100644 index 0000000000000000000000000000000000000000..8ff13001f2c6ac989848eb4ed546318fedd51c85 --- /dev/null +++ b/packages/create-llama/CHANGELOG.md @@ -0,0 +1,49 @@ +# create-llama + +## 0.0.9 + +### Patch Changes + +- acfe232: Deployment fixes (thanks @seldo) + +## 0.0.8 + +### Patch Changes + +- 8cdb07f: Fix Next deployment (thanks @seldo and @marcusschiesser) + +## 0.0.7 + +### Patch Changes + +- 9f9f293: Added more to README and made it easier to switch models (thanks @seldo) + +## 0.0.6 + +### Patch Changes + +- 4431ec7: Label bug fix (thanks @marcusschiesser) + +## 0.0.5 + +### Patch Changes + +- 25257f4: Fix issue where it doesn't find OpenAI Key when running npm run generate (#182) (thanks @RayFernando1337) + +## 0.0.4 + +### Patch Changes + +- 031e926: Update create-llama readme (thanks @logan-markewich) + +## 0.0.3 + +### Patch Changes + +- 91b42a3: change version (thanks @marcusschiesser) + +## 0.0.2 + +### Patch Changes + +- e2a6805: Hello Create Llama (thanks @marcusschiesser) diff --git a/packages/create-llama/LICENSE.md b/packages/create-llama/LICENSE.md new file mode 100644 index 0000000000000000000000000000000000000000..c16e650c0ed5197b51ab46b3d4abfdee5069383b --- /dev/null +++ b/packages/create-llama/LICENSE.md @@ -0,0 +1,9 @@ +The MIT License (MIT) + +Copyright (c) 2023 LlamaIndex, Vercel, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/packages/create-llama/README.md b/packages/create-llama/README.md new file mode 100644 index 0000000000000000000000000000000000000000..1f6ba4777256c99e0335ac3a101979232c0591cb --- /dev/null +++ b/packages/create-llama/README.md @@ -0,0 +1,126 @@ +# Create LlamaIndex App + +The easiest way to get started with [LlamaIndex](https://www.llamaindex.ai/) is by using `create-llama`. This CLI tool enables you to quickly start building a new LlamaIndex application, with everything set up for you. + +Just run + +```bash +npx create-llama@latest +``` + +to get started, or see below for more options. Once your app is generated, run + +```bash +npm run dev +``` + +to start the development server. You can then visit [http://localhost:3000](http://localhost:3000) to see your app. + +## What you'll get + +- A Next.js-powered front-end. The app is set up as a chat interface that can answer questions about your data (see below) + - You can style it with HTML and CSS, or you can optionally use components from [shadcn/ui](https://ui.shadcn.com/) +- Your choice of 3 back-ends: + - **Next.js**: if you select this option, you’ll have a full stack Next.js application that you can deploy to a host like [Vercel](https://vercel.com/) in just a few clicks. This uses [LlamaIndex.TS](https://www.npmjs.com/package/llamaindex), our TypeScript library. + - **Express**: if you want a more traditional Node.js application you can generate an Express backend. This also uses LlamaIndex.TS. + - **Python FastAPI**: if you select this option you’ll get a backend powered by the [llama-index python package](https://pypi.org/project/llama-index/), which you can deploy to a service like Render or fly.io. +- The back-end has a single endpoint that allows you to send the state of your chat and receive additional responses +- You can choose whether you want a streaming or non-streaming back-end (if you're not sure, we recommend streaming) +- You can choose whether you want to use `ContextChatEngine` or `SimpleChatEngine` + - `SimpleChatEngine` will just talk to the LLM directly without using your data + - `ContextChatEngine` will use your data to answer questions (see below). +- The app uses OpenAI by default, so you'll need an OpenAI API key, or you can customize it to use any of the dozens of LLMs we support. + +## Using your data + +If you've enabled `ContextChatEngine`, you can supply your own data and the app will index it and answer questions. Your generated app will have a folder called `data`: + +- With the Next.js backend this is `./data` +- With the Express or Python backend this is in `./backend/data` + +The app will ingest any supported files you put in this directory. Your Next.js and Express apps use LlamaIndex.TS so they will be able to ingest any PDF, text, CSV, Markdown, Word and HTML files. The Python backend can read even more types, including video and audio files. + +Before you can use your data, you need to index it. If you're using the Next.js or Express apps, run: + +```bash +npm run generate +``` + +Then re-start your app. Remember you'll need to re-run `generate` if you add new files to your `data` folder. If you're using the Python backend, you can trigger indexing of your data by deleting the `./storage` folder and re-starting the app. + +## Don't want a front-end? + +It's optional! If you've selected the Python or Express back-ends, just delete the `frontend` folder and you'll get an API without any front-end code. + +## Customizing the LLM + +By default the app will use OpenAI's gpt-3.5-turbo model. If you want to use GPT-4, you can modify this by editing a file: + +- In the Next.js backend, edit `./app/api/chat/route.ts` and replace `gpt-3.5-turbo` with `gpt-4` +- In the Express backend, edit `./backend/src/controllers/chat.controller.ts` and likewise replace `gpt-3.5-turbo` with `gpt-4` +- In the Python backend, edit `./backend/app/utils/index.py` and once again replace `gpt-3.5-turbo` with `gpt-4` + +You can also replace OpenAI with one of our [dozens of other supported LLMs](https://docs.llamaindex.ai/en/stable/module_guides/models/llms/modules.html). + +## Example + +The simplest thing to do is run `create-llama` in interactive mode: + +```bash +npx create-llama@latest +# or +npm create llama@latest +# or +yarn create llama +# or +pnpm create llama@latest +``` + +You will be asked for the name of your project, along with other configuration options, something like this: + +```bash +>> npm create llama@latest +Need to install the following packages: + create-llama@latest +Ok to proceed? (y) y +✔ What is your project named? … my-app +✔ Which template would you like to use? › Chat with streaming +✔ Which framework would you like to use? › NextJS +✔ Which UI would you like to use? › Just HTML +✔ Which chat engine would you like to use? › ContextChatEngine +✔ Please provide your OpenAI API key (leave blank to skip): … +✔ Would you like to use ESLint? … No / Yes +Creating a new LlamaIndex app in /home/my-app. +``` + +### Running non-interactively + +You can also pass command line arguments to set up a new project +non-interactively. See `create-llama --help`: + +```bash +create-llama <project-directory> [options] + +Options: + -V, --version output the version number + + --use-npm + + Explicitly tell the CLI to bootstrap the app using npm + + --use-pnpm + + Explicitly tell the CLI to bootstrap the app using pnpm + + --use-yarn + + Explicitly tell the CLI to bootstrap the app using Yarn + +``` + +## LlamaIndex Documentation + +- [TS/JS docs](https://ts.llamaindex.ai/) +- [Python docs](https://docs.llamaindex.ai/en/stable/) + +Inspired by and adapted from [create-next-app](https://github.com/vercel/next.js/tree/canary/packages/create-next-app) diff --git a/packages/create-llama/create-app.ts b/packages/create-llama/create-app.ts new file mode 100644 index 0000000000000000000000000000000000000000..25c47dbd0bcd72a01625c2fadd0b04fda7da22be --- /dev/null +++ b/packages/create-llama/create-app.ts @@ -0,0 +1,109 @@ +/* eslint-disable import/no-extraneous-dependencies */ +import path from "path"; +import { green } from "picocolors"; +import { tryGitInit } from "./helpers/git"; +import { isFolderEmpty } from "./helpers/is-folder-empty"; +import { getOnline } from "./helpers/is-online"; +import { isWriteable } from "./helpers/is-writeable"; +import { makeDir } from "./helpers/make-dir"; + +import fs from "fs"; +import terminalLink from "terminal-link"; +import type { InstallTemplateArgs } from "./templates"; +import { installTemplate } from "./templates"; + +export async function createApp({ + template, + framework, + engine, + ui, + appPath, + packageManager, + eslint, + frontend, + openAIKey, +}: Omit< + InstallTemplateArgs, + "appName" | "root" | "isOnline" | "customApiPath" +> & { + appPath: string; + frontend: boolean; +}): Promise<void> { + const root = path.resolve(appPath); + + if (!(await isWriteable(path.dirname(root)))) { + console.error( + "The application path is not writable, please check folder permissions and try again.", + ); + console.error( + "It is likely you do not have write permissions for this folder.", + ); + process.exit(1); + } + + const appName = path.basename(root); + + await makeDir(root); + if (!isFolderEmpty(root, appName)) { + process.exit(1); + } + + const useYarn = packageManager === "yarn"; + const isOnline = !useYarn || (await getOnline()); + + console.log(`Creating a new LlamaIndex app in ${green(root)}.`); + console.log(); + + const args = { + appName, + root, + template, + framework, + engine, + ui, + packageManager, + isOnline, + eslint, + openAIKey, + }; + + if (frontend) { + // install backend + const backendRoot = path.join(root, "backend"); + await makeDir(backendRoot); + await installTemplate({ ...args, root: backendRoot, backend: true }); + // install frontend + const frontendRoot = path.join(root, "frontend"); + await makeDir(frontendRoot); + await installTemplate({ + ...args, + root: frontendRoot, + framework: "nextjs", + customApiPath: "http://localhost:8000/api/chat", + backend: false, + }); + // copy readme for fullstack + await fs.promises.copyFile( + path.join(__dirname, "templates", "README-fullstack.md"), + path.join(root, "README.md"), + ); + } else { + await installTemplate({ ...args, backend: true, forBackend: framework }); + } + + process.chdir(root); + if (tryGitInit(root)) { + console.log("Initialized a git repository."); + console.log(); + } + + console.log(`${green("Success!")} Created ${appName} at ${appPath}`); + + console.log( + `Now have a look at the ${terminalLink( + "README.md", + `file://${appName}/README.md`, + )} and learn how to get started.`, + ); + console.log(); +} diff --git a/packages/create-llama/helpers/copy.ts b/packages/create-llama/helpers/copy.ts new file mode 100644 index 0000000000000000000000000000000000000000..a5b722ba34fe41e867e686f10b1bdf725c58c0a0 --- /dev/null +++ b/packages/create-llama/helpers/copy.ts @@ -0,0 +1,50 @@ +/* eslint-disable import/no-extraneous-dependencies */ +import { async as glob } from "fast-glob"; +import fs from "fs"; +import path from "path"; + +interface CopyOption { + cwd?: string; + rename?: (basename: string) => string; + parents?: boolean; +} + +const identity = (x: string) => x; + +export const copy = async ( + src: string | string[], + dest: string, + { cwd, rename = identity, parents = true }: CopyOption = {}, +) => { + const source = typeof src === "string" ? [src] : src; + + if (source.length === 0 || !dest) { + throw new TypeError("`src` and `dest` are required"); + } + + const sourceFiles = await glob(source, { + cwd, + dot: true, + absolute: false, + stats: false, + }); + + const destRelativeToCwd = cwd ? path.resolve(cwd, dest) : dest; + + return Promise.all( + sourceFiles.map(async (p) => { + const dirname = path.dirname(p); + const basename = rename(path.basename(p)); + + const from = cwd ? path.resolve(cwd, p) : p; + const to = parents + ? path.join(destRelativeToCwd, dirname, basename) + : path.join(destRelativeToCwd, basename); + + // Ensure the destination directory exists + await fs.promises.mkdir(path.dirname(to), { recursive: true }); + + return fs.promises.copyFile(from, to); + }), + ); +}; diff --git a/packages/create-llama/helpers/get-pkg-manager.ts b/packages/create-llama/helpers/get-pkg-manager.ts new file mode 100644 index 0000000000000000000000000000000000000000..0187c88a49e67bf7aa7fe95520b3af91777987f8 --- /dev/null +++ b/packages/create-llama/helpers/get-pkg-manager.ts @@ -0,0 +1,15 @@ +export type PackageManager = "npm" | "pnpm" | "yarn"; + +export function getPkgManager(): PackageManager { + const userAgent = process.env.npm_config_user_agent || ""; + + if (userAgent.startsWith("yarn")) { + return "yarn"; + } + + if (userAgent.startsWith("pnpm")) { + return "pnpm"; + } + + return "npm"; +} diff --git a/packages/create-llama/helpers/git.ts b/packages/create-llama/helpers/git.ts new file mode 100644 index 0000000000000000000000000000000000000000..2cdfe8dc34baefd0c092bbefe6fe071bd4729e0c --- /dev/null +++ b/packages/create-llama/helpers/git.ts @@ -0,0 +1,58 @@ +/* eslint-disable import/no-extraneous-dependencies */ +import { execSync } from "child_process"; +import fs from "fs"; +import path from "path"; + +function isInGitRepository(): boolean { + try { + execSync("git rev-parse --is-inside-work-tree", { stdio: "ignore" }); + return true; + } catch (_) {} + return false; +} + +function isInMercurialRepository(): boolean { + try { + execSync("hg --cwd . root", { stdio: "ignore" }); + return true; + } catch (_) {} + return false; +} + +function isDefaultBranchSet(): boolean { + try { + execSync("git config init.defaultBranch", { stdio: "ignore" }); + return true; + } catch (_) {} + return false; +} + +export function tryGitInit(root: string): boolean { + let didInit = false; + try { + execSync("git --version", { stdio: "ignore" }); + if (isInGitRepository() || isInMercurialRepository()) { + return false; + } + + execSync("git init", { stdio: "ignore" }); + didInit = true; + + if (!isDefaultBranchSet()) { + execSync("git checkout -b main", { stdio: "ignore" }); + } + + execSync("git add -A", { stdio: "ignore" }); + execSync('git commit -m "Initial commit from Create Llama"', { + stdio: "ignore", + }); + return true; + } catch (e) { + if (didInit) { + try { + fs.rmSync(path.join(root, ".git"), { recursive: true, force: true }); + } catch (_) {} + } + return false; + } +} diff --git a/packages/create-llama/helpers/install.ts b/packages/create-llama/helpers/install.ts new file mode 100644 index 0000000000000000000000000000000000000000..9f0f20356265081bbb062454b14d1c9059544900 --- /dev/null +++ b/packages/create-llama/helpers/install.ts @@ -0,0 +1,50 @@ +/* eslint-disable import/no-extraneous-dependencies */ +import spawn from "cross-spawn"; +import { yellow } from "picocolors"; +import type { PackageManager } from "./get-pkg-manager"; + +/** + * Spawn a package manager installation based on user preference. + * + * @returns A Promise that resolves once the installation is finished. + */ +export async function callPackageManager( + /** Indicate which package manager to use. */ + packageManager: PackageManager, + /** Indicate whether there is an active Internet connection.*/ + isOnline: boolean, + args: string[] = ["install"], +): Promise<void> { + if (!isOnline) { + console.log( + yellow("You appear to be offline.\nFalling back to the local cache."), + ); + args.push("--offline"); + } + /** + * Return a Promise that resolves once the installation is finished. + */ + return new Promise((resolve, reject) => { + /** + * Spawn the installation process. + */ + const child = spawn(packageManager, args, { + stdio: "inherit", + env: { + ...process.env, + ADBLOCK: "1", + // we set NODE_ENV to development as pnpm skips dev + // dependencies when production + NODE_ENV: "development", + DISABLE_OPENCOLLECTIVE: "1", + }, + }); + child.on("close", (code) => { + if (code !== 0) { + reject({ command: `${packageManager} ${args.join(" ")}` }); + return; + } + resolve(); + }); + }); +} diff --git a/packages/create-llama/helpers/is-folder-empty.ts b/packages/create-llama/helpers/is-folder-empty.ts new file mode 100644 index 0000000000000000000000000000000000000000..927a344c00fe80bc8c906349d70ffad5bb47d15e --- /dev/null +++ b/packages/create-llama/helpers/is-folder-empty.ts @@ -0,0 +1,62 @@ +/* eslint-disable import/no-extraneous-dependencies */ +import fs from "fs"; +import path from "path"; +import { blue, green } from "picocolors"; + +export function isFolderEmpty(root: string, name: string): boolean { + const validFiles = [ + ".DS_Store", + ".git", + ".gitattributes", + ".gitignore", + ".gitlab-ci.yml", + ".hg", + ".hgcheck", + ".hgignore", + ".idea", + ".npmignore", + ".travis.yml", + "LICENSE", + "Thumbs.db", + "docs", + "mkdocs.yml", + "npm-debug.log", + "yarn-debug.log", + "yarn-error.log", + "yarnrc.yml", + ".yarn", + ]; + + const conflicts = fs + .readdirSync(root) + .filter((file) => !validFiles.includes(file)) + // Support IntelliJ IDEA-based editors + .filter((file) => !/\.iml$/.test(file)); + + if (conflicts.length > 0) { + console.log( + `The directory ${green(name)} contains files that could conflict:`, + ); + console.log(); + for (const file of conflicts) { + try { + const stats = fs.lstatSync(path.join(root, file)); + if (stats.isDirectory()) { + console.log(` ${blue(file)}/`); + } else { + console.log(` ${file}`); + } + } catch { + console.log(` ${file}`); + } + } + console.log(); + console.log( + "Either try using a new directory name, or remove the files listed above.", + ); + console.log(); + return false; + } + + return true; +} diff --git a/packages/create-llama/helpers/is-online.ts b/packages/create-llama/helpers/is-online.ts new file mode 100644 index 0000000000000000000000000000000000000000..eab6980053517b8c350f537eb34ef238826909a8 --- /dev/null +++ b/packages/create-llama/helpers/is-online.ts @@ -0,0 +1,40 @@ +import { execSync } from "child_process"; +import dns from "dns"; +import url from "url"; + +function getProxy(): string | undefined { + if (process.env.https_proxy) { + return process.env.https_proxy; + } + + try { + const httpsProxy = execSync("npm config get https-proxy").toString().trim(); + return httpsProxy !== "null" ? httpsProxy : undefined; + } catch (e) { + return; + } +} + +export function getOnline(): Promise<boolean> { + return new Promise((resolve) => { + dns.lookup("registry.yarnpkg.com", (registryErr) => { + if (!registryErr) { + return resolve(true); + } + + const proxy = getProxy(); + if (!proxy) { + return resolve(false); + } + + const { hostname } = url.parse(proxy); + if (!hostname) { + return resolve(false); + } + + dns.lookup(hostname, (proxyErr) => { + resolve(proxyErr == null); + }); + }); + }); +} diff --git a/packages/create-llama/helpers/is-url.ts b/packages/create-llama/helpers/is-url.ts new file mode 100644 index 0000000000000000000000000000000000000000..eb87b975252f721bf596f98b628f4b6394a63516 --- /dev/null +++ b/packages/create-llama/helpers/is-url.ts @@ -0,0 +1,8 @@ +export function isUrl(url: string): boolean { + try { + new URL(url); + return true; + } catch (error) { + return false; + } +} diff --git a/packages/create-llama/helpers/is-writeable.ts b/packages/create-llama/helpers/is-writeable.ts new file mode 100644 index 0000000000000000000000000000000000000000..fa29d60558b33c0cd9823ec29842d48648b37901 --- /dev/null +++ b/packages/create-llama/helpers/is-writeable.ts @@ -0,0 +1,10 @@ +import fs from "fs"; + +export async function isWriteable(directory: string): Promise<boolean> { + try { + await fs.promises.access(directory, (fs.constants || fs).W_OK); + return true; + } catch (err) { + return false; + } +} diff --git a/packages/create-llama/helpers/make-dir.ts b/packages/create-llama/helpers/make-dir.ts new file mode 100644 index 0000000000000000000000000000000000000000..2c258fd6b5a0d2362c13cfcbade7cac21702fb5a --- /dev/null +++ b/packages/create-llama/helpers/make-dir.ts @@ -0,0 +1,8 @@ +import fs from "fs"; + +export function makeDir( + root: string, + options = { recursive: true }, +): Promise<string | undefined> { + return fs.promises.mkdir(root, options); +} diff --git a/packages/create-llama/helpers/validate-pkg.ts b/packages/create-llama/helpers/validate-pkg.ts new file mode 100644 index 0000000000000000000000000000000000000000..68317653c8e455aec9ce6d192f725a74b8199cfd --- /dev/null +++ b/packages/create-llama/helpers/validate-pkg.ts @@ -0,0 +1,20 @@ +// eslint-disable-next-line import/no-extraneous-dependencies +import validateProjectName from "validate-npm-package-name"; + +export function validateNpmName(name: string): { + valid: boolean; + problems?: string[]; +} { + const nameValidation = validateProjectName(name); + if (nameValidation.validForNewPackages) { + return { valid: true }; + } + + return { + valid: false, + problems: [ + ...(nameValidation.errors || []), + ...(nameValidation.warnings || []), + ], + }; +} diff --git a/packages/create-llama/index.ts b/packages/create-llama/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..14571b74b651992c937279a5a0cff365d33de6c3 --- /dev/null +++ b/packages/create-llama/index.ts @@ -0,0 +1,402 @@ +#!/usr/bin/env node +/* eslint-disable import/no-extraneous-dependencies */ +import ciInfo from "ci-info"; +import Commander from "commander"; +import Conf from "conf"; +import fs from "fs"; +import path from "path"; +import { blue, bold, cyan, green, red, yellow } from "picocolors"; +import prompts from "prompts"; +import checkForUpdate from "update-check"; +import { createApp } from "./create-app"; +import { getPkgManager } from "./helpers/get-pkg-manager"; +import { isFolderEmpty } from "./helpers/is-folder-empty"; +import { validateNpmName } from "./helpers/validate-pkg"; +import packageJson from "./package.json"; + +let projectPath: string = ""; + +const handleSigTerm = () => process.exit(0); + +process.on("SIGINT", handleSigTerm); +process.on("SIGTERM", handleSigTerm); + +const onPromptState = (state: any) => { + if (state.aborted) { + // If we don't re-enable the terminal cursor before exiting + // the program, the cursor will remain hidden + process.stdout.write("\x1B[?25h"); + process.stdout.write("\n"); + process.exit(1); + } +}; + +const program = new Commander.Command(packageJson.name) + .version(packageJson.version) + .arguments("<project-directory>") + .usage(`${green("<project-directory>")} [options]`) + .action((name) => { + projectPath = name; + }) + .option( + "--eslint", + ` + + Initialize with eslint config. +`, + ) + .option( + "--use-npm", + ` + + Explicitly tell the CLI to bootstrap the application using npm +`, + ) + .option( + "--use-pnpm", + ` + + Explicitly tell the CLI to bootstrap the application using pnpm +`, + ) + .option( + "--use-yarn", + ` + + Explicitly tell the CLI to bootstrap the application using Yarn +`, + ) + .option( + "--reset-preferences", + ` + + Explicitly tell the CLI to reset any stored preferences +`, + ) + .allowUnknownOption() + .parse(process.argv); + +const packageManager = !!program.useNpm + ? "npm" + : !!program.usePnpm + ? "pnpm" + : !!program.useYarn + ? "yarn" + : getPkgManager(); + +async function run(): Promise<void> { + const conf = new Conf({ projectName: "create-llama" }); + + if (program.resetPreferences) { + conf.clear(); + console.log(`Preferences reset successfully`); + return; + } + + if (typeof projectPath === "string") { + projectPath = projectPath.trim(); + } + + if (!projectPath) { + const res = await prompts({ + onState: onPromptState, + type: "text", + name: "path", + message: "What is your project named?", + initial: "my-app", + validate: (name) => { + const validation = validateNpmName(path.basename(path.resolve(name))); + if (validation.valid) { + return true; + } + return "Invalid project name: " + validation.problems![0]; + }, + }); + + if (typeof res.path === "string") { + projectPath = res.path.trim(); + } + } + + if (!projectPath) { + console.log( + "\nPlease specify the project directory:\n" + + ` ${cyan(program.name())} ${green("<project-directory>")}\n` + + "For example:\n" + + ` ${cyan(program.name())} ${green("my-next-app")}\n\n` + + `Run ${cyan(`${program.name()} --help`)} to see all options.`, + ); + process.exit(1); + } + + const resolvedProjectPath = path.resolve(projectPath); + const projectName = path.basename(resolvedProjectPath); + + const { valid, problems } = validateNpmName(projectName); + if (!valid) { + console.error( + `Could not create a project called ${red( + `"${projectName}"`, + )} because of npm naming restrictions:`, + ); + + problems!.forEach((p) => console.error(` ${red(bold("*"))} ${p}`)); + process.exit(1); + } + + /** + * Verify the project dir is empty or doesn't exist + */ + const root = path.resolve(resolvedProjectPath); + const appName = path.basename(root); + const folderExists = fs.existsSync(root); + + if (folderExists && !isFolderEmpty(root, appName)) { + process.exit(1); + } + + const preferences = (conf.get("preferences") || {}) as Record< + string, + boolean | string + >; + + const defaults: typeof preferences = { + template: "simple", + framework: "nextjs", + engine: "simple", + ui: "html", + eslint: true, + frontend: false, + openAIKey: "", + }; + const getPrefOrDefault = (field: string) => + preferences[field] ?? defaults[field]; + + const handlers = { + onCancel: () => { + console.error("Exiting."); + process.exit(1); + }, + }; + + if (!program.template) { + if (ciInfo.isCI) { + program.template = getPrefOrDefault("template"); + } else { + const { template } = await prompts( + { + type: "select", + name: "template", + message: "Which template would you like to use?", + choices: [ + { title: "Chat without streaming", value: "simple" }, + { title: "Chat with streaming", value: "streaming" }, + ], + initial: 1, + }, + handlers, + ); + program.template = template; + preferences.template = template; + } + } + + if (!program.framework) { + if (ciInfo.isCI) { + program.framework = getPrefOrDefault("framework"); + } else { + const { framework } = await prompts( + { + type: "select", + name: "framework", + message: "Which framework would you like to use?", + choices: [ + { title: "NextJS", value: "nextjs" }, + { title: "Express", value: "express" }, + { title: "FastAPI (Python)", value: "fastapi" }, + ], + initial: 0, + }, + handlers, + ); + program.framework = framework; + preferences.framework = framework; + } + } + + if (program.framework === "express" || program.framework === "fastapi") { + // if a backend-only framework is selected, ask whether we should create a frontend + if (!program.frontend) { + if (ciInfo.isCI) { + program.frontend = getPrefOrDefault("frontend"); + } else { + const styledNextJS = blue("NextJS"); + const styledBackend = green( + program.framework === "express" + ? "Express " + : program.framework === "fastapi" + ? "FastAPI (Python) " + : "", + ); + const { frontend } = await prompts({ + onState: onPromptState, + type: "toggle", + name: "frontend", + message: `Would you like to generate a ${styledNextJS} frontend for your ${styledBackend}backend?`, + initial: getPrefOrDefault("frontend"), + active: "Yes", + inactive: "No", + }); + program.frontend = Boolean(frontend); + preferences.frontend = Boolean(frontend); + } + } + } + + if (program.framework === "nextjs" || program.frontend) { + if (!program.ui) { + if (ciInfo.isCI) { + program.ui = getPrefOrDefault("ui"); + } else { + const { ui } = await prompts( + { + type: "select", + name: "ui", + message: "Which UI would you like to use?", + choices: [ + { title: "Just HTML", value: "html" }, + { title: "Shadcn", value: "shadcn" }, + ], + initial: 0, + }, + handlers, + ); + program.ui = ui; + preferences.ui = ui; + } + } + } + + if (program.framework === "express" || program.framework === "nextjs") { + if (!program.engine) { + if (ciInfo.isCI) { + program.engine = getPrefOrDefault("engine"); + } else { + const { engine } = await prompts( + { + type: "select", + name: "engine", + message: "Which chat engine would you like to use?", + choices: [ + { title: "ContextChatEngine", value: "context" }, + { + title: "SimpleChatEngine (no data, just chat)", + value: "simple", + }, + ], + initial: 0, + }, + handlers, + ); + program.engine = engine; + preferences.engine = engine; + } + } + } + + if (!program.openAIKey) { + const { key } = await prompts( + { + type: "text", + name: "key", + message: "Please provide your OpenAI API key (leave blank to skip):", + }, + handlers, + ); + program.openAIKey = key; + preferences.openAIKey = key; + } + + if ( + program.framework !== "fastapi" && + !process.argv.includes("--eslint") && + !process.argv.includes("--no-eslint") + ) { + if (ciInfo.isCI) { + program.eslint = getPrefOrDefault("eslint"); + } else { + const styledEslint = blue("ESLint"); + const { eslint } = await prompts({ + onState: onPromptState, + type: "toggle", + name: "eslint", + message: `Would you like to use ${styledEslint}?`, + initial: getPrefOrDefault("eslint"), + active: "Yes", + inactive: "No", + }); + program.eslint = Boolean(eslint); + preferences.eslint = Boolean(eslint); + } + } + + await createApp({ + template: program.template, + framework: program.framework, + engine: program.engine, + ui: program.ui, + appPath: resolvedProjectPath, + packageManager, + eslint: program.eslint, + frontend: program.frontend, + openAIKey: program.openAIKey, + }); + conf.set("preferences", preferences); +} + +const update = checkForUpdate(packageJson).catch(() => null); + +async function notifyUpdate(): Promise<void> { + try { + const res = await update; + if (res?.latest) { + const updateMessage = + packageManager === "yarn" + ? "yarn global add create-llama@latest" + : packageManager === "pnpm" + ? "pnpm add -g create-llama@latest" + : "npm i -g create-llama@latest"; + + console.log( + yellow(bold("A new version of `create-llama` is available!")) + + "\n" + + "You can update by running: " + + cyan(updateMessage) + + "\n", + ); + } + process.exit(); + } catch { + // ignore error + } +} + +run() + .then(notifyUpdate) + .catch(async (reason) => { + console.log(); + console.log("Aborting installation."); + if (reason.command) { + console.log(` ${cyan(reason.command)} has failed.`); + } else { + console.log( + red("Unexpected error. Please report it as a bug:") + "\n", + reason, + ); + } + console.log(); + + await notifyUpdate(); + + process.exit(1); + }); diff --git a/packages/create-llama/package.json b/packages/create-llama/package.json new file mode 100644 index 0000000000000000000000000000000000000000..d2425267b1ecd9760377caeb2c6d2ab5e345b541 --- /dev/null +++ b/packages/create-llama/package.json @@ -0,0 +1,55 @@ +{ + "name": "create-llama", + "version": "0.0.9", + "keywords": [ + "rag", + "llamaindex", + "next.js" + ], + "description": "Create LlamaIndex-powered apps with one command", + "repository": { + "type": "git", + "url": "https://github.com/run-llama/LlamaIndexTS", + "directory": "packages/create-llama" + }, + "license": "MIT", + "bin": { + "create-llama": "./dist/index.js" + }, + "files": [ + "dist" + ], + "scripts": { + "dev": "ncc build ./index.ts -w -o dist/", + "build": "ncc build ./index.ts -o ./dist/ --minify --no-cache --no-source-map-register", + "lint": "eslint . --ignore-pattern dist", + "prepublishOnly": "cd ../../ && turbo run build" + }, + "devDependencies": { + "@types/async-retry": "1.4.2", + "@types/ci-info": "2.0.0", + "@types/cross-spawn": "6.0.0", + "@types/node": "^20.9.0", + "@types/prompts": "2.0.1", + "@types/tar": "6.1.5", + "@types/validate-npm-package-name": "3.0.0", + "@vercel/ncc": "0.34.0", + "async-retry": "1.3.1", + "async-sema": "3.0.1", + "ci-info": "github:watson/ci-info#f43f6a1cefff47fb361c88cf4b943fdbcaafe540", + "commander": "2.20.0", + "conf": "10.2.0", + "cross-spawn": "7.0.3", + "fast-glob": "3.3.1", + "got": "10.7.0", + "picocolors": "1.0.0", + "prompts": "2.1.0", + "tar": "6.1.15", + "terminal-link": "^3.0.0", + "update-check": "1.5.4", + "validate-npm-package-name": "3.0.0" + }, + "engines": { + "node": ">=16.14.0" + } +} diff --git a/packages/create-llama/templates/.gitignore b/packages/create-llama/templates/.gitignore new file mode 100644 index 0000000000000000000000000000000000000000..ec6c67b630467343abb46cfeea0535ce4b339554 --- /dev/null +++ b/packages/create-llama/templates/.gitignore @@ -0,0 +1,3 @@ +__pycache__ +poetry.lock +storage diff --git a/packages/create-llama/templates/README-fullstack.md b/packages/create-llama/templates/README-fullstack.md new file mode 100644 index 0000000000000000000000000000000000000000..5a41b8cfc370f4fe99269331065bdee8b6aa8e8c --- /dev/null +++ b/packages/create-llama/templates/README-fullstack.md @@ -0,0 +1,18 @@ +This is a [LlamaIndex](https://www.llamaindex.ai/) project bootstrapped with [`create-llama`](https://github.com/run-llama/LlamaIndexTS/tree/main/packages/create-llama). + +## Getting Started + +First, startup the backend as described in the [backend README](./backend/README.md). + +Second, run the development server of the frontend as described in the [frontend README](./frontend/README.md). + +Open [http://localhost:3000](http://localhost:3000) with your browser to see the result. + +## Learn More + +To learn more about LlamaIndex, take a look at the following resources: + +- [LlamaIndex Documentation](https://docs.llamaindex.ai) - learn about LlamaIndex (Python features). +- [LlamaIndexTS Documentation](https://ts.llamaindex.ai) - learn about LlamaIndex (Typescript features). + +You can check out [the LlamaIndexTS GitHub repository](https://github.com/run-llama/LlamaIndexTS) - your feedback and contributions are welcome! diff --git a/packages/create-llama/templates/components/data/101.pdf b/packages/create-llama/templates/components/data/101.pdf new file mode 100644 index 0000000000000000000000000000000000000000..ae5acffd5398b7c59e2df9e6dead2d99128b719c Binary files /dev/null and b/packages/create-llama/templates/components/data/101.pdf differ diff --git a/packages/create-llama/templates/components/engines/context/constants.mjs b/packages/create-llama/templates/components/engines/context/constants.mjs new file mode 100644 index 0000000000000000000000000000000000000000..8cfb403c3790b0c5088a802071896d2fdca98ded --- /dev/null +++ b/packages/create-llama/templates/components/engines/context/constants.mjs @@ -0,0 +1,4 @@ +export const STORAGE_DIR = "./data"; +export const STORAGE_CACHE_DIR = "./cache"; +export const CHUNK_SIZE = 512; +export const CHUNK_OVERLAP = 20; diff --git a/packages/create-llama/templates/components/engines/context/generate.mjs b/packages/create-llama/templates/components/engines/context/generate.mjs new file mode 100644 index 0000000000000000000000000000000000000000..8420dd5f81eab52574ec51770cf0e09ccb139563 --- /dev/null +++ b/packages/create-llama/templates/components/engines/context/generate.mjs @@ -0,0 +1,48 @@ +import { + serviceContextFromDefaults, + SimpleDirectoryReader, + storageContextFromDefaults, + VectorStoreIndex, +} from "llamaindex"; + +import { + CHUNK_OVERLAP, + CHUNK_SIZE, + STORAGE_CACHE_DIR, + STORAGE_DIR, +} from "./constants.mjs"; + +async function getRuntime(func) { + const start = Date.now(); + await func(); + const end = Date.now(); + return end - start; +} + +async function generateDatasource(serviceContext) { + console.log(`Generating storage context...`); + // Split documents, create embeddings and store them in the storage context + const ms = await getRuntime(async () => { + const storageContext = await storageContextFromDefaults({ + persistDir: STORAGE_CACHE_DIR, + }); + const documents = await new SimpleDirectoryReader().loadData({ + directoryPath: STORAGE_DIR, + }); + await VectorStoreIndex.fromDocuments(documents, { + storageContext, + serviceContext, + }); + }); + console.log(`Storage context successfully generated in ${ms / 1000}s.`); +} + +(async () => { + const serviceContext = serviceContextFromDefaults({ + chunkSize: CHUNK_SIZE, + chunkOverlap: CHUNK_OVERLAP, + }); + + await generateDatasource(serviceContext); + console.log("Finished generating storage."); +})(); diff --git a/packages/create-llama/templates/components/engines/context/index.ts b/packages/create-llama/templates/components/engines/context/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..cdd93809dcd7d9939aba8798fdac3639151e4ac5 --- /dev/null +++ b/packages/create-llama/templates/components/engines/context/index.ts @@ -0,0 +1,44 @@ +import { + ContextChatEngine, + LLM, + serviceContextFromDefaults, + SimpleDocumentStore, + storageContextFromDefaults, + VectorStoreIndex, +} from "llamaindex"; +import { CHUNK_OVERLAP, CHUNK_SIZE, STORAGE_CACHE_DIR } from "./constants.mjs"; + +async function getDataSource(llm: LLM) { + const serviceContext = serviceContextFromDefaults({ + llm, + chunkSize: CHUNK_SIZE, + chunkOverlap: CHUNK_OVERLAP, + }); + let storageContext = await storageContextFromDefaults({ + persistDir: `${STORAGE_CACHE_DIR}`, + }); + + const numberOfDocs = Object.keys( + (storageContext.docStore as SimpleDocumentStore).toDict(), + ).length; + if (numberOfDocs === 0) { + throw new Error( + `StorageContext is empty - call 'npm run generate' to generate the storage first`, + ); + } + return await VectorStoreIndex.init({ + storageContext, + serviceContext, + }); +} + +export async function createChatEngine(llm: LLM) { + const index = await getDataSource(llm); + const retriever = index.asRetriever(); + retriever.similarityTopK = 5; + + return new ContextChatEngine({ + chatModel: llm, + retriever, + }); +} diff --git a/packages/create-llama/templates/components/ui/shadcn/README-template.md b/packages/create-llama/templates/components/ui/shadcn/README-template.md new file mode 100644 index 0000000000000000000000000000000000000000..ebfcf48c999ef8e040b282adfd4312767f731bb5 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/README-template.md @@ -0,0 +1 @@ +Using the chat component from https://github.com/marcusschiesser/ui (based on https://ui.shadcn.com/) diff --git a/packages/create-llama/templates/components/ui/shadcn/button.tsx b/packages/create-llama/templates/components/ui/shadcn/button.tsx new file mode 100644 index 0000000000000000000000000000000000000000..662b0404d83445eb7fca1ead6724e944610fdf25 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/button.tsx @@ -0,0 +1,56 @@ +import { Slot } from "@radix-ui/react-slot"; +import { cva, type VariantProps } from "class-variance-authority"; +import * as React from "react"; + +import { cn } from "./lib/utils"; + +const buttonVariants = cva( + "inline-flex items-center justify-center whitespace-nowrap rounded-md text-sm font-medium ring-offset-background transition-colors focus-visible:outline-none focus-visible:ring-2 focus-visible:ring-ring focus-visible:ring-offset-2 disabled:pointer-events-none disabled:opacity-50", + { + variants: { + variant: { + default: "bg-primary text-primary-foreground hover:bg-primary/90", + destructive: + "bg-destructive text-destructive-foreground hover:bg-destructive/90", + outline: + "border border-input bg-background hover:bg-accent hover:text-accent-foreground", + secondary: + "bg-secondary text-secondary-foreground hover:bg-secondary/80", + ghost: "hover:bg-accent hover:text-accent-foreground", + link: "text-primary underline-offset-4 hover:underline", + }, + size: { + default: "h-10 px-4 py-2", + sm: "h-9 rounded-md px-3", + lg: "h-11 rounded-md px-8", + icon: "h-10 w-10", + }, + }, + defaultVariants: { + variant: "default", + size: "default", + }, + }, +); + +export interface ButtonProps + extends React.ButtonHTMLAttributes<HTMLButtonElement>, + VariantProps<typeof buttonVariants> { + asChild?: boolean; +} + +const Button = React.forwardRef<HTMLButtonElement, ButtonProps>( + ({ className, variant, size, asChild = false, ...props }, ref) => { + const Comp = asChild ? Slot : "button"; + return ( + <Comp + className={cn(buttonVariants({ variant, size, className }))} + ref={ref} + {...props} + /> + ); + }, +); +Button.displayName = "Button"; + +export { Button, buttonVariants }; diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/chat-actions.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/chat-actions.tsx new file mode 100644 index 0000000000000000000000000000000000000000..151ef61a945c49cacfd44c77cbdf7287b5967861 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/chat-actions.tsx @@ -0,0 +1,28 @@ +import { PauseCircle, RefreshCw } from "lucide-react"; + +import { Button } from "../button"; +import { ChatHandler } from "./chat.interface"; + +export default function ChatActions( + props: Pick<ChatHandler, "stop" | "reload"> & { + showReload?: boolean; + showStop?: boolean; + }, +) { + return ( + <div className="space-x-4"> + {props.showStop && ( + <Button variant="outline" size="sm" onClick={props.stop}> + <PauseCircle className="mr-2 h-4 w-4" /> + Stop generating + </Button> + )} + {props.showReload && ( + <Button variant="outline" size="sm" onClick={props.reload}> + <RefreshCw className="mr-2 h-4 w-4" /> + Regenerate + </Button> + )} + </div> + ); +} diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/chat-avatar.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/chat-avatar.tsx new file mode 100644 index 0000000000000000000000000000000000000000..ce04e306a7164e49e7ea6950a55c4f5cedc2ee2a --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/chat-avatar.tsx @@ -0,0 +1,25 @@ +import { User2 } from "lucide-react"; +import Image from "next/image"; + +export default function ChatAvatar({ role }: { role: string }) { + if (role === "user") { + return ( + <div className="flex h-8 w-8 shrink-0 select-none items-center justify-center rounded-md border bg-background shadow"> + <User2 className="h-4 w-4" /> + </div> + ); + } + + return ( + <div className="flex h-8 w-8 shrink-0 select-none items-center justify-center rounded-md border bg-black text-white shadow"> + <Image + className="rounded-md" + src="/llama.png" + alt="Llama Logo" + width={24} + height={24} + priority + /> + </div> + ); +} diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/chat-input.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/chat-input.tsx new file mode 100644 index 0000000000000000000000000000000000000000..1a0cc3e0cc6d92178bafce5e8d573586e024e3f6 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/chat-input.tsx @@ -0,0 +1,29 @@ +import { Button } from "../button"; +import { Input } from "../input"; +import { ChatHandler } from "./chat.interface"; + +export default function ChatInput( + props: Pick< + ChatHandler, + "isLoading" | "handleSubmit" | "handleInputChange" | "input" + >, +) { + return ( + <form + onSubmit={props.handleSubmit} + className="flex w-full items-start justify-between gap-4 rounded-xl bg-white p-4 shadow-xl" + > + <Input + autoFocus + name="message" + placeholder="Type a message" + className="flex-1" + value={props.input} + onChange={props.handleInputChange} + /> + <Button type="submit" disabled={props.isLoading}> + Send message + </Button> + </form> + ); +} diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/chat-message.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/chat-message.tsx new file mode 100644 index 0000000000000000000000000000000000000000..9ada08a3d7498a204ef3403b2148007f302936bf --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/chat-message.tsx @@ -0,0 +1,33 @@ +import { Check, Copy } from "lucide-react"; + +import { Button } from "../button"; +import ChatAvatar from "./chat-avatar"; +import { Message } from "./chat.interface"; +import Markdown from "./markdown"; +import { useCopyToClipboard } from "./use-copy-to-clipboard"; + +export default function ChatMessage(chatMessage: Message) { + const { isCopied, copyToClipboard } = useCopyToClipboard({ timeout: 2000 }); + return ( + <div className="flex items-start gap-4 pr-5 pt-5"> + <ChatAvatar role={chatMessage.role} /> + <div className="group flex flex-1 justify-between gap-2"> + <div className="flex-1"> + <Markdown content={chatMessage.content} /> + </div> + <Button + onClick={() => copyToClipboard(chatMessage.content)} + size="icon" + variant="ghost" + className="h-8 w-8 opacity-0 group-hover:opacity-100" + > + {isCopied ? ( + <Check className="h-4 w-4" /> + ) : ( + <Copy className="h-4 w-4" /> + )} + </Button> + </div> + </div> + ); +} diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/chat-messages.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/chat-messages.tsx new file mode 100644 index 0000000000000000000000000000000000000000..dd0a442b6cd567094f6393bf2ccf221ee1eb178d --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/chat-messages.tsx @@ -0,0 +1,51 @@ +import { useEffect, useRef } from "react"; + +import ChatActions from "./chat-actions"; +import ChatMessage from "./chat-message"; +import { ChatHandler } from "./chat.interface"; + +export default function ChatMessages( + props: Pick<ChatHandler, "messages" | "isLoading" | "reload" | "stop">, +) { + const scrollableChatContainerRef = useRef<HTMLDivElement>(null); + const messageLength = props.messages.length; + const lastMessage = props.messages[messageLength - 1]; + + const scrollToBottom = () => { + if (scrollableChatContainerRef.current) { + scrollableChatContainerRef.current.scrollTop = + scrollableChatContainerRef.current.scrollHeight; + } + }; + + const isLastMessageFromAssistant = + messageLength > 0 && lastMessage?.role !== "user"; + const showReload = + props.reload && !props.isLoading && isLastMessageFromAssistant; + const showStop = props.stop && props.isLoading; + + useEffect(() => { + scrollToBottom(); + }, [messageLength, lastMessage]); + + return ( + <div className="w-full rounded-xl bg-white p-4 shadow-xl pb-0"> + <div + className="flex h-[50vh] flex-col gap-5 divide-y overflow-y-auto pb-4" + ref={scrollableChatContainerRef} + > + {props.messages.map((m) => ( + <ChatMessage key={m.id} {...m} /> + ))} + </div> + <div className="flex justify-end py-4"> + <ChatActions + reload={props.reload} + stop={props.stop} + showReload={showReload} + showStop={showStop} + /> + </div> + </div> + ); +} diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/chat.interface.ts b/packages/create-llama/templates/components/ui/shadcn/chat/chat.interface.ts new file mode 100644 index 0000000000000000000000000000000000000000..3256f7f031b42114f192f3375632654dc21f78d8 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/chat.interface.ts @@ -0,0 +1,15 @@ +export interface Message { + id: string; + content: string; + role: string; +} + +export interface ChatHandler { + messages: Message[]; + input: string; + isLoading: boolean; + handleSubmit: (e: React.FormEvent<HTMLFormElement>) => void; + handleInputChange: (e: React.ChangeEvent<HTMLInputElement>) => void; + reload?: () => void; + stop?: () => void; +} diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/codeblock.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/codeblock.tsx new file mode 100644 index 0000000000000000000000000000000000000000..014a0fc3afb58366508bf2ab5d4314b6bfc4abc7 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/codeblock.tsx @@ -0,0 +1,139 @@ +"use client"; + +import { Check, Copy, Download } from "lucide-react"; +import { FC, memo } from "react"; +import { Prism, SyntaxHighlighterProps } from "react-syntax-highlighter"; +import { coldarkDark } from "react-syntax-highlighter/dist/cjs/styles/prism"; + +import { Button } from "../button"; +import { useCopyToClipboard } from "./use-copy-to-clipboard"; + +// TODO: Remove this when @type/react-syntax-highlighter is updated +const SyntaxHighlighter = Prism as unknown as FC<SyntaxHighlighterProps>; + +interface Props { + language: string; + value: string; +} + +interface languageMap { + [key: string]: string | undefined; +} + +export const programmingLanguages: languageMap = { + javascript: ".js", + python: ".py", + java: ".java", + c: ".c", + cpp: ".cpp", + "c++": ".cpp", + "c#": ".cs", + ruby: ".rb", + php: ".php", + swift: ".swift", + "objective-c": ".m", + kotlin: ".kt", + typescript: ".ts", + go: ".go", + perl: ".pl", + rust: ".rs", + scala: ".scala", + haskell: ".hs", + lua: ".lua", + shell: ".sh", + sql: ".sql", + html: ".html", + css: ".css", + // add more file extensions here, make sure the key is same as language prop in CodeBlock.tsx component +}; + +export const generateRandomString = (length: number, lowercase = false) => { + const chars = "ABCDEFGHJKLMNPQRSTUVWXY3456789"; // excluding similar looking characters like Z, 2, I, 1, O, 0 + let result = ""; + for (let i = 0; i < length; i++) { + result += chars.charAt(Math.floor(Math.random() * chars.length)); + } + return lowercase ? result.toLowerCase() : result; +}; + +const CodeBlock: FC<Props> = memo(({ language, value }) => { + const { isCopied, copyToClipboard } = useCopyToClipboard({ timeout: 2000 }); + + const downloadAsFile = () => { + if (typeof window === "undefined") { + return; + } + const fileExtension = programmingLanguages[language] || ".file"; + const suggestedFileName = `file-${generateRandomString( + 3, + true, + )}${fileExtension}`; + const fileName = window.prompt("Enter file name" || "", suggestedFileName); + + if (!fileName) { + // User pressed cancel on prompt. + return; + } + + const blob = new Blob([value], { type: "text/plain" }); + const url = URL.createObjectURL(blob); + const link = document.createElement("a"); + link.download = fileName; + link.href = url; + link.style.display = "none"; + document.body.appendChild(link); + link.click(); + document.body.removeChild(link); + URL.revokeObjectURL(url); + }; + + const onCopy = () => { + if (isCopied) return; + copyToClipboard(value); + }; + + return ( + <div className="codeblock relative w-full bg-zinc-950 font-sans"> + <div className="flex w-full items-center justify-between bg-zinc-800 px-6 py-2 pr-4 text-zinc-100"> + <span className="text-xs lowercase">{language}</span> + <div className="flex items-center space-x-1"> + <Button variant="ghost" onClick={downloadAsFile} size="icon"> + <Download /> + <span className="sr-only">Download</span> + </Button> + <Button variant="ghost" size="icon" onClick={onCopy}> + {isCopied ? ( + <Check className="h-4 w-4" /> + ) : ( + <Copy className="h-4 w-4" /> + )} + <span className="sr-only">Copy code</span> + </Button> + </div> + </div> + <SyntaxHighlighter + language={language} + style={coldarkDark} + PreTag="div" + showLineNumbers + customStyle={{ + width: "100%", + background: "transparent", + padding: "1.5rem 1rem", + borderRadius: "0.5rem", + }} + codeTagProps={{ + style: { + fontSize: "0.9rem", + fontFamily: "var(--font-mono)", + }, + }} + > + {value} + </SyntaxHighlighter> + </div> + ); +}); +CodeBlock.displayName = "CodeBlock"; + +export { CodeBlock }; diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/index.ts b/packages/create-llama/templates/components/ui/shadcn/chat/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..c7990f9c13fff2f6cc17faf0a87c7d42f5326471 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/index.ts @@ -0,0 +1,5 @@ +import ChatInput from "./chat-input"; +import ChatMessages from "./chat-messages"; + +export { type ChatHandler, type Message } from "./chat.interface"; +export { ChatInput, ChatMessages }; diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/markdown.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/markdown.tsx new file mode 100644 index 0000000000000000000000000000000000000000..3ca538051d69aac03135b367c8d8a7d01d7be592 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/markdown.tsx @@ -0,0 +1,59 @@ +import { FC, memo } from "react"; +import ReactMarkdown, { Options } from "react-markdown"; +import remarkGfm from "remark-gfm"; +import remarkMath from "remark-math"; + +import { CodeBlock } from "./codeblock"; + +const MemoizedReactMarkdown: FC<Options> = memo( + ReactMarkdown, + (prevProps, nextProps) => + prevProps.children === nextProps.children && + prevProps.className === nextProps.className, +); + +export default function Markdown({ content }: { content: string }) { + return ( + <MemoizedReactMarkdown + className="prose dark:prose-invert prose-p:leading-relaxed prose-pre:p-0 break-words" + remarkPlugins={[remarkGfm, remarkMath]} + components={{ + p({ children }) { + return <p className="mb-2 last:mb-0">{children}</p>; + }, + code({ node, inline, className, children, ...props }) { + if (children.length) { + if (children[0] == "▍") { + return ( + <span className="mt-1 animate-pulse cursor-default">▍</span> + ); + } + + children[0] = (children[0] as string).replace("`▍`", "▍"); + } + + const match = /language-(\w+)/.exec(className || ""); + + if (inline) { + return ( + <code className={className} {...props}> + {children} + </code> + ); + } + + return ( + <CodeBlock + key={Math.random()} + language={(match && match[1]) || ""} + value={String(children).replace(/\n$/, "")} + {...props} + /> + ); + }, + }} + > + {content} + </MemoizedReactMarkdown> + ); +} diff --git a/packages/create-llama/templates/components/ui/shadcn/chat/use-copy-to-clipboard.tsx b/packages/create-llama/templates/components/ui/shadcn/chat/use-copy-to-clipboard.tsx new file mode 100644 index 0000000000000000000000000000000000000000..e011d69bdc2a3c0e2a2c187fa29b00f429e1c947 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/chat/use-copy-to-clipboard.tsx @@ -0,0 +1,33 @@ +"use client"; + +import * as React from "react"; + +export interface useCopyToClipboardProps { + timeout?: number; +} + +export function useCopyToClipboard({ + timeout = 2000, +}: useCopyToClipboardProps) { + const [isCopied, setIsCopied] = React.useState<Boolean>(false); + + const copyToClipboard = (value: string) => { + if (typeof window === "undefined" || !navigator.clipboard?.writeText) { + return; + } + + if (!value) { + return; + } + + navigator.clipboard.writeText(value).then(() => { + setIsCopied(true); + + setTimeout(() => { + setIsCopied(false); + }, timeout); + }); + }; + + return { isCopied, copyToClipboard }; +} diff --git a/packages/create-llama/templates/components/ui/shadcn/input.tsx b/packages/create-llama/templates/components/ui/shadcn/input.tsx new file mode 100644 index 0000000000000000000000000000000000000000..edfa129e623cca64fa706d7750e3635fecd1d628 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/input.tsx @@ -0,0 +1,25 @@ +import * as React from "react"; + +import { cn } from "./lib/utils"; + +export interface InputProps + extends React.InputHTMLAttributes<HTMLInputElement> {} + +const Input = React.forwardRef<HTMLInputElement, InputProps>( + ({ className, type, ...props }, ref) => { + return ( + <input + type={type} + className={cn( + "flex h-10 w-full rounded-md border border-input bg-background px-3 py-2 text-sm ring-offset-background file:border-0 file:bg-transparent file:text-sm file:font-medium placeholder:text-muted-foreground focus-visible:outline-none focus-visible:ring-2 focus-visible:ring-ring focus-visible:ring-offset-2 disabled:cursor-not-allowed disabled:opacity-50", + className, + )} + ref={ref} + {...props} + /> + ); + }, +); +Input.displayName = "Input"; + +export { Input }; diff --git a/packages/create-llama/templates/components/ui/shadcn/lib/utils.ts b/packages/create-llama/templates/components/ui/shadcn/lib/utils.ts new file mode 100644 index 0000000000000000000000000000000000000000..a5ef193506d07d0459fec4f187af08283094d7c8 --- /dev/null +++ b/packages/create-llama/templates/components/ui/shadcn/lib/utils.ts @@ -0,0 +1,6 @@ +import { clsx, type ClassValue } from "clsx"; +import { twMerge } from "tailwind-merge"; + +export function cn(...inputs: ClassValue[]) { + return twMerge(clsx(inputs)); +} diff --git a/packages/create-llama/templates/index.ts b/packages/create-llama/templates/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..a9f0998eb2315ee1e2166904e548d14db7fb5b00 --- /dev/null +++ b/packages/create-llama/templates/index.ts @@ -0,0 +1,328 @@ +import { copy } from "../helpers/copy"; +import { callPackageManager } from "../helpers/install"; + +import fs from "fs/promises"; +import os from "os"; +import path from "path"; +import { bold, cyan } from "picocolors"; +import { version } from "../../core/package.json"; + +import { PackageManager } from "../helpers/get-pkg-manager"; +import { + InstallTemplateArgs, + TemplateEngine, + TemplateFramework, +} from "./types"; + +const envFileNameMap: Record<TemplateFramework, string> = { + nextjs: ".env.local", + express: ".env", + fastapi: ".env", +}; + +const createEnvLocalFile = async ( + root: string, + framework: TemplateFramework, + openAIKey?: string, +) => { + if (openAIKey) { + const envFileName = envFileNameMap[framework]; + if (!envFileName) return; + await fs.writeFile( + path.join(root, envFileName), + `OPENAI_API_KEY=${openAIKey}\n`, + ); + console.log(`Created '${envFileName}' file containing OPENAI_API_KEY`); + process.env["OPENAI_API_KEY"] = openAIKey; + } +}; + +const copyTestData = async ( + root: string, + framework: TemplateFramework, + packageManager?: PackageManager, + engine?: TemplateEngine, +) => { + if (engine === "context" || framework === "fastapi") { + const srcPath = path.join(__dirname, "components", "data"); + const destPath = path.join(root, "data"); + console.log(`\nCopying test data to ${cyan(destPath)}\n`); + await copy("**", destPath, { + parents: true, + cwd: srcPath, + }); + } + + if (packageManager && engine === "context") { + if (process.env["OPENAI_API_KEY"]) { + console.log( + `\nRunning ${cyan( + `${packageManager} run generate`, + )} to generate the context data.\n`, + ); + await callPackageManager(packageManager, true, ["run", "generate"]); + console.log(); + } else { + console.log( + `\nAfter setting your OpenAI key, run ${cyan( + `${packageManager} run generate`, + )} to generate the context data.\n`, + ); + } + } +}; + +const rename = (name: string) => { + switch (name) { + case "gitignore": + case "eslintrc.json": { + return `.${name}`; + } + // README.md is ignored by webpack-asset-relocator-loader used by ncc: + // https://github.com/vercel/webpack-asset-relocator-loader/blob/e9308683d47ff507253e37c9bcbb99474603192b/src/asset-relocator.js#L227 + case "README-template.md": { + return "README.md"; + } + default: { + return name; + } + } +}; + +/** + * Install a LlamaIndex internal template to a given `root` directory. + */ +const installTSTemplate = async ({ + appName, + root, + packageManager, + isOnline, + template, + framework, + engine, + ui, + eslint, + customApiPath, + forBackend, +}: InstallTemplateArgs) => { + console.log(bold(`Using ${packageManager}.`)); + + /** + * Copy the template files to the target directory. + */ + console.log("\nInitializing project with template:", template, "\n"); + const templatePath = path.join(__dirname, "types", template, framework); + const copySource = ["**"]; + if (!eslint) copySource.push("!eslintrc.json"); + + await copy(copySource, root, { + parents: true, + cwd: templatePath, + rename, + }); + + /** + * If the backend is next.js, rename next.config.app.js to next.config.js + * If not, rename next.config.static.js to next.config.js + */ + if (framework == "nextjs" && forBackend === "nextjs") { + const nextConfigAppPath = path.join(root, "next.config.app.js"); + const nextConfigPath = path.join(root, "next.config.js"); + await fs.rename(nextConfigAppPath, nextConfigPath); + // delete next.config.static.js + const nextConfigStaticPath = path.join(root, "next.config.static.js"); + await fs.rm(nextConfigStaticPath); + } else if (framework == "nextjs" && typeof forBackend === "undefined") { + const nextConfigStaticPath = path.join(root, "next.config.static.js"); + const nextConfigPath = path.join(root, "next.config.js"); + await fs.rename(nextConfigStaticPath, nextConfigPath); + // delete next.config.app.js + const nextConfigAppPath = path.join(root, "next.config.app.js"); + await fs.rm(nextConfigAppPath); + } + + /** + * Copy the selected chat engine files to the target directory and reference it. + */ + let relativeEngineDestPath; + const compPath = path.join(__dirname, "components"); + if (engine && (framework === "express" || framework === "nextjs")) { + console.log("\nUsing chat engine:", engine, "\n"); + const enginePath = path.join(compPath, "engines", engine); + relativeEngineDestPath = + framework === "nextjs" + ? path.join("app", "api", "chat") + : path.join("src", "controllers"); + await copy("**", path.join(root, relativeEngineDestPath, "engine"), { + parents: true, + cwd: enginePath, + }); + } + + /** + * Copy the selected UI files to the target directory and reference it. + */ + if (framework === "nextjs" && ui !== "html") { + console.log("\nUsing UI:", ui, "\n"); + const uiPath = path.join(compPath, "ui", ui); + const destUiPath = path.join(root, "app", "components", "ui"); + // remove the default ui folder + await fs.rm(destUiPath, { recursive: true }); + // copy the selected ui folder + await copy("**", destUiPath, { + parents: true, + cwd: uiPath, + rename, + }); + } + + /** + * Update the package.json scripts. + */ + const packageJsonFile = path.join(root, "package.json"); + const packageJson: any = JSON.parse( + await fs.readFile(packageJsonFile, "utf8"), + ); + packageJson.name = appName; + packageJson.version = "0.1.0"; + + packageJson.dependencies = { + ...packageJson.dependencies, + llamaindex: version, + }; + + if (framework === "nextjs" && customApiPath) { + console.log( + "\nUsing external API with custom API path:", + customApiPath, + "\n", + ); + // remove the default api folder + const apiPath = path.join(root, "app", "api"); + await fs.rm(apiPath, { recursive: true }); + // modify the dev script to use the custom api path + packageJson.scripts = { + ...packageJson.scripts, + dev: `NEXT_PUBLIC_CHAT_API=${customApiPath} next dev`, + }; + } + + if (engine === "context" && relativeEngineDestPath) { + // add generate script if using context engine + packageJson.scripts = { + ...packageJson.scripts, + generate: `node ${path.join( + relativeEngineDestPath, + "engine", + "generate.mjs", + )}`, + }; + } + + if (framework === "nextjs" && ui === "shadcn") { + // add shadcn dependencies to package.json + packageJson.dependencies = { + ...packageJson.dependencies, + "tailwind-merge": "^2", + "@radix-ui/react-slot": "^1", + "class-variance-authority": "^0.7", + "lucide-react": "^0.291", + remark: "^14.0.3", + "remark-code-import": "^1.2.0", + "remark-gfm": "^3.0.1", + "remark-math": "^5.1.1", + "react-markdown": "^8.0.7", + "react-syntax-highlighter": "^15.5.0", + }; + + packageJson.devDependencies = { + ...packageJson.devDependencies, + "@types/react-syntax-highlighter": "^15.5.6", + }; + } + + if (!eslint) { + // Remove packages starting with "eslint" from devDependencies + packageJson.devDependencies = Object.fromEntries( + Object.entries(packageJson.devDependencies).filter( + ([key]) => !key.startsWith("eslint"), + ), + ); + } + await fs.writeFile( + packageJsonFile, + JSON.stringify(packageJson, null, 2) + os.EOL, + ); + + console.log("\nInstalling dependencies:"); + for (const dependency in packageJson.dependencies) + console.log(`- ${cyan(dependency)}`); + + console.log("\nInstalling devDependencies:"); + for (const dependency in packageJson.devDependencies) + console.log(`- ${cyan(dependency)}`); + + console.log(); + + await callPackageManager(packageManager, isOnline); +}; + +const installPythonTemplate = async ({ + root, + template, + framework, +}: Pick<InstallTemplateArgs, "root" | "framework" | "template">) => { + console.log("\nInitializing Python project with template:", template, "\n"); + const templatePath = path.join(__dirname, "types", template, framework); + await copy("**", root, { + parents: true, + cwd: templatePath, + rename(name) { + switch (name) { + case "gitignore": { + return `.${name}`; + } + // README.md is ignored by webpack-asset-relocator-loader used by ncc: + // https://github.com/vercel/webpack-asset-relocator-loader/blob/e9308683d47ff507253e37c9bcbb99474603192b/src/asset-relocator.js#L227 + case "README-template.md": { + return "README.md"; + } + default: { + return name; + } + } + }, + }); + + console.log( + "\nPython project, dependencies won't be installed automatically.\n", + ); +}; + +export const installTemplate = async ( + props: InstallTemplateArgs & { backend: boolean }, +) => { + process.chdir(props.root); + if (props.framework === "fastapi") { + await installPythonTemplate(props); + } else { + await installTSTemplate(props); + } + + if (props.backend) { + // This is a backend, so we need to copy the test data and create the env file. + + // Copy the environment file to the target directory. + await createEnvLocalFile(props.root, props.framework, props.openAIKey); + + // Copy test pdf file + await copyTestData( + props.root, + props.framework, + props.packageManager, + props.engine, + ); + } +}; + +export * from "./types"; diff --git a/packages/create-llama/templates/types.ts b/packages/create-llama/templates/types.ts new file mode 100644 index 0000000000000000000000000000000000000000..926dddd5d97899e0886f6c2fc788906d168363e4 --- /dev/null +++ b/packages/create-llama/templates/types.ts @@ -0,0 +1,21 @@ +import { PackageManager } from "../helpers/get-pkg-manager"; + +export type TemplateType = "simple" | "streaming"; +export type TemplateFramework = "nextjs" | "express" | "fastapi"; +export type TemplateEngine = "simple" | "context"; +export type TemplateUI = "html" | "shadcn"; + +export interface InstallTemplateArgs { + appName: string; + root: string; + packageManager: PackageManager; + isOnline: boolean; + template: TemplateType; + framework: TemplateFramework; + engine?: TemplateEngine; + ui: TemplateUI; + eslint: boolean; + customApiPath?: string; + openAIKey?: string; + forBackend?: string; +} diff --git a/packages/create-llama/templates/types/simple/express/README-template.md b/packages/create-llama/templates/types/simple/express/README-template.md new file mode 100644 index 0000000000000000000000000000000000000000..7ea94ab755535aefd4d5edc9f20a5908d7fedead --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/README-template.md @@ -0,0 +1,50 @@ +This is a [LlamaIndex](https://www.llamaindex.ai/) project using [Express](https://expressjs.com/) bootstrapped with [`create-llama`](https://github.com/run-llama/LlamaIndexTS/tree/main/packages/create-llama). + +## Getting Started + +First, install the dependencies: + +``` +npm install +``` + +Second, run the development server: + +``` +npm run dev +``` + +Then call the express API endpoint `/api/chat` to see the result: + +``` +curl --location 'localhost:8000/api/chat' \ +--header 'Content-Type: application/json' \ +--data '{ "messages": [{ "role": "user", "content": "Hello" }] }' +``` + +You can start editing the API by modifying `src/controllers/chat.controller.ts`. The endpoint auto-updates as you save the file. + +## Production + +First, build the project: + +``` +npm run build +``` + +You can then run the production server: + +``` +NODE_ENV=production npm run start +``` + +> Note that the `NODE_ENV` environment variable is set to `production`. This disables CORS for all origins. + +## Learn More + +To learn more about LlamaIndex, take a look at the following resources: + +- [LlamaIndex Documentation](https://docs.llamaindex.ai) - learn about LlamaIndex (Python features). +- [LlamaIndexTS Documentation](https://ts.llamaindex.ai) - learn about LlamaIndex (Typescript features). + +You can check out [the LlamaIndexTS GitHub repository](https://github.com/run-llama/LlamaIndexTS) - your feedback and contributions are welcome! diff --git a/packages/create-llama/templates/types/simple/express/eslintrc.json b/packages/create-llama/templates/types/simple/express/eslintrc.json new file mode 100644 index 0000000000000000000000000000000000000000..c19581799d886ce5be17def8ad268c2f4b175109 --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/eslintrc.json @@ -0,0 +1,3 @@ +{ + "extends": "eslint:recommended" +} \ No newline at end of file diff --git a/packages/create-llama/templates/types/simple/express/gitignore b/packages/create-llama/templates/types/simple/express/gitignore new file mode 100644 index 0000000000000000000000000000000000000000..15c3d3d576346a73d81d193ffc345f814cc291ca --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/gitignore @@ -0,0 +1,2 @@ +# local env files +.env diff --git a/packages/create-llama/templates/types/simple/express/index.ts b/packages/create-llama/templates/types/simple/express/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..daf5d8b6e82599243a1becc1d8e85c0de769e9dd --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/index.ts @@ -0,0 +1,38 @@ +import cors from "cors"; +import "dotenv/config"; +import express, { Express, Request, Response } from "express"; +import chatRouter from "./src/routes/chat.route"; + +const app: Express = express(); +const port = 8000; + +const env = process.env["NODE_ENV"]; +const isDevelopment = !env || env === "development"; +const prodCorsOrigin = process.env["PROD_CORS_ORIGIN"]; + +if (isDevelopment) { + console.warn("Running in development mode - allowing CORS for all origins"); + app.use(cors()); +} else if (prodCorsOrigin) { + console.log( + `Running in production mode - allowing CORS for domain: ${prodCorsOrigin}`, + ); + const corsOptions = { + origin: prodCorsOrigin, // Restrict to production domain + }; + app.use(cors(corsOptions)); +} else { + console.warn("Production CORS origin not set, defaulting to no CORS."); +} + +app.use(express.text()); + +app.get("/", (req: Request, res: Response) => { + res.send("LlamaIndex Express Server"); +}); + +app.use("/api/chat", chatRouter); + +app.listen(port, () => { + console.log(`⚡️[server]: Server is running at http://localhost:${port}`); +}); diff --git a/packages/create-llama/templates/types/simple/express/package.json b/packages/create-llama/templates/types/simple/express/package.json new file mode 100644 index 0000000000000000000000000000000000000000..55902071463959a02df82ad72ae516d0e385bc78 --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/package.json @@ -0,0 +1,27 @@ +{ + "name": "llama-index-express", + "version": "1.0.0", + "main": "dist/index.js", + "type": "module", + "scripts": { + "build": "tsup index.ts --format esm --dts", + "start": "node dist/index.js", + "dev": "concurrently \"tsup index.ts --format esm --dts --watch\" \"nodemon -q dist/index.js\"" + }, + "dependencies": { + "cors": "^2.8.5", + "dotenv": "^16.3.1", + "express": "^4", + "llamaindex": "0.0.31" + }, + "devDependencies": { + "@types/cors": "^2.8.16", + "@types/express": "^4", + "@types/node": "^20", + "concurrently": "^8", + "eslint": "^8", + "nodemon": "^3", + "tsup": "^7", + "typescript": "^5" + } +} diff --git a/packages/create-llama/templates/types/simple/express/src/controllers/chat.controller.ts b/packages/create-llama/templates/types/simple/express/src/controllers/chat.controller.ts new file mode 100644 index 0000000000000000000000000000000000000000..dd4532ffde1f611545a0b406899eb73c657ca11b --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/src/controllers/chat.controller.ts @@ -0,0 +1,37 @@ +import { NextFunction, Request, Response } from "express"; +import { ChatMessage, OpenAI } from "llamaindex"; +import { createChatEngine } from "./engine"; + +export const chat = async (req: Request, res: Response, next: NextFunction) => { + try { + const { messages }: { messages: ChatMessage[] } = JSON.parse(req.body); + const lastMessage = messages.pop(); + if (!messages || !lastMessage || lastMessage.role !== "user") { + return res.status(400).json({ + error: + "messages are required in the request body and the last message must be from the user", + }); + } + + const llm = new OpenAI({ + model: "gpt-3.5-turbo", + }); + + const chatEngine = await createChatEngine(llm); + + const response = await chatEngine.chat(lastMessage.content, messages); + const result: ChatMessage = { + role: "assistant", + content: response.response, + }; + + return res.status(200).json({ + result, + }); + } catch (error) { + console.error("[LlamaIndex]", error); + return res.status(500).json({ + error: (error as Error).message, + }); + } +}; diff --git a/packages/create-llama/templates/types/simple/express/src/controllers/engine/index.ts b/packages/create-llama/templates/types/simple/express/src/controllers/engine/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..abb02e90cd2ce91096791bf10c4665afcbe11d38 --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/src/controllers/engine/index.ts @@ -0,0 +1,7 @@ +import { LLM, SimpleChatEngine } from "llamaindex"; + +export async function createChatEngine(llm: LLM) { + return new SimpleChatEngine({ + llm, + }); +} diff --git a/packages/create-llama/templates/types/simple/express/src/routes/chat.route.ts b/packages/create-llama/templates/types/simple/express/src/routes/chat.route.ts new file mode 100644 index 0000000000000000000000000000000000000000..bdfeb08534b9a2c987c4d23a4bb5c6df50075908 --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/src/routes/chat.route.ts @@ -0,0 +1,8 @@ +import express from "express"; +import { chat } from "../controllers/chat.controller"; + +const llmRouter = express.Router(); + +llmRouter.route("/").post(chat); + +export default llmRouter; diff --git a/packages/create-llama/templates/types/simple/express/tsconfig.json b/packages/create-llama/templates/types/simple/express/tsconfig.json new file mode 100644 index 0000000000000000000000000000000000000000..e886da1ef324ab02d14102f3a4a36c8f90f70eef --- /dev/null +++ b/packages/create-llama/templates/types/simple/express/tsconfig.json @@ -0,0 +1,10 @@ +{ + "compilerOptions": { + "target": "es2016", + "esModuleInterop": true, + "forceConsistentCasingInFileNames": true, + "strict": true, + "skipLibCheck": true, + "moduleResolution": "node" + } +} \ No newline at end of file diff --git a/packages/create-llama/templates/types/simple/fastapi/README-template.md b/packages/create-llama/templates/types/simple/fastapi/README-template.md new file mode 100644 index 0000000000000000000000000000000000000000..f0bfa5e089a960e2327b6ccdd4548948952b36f3 --- /dev/null +++ b/packages/create-llama/templates/types/simple/fastapi/README-template.md @@ -0,0 +1,50 @@ +This is a [LlamaIndex](https://www.llamaindex.ai/) project using [FastAPI](https://fastapi.tiangolo.com/) bootstrapped with [`create-llama`](https://github.com/run-llama/LlamaIndexTS/tree/main/packages/create-llama). + +## Getting Started + +First, setup the environment: + +``` +poetry install +poetry shell +``` + +By default, we use the OpenAI LLM (though you can customize, see app/api/routers/chat.py). As a result you need to specify an `OPENAI_API_KEY` in an .env file in this directory. + +Example `backend/.env` file: + +``` +OPENAI_API_KEY=<openai_api_key> +``` + +Second, run the development server: + +``` +python main.py +``` + +Then call the API endpoint `/api/chat` to see the result: + +``` +curl --location 'localhost:8000/api/chat' \ +--header 'Content-Type: application/json' \ +--data '{ "messages": [{ "role": "user", "content": "Hello" }] }' +``` + +You can start editing the API by modifying `app/api/routers/chat.py`. The endpoint auto-updates as you save the file. + +Open [http://localhost:8000/docs](http://localhost:8000/docs) with your browser to see the Swagger UI of the API. + +The API allows CORS for all origins to simplify development. You can change this behavior by setting the `ENVIRONMENT` environment variable to `prod`: + +``` +ENVIRONMENT=prod uvicorn main:app +``` + +## Learn More + +To learn more about LlamaIndex, take a look at the following resources: + +- [LlamaIndex Documentation](https://docs.llamaindex.ai) - learn about LlamaIndex. + +You can check out [the LlamaIndex GitHub repository](https://github.com/run-llama/llama_index) - your feedback and contributions are welcome! diff --git a/packages/create-llama/templates/types/simple/fastapi/app/__init__.py b/packages/create-llama/templates/types/simple/fastapi/app/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/simple/fastapi/app/api/__init__.py b/packages/create-llama/templates/types/simple/fastapi/app/api/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/simple/fastapi/app/api/routers/__init__.py b/packages/create-llama/templates/types/simple/fastapi/app/api/routers/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/simple/fastapi/app/api/routers/chat.py b/packages/create-llama/templates/types/simple/fastapi/app/api/routers/chat.py new file mode 100644 index 0000000000000000000000000000000000000000..81f602edbeae66c5850b30a6183c009ab4b1e014 --- /dev/null +++ b/packages/create-llama/templates/types/simple/fastapi/app/api/routers/chat.py @@ -0,0 +1,56 @@ +from typing import List + +from app.utils.index import get_index +from fastapi import APIRouter, Depends, HTTPException, status +from llama_index import VectorStoreIndex +from llama_index.llms.base import MessageRole, ChatMessage +from pydantic import BaseModel + +chat_router = r = APIRouter() + + +class _Message(BaseModel): + role: MessageRole + content: str + + +class _ChatData(BaseModel): + messages: List[_Message] + + +class _Result(BaseModel): + result: _Message + + +@r.post("") +async def chat( + data: _ChatData, + index: VectorStoreIndex = Depends(get_index), +) -> _Result: + # check preconditions and get last message + if len(data.messages) == 0: + raise HTTPException( + status_code=status.HTTP_400_BAD_REQUEST, + detail="No messages provided", + ) + lastMessage = data.messages.pop() + if lastMessage.role != MessageRole.USER: + raise HTTPException( + status_code=status.HTTP_400_BAD_REQUEST, + detail="Last message must be from user", + ) + # convert messages coming from the request to type ChatMessage + messages = [ + ChatMessage( + role=m.role, + content=m.content, + ) + for m in data.messages + ] + + # query chat engine + chat_engine = index.as_chat_engine() + response = chat_engine.chat(lastMessage.content, messages) + return _Result( + result=_Message(role=MessageRole.ASSISTANT, content=response.response) + ) diff --git a/packages/create-llama/templates/types/simple/fastapi/app/utils/__init__.py b/packages/create-llama/templates/types/simple/fastapi/app/utils/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/simple/fastapi/app/utils/index.py b/packages/create-llama/templates/types/simple/fastapi/app/utils/index.py new file mode 100644 index 0000000000000000000000000000000000000000..530935b7ec84c93bafee5e4d37265f4e4411fd65 --- /dev/null +++ b/packages/create-llama/templates/types/simple/fastapi/app/utils/index.py @@ -0,0 +1,39 @@ +import logging +import os + +from llama_index import ( + SimpleDirectoryReader, + StorageContext, + VectorStoreIndex, + load_index_from_storage, + ServiceContext, +) +from llama_index.llms import OpenAI + + +STORAGE_DIR = "./storage" # directory to cache the generated index +DATA_DIR = "./data" # directory containing the documents to index + +service_context = ServiceContext.from_defaults( + llm=OpenAI(model="gpt-3.5-turbo") +) + + +def get_index(): + logger = logging.getLogger("uvicorn") + # check if storage already exists + if not os.path.exists(STORAGE_DIR): + logger.info("Creating new index") + # load the documents and create the index + documents = SimpleDirectoryReader(DATA_DIR).load_data() + index = VectorStoreIndex.from_documents(documents,service_context=service_context) + # store it for later + index.storage_context.persist(STORAGE_DIR) + logger.info(f"Finished creating new index. Stored in {STORAGE_DIR}") + else: + # load the existing index + logger.info(f"Loading index from {STORAGE_DIR}...") + storage_context = StorageContext.from_defaults(persist_dir=STORAGE_DIR) + index = load_index_from_storage(storage_context,service_context=service_context) + logger.info(f"Finished loading index from {STORAGE_DIR}") + return index diff --git a/packages/create-llama/templates/types/simple/fastapi/gitignore b/packages/create-llama/templates/types/simple/fastapi/gitignore new file mode 100644 index 0000000000000000000000000000000000000000..a6ad564cd45eee8c8bd1fdc633d733d17b4a777a --- /dev/null +++ b/packages/create-llama/templates/types/simple/fastapi/gitignore @@ -0,0 +1,3 @@ +__pycache__ +storage +.env diff --git a/packages/create-llama/templates/types/simple/fastapi/main.py b/packages/create-llama/templates/types/simple/fastapi/main.py new file mode 100644 index 0000000000000000000000000000000000000000..00cb79c44d58f4819243b8ee16c3108bef950382 --- /dev/null +++ b/packages/create-llama/templates/types/simple/fastapi/main.py @@ -0,0 +1,31 @@ +from dotenv import load_dotenv +load_dotenv() + +import logging +import os +import uvicorn +from app.api.routers.chat import chat_router +from fastapi import FastAPI +from fastapi.middleware.cors import CORSMiddleware + +app = FastAPI() + +environment = os.getenv("ENVIRONMENT", "dev") # Default to 'development' if not set + + +if environment == "dev": + logger = logging.getLogger("uvicorn") + logger.warning("Running in development mode - allowing CORS for all origins") + app.add_middleware( + CORSMiddleware, + allow_origins=["*"], + allow_credentials=True, + allow_methods=["*"], + allow_headers=["*"], + ) + +app.include_router(chat_router, prefix="/api/chat") + + +if __name__ == "__main__": + uvicorn.run(app="main:app", host="0.0.0.0", reload=True) diff --git a/packages/create-llama/templates/types/simple/fastapi/pyproject.toml b/packages/create-llama/templates/types/simple/fastapi/pyproject.toml new file mode 100644 index 0000000000000000000000000000000000000000..59d182bbb47a8d0ee06de3550f2c7fbf954a3901 --- /dev/null +++ b/packages/create-llama/templates/types/simple/fastapi/pyproject.toml @@ -0,0 +1,19 @@ +[tool.poetry] +name = "llamaindex-fastapi" +version = "0.1.0" +description = "" +authors = ["Marcus Schiesser <mail@marcusschiesser.de>"] +readme = "README.md" + +[tool.poetry.dependencies] +python = "^3.11,<3.12" +fastapi = "^0.104.1" +uvicorn = { extras = ["standard"], version = "^0.23.2" } +llama-index = "^0.8.56" +pypdf = "^3.17.0" +python-dotenv = "^1.0.0" + + +[build-system] +requires = ["poetry-core"] +build-backend = "poetry.core.masonry.api" diff --git a/packages/create-llama/templates/types/simple/fastapi/tests/__init__.py b/packages/create-llama/templates/types/simple/fastapi/tests/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/simple/nextjs/.env.example b/packages/create-llama/templates/types/simple/nextjs/.env.example new file mode 100644 index 0000000000000000000000000000000000000000..7ac0a01551a65a68003c2615d510269b5d6a77f6 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/.env.example @@ -0,0 +1,3 @@ +# Rename this file to `.env.local` to use environment variables locally with `next dev` +# https://nextjs.org/docs/pages/building-your-application/configuring/environment-variables +MY_HOST="example.com" diff --git a/packages/create-llama/templates/types/simple/nextjs/README-template.md b/packages/create-llama/templates/types/simple/nextjs/README-template.md new file mode 100644 index 0000000000000000000000000000000000000000..1509ded7c3be489d369b94d6d6a286d496f488d8 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/README-template.md @@ -0,0 +1,30 @@ +This is a [LlamaIndex](https://www.llamaindex.ai/) project using [Next.js](https://nextjs.org/) bootstrapped with [`create-llama`](https://github.com/run-llama/LlamaIndexTS/tree/main/packages/create-llama). + +## Getting Started + +First, install the dependencies: + +``` +npm install +``` + +Second, run the development server: + +``` +npm run dev +``` + +Open [http://localhost:3000](http://localhost:3000) with your browser to see the result. + +You can start editing the page by modifying `app/page.tsx`. The page auto-updates as you edit the file. + +This project uses [`next/font`](https://nextjs.org/docs/basic-features/font-optimization) to automatically optimize and load Inter, a custom Google Font. + +## Learn More + +To learn more about LlamaIndex, take a look at the following resources: + +- [LlamaIndex Documentation](https://docs.llamaindex.ai) - learn about LlamaIndex (Python features). +- [LlamaIndexTS Documentation](https://ts.llamaindex.ai) - learn about LlamaIndex (Typescript features). + +You can check out [the LlamaIndexTS GitHub repository](https://github.com/run-llama/LlamaIndexTS) - your feedback and contributions are welcome! diff --git a/packages/create-llama/templates/types/simple/nextjs/app/api/chat/engine/index.ts b/packages/create-llama/templates/types/simple/nextjs/app/api/chat/engine/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..abb02e90cd2ce91096791bf10c4665afcbe11d38 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/api/chat/engine/index.ts @@ -0,0 +1,7 @@ +import { LLM, SimpleChatEngine } from "llamaindex"; + +export async function createChatEngine(llm: LLM) { + return new SimpleChatEngine({ + llm, + }); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/api/chat/route.ts b/packages/create-llama/templates/types/simple/nextjs/app/api/chat/route.ts new file mode 100644 index 0000000000000000000000000000000000000000..097341ab43922058b9d06b53c215feb16a2a7e23 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/api/chat/route.ts @@ -0,0 +1,47 @@ +import { ChatMessage, OpenAI } from "llamaindex"; +import { NextRequest, NextResponse } from "next/server"; +import { createChatEngine } from "./engine"; + +export const runtime = "nodejs"; +export const dynamic = "force-dynamic"; + +export async function POST(request: NextRequest) { + try { + const body = await request.json(); + const { messages }: { messages: ChatMessage[] } = body; + const lastMessage = messages.pop(); + if (!messages || !lastMessage || lastMessage.role !== "user") { + return NextResponse.json( + { + error: + "messages are required in the request body and the last message must be from the user", + }, + { status: 400 }, + ); + } + + const llm = new OpenAI({ + model: "gpt-3.5-turbo", + }); + + const chatEngine = await createChatEngine(llm); + + const response = await chatEngine.chat(lastMessage.content, messages); + const result: ChatMessage = { + role: "assistant", + content: response.response, + }; + + return NextResponse.json({ result }); + } catch (error) { + console.error("[LlamaIndex]", error); + return NextResponse.json( + { + error: (error as Error).message, + }, + { + status: 500, + }, + ); + } +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/components/chat-section.tsx b/packages/create-llama/templates/types/simple/nextjs/app/components/chat-section.tsx new file mode 100644 index 0000000000000000000000000000000000000000..133a0a884bb82fb1ed3c78553852b8ae9b169cd5 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/components/chat-section.tsx @@ -0,0 +1,80 @@ +"use client"; + +import { nanoid } from "nanoid"; +import { useState } from "react"; +import { ChatInput, ChatInputProps, ChatMessages, Message } from "./ui/chat"; + +function useChat(): ChatInputProps & { messages: Message[] } { + const [messages, setMessages] = useState<Message[]>([]); + const [isLoading, setIsLoading] = useState(false); + const [input, setInput] = useState(""); + + const getAssistantMessage = async (messages: Message[]) => { + const response = await fetch( + process.env.NEXT_PUBLIC_CHAT_API ?? "/api/chat", + { + method: "POST", + headers: { + "Content-Type": "application/json", + }, + body: JSON.stringify({ + messages, + }), + }, + ); + const data = await response.json(); + const assistantMessage = data.result as Message; + return assistantMessage; + }; + + const handleSubmit = async (e: React.FormEvent<HTMLFormElement>) => { + e.preventDefault(); + if (!input) return; + + setIsLoading(true); + + try { + const newMessages = [ + ...messages, + { id: nanoid(), content: input, role: "user" }, + ]; + setMessages(newMessages); + setInput(""); + const assistantMessage = await getAssistantMessage(newMessages); + setMessages([...newMessages, { ...assistantMessage, id: nanoid() }]); + } catch (error: any) { + console.log(error); + alert(error.message); + } finally { + setIsLoading(false); + } + }; + + const handleInputChange = (e: any): void => { + setInput(e.target.value); + }; + + return { + messages, + isLoading, + input, + handleSubmit, + handleInputChange, + }; +} + +export default function ChatSection() { + const { messages, isLoading, input, handleSubmit, handleInputChange } = + useChat(); + return ( + <div className="space-y-4 max-w-5xl w-full"> + <ChatMessages messages={messages} /> + <ChatInput + handleSubmit={handleSubmit} + isLoading={isLoading} + input={input} + handleInputChange={handleInputChange} + /> + </div> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/components/header.tsx b/packages/create-llama/templates/types/simple/nextjs/app/components/header.tsx new file mode 100644 index 0000000000000000000000000000000000000000..2b0e488f769eff6700a282c2a6a77dd8d0a4dac8 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/components/header.tsx @@ -0,0 +1,28 @@ +import Image from "next/image"; + +export default function Header() { + return ( + <div className="z-10 max-w-5xl w-full items-center justify-between font-mono text-sm lg:flex"> + <p className="fixed left-0 top-0 flex w-full justify-center border-b border-gray-300 bg-gradient-to-b from-zinc-200 pb-6 pt-8 backdrop-blur-2xl dark:border-neutral-800 dark:bg-zinc-800/30 dark:from-inherit lg:static lg:w-auto lg:rounded-xl lg:border lg:bg-gray-200 lg:p-4 lg:dark:bg-zinc-800/30"> + Get started by editing + <code className="font-mono font-bold">app/page.tsx</code> + </p> + <div className="fixed bottom-0 left-0 flex h-48 w-full items-end justify-center bg-gradient-to-t from-white via-white dark:from-black dark:via-black lg:static lg:h-auto lg:w-auto lg:bg-none"> + <a + href="https://www.llamaindex.ai/" + className="flex items-center justify-center font-nunito text-lg font-bold gap-2" + > + <span>Built by LlamaIndex</span> + <Image + className="rounded-xl" + src="/llama.png" + alt="Llama Logo" + width={40} + height={40} + priority + /> + </a> + </div> + </div> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-avatar.tsx b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-avatar.tsx new file mode 100644 index 0000000000000000000000000000000000000000..cd241104e4ef210c728aec47a1ab8b0161ad6538 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-avatar.tsx @@ -0,0 +1,34 @@ +"use client"; + +import Image from "next/image"; +import { Message } from "./chat-messages"; + +export default function ChatAvatar(message: Message) { + if (message.role === "user") { + return ( + <div className="flex h-8 w-8 shrink-0 select-none items-center justify-center rounded-md border shadow bg-background"> + <svg + xmlns="http://www.w3.org/2000/svg" + viewBox="0 0 256 256" + fill="currentColor" + className="h-4 w-4" + > + <path d="M230.92 212c-15.23-26.33-38.7-45.21-66.09-54.16a72 72 0 1 0-73.66 0c-27.39 8.94-50.86 27.82-66.09 54.16a8 8 0 1 0 13.85 8c18.84-32.56 52.14-52 89.07-52s70.23 19.44 89.07 52a8 8 0 1 0 13.85-8ZM72 96a56 56 0 1 1 56 56 56.06 56.06 0 0 1-56-56Z"></path> + </svg> + </div> + ); + } + + return ( + <div className="flex h-8 w-8 shrink-0 select-none items-center justify-center rounded-md border bg-black text-white"> + <Image + className="rounded-md" + src="/llama.png" + alt="Llama Logo" + width={24} + height={24} + priority + /> + </div> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-input.tsx b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-input.tsx new file mode 100644 index 0000000000000000000000000000000000000000..3eb979b02735943f3f11290c78b84f0e37709438 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-input.tsx @@ -0,0 +1,42 @@ +"use client"; + +export interface ChatInputProps { + /** The current value of the input */ + input?: string; + /** An input/textarea-ready onChange handler to control the value of the input */ + handleInputChange?: ( + e: + | React.ChangeEvent<HTMLInputElement> + | React.ChangeEvent<HTMLTextAreaElement>, + ) => void; + /** Form submission handler to automatically reset input and append a user message */ + handleSubmit: (e: React.FormEvent<HTMLFormElement>) => void; + isLoading: boolean; +} + +export default function ChatInput(props: ChatInputProps) { + return ( + <> + <form + onSubmit={props.handleSubmit} + className="flex items-start justify-between w-full max-w-5xl p-4 bg-white rounded-xl shadow-xl gap-4" + > + <input + autoFocus + name="message" + placeholder="Type a message" + className="w-full p-4 rounded-xl shadow-inner flex-1" + value={props.input} + onChange={props.handleInputChange} + /> + <button + disabled={props.isLoading} + type="submit" + className="p-4 text-white rounded-xl shadow-xl bg-gradient-to-r from-cyan-500 to-sky-500 disabled:opacity-50 disabled:cursor-not-allowed" + > + Send message + </button> + </form> + </> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-item.tsx b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-item.tsx new file mode 100644 index 0000000000000000000000000000000000000000..2244f729a8ba668121ab5ec0842963d22153ef92 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-item.tsx @@ -0,0 +1,13 @@ +"use client"; + +import ChatAvatar from "./chat-avatar"; +import { Message } from "./chat-messages"; + +export default function ChatItem(message: Message) { + return ( + <div className="flex items-start gap-4 pt-5"> + <ChatAvatar {...message} /> + <p className="break-words">{message.content}</p> + </div> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-messages.tsx b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-messages.tsx new file mode 100644 index 0000000000000000000000000000000000000000..65eacabbfb1b7bc99950b43e7fd07ba56b3ecdb0 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/chat-messages.tsx @@ -0,0 +1,38 @@ +"use client"; + +import { useEffect, useRef } from "react"; +import ChatItem from "./chat-item"; + +export interface Message { + id: string; + content: string; + role: string; +} + +export default function ChatMessages({ messages }: { messages: Message[] }) { + const scrollableChatContainerRef = useRef<HTMLDivElement>(null); + + const scrollToBottom = () => { + if (scrollableChatContainerRef.current) { + scrollableChatContainerRef.current.scrollTop = + scrollableChatContainerRef.current.scrollHeight; + } + }; + + useEffect(() => { + scrollToBottom(); + }, [messages.length]); + + return ( + <div className="w-full max-w-5xl p-4 bg-white rounded-xl shadow-xl"> + <div + className="flex flex-col gap-5 divide-y h-[50vh] overflow-auto" + ref={scrollableChatContainerRef} + > + {messages.map((m: Message) => ( + <ChatItem key={m.id} {...m} /> + ))} + </div> + </div> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/index.ts b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..5de7dce47fc1e2330759171db291eedbca19e722 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/components/ui/chat/index.ts @@ -0,0 +1,6 @@ +import ChatInput from "./chat-input"; +import ChatMessages from "./chat-messages"; + +export type { ChatInputProps } from "./chat-input"; +export type { Message } from "./chat-messages"; +export { ChatInput, ChatMessages }; diff --git a/packages/create-llama/templates/types/simple/nextjs/app/favicon.ico b/packages/create-llama/templates/types/simple/nextjs/app/favicon.ico new file mode 100644 index 0000000000000000000000000000000000000000..a1eaef62f2dfa895f1bbffc6595bb53d9604963e Binary files /dev/null and b/packages/create-llama/templates/types/simple/nextjs/app/favicon.ico differ diff --git a/packages/create-llama/templates/types/simple/nextjs/app/globals.css b/packages/create-llama/templates/types/simple/nextjs/app/globals.css new file mode 100644 index 0000000000000000000000000000000000000000..09b85ed2c912e25518ddebbfebaba69090f889f4 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/globals.css @@ -0,0 +1,94 @@ +@tailwind base; +@tailwind components; +@tailwind utilities; + +@layer base { + :root { + --background: 0 0% 100%; + --foreground: 222.2 47.4% 11.2%; + + --muted: 210 40% 96.1%; + --muted-foreground: 215.4 16.3% 46.9%; + + --popover: 0 0% 100%; + --popover-foreground: 222.2 47.4% 11.2%; + + --border: 214.3 31.8% 91.4%; + --input: 214.3 31.8% 91.4%; + + --card: 0 0% 100%; + --card-foreground: 222.2 47.4% 11.2%; + + --primary: 222.2 47.4% 11.2%; + --primary-foreground: 210 40% 98%; + + --secondary: 210 40% 96.1%; + --secondary-foreground: 222.2 47.4% 11.2%; + + --accent: 210 40% 96.1%; + --accent-foreground: 222.2 47.4% 11.2%; + + --destructive: 0 100% 50%; + --destructive-foreground: 210 40% 98%; + + --ring: 215 20.2% 65.1%; + + --radius: 0.5rem; + } + + .dark { + --background: 224 71% 4%; + --foreground: 213 31% 91%; + + --muted: 223 47% 11%; + --muted-foreground: 215.4 16.3% 56.9%; + + --accent: 216 34% 17%; + --accent-foreground: 210 40% 98%; + + --popover: 224 71% 4%; + --popover-foreground: 215 20.2% 65.1%; + + --border: 216 34% 17%; + --input: 216 34% 17%; + + --card: 224 71% 4%; + --card-foreground: 213 31% 91%; + + --primary: 210 40% 98%; + --primary-foreground: 222.2 47.4% 1.2%; + + --secondary: 222.2 47.4% 11.2%; + --secondary-foreground: 210 40% 98%; + + --destructive: 0 63% 31%; + --destructive-foreground: 210 40% 98%; + + --ring: 216 34% 17%; + + --radius: 0.5rem; + } +} + +@layer base { + * { + @apply border-border; + } + body { + @apply bg-background text-foreground; + font-feature-settings: + "rlig" 1, + "calt" 1; + } + .background-gradient { + background-color: #fff; + background-image: radial-gradient( + at 21% 11%, + rgba(186, 186, 233, 0.53) 0, + transparent 50% + ), + radial-gradient(at 85% 0, hsla(46, 57%, 78%, 0.52) 0, transparent 50%), + radial-gradient(at 91% 36%, rgba(194, 213, 255, 0.68) 0, transparent 50%), + radial-gradient(at 8% 40%, rgba(251, 218, 239, 0.46) 0, transparent 50%); + } +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/layout.tsx b/packages/create-llama/templates/types/simple/nextjs/app/layout.tsx new file mode 100644 index 0000000000000000000000000000000000000000..fb097706274bdfe4690e4953bba24d7acea0a021 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/layout.tsx @@ -0,0 +1,22 @@ +import type { Metadata } from "next"; +import { Inter } from "next/font/google"; +import "./globals.css"; + +const inter = Inter({ subsets: ["latin"] }); + +export const metadata: Metadata = { + title: "Create Llama App", + description: "Generated by create-llama", +}; + +export default function RootLayout({ + children, +}: { + children: React.ReactNode; +}) { + return ( + <html lang="en"> + <body className={inter.className}>{children}</body> + </html> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/app/page.tsx b/packages/create-llama/templates/types/simple/nextjs/app/page.tsx new file mode 100644 index 0000000000000000000000000000000000000000..31f51facb248687cf7e7c6b34493778634a8c59c --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/app/page.tsx @@ -0,0 +1,11 @@ +import ChatSection from "@/app/components/chat-section"; +import Header from "@/app/components/header"; + +export default function Home() { + return ( + <main className="flex min-h-screen flex-col items-center gap-10 p-24 background-gradient"> + <Header /> + <ChatSection /> + </main> + ); +} diff --git a/packages/create-llama/templates/types/simple/nextjs/eslintrc.json b/packages/create-llama/templates/types/simple/nextjs/eslintrc.json new file mode 100644 index 0000000000000000000000000000000000000000..bffb357a7122523ec94045523758c4b825b448ef --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/eslintrc.json @@ -0,0 +1,3 @@ +{ + "extends": "next/core-web-vitals" +} diff --git a/packages/create-llama/templates/types/simple/nextjs/gitignore b/packages/create-llama/templates/types/simple/nextjs/gitignore new file mode 100644 index 0000000000000000000000000000000000000000..8f322f0d8f49570a594b865ef8916c428a01afc1 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/gitignore @@ -0,0 +1,35 @@ +# See https://help.github.com/articles/ignoring-files/ for more about ignoring files. + +# dependencies +/node_modules +/.pnp +.pnp.js + +# testing +/coverage + +# next.js +/.next/ +/out/ + +# production +/build + +# misc +.DS_Store +*.pem + +# debug +npm-debug.log* +yarn-debug.log* +yarn-error.log* + +# local env files +.env*.local + +# vercel +.vercel + +# typescript +*.tsbuildinfo +next-env.d.ts diff --git a/packages/create-llama/templates/types/simple/nextjs/next-env.d.ts b/packages/create-llama/templates/types/simple/nextjs/next-env.d.ts new file mode 100644 index 0000000000000000000000000000000000000000..4f11a03dc6cc37f2b5105c08f2e7b24c603ab2f4 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/next-env.d.ts @@ -0,0 +1,5 @@ +/// <reference types="next" /> +/// <reference types="next/image-types/global" /> + +// NOTE: This file should not be edited +// see https://nextjs.org/docs/basic-features/typescript for more information. diff --git a/packages/create-llama/templates/types/simple/nextjs/next.config.app.js b/packages/create-llama/templates/types/simple/nextjs/next.config.app.js new file mode 100644 index 0000000000000000000000000000000000000000..74655207e206e9efa7215e79ea163e8ae2052361 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/next.config.app.js @@ -0,0 +1,11 @@ +/** @type {import('next').NextConfig} */ +const nextConfig = { + experimental: { + serverComponentsExternalPackages: ["llamaindex"], + outputFileTracingIncludes: { + "/*": ["./cache/**/*"], + }, + }, +}; + +module.exports = nextConfig; diff --git a/packages/create-llama/templates/types/simple/nextjs/next.config.static.js b/packages/create-llama/templates/types/simple/nextjs/next.config.static.js new file mode 100644 index 0000000000000000000000000000000000000000..166b3e67d75ddc6d594b1c3d0960cc51f54b13b9 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/next.config.static.js @@ -0,0 +1,13 @@ +/** @type {import('next').NextConfig} */ +const nextConfig = { + output: "export", + images: { unoptimized: true }, + experimental: { + serverComponentsExternalPackages: ["llamaindex"], + outputFileTracingIncludes: { + "/*": ["./cache/**/*"], + }, + }, +}; + +module.exports = nextConfig; diff --git a/packages/create-llama/templates/types/simple/nextjs/package.json b/packages/create-llama/templates/types/simple/nextjs/package.json new file mode 100644 index 0000000000000000000000000000000000000000..990b41c832c69b81883c88b2d078c55bef15b42c --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/package.json @@ -0,0 +1,28 @@ +{ + "name": "llama-index-nextjs", + "version": "1.0.0", + "scripts": { + "dev": "next dev", + "build": "next build", + "start": "next start", + "lint": "next lint" + }, + "dependencies": { + "llamaindex": "0.0.31", + "nanoid": "^5", + "next": "^13", + "react": "^18", + "react-dom": "^18" + }, + "devDependencies": { + "@types/node": "^20", + "@types/react": "^18", + "@types/react-dom": "^18", + "autoprefixer": "^10", + "eslint": "^8", + "eslint-config-next": "^13", + "postcss": "^8", + "tailwindcss": "^3", + "typescript": "^5" + } +} \ No newline at end of file diff --git a/packages/create-llama/templates/types/simple/nextjs/postcss.config.js b/packages/create-llama/templates/types/simple/nextjs/postcss.config.js new file mode 100644 index 0000000000000000000000000000000000000000..12a703d900da8159c30e75acbd2c4d87ae177f62 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/postcss.config.js @@ -0,0 +1,6 @@ +module.exports = { + plugins: { + tailwindcss: {}, + autoprefixer: {}, + }, +}; diff --git a/packages/create-llama/templates/types/simple/nextjs/public/llama.png b/packages/create-llama/templates/types/simple/nextjs/public/llama.png new file mode 100644 index 0000000000000000000000000000000000000000..d4efba3b816bf765439c6d01b322b02684e946c3 Binary files /dev/null and b/packages/create-llama/templates/types/simple/nextjs/public/llama.png differ diff --git a/packages/create-llama/templates/types/simple/nextjs/tailwind.config.ts b/packages/create-llama/templates/types/simple/nextjs/tailwind.config.ts new file mode 100644 index 0000000000000000000000000000000000000000..aa5580affac868255fedb5a8ddc0dde7a105c454 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/tailwind.config.ts @@ -0,0 +1,78 @@ +import type { Config } from "tailwindcss"; +import { fontFamily } from "tailwindcss/defaultTheme"; + +const config: Config = { + darkMode: ["class"], + content: ["app/**/*.{ts,tsx}", "components/**/*.{ts,tsx}"], + theme: { + container: { + center: true, + padding: "2rem", + screens: { + "2xl": "1400px", + }, + }, + extend: { + colors: { + border: "hsl(var(--border))", + input: "hsl(var(--input))", + ring: "hsl(var(--ring))", + background: "hsl(var(--background))", + foreground: "hsl(var(--foreground))", + primary: { + DEFAULT: "hsl(var(--primary))", + foreground: "hsl(var(--primary-foreground))", + }, + secondary: { + DEFAULT: "hsl(var(--secondary))", + foreground: "hsl(var(--secondary-foreground))", + }, + destructive: { + DEFAULT: "hsl(var(--destructive) / <alpha-value>)", + foreground: "hsl(var(--destructive-foreground) / <alpha-value>)", + }, + muted: { + DEFAULT: "hsl(var(--muted))", + foreground: "hsl(var(--muted-foreground))", + }, + accent: { + DEFAULT: "hsl(var(--accent))", + foreground: "hsl(var(--accent-foreground))", + }, + popover: { + DEFAULT: "hsl(var(--popover))", + foreground: "hsl(var(--popover-foreground))", + }, + card: { + DEFAULT: "hsl(var(--card))", + foreground: "hsl(var(--card-foreground))", + }, + }, + borderRadius: { + xl: `calc(var(--radius) + 4px)`, + lg: `var(--radius)`, + md: `calc(var(--radius) - 2px)`, + sm: "calc(var(--radius) - 4px)", + }, + fontFamily: { + sans: ["var(--font-sans)", ...fontFamily.sans], + }, + keyframes: { + "accordion-down": { + from: { height: "0" }, + to: { height: "var(--radix-accordion-content-height)" }, + }, + "accordion-up": { + from: { height: "var(--radix-accordion-content-height)" }, + to: { height: "0" }, + }, + }, + animation: { + "accordion-down": "accordion-down 0.2s ease-out", + "accordion-up": "accordion-up 0.2s ease-out", + }, + }, + }, + plugins: [], +}; +export default config; diff --git a/packages/create-llama/templates/types/simple/nextjs/tsconfig.json b/packages/create-llama/templates/types/simple/nextjs/tsconfig.json new file mode 100644 index 0000000000000000000000000000000000000000..c7146963787144d4861e149d8d233049b7daefc7 --- /dev/null +++ b/packages/create-llama/templates/types/simple/nextjs/tsconfig.json @@ -0,0 +1,27 @@ +{ + "compilerOptions": { + "target": "es5", + "lib": ["dom", "dom.iterable", "esnext"], + "allowJs": true, + "skipLibCheck": true, + "strict": true, + "noEmit": true, + "esModuleInterop": true, + "module": "esnext", + "moduleResolution": "bundler", + "resolveJsonModule": true, + "isolatedModules": true, + "jsx": "preserve", + "incremental": true, + "plugins": [ + { + "name": "next" + } + ], + "paths": { + "@/*": ["./*"] + } + }, + "include": ["next-env.d.ts", "**/*.ts", "**/*.tsx", ".next/types/**/*.ts"], + "exclude": ["node_modules"] +} diff --git a/packages/create-llama/templates/types/streaming/express/README-template.md b/packages/create-llama/templates/types/streaming/express/README-template.md new file mode 100644 index 0000000000000000000000000000000000000000..7ea94ab755535aefd4d5edc9f20a5908d7fedead --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/README-template.md @@ -0,0 +1,50 @@ +This is a [LlamaIndex](https://www.llamaindex.ai/) project using [Express](https://expressjs.com/) bootstrapped with [`create-llama`](https://github.com/run-llama/LlamaIndexTS/tree/main/packages/create-llama). + +## Getting Started + +First, install the dependencies: + +``` +npm install +``` + +Second, run the development server: + +``` +npm run dev +``` + +Then call the express API endpoint `/api/chat` to see the result: + +``` +curl --location 'localhost:8000/api/chat' \ +--header 'Content-Type: application/json' \ +--data '{ "messages": [{ "role": "user", "content": "Hello" }] }' +``` + +You can start editing the API by modifying `src/controllers/chat.controller.ts`. The endpoint auto-updates as you save the file. + +## Production + +First, build the project: + +``` +npm run build +``` + +You can then run the production server: + +``` +NODE_ENV=production npm run start +``` + +> Note that the `NODE_ENV` environment variable is set to `production`. This disables CORS for all origins. + +## Learn More + +To learn more about LlamaIndex, take a look at the following resources: + +- [LlamaIndex Documentation](https://docs.llamaindex.ai) - learn about LlamaIndex (Python features). +- [LlamaIndexTS Documentation](https://ts.llamaindex.ai) - learn about LlamaIndex (Typescript features). + +You can check out [the LlamaIndexTS GitHub repository](https://github.com/run-llama/LlamaIndexTS) - your feedback and contributions are welcome! diff --git a/packages/create-llama/templates/types/streaming/express/eslintrc.json b/packages/create-llama/templates/types/streaming/express/eslintrc.json new file mode 100644 index 0000000000000000000000000000000000000000..c19581799d886ce5be17def8ad268c2f4b175109 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/eslintrc.json @@ -0,0 +1,3 @@ +{ + "extends": "eslint:recommended" +} \ No newline at end of file diff --git a/packages/create-llama/templates/types/streaming/express/gitignore b/packages/create-llama/templates/types/streaming/express/gitignore new file mode 100644 index 0000000000000000000000000000000000000000..15c3d3d576346a73d81d193ffc345f814cc291ca --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/gitignore @@ -0,0 +1,2 @@ +# local env files +.env diff --git a/packages/create-llama/templates/types/streaming/express/index.ts b/packages/create-llama/templates/types/streaming/express/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..daf5d8b6e82599243a1becc1d8e85c0de769e9dd --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/index.ts @@ -0,0 +1,38 @@ +import cors from "cors"; +import "dotenv/config"; +import express, { Express, Request, Response } from "express"; +import chatRouter from "./src/routes/chat.route"; + +const app: Express = express(); +const port = 8000; + +const env = process.env["NODE_ENV"]; +const isDevelopment = !env || env === "development"; +const prodCorsOrigin = process.env["PROD_CORS_ORIGIN"]; + +if (isDevelopment) { + console.warn("Running in development mode - allowing CORS for all origins"); + app.use(cors()); +} else if (prodCorsOrigin) { + console.log( + `Running in production mode - allowing CORS for domain: ${prodCorsOrigin}`, + ); + const corsOptions = { + origin: prodCorsOrigin, // Restrict to production domain + }; + app.use(cors(corsOptions)); +} else { + console.warn("Production CORS origin not set, defaulting to no CORS."); +} + +app.use(express.text()); + +app.get("/", (req: Request, res: Response) => { + res.send("LlamaIndex Express Server"); +}); + +app.use("/api/chat", chatRouter); + +app.listen(port, () => { + console.log(`⚡️[server]: Server is running at http://localhost:${port}`); +}); diff --git a/packages/create-llama/templates/types/streaming/express/package.json b/packages/create-llama/templates/types/streaming/express/package.json new file mode 100644 index 0000000000000000000000000000000000000000..72f127b407a8c7ce675bf4d634a42f57af78bb4c --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/package.json @@ -0,0 +1,28 @@ +{ + "name": "llama-index-express-streaming", + "version": "1.0.0", + "main": "dist/index.js", + "type": "module", + "scripts": { + "build": "tsup index.ts --format esm --dts", + "start": "node dist/index.js", + "dev": "concurrently \"tsup index.ts --format esm --dts --watch\" \"nodemon -q dist/index.js\"" + }, + "dependencies": { + "ai": "^2", + "cors": "^2.8.5", + "dotenv": "^16.3.1", + "express": "^4", + "llamaindex": "0.0.31" + }, + "devDependencies": { + "@types/cors": "^2.8.16", + "@types/express": "^4", + "@types/node": "^20", + "concurrently": "^8", + "eslint": "^8", + "nodemon": "^3", + "tsup": "^7", + "typescript": "^5" + } +} diff --git a/packages/create-llama/templates/types/streaming/express/src/controllers/chat.controller.ts b/packages/create-llama/templates/types/streaming/express/src/controllers/chat.controller.ts new file mode 100644 index 0000000000000000000000000000000000000000..efa05479614fcb36de52e90fa47a0026b73db468 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/src/controllers/chat.controller.ts @@ -0,0 +1,36 @@ +import { streamToResponse } from "ai"; +import { NextFunction, Request, Response } from "express"; +import { ChatMessage, OpenAI } from "llamaindex"; +import { createChatEngine } from "./engine"; +import { LlamaIndexStream } from "./llamaindex-stream"; + +export const chat = async (req: Request, res: Response, next: NextFunction) => { + try { + const { messages }: { messages: ChatMessage[] } = JSON.parse(req.body); + const lastMessage = messages.pop(); + if (!messages || !lastMessage || lastMessage.role !== "user") { + return res.status(400).json({ + error: + "messages are required in the request body and the last message must be from the user", + }); + } + + const llm = new OpenAI({ + model: "gpt-3.5-turbo", + }); + + const chatEngine = await createChatEngine(llm); + + const response = await chatEngine.chat(lastMessage.content, messages, true); + + // Transform the response into a readable stream + const stream = LlamaIndexStream(response); + + streamToResponse(stream, res); + } catch (error) { + console.error("[LlamaIndex]", error); + return res.status(500).json({ + error: (error as Error).message, + }); + } +}; diff --git a/packages/create-llama/templates/types/streaming/express/src/controllers/engine/index.ts b/packages/create-llama/templates/types/streaming/express/src/controllers/engine/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..abb02e90cd2ce91096791bf10c4665afcbe11d38 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/src/controllers/engine/index.ts @@ -0,0 +1,7 @@ +import { LLM, SimpleChatEngine } from "llamaindex"; + +export async function createChatEngine(llm: LLM) { + return new SimpleChatEngine({ + llm, + }); +} diff --git a/packages/create-llama/templates/types/streaming/express/src/controllers/llamaindex-stream.ts b/packages/create-llama/templates/types/streaming/express/src/controllers/llamaindex-stream.ts new file mode 100644 index 0000000000000000000000000000000000000000..12328de875d8a59a5501db7fbf2aa0d763a3dbaa --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/src/controllers/llamaindex-stream.ts @@ -0,0 +1,35 @@ +import { + createCallbacksTransformer, + createStreamDataTransformer, + trimStartOfStreamHelper, + type AIStreamCallbacksAndOptions, +} from "ai"; + +function createParser(res: AsyncGenerator<any>) { + const trimStartOfStream = trimStartOfStreamHelper(); + return new ReadableStream<string>({ + async pull(controller): Promise<void> { + const { value, done } = await res.next(); + if (done) { + controller.close(); + return; + } + + const text = trimStartOfStream(value ?? ""); + if (text) { + controller.enqueue(text); + } + }, + }); +} + +export function LlamaIndexStream( + res: AsyncGenerator<any>, + callbacks?: AIStreamCallbacksAndOptions, +): ReadableStream { + return createParser(res) + .pipeThrough(createCallbacksTransformer(callbacks)) + .pipeThrough( + createStreamDataTransformer(callbacks?.experimental_streamData), + ); +} diff --git a/packages/create-llama/templates/types/streaming/express/src/routes/chat.route.ts b/packages/create-llama/templates/types/streaming/express/src/routes/chat.route.ts new file mode 100644 index 0000000000000000000000000000000000000000..bdfeb08534b9a2c987c4d23a4bb5c6df50075908 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/src/routes/chat.route.ts @@ -0,0 +1,8 @@ +import express from "express"; +import { chat } from "../controllers/chat.controller"; + +const llmRouter = express.Router(); + +llmRouter.route("/").post(chat); + +export default llmRouter; diff --git a/packages/create-llama/templates/types/streaming/express/tsconfig.json b/packages/create-llama/templates/types/streaming/express/tsconfig.json new file mode 100644 index 0000000000000000000000000000000000000000..e886da1ef324ab02d14102f3a4a36c8f90f70eef --- /dev/null +++ b/packages/create-llama/templates/types/streaming/express/tsconfig.json @@ -0,0 +1,10 @@ +{ + "compilerOptions": { + "target": "es2016", + "esModuleInterop": true, + "forceConsistentCasingInFileNames": true, + "strict": true, + "skipLibCheck": true, + "moduleResolution": "node" + } +} \ No newline at end of file diff --git a/packages/create-llama/templates/types/streaming/fastapi/README-template.md b/packages/create-llama/templates/types/streaming/fastapi/README-template.md new file mode 100644 index 0000000000000000000000000000000000000000..f0bfa5e089a960e2327b6ccdd4548948952b36f3 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/fastapi/README-template.md @@ -0,0 +1,50 @@ +This is a [LlamaIndex](https://www.llamaindex.ai/) project using [FastAPI](https://fastapi.tiangolo.com/) bootstrapped with [`create-llama`](https://github.com/run-llama/LlamaIndexTS/tree/main/packages/create-llama). + +## Getting Started + +First, setup the environment: + +``` +poetry install +poetry shell +``` + +By default, we use the OpenAI LLM (though you can customize, see app/api/routers/chat.py). As a result you need to specify an `OPENAI_API_KEY` in an .env file in this directory. + +Example `backend/.env` file: + +``` +OPENAI_API_KEY=<openai_api_key> +``` + +Second, run the development server: + +``` +python main.py +``` + +Then call the API endpoint `/api/chat` to see the result: + +``` +curl --location 'localhost:8000/api/chat' \ +--header 'Content-Type: application/json' \ +--data '{ "messages": [{ "role": "user", "content": "Hello" }] }' +``` + +You can start editing the API by modifying `app/api/routers/chat.py`. The endpoint auto-updates as you save the file. + +Open [http://localhost:8000/docs](http://localhost:8000/docs) with your browser to see the Swagger UI of the API. + +The API allows CORS for all origins to simplify development. You can change this behavior by setting the `ENVIRONMENT` environment variable to `prod`: + +``` +ENVIRONMENT=prod uvicorn main:app +``` + +## Learn More + +To learn more about LlamaIndex, take a look at the following resources: + +- [LlamaIndex Documentation](https://docs.llamaindex.ai) - learn about LlamaIndex. + +You can check out [the LlamaIndex GitHub repository](https://github.com/run-llama/llama_index) - your feedback and contributions are welcome! diff --git a/packages/create-llama/templates/types/streaming/fastapi/app/__init__.py b/packages/create-llama/templates/types/streaming/fastapi/app/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/streaming/fastapi/app/api/__init__.py b/packages/create-llama/templates/types/streaming/fastapi/app/api/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/streaming/fastapi/app/api/routers/__init__.py b/packages/create-llama/templates/types/streaming/fastapi/app/api/routers/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/streaming/fastapi/app/api/routers/chat.py b/packages/create-llama/templates/types/streaming/fastapi/app/api/routers/chat.py new file mode 100644 index 0000000000000000000000000000000000000000..36b618e232a33fc882b3d4b42b885c29c64edd4e --- /dev/null +++ b/packages/create-llama/templates/types/streaming/fastapi/app/api/routers/chat.py @@ -0,0 +1,65 @@ +from typing import List + +from fastapi.responses import StreamingResponse + +from app.utils.json import json_to_model +from app.utils.index import get_index +from fastapi import APIRouter, Depends, HTTPException, Request, status +from llama_index import VectorStoreIndex +from llama_index.llms.base import MessageRole, ChatMessage +from pydantic import BaseModel + +chat_router = r = APIRouter() + + +class _Message(BaseModel): + role: MessageRole + content: str + + +class _ChatData(BaseModel): + messages: List[_Message] + + +@r.post("") +async def chat( + request: Request, + # Note: To support clients sending a JSON object using content-type "text/plain", + # we need to use Depends(json_to_model(_ChatData)) here + data: _ChatData = Depends(json_to_model(_ChatData)), + index: VectorStoreIndex = Depends(get_index), +): + # check preconditions and get last message + if len(data.messages) == 0: + raise HTTPException( + status_code=status.HTTP_400_BAD_REQUEST, + detail="No messages provided", + ) + lastMessage = data.messages.pop() + if lastMessage.role != MessageRole.USER: + raise HTTPException( + status_code=status.HTTP_400_BAD_REQUEST, + detail="Last message must be from user", + ) + # convert messages coming from the request to type ChatMessage + messages = [ + ChatMessage( + role=m.role, + content=m.content, + ) + for m in data.messages + ] + + # query chat engine + chat_engine = index.as_chat_engine() + response = chat_engine.stream_chat(lastMessage.content, messages) + + # stream response + async def event_generator(): + for token in response.response_gen: + # If client closes connection, stop sending events + if await request.is_disconnected(): + break + yield token + + return StreamingResponse(event_generator(), media_type="text/plain") diff --git a/packages/create-llama/templates/types/streaming/fastapi/app/utils/__init__.py b/packages/create-llama/templates/types/streaming/fastapi/app/utils/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/streaming/fastapi/app/utils/index.py b/packages/create-llama/templates/types/streaming/fastapi/app/utils/index.py new file mode 100644 index 0000000000000000000000000000000000000000..cb16cdba37897fc203bdd0358c5f088628375a3f --- /dev/null +++ b/packages/create-llama/templates/types/streaming/fastapi/app/utils/index.py @@ -0,0 +1,38 @@ +import logging +import os + +from llama_index import ( + SimpleDirectoryReader, + StorageContext, + VectorStoreIndex, + load_index_from_storage, + ServiceContext, +) +from llama_index.llms import OpenAI + + +STORAGE_DIR = "./storage" # directory to cache the generated index +DATA_DIR = "./data" # directory containing the documents to index + +service_context = ServiceContext.from_defaults( + llm=OpenAI(model="gpt-3.5-turbo") +) + +def get_index(): + logger = logging.getLogger("uvicorn") + # check if storage already exists + if not os.path.exists(STORAGE_DIR): + logger.info("Creating new index") + # load the documents and create the index + documents = SimpleDirectoryReader(DATA_DIR).load_data() + index = VectorStoreIndex.from_documents(documents,service_context=service_context) + # store it for later + index.storage_context.persist(STORAGE_DIR) + logger.info(f"Finished creating new index. Stored in {STORAGE_DIR}") + else: + # load the existing index + logger.info(f"Loading index from {STORAGE_DIR}...") + storage_context = StorageContext.from_defaults(persist_dir=STORAGE_DIR) + index = load_index_from_storage(storage_context,service_context=service_context) + logger.info(f"Finished loading index from {STORAGE_DIR}") + return index diff --git a/packages/create-llama/templates/types/streaming/fastapi/app/utils/json.py b/packages/create-llama/templates/types/streaming/fastapi/app/utils/json.py new file mode 100644 index 0000000000000000000000000000000000000000..d9a847f53e107f665389f11ec005795e0fb8c5b3 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/fastapi/app/utils/json.py @@ -0,0 +1,22 @@ +import json +from typing import TypeVar +from fastapi import HTTPException, Request + +from pydantic import BaseModel, ValidationError + + +T = TypeVar("T", bound=BaseModel) + + +def json_to_model(cls: T): + async def get_json(request: Request) -> T: + body = await request.body() + try: + data_dict = json.loads(body.decode("utf-8")) + return cls(**data_dict) + except (json.JSONDecodeError, ValidationError) as e: + raise HTTPException( + status_code=400, detail=f"Could not decode JSON: {str(e)}" + ) + + return get_json diff --git a/packages/create-llama/templates/types/streaming/fastapi/gitignore b/packages/create-llama/templates/types/streaming/fastapi/gitignore new file mode 100644 index 0000000000000000000000000000000000000000..a6ad564cd45eee8c8bd1fdc633d733d17b4a777a --- /dev/null +++ b/packages/create-llama/templates/types/streaming/fastapi/gitignore @@ -0,0 +1,3 @@ +__pycache__ +storage +.env diff --git a/packages/create-llama/templates/types/streaming/fastapi/main.py b/packages/create-llama/templates/types/streaming/fastapi/main.py new file mode 100644 index 0000000000000000000000000000000000000000..00cb79c44d58f4819243b8ee16c3108bef950382 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/fastapi/main.py @@ -0,0 +1,31 @@ +from dotenv import load_dotenv +load_dotenv() + +import logging +import os +import uvicorn +from app.api.routers.chat import chat_router +from fastapi import FastAPI +from fastapi.middleware.cors import CORSMiddleware + +app = FastAPI() + +environment = os.getenv("ENVIRONMENT", "dev") # Default to 'development' if not set + + +if environment == "dev": + logger = logging.getLogger("uvicorn") + logger.warning("Running in development mode - allowing CORS for all origins") + app.add_middleware( + CORSMiddleware, + allow_origins=["*"], + allow_credentials=True, + allow_methods=["*"], + allow_headers=["*"], + ) + +app.include_router(chat_router, prefix="/api/chat") + + +if __name__ == "__main__": + uvicorn.run(app="main:app", host="0.0.0.0", reload=True) diff --git a/packages/create-llama/templates/types/streaming/fastapi/pyproject.toml b/packages/create-llama/templates/types/streaming/fastapi/pyproject.toml new file mode 100644 index 0000000000000000000000000000000000000000..f5b75b3cfdbe88001d4588faf27e07cec36212a9 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/fastapi/pyproject.toml @@ -0,0 +1,19 @@ +[tool.poetry] +name = "llamaindex-fastapi-streaming" +version = "0.1.0" +description = "" +authors = ["Marcus Schiesser <mail@marcusschiesser.de>"] +readme = "README.md" + +[tool.poetry.dependencies] +python = "^3.11,<3.12" +fastapi = "^0.104.1" +uvicorn = { extras = ["standard"], version = "^0.23.2" } +llama-index = "^0.8.56" +pypdf = "^3.17.0" +python-dotenv = "^1.0.0" + + +[build-system] +requires = ["poetry-core"] +build-backend = "poetry.core.masonry.api" diff --git a/packages/create-llama/templates/types/streaming/fastapi/tests/__init__.py b/packages/create-llama/templates/types/streaming/fastapi/tests/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/packages/create-llama/templates/types/streaming/nextjs/.env.example b/packages/create-llama/templates/types/streaming/nextjs/.env.example new file mode 100644 index 0000000000000000000000000000000000000000..7ac0a01551a65a68003c2615d510269b5d6a77f6 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/.env.example @@ -0,0 +1,3 @@ +# Rename this file to `.env.local` to use environment variables locally with `next dev` +# https://nextjs.org/docs/pages/building-your-application/configuring/environment-variables +MY_HOST="example.com" diff --git a/packages/create-llama/templates/types/streaming/nextjs/README-template.md b/packages/create-llama/templates/types/streaming/nextjs/README-template.md new file mode 100644 index 0000000000000000000000000000000000000000..1509ded7c3be489d369b94d6d6a286d496f488d8 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/README-template.md @@ -0,0 +1,30 @@ +This is a [LlamaIndex](https://www.llamaindex.ai/) project using [Next.js](https://nextjs.org/) bootstrapped with [`create-llama`](https://github.com/run-llama/LlamaIndexTS/tree/main/packages/create-llama). + +## Getting Started + +First, install the dependencies: + +``` +npm install +``` + +Second, run the development server: + +``` +npm run dev +``` + +Open [http://localhost:3000](http://localhost:3000) with your browser to see the result. + +You can start editing the page by modifying `app/page.tsx`. The page auto-updates as you edit the file. + +This project uses [`next/font`](https://nextjs.org/docs/basic-features/font-optimization) to automatically optimize and load Inter, a custom Google Font. + +## Learn More + +To learn more about LlamaIndex, take a look at the following resources: + +- [LlamaIndex Documentation](https://docs.llamaindex.ai) - learn about LlamaIndex (Python features). +- [LlamaIndexTS Documentation](https://ts.llamaindex.ai) - learn about LlamaIndex (Typescript features). + +You can check out [the LlamaIndexTS GitHub repository](https://github.com/run-llama/LlamaIndexTS) - your feedback and contributions are welcome! diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/engine/index.ts b/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/engine/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..abb02e90cd2ce91096791bf10c4665afcbe11d38 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/engine/index.ts @@ -0,0 +1,7 @@ +import { LLM, SimpleChatEngine } from "llamaindex"; + +export async function createChatEngine(llm: LLM) { + return new SimpleChatEngine({ + llm, + }); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/llamaindex-stream.ts b/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/llamaindex-stream.ts new file mode 100644 index 0000000000000000000000000000000000000000..12328de875d8a59a5501db7fbf2aa0d763a3dbaa --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/llamaindex-stream.ts @@ -0,0 +1,35 @@ +import { + createCallbacksTransformer, + createStreamDataTransformer, + trimStartOfStreamHelper, + type AIStreamCallbacksAndOptions, +} from "ai"; + +function createParser(res: AsyncGenerator<any>) { + const trimStartOfStream = trimStartOfStreamHelper(); + return new ReadableStream<string>({ + async pull(controller): Promise<void> { + const { value, done } = await res.next(); + if (done) { + controller.close(); + return; + } + + const text = trimStartOfStream(value ?? ""); + if (text) { + controller.enqueue(text); + } + }, + }); +} + +export function LlamaIndexStream( + res: AsyncGenerator<any>, + callbacks?: AIStreamCallbacksAndOptions, +): ReadableStream { + return createParser(res) + .pipeThrough(createCallbacksTransformer(callbacks)) + .pipeThrough( + createStreamDataTransformer(callbacks?.experimental_streamData), + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/route.ts b/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/route.ts new file mode 100644 index 0000000000000000000000000000000000000000..989a5fec484fae3b34060ed20b4c1d5f1e42773f --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/api/chat/route.ts @@ -0,0 +1,49 @@ +import { Message, StreamingTextResponse } from "ai"; +import { OpenAI } from "llamaindex"; +import { NextRequest, NextResponse } from "next/server"; +import { createChatEngine } from "./engine"; +import { LlamaIndexStream } from "./llamaindex-stream"; + +export const runtime = "nodejs"; +export const dynamic = "force-dynamic"; + +export async function POST(request: NextRequest) { + try { + const body = await request.json(); + const { messages }: { messages: Message[] } = body; + const lastMessage = messages.pop(); + if (!messages || !lastMessage || lastMessage.role !== "user") { + return NextResponse.json( + { + error: + "messages are required in the request body and the last message must be from the user", + }, + { status: 400 }, + ); + } + + const llm = new OpenAI({ + model: "gpt-3.5-turbo", + }); + + const chatEngine = await createChatEngine(llm); + + const response = await chatEngine.chat(lastMessage.content, messages, true); + + // Transform the response into a readable stream + const stream = LlamaIndexStream(response); + + // Return a StreamingTextResponse, which can be consumed by the client + return new StreamingTextResponse(stream); + } catch (error) { + console.error("[LlamaIndex]", error); + return NextResponse.json( + { + error: (error as Error).message, + }, + { + status: 500, + }, + ); + } +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/components/chat-section.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/components/chat-section.tsx new file mode 100644 index 0000000000000000000000000000000000000000..04098fcdf41a4e686459f0ce0d6f3ca311895a9e --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/components/chat-section.tsx @@ -0,0 +1,33 @@ +"use client"; + +import { useChat } from "ai/react"; +import { ChatInput, ChatMessages } from "./ui/chat"; + +export default function ChatSection() { + const { + messages, + input, + isLoading, + handleSubmit, + handleInputChange, + reload, + stop, + } = useChat({ api: process.env.NEXT_PUBLIC_CHAT_API }); + + return ( + <div className="space-y-4 max-w-5xl w-full"> + <ChatMessages + messages={messages} + isLoading={isLoading} + reload={reload} + stop={stop} + /> + <ChatInput + input={input} + handleSubmit={handleSubmit} + handleInputChange={handleInputChange} + isLoading={isLoading} + /> + </div> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/components/header.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/components/header.tsx new file mode 100644 index 0000000000000000000000000000000000000000..2b0e488f769eff6700a282c2a6a77dd8d0a4dac8 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/components/header.tsx @@ -0,0 +1,28 @@ +import Image from "next/image"; + +export default function Header() { + return ( + <div className="z-10 max-w-5xl w-full items-center justify-between font-mono text-sm lg:flex"> + <p className="fixed left-0 top-0 flex w-full justify-center border-b border-gray-300 bg-gradient-to-b from-zinc-200 pb-6 pt-8 backdrop-blur-2xl dark:border-neutral-800 dark:bg-zinc-800/30 dark:from-inherit lg:static lg:w-auto lg:rounded-xl lg:border lg:bg-gray-200 lg:p-4 lg:dark:bg-zinc-800/30"> + Get started by editing + <code className="font-mono font-bold">app/page.tsx</code> + </p> + <div className="fixed bottom-0 left-0 flex h-48 w-full items-end justify-center bg-gradient-to-t from-white via-white dark:from-black dark:via-black lg:static lg:h-auto lg:w-auto lg:bg-none"> + <a + href="https://www.llamaindex.ai/" + className="flex items-center justify-center font-nunito text-lg font-bold gap-2" + > + <span>Built by LlamaIndex</span> + <Image + className="rounded-xl" + src="/llama.png" + alt="Llama Logo" + width={40} + height={40} + priority + /> + </a> + </div> + </div> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-avatar.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-avatar.tsx new file mode 100644 index 0000000000000000000000000000000000000000..cd241104e4ef210c728aec47a1ab8b0161ad6538 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-avatar.tsx @@ -0,0 +1,34 @@ +"use client"; + +import Image from "next/image"; +import { Message } from "./chat-messages"; + +export default function ChatAvatar(message: Message) { + if (message.role === "user") { + return ( + <div className="flex h-8 w-8 shrink-0 select-none items-center justify-center rounded-md border shadow bg-background"> + <svg + xmlns="http://www.w3.org/2000/svg" + viewBox="0 0 256 256" + fill="currentColor" + className="h-4 w-4" + > + <path d="M230.92 212c-15.23-26.33-38.7-45.21-66.09-54.16a72 72 0 1 0-73.66 0c-27.39 8.94-50.86 27.82-66.09 54.16a8 8 0 1 0 13.85 8c18.84-32.56 52.14-52 89.07-52s70.23 19.44 89.07 52a8 8 0 1 0 13.85-8ZM72 96a56 56 0 1 1 56 56 56.06 56.06 0 0 1-56-56Z"></path> + </svg> + </div> + ); + } + + return ( + <div className="flex h-8 w-8 shrink-0 select-none items-center justify-center rounded-md border bg-black text-white"> + <Image + className="rounded-md" + src="/llama.png" + alt="Llama Logo" + width={24} + height={24} + priority + /> + </div> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-input.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-input.tsx new file mode 100644 index 0000000000000000000000000000000000000000..3eb979b02735943f3f11290c78b84f0e37709438 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-input.tsx @@ -0,0 +1,42 @@ +"use client"; + +export interface ChatInputProps { + /** The current value of the input */ + input?: string; + /** An input/textarea-ready onChange handler to control the value of the input */ + handleInputChange?: ( + e: + | React.ChangeEvent<HTMLInputElement> + | React.ChangeEvent<HTMLTextAreaElement>, + ) => void; + /** Form submission handler to automatically reset input and append a user message */ + handleSubmit: (e: React.FormEvent<HTMLFormElement>) => void; + isLoading: boolean; +} + +export default function ChatInput(props: ChatInputProps) { + return ( + <> + <form + onSubmit={props.handleSubmit} + className="flex items-start justify-between w-full max-w-5xl p-4 bg-white rounded-xl shadow-xl gap-4" + > + <input + autoFocus + name="message" + placeholder="Type a message" + className="w-full p-4 rounded-xl shadow-inner flex-1" + value={props.input} + onChange={props.handleInputChange} + /> + <button + disabled={props.isLoading} + type="submit" + className="p-4 text-white rounded-xl shadow-xl bg-gradient-to-r from-cyan-500 to-sky-500 disabled:opacity-50 disabled:cursor-not-allowed" + > + Send message + </button> + </form> + </> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-item.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-item.tsx new file mode 100644 index 0000000000000000000000000000000000000000..2244f729a8ba668121ab5ec0842963d22153ef92 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-item.tsx @@ -0,0 +1,13 @@ +"use client"; + +import ChatAvatar from "./chat-avatar"; +import { Message } from "./chat-messages"; + +export default function ChatItem(message: Message) { + return ( + <div className="flex items-start gap-4 pt-5"> + <ChatAvatar {...message} /> + <p className="break-words">{message.content}</p> + </div> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-messages.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-messages.tsx new file mode 100644 index 0000000000000000000000000000000000000000..0e978394015bd985af40646e87fa6620e9001a2f --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/chat-messages.tsx @@ -0,0 +1,48 @@ +"use client"; + +import { useEffect, useRef } from "react"; +import ChatItem from "./chat-item"; + +export interface Message { + id: string; + content: string; + role: string; +} + +export default function ChatMessages({ + messages, + isLoading, + reload, + stop, +}: { + messages: Message[]; + isLoading?: boolean; + stop?: () => void; + reload?: () => void; +}) { + const scrollableChatContainerRef = useRef<HTMLDivElement>(null); + + const scrollToBottom = () => { + if (scrollableChatContainerRef.current) { + scrollableChatContainerRef.current.scrollTop = + scrollableChatContainerRef.current.scrollHeight; + } + }; + + useEffect(() => { + scrollToBottom(); + }, [messages.length]); + + return ( + <div className="w-full max-w-5xl p-4 bg-white rounded-xl shadow-xl"> + <div + className="flex flex-col gap-5 divide-y h-[50vh] overflow-auto" + ref={scrollableChatContainerRef} + > + {messages.map((m: Message) => ( + <ChatItem key={m.id} {...m} /> + ))} + </div> + </div> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/index.ts b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/index.ts new file mode 100644 index 0000000000000000000000000000000000000000..5de7dce47fc1e2330759171db291eedbca19e722 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/components/ui/chat/index.ts @@ -0,0 +1,6 @@ +import ChatInput from "./chat-input"; +import ChatMessages from "./chat-messages"; + +export type { ChatInputProps } from "./chat-input"; +export type { Message } from "./chat-messages"; +export { ChatInput, ChatMessages }; diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/favicon.ico b/packages/create-llama/templates/types/streaming/nextjs/app/favicon.ico new file mode 100644 index 0000000000000000000000000000000000000000..a1eaef62f2dfa895f1bbffc6595bb53d9604963e Binary files /dev/null and b/packages/create-llama/templates/types/streaming/nextjs/app/favicon.ico differ diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/globals.css b/packages/create-llama/templates/types/streaming/nextjs/app/globals.css new file mode 100644 index 0000000000000000000000000000000000000000..09b85ed2c912e25518ddebbfebaba69090f889f4 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/globals.css @@ -0,0 +1,94 @@ +@tailwind base; +@tailwind components; +@tailwind utilities; + +@layer base { + :root { + --background: 0 0% 100%; + --foreground: 222.2 47.4% 11.2%; + + --muted: 210 40% 96.1%; + --muted-foreground: 215.4 16.3% 46.9%; + + --popover: 0 0% 100%; + --popover-foreground: 222.2 47.4% 11.2%; + + --border: 214.3 31.8% 91.4%; + --input: 214.3 31.8% 91.4%; + + --card: 0 0% 100%; + --card-foreground: 222.2 47.4% 11.2%; + + --primary: 222.2 47.4% 11.2%; + --primary-foreground: 210 40% 98%; + + --secondary: 210 40% 96.1%; + --secondary-foreground: 222.2 47.4% 11.2%; + + --accent: 210 40% 96.1%; + --accent-foreground: 222.2 47.4% 11.2%; + + --destructive: 0 100% 50%; + --destructive-foreground: 210 40% 98%; + + --ring: 215 20.2% 65.1%; + + --radius: 0.5rem; + } + + .dark { + --background: 224 71% 4%; + --foreground: 213 31% 91%; + + --muted: 223 47% 11%; + --muted-foreground: 215.4 16.3% 56.9%; + + --accent: 216 34% 17%; + --accent-foreground: 210 40% 98%; + + --popover: 224 71% 4%; + --popover-foreground: 215 20.2% 65.1%; + + --border: 216 34% 17%; + --input: 216 34% 17%; + + --card: 224 71% 4%; + --card-foreground: 213 31% 91%; + + --primary: 210 40% 98%; + --primary-foreground: 222.2 47.4% 1.2%; + + --secondary: 222.2 47.4% 11.2%; + --secondary-foreground: 210 40% 98%; + + --destructive: 0 63% 31%; + --destructive-foreground: 210 40% 98%; + + --ring: 216 34% 17%; + + --radius: 0.5rem; + } +} + +@layer base { + * { + @apply border-border; + } + body { + @apply bg-background text-foreground; + font-feature-settings: + "rlig" 1, + "calt" 1; + } + .background-gradient { + background-color: #fff; + background-image: radial-gradient( + at 21% 11%, + rgba(186, 186, 233, 0.53) 0, + transparent 50% + ), + radial-gradient(at 85% 0, hsla(46, 57%, 78%, 0.52) 0, transparent 50%), + radial-gradient(at 91% 36%, rgba(194, 213, 255, 0.68) 0, transparent 50%), + radial-gradient(at 8% 40%, rgba(251, 218, 239, 0.46) 0, transparent 50%); + } +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/layout.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/layout.tsx new file mode 100644 index 0000000000000000000000000000000000000000..fb097706274bdfe4690e4953bba24d7acea0a021 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/layout.tsx @@ -0,0 +1,22 @@ +import type { Metadata } from "next"; +import { Inter } from "next/font/google"; +import "./globals.css"; + +const inter = Inter({ subsets: ["latin"] }); + +export const metadata: Metadata = { + title: "Create Llama App", + description: "Generated by create-llama", +}; + +export default function RootLayout({ + children, +}: { + children: React.ReactNode; +}) { + return ( + <html lang="en"> + <body className={inter.className}>{children}</body> + </html> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/app/page.tsx b/packages/create-llama/templates/types/streaming/nextjs/app/page.tsx new file mode 100644 index 0000000000000000000000000000000000000000..ef00262b4a80049c70d66d1ceaced4afaabfd587 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/app/page.tsx @@ -0,0 +1,11 @@ +import Header from "@/app/components/header"; +import ChatSection from "./components/chat-section"; + +export default function Home() { + return ( + <main className="flex min-h-screen flex-col items-center gap-10 p-24 background-gradient"> + <Header /> + <ChatSection /> + </main> + ); +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/eslintrc.json b/packages/create-llama/templates/types/streaming/nextjs/eslintrc.json new file mode 100644 index 0000000000000000000000000000000000000000..bffb357a7122523ec94045523758c4b825b448ef --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/eslintrc.json @@ -0,0 +1,3 @@ +{ + "extends": "next/core-web-vitals" +} diff --git a/packages/create-llama/templates/types/streaming/nextjs/gitignore b/packages/create-llama/templates/types/streaming/nextjs/gitignore new file mode 100644 index 0000000000000000000000000000000000000000..8f322f0d8f49570a594b865ef8916c428a01afc1 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/gitignore @@ -0,0 +1,35 @@ +# See https://help.github.com/articles/ignoring-files/ for more about ignoring files. + +# dependencies +/node_modules +/.pnp +.pnp.js + +# testing +/coverage + +# next.js +/.next/ +/out/ + +# production +/build + +# misc +.DS_Store +*.pem + +# debug +npm-debug.log* +yarn-debug.log* +yarn-error.log* + +# local env files +.env*.local + +# vercel +.vercel + +# typescript +*.tsbuildinfo +next-env.d.ts diff --git a/packages/create-llama/templates/types/streaming/nextjs/next-env.d.ts b/packages/create-llama/templates/types/streaming/nextjs/next-env.d.ts new file mode 100644 index 0000000000000000000000000000000000000000..4f11a03dc6cc37f2b5105c08f2e7b24c603ab2f4 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/next-env.d.ts @@ -0,0 +1,5 @@ +/// <reference types="next" /> +/// <reference types="next/image-types/global" /> + +// NOTE: This file should not be edited +// see https://nextjs.org/docs/basic-features/typescript for more information. diff --git a/packages/create-llama/templates/types/streaming/nextjs/next.config.app.js b/packages/create-llama/templates/types/streaming/nextjs/next.config.app.js new file mode 100644 index 0000000000000000000000000000000000000000..74655207e206e9efa7215e79ea163e8ae2052361 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/next.config.app.js @@ -0,0 +1,11 @@ +/** @type {import('next').NextConfig} */ +const nextConfig = { + experimental: { + serverComponentsExternalPackages: ["llamaindex"], + outputFileTracingIncludes: { + "/*": ["./cache/**/*"], + }, + }, +}; + +module.exports = nextConfig; diff --git a/packages/create-llama/templates/types/streaming/nextjs/next.config.static.js b/packages/create-llama/templates/types/streaming/nextjs/next.config.static.js new file mode 100644 index 0000000000000000000000000000000000000000..166b3e67d75ddc6d594b1c3d0960cc51f54b13b9 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/next.config.static.js @@ -0,0 +1,13 @@ +/** @type {import('next').NextConfig} */ +const nextConfig = { + output: "export", + images: { unoptimized: true }, + experimental: { + serverComponentsExternalPackages: ["llamaindex"], + outputFileTracingIncludes: { + "/*": ["./cache/**/*"], + }, + }, +}; + +module.exports = nextConfig; diff --git a/packages/create-llama/templates/types/streaming/nextjs/package.json b/packages/create-llama/templates/types/streaming/nextjs/package.json new file mode 100644 index 0000000000000000000000000000000000000000..e9f23201d893320cfdfcbd3fbac9ad48ebbb8d7c --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/package.json @@ -0,0 +1,28 @@ +{ + "name": "llama-index-nextjs-streaming", + "version": "1.0.0", + "scripts": { + "dev": "next dev", + "build": "next build", + "start": "next start", + "lint": "next lint" + }, + "dependencies": { + "ai": "^2", + "llamaindex": "0.0.31", + "next": "^13", + "react": "^18", + "react-dom": "^18" + }, + "devDependencies": { + "@types/node": "^20", + "@types/react": "^18", + "@types/react-dom": "^18", + "autoprefixer": "^10", + "eslint": "^8", + "eslint-config-next": "^13", + "postcss": "^8", + "tailwindcss": "^3", + "typescript": "^5" + } +} \ No newline at end of file diff --git a/packages/create-llama/templates/types/streaming/nextjs/postcss.config.js b/packages/create-llama/templates/types/streaming/nextjs/postcss.config.js new file mode 100644 index 0000000000000000000000000000000000000000..12a703d900da8159c30e75acbd2c4d87ae177f62 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/postcss.config.js @@ -0,0 +1,6 @@ +module.exports = { + plugins: { + tailwindcss: {}, + autoprefixer: {}, + }, +}; diff --git a/packages/create-llama/templates/types/streaming/nextjs/public/llama.png b/packages/create-llama/templates/types/streaming/nextjs/public/llama.png new file mode 100644 index 0000000000000000000000000000000000000000..d4efba3b816bf765439c6d01b322b02684e946c3 Binary files /dev/null and b/packages/create-llama/templates/types/streaming/nextjs/public/llama.png differ diff --git a/packages/create-llama/templates/types/streaming/nextjs/tailwind.config.ts b/packages/create-llama/templates/types/streaming/nextjs/tailwind.config.ts new file mode 100644 index 0000000000000000000000000000000000000000..aa5580affac868255fedb5a8ddc0dde7a105c454 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/tailwind.config.ts @@ -0,0 +1,78 @@ +import type { Config } from "tailwindcss"; +import { fontFamily } from "tailwindcss/defaultTheme"; + +const config: Config = { + darkMode: ["class"], + content: ["app/**/*.{ts,tsx}", "components/**/*.{ts,tsx}"], + theme: { + container: { + center: true, + padding: "2rem", + screens: { + "2xl": "1400px", + }, + }, + extend: { + colors: { + border: "hsl(var(--border))", + input: "hsl(var(--input))", + ring: "hsl(var(--ring))", + background: "hsl(var(--background))", + foreground: "hsl(var(--foreground))", + primary: { + DEFAULT: "hsl(var(--primary))", + foreground: "hsl(var(--primary-foreground))", + }, + secondary: { + DEFAULT: "hsl(var(--secondary))", + foreground: "hsl(var(--secondary-foreground))", + }, + destructive: { + DEFAULT: "hsl(var(--destructive) / <alpha-value>)", + foreground: "hsl(var(--destructive-foreground) / <alpha-value>)", + }, + muted: { + DEFAULT: "hsl(var(--muted))", + foreground: "hsl(var(--muted-foreground))", + }, + accent: { + DEFAULT: "hsl(var(--accent))", + foreground: "hsl(var(--accent-foreground))", + }, + popover: { + DEFAULT: "hsl(var(--popover))", + foreground: "hsl(var(--popover-foreground))", + }, + card: { + DEFAULT: "hsl(var(--card))", + foreground: "hsl(var(--card-foreground))", + }, + }, + borderRadius: { + xl: `calc(var(--radius) + 4px)`, + lg: `var(--radius)`, + md: `calc(var(--radius) - 2px)`, + sm: "calc(var(--radius) - 4px)", + }, + fontFamily: { + sans: ["var(--font-sans)", ...fontFamily.sans], + }, + keyframes: { + "accordion-down": { + from: { height: "0" }, + to: { height: "var(--radix-accordion-content-height)" }, + }, + "accordion-up": { + from: { height: "var(--radix-accordion-content-height)" }, + to: { height: "0" }, + }, + }, + animation: { + "accordion-down": "accordion-down 0.2s ease-out", + "accordion-up": "accordion-up 0.2s ease-out", + }, + }, + }, + plugins: [], +}; +export default config; diff --git a/packages/create-llama/templates/types/streaming/nextjs/tsconfig.json b/packages/create-llama/templates/types/streaming/nextjs/tsconfig.json new file mode 100644 index 0000000000000000000000000000000000000000..c7146963787144d4861e149d8d233049b7daefc7 --- /dev/null +++ b/packages/create-llama/templates/types/streaming/nextjs/tsconfig.json @@ -0,0 +1,27 @@ +{ + "compilerOptions": { + "target": "es5", + "lib": ["dom", "dom.iterable", "esnext"], + "allowJs": true, + "skipLibCheck": true, + "strict": true, + "noEmit": true, + "esModuleInterop": true, + "module": "esnext", + "moduleResolution": "bundler", + "resolveJsonModule": true, + "isolatedModules": true, + "jsx": "preserve", + "incremental": true, + "plugins": [ + { + "name": "next" + } + ], + "paths": { + "@/*": ["./*"] + } + }, + "include": ["next-env.d.ts", "**/*.ts", "**/*.tsx", ".next/types/**/*.ts"], + "exclude": ["node_modules"] +} diff --git a/packages/create-llama/tsconfig.json b/packages/create-llama/tsconfig.json new file mode 100644 index 0000000000000000000000000000000000000000..e4edad9e127c7de102ca7bdd6b243168a83bbc20 --- /dev/null +++ b/packages/create-llama/tsconfig.json @@ -0,0 +1,11 @@ +{ + "compilerOptions": { + "target": "es2019", + "moduleResolution": "node", + "strict": true, + "resolveJsonModule": true, + "esModuleInterop": true, + "skipLibCheck": false + }, + "exclude": ["templates", "dist"] +} diff --git a/packages/eslint-config-custom/index.js b/packages/eslint-config-custom/index.js index d93af2127f28f5a34406af37b548ec6311b3ad50..8417c5e6d90aef30254fec90a19fbb1d347ed4f1 100644 --- a/packages/eslint-config-custom/index.js +++ b/packages/eslint-config-custom/index.js @@ -36,6 +36,10 @@ module.exports = { "NOTION_TOKEN", "MONGODB_URI", + + "https_proxy", + "npm_config_user_agent", + "NEXT_PUBLIC_CHAT_API", ], }, ], diff --git a/pnpm-lock.yaml b/pnpm-lock.yaml index 2988f4a7c4cacd47d7bd7e46b72d8608e23c4452..7b8fa48c4e4b4ce819d245eb0e2a17ebdb617073 100644 --- a/pnpm-lock.yaml +++ b/pnpm-lock.yaml @@ -11,20 +11,19 @@ overrides: importers: .: - dependencies: + devDependencies: '@changesets/cli': specifier: ^2.26.2 version: 2.26.2 - devDependencies: '@turbo/gen': specifier: ^1.10.16 - version: 1.10.16(@types/node@18.18.7)(typescript@5.2.2) + version: 1.10.16(@types/node@18.18.12)(typescript@5.3.2) '@types/jest': - specifier: ^29.5.6 - version: 29.5.6 + specifier: ^29.5.10 + version: 29.5.10 eslint: - specifier: ^8.52.0 - version: 8.52.0 + specifier: ^8.54.0 + version: 8.54.0 eslint-config-custom: specifier: workspace:* version: link:packages/eslint-config-custom @@ -33,16 +32,19 @@ importers: version: 8.0.3 jest: specifier: ^29.7.0 - version: 29.7.0(@types/node@18.18.7) + version: 29.7.0(@types/node@18.18.12) + lint-staged: + specifier: ^15.1.0 + version: 15.1.0 prettier: - specifier: ^3.0.3 - version: 3.0.3 + specifier: ^3.1.0 + version: 3.1.0 prettier-plugin-organize-imports: - specifier: ^3.2.3 - version: 3.2.3(prettier@3.0.3)(typescript@5.2.2) + specifier: ^3.2.4 + version: 3.2.4(prettier@3.1.0)(typescript@5.3.2) ts-jest: specifier: ^29.1.1 - version: 29.1.1(@babel/core@7.23.0)(jest@29.7.0)(typescript@5.2.2) + version: 29.1.1(@babel/core@7.23.3)(jest@29.7.0)(typescript@5.3.2) turbo: specifier: ^1.10.16 version: 1.10.16 @@ -51,10 +53,10 @@ importers: dependencies: '@docusaurus/core': specifier: 2.4.3 - version: 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + version: 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/preset-classic': specifier: 2.4.3 - version: 2.4.3(@algolia/client-search@4.20.0)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.8.3)(typescript@4.9.5) + version: 2.4.3(@algolia/client-search@4.20.0)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.10.0)(typescript@4.9.5) '@docusaurus/remark-plugin-npm2yarn': specifier: ^2.4.3 version: 2.4.3 @@ -72,7 +74,7 @@ importers: version: 1.3.5(react@17.0.2) raw-loader: specifier: ^4.0.2 - version: 4.0.2(webpack@5.88.2) + version: 4.0.2(webpack@5.89.0) react: specifier: ^17.0.2 version: 17.0.2 @@ -102,6 +104,25 @@ importers: specifier: ^4.9.5 version: 4.9.5 + apps/mongodb: + dependencies: + dotenv: + specifier: ^16.3.1 + version: 16.3.1 + llamaindex: + specifier: workspace:* + version: link:../../packages/core + mongodb: + specifier: ^6.2.0 + version: 6.2.0 + devDependencies: + '@types/node': + specifier: ^18.18.6 + version: 18.18.8 + ts-node: + specifier: ^10.9.1 + version: 10.9.1(@types/node@18.18.8)(typescript@5.3.2) + apps/simple: dependencies: '@notionhq/client': @@ -122,22 +143,28 @@ importers: version: 18.18.7 ts-node: specifier: ^10.9.1 - version: 10.9.1(@types/node@18.18.7)(typescript@5.2.2) + version: 10.9.1(@types/node@18.18.7)(typescript@5.3.2) packages/core: dependencies: '@anthropic-ai/sdk': - specifier: ^0.8.1 - version: 0.8.1 + specifier: ^0.9.1 + version: 0.9.1 '@notionhq/client': specifier: ^2.2.13 version: 2.2.13 + '@xenova/transformers': + specifier: ^2.8.0 + version: 2.8.0 assemblyai: specifier: ^3.0.1 - version: 3.0.1 + version: 3.1.1 + crypto-js: + specifier: ^4.2.0 + version: 4.2.0 js-tiktoken: - specifier: ^1.0.7 - version: 1.0.7 + specifier: ^1.0.8 + version: 1.0.8 lodash: specifier: ^4.17.21 version: 4.17.21 @@ -148,29 +175,35 @@ importers: specifier: ^2.0.0 version: 2.0.0 mongodb: - specifier: ^6.2.0 - version: 6.2.0 + specifier: ^6.3.0 + version: 6.3.0 notion-md-crawler: specifier: ^0.0.2 version: 0.0.2 openai: - specifier: ^4.14.0 - version: 4.14.1 + specifier: ^4.19.1 + version: 4.19.1 papaparse: specifier: ^5.4.1 version: 5.4.1 pdf-parse: specifier: ^1.1.1 version: 1.1.1 + pg: + specifier: ^8.11.3 + version: 8.11.3 + pgvector: + specifier: ^0.1.5 + version: 0.1.5 portkey-ai: - specifier: ^0.1.13 - version: 0.1.13 + specifier: ^0.1.16 + version: 0.1.16 rake-modified: specifier: ^1.0.8 version: 1.0.8 replicate: - specifier: ^0.20.1 - version: 0.20.1 + specifier: ^0.21.1 + version: 0.21.1 string-strip-html: specifier: ^13.4.3 version: 13.4.3 @@ -181,49 +214,124 @@ importers: specifier: ^1.14.3 version: 1.14.3 devDependencies: + '@types/crypto-js': + specifier: ^4.2.1 + version: 4.2.1 '@types/lodash': - specifier: ^4.14.200 - version: 4.14.200 + specifier: ^4.14.202 + version: 4.14.202 '@types/node': - specifier: ^18.18.7 - version: 18.18.7 + specifier: ^18.18.12 + version: 18.18.12 '@types/papaparse': - specifier: ^5.3.10 - version: 5.3.10 + specifier: ^5.3.13 + version: 5.3.13 '@types/pdf-parse': - specifier: ^1.1.3 - version: 1.1.3 + specifier: ^1.1.4 + version: 1.1.4 + '@types/pg': + specifier: ^8.10.7 + version: 8.10.9 '@types/uuid': - specifier: ^9.0.6 - version: 9.0.6 + specifier: ^9.0.7 + version: 9.0.7 node-stdlib-browser: specifier: ^1.2.0 version: 1.2.0 tsup: specifier: ^7.2.0 - version: 7.2.0(typescript@5.2.2) + version: 7.2.0(typescript@5.3.2) typescript: - specifier: ^5.2.2 - version: 5.2.2 + specifier: ^5.3.2 + version: 5.3.2 + + packages/create-llama: + devDependencies: + '@types/async-retry': + specifier: 1.4.2 + version: 1.4.2 + '@types/ci-info': + specifier: 2.0.0 + version: 2.0.0 + '@types/cross-spawn': + specifier: 6.0.0 + version: 6.0.0 + '@types/node': + specifier: ^20.9.0 + version: 20.9.0 + '@types/prompts': + specifier: 2.0.1 + version: 2.0.1 + '@types/tar': + specifier: 6.1.5 + version: 6.1.5 + '@types/validate-npm-package-name': + specifier: 3.0.0 + version: 3.0.0 + '@vercel/ncc': + specifier: 0.34.0 + version: 0.34.0 + async-retry: + specifier: 1.3.1 + version: 1.3.1 + async-sema: + specifier: 3.0.1 + version: 3.0.1 + ci-info: + specifier: github:watson/ci-info#f43f6a1cefff47fb361c88cf4b943fdbcaafe540 + version: github.com/watson/ci-info/f43f6a1cefff47fb361c88cf4b943fdbcaafe540 + commander: + specifier: 2.20.0 + version: 2.20.0 + conf: + specifier: 10.2.0 + version: 10.2.0 + cross-spawn: + specifier: 7.0.3 + version: 7.0.3 + fast-glob: + specifier: 3.3.1 + version: 3.3.1 + got: + specifier: 10.7.0 + version: 10.7.0 + picocolors: + specifier: 1.0.0 + version: 1.0.0 + prompts: + specifier: 2.1.0 + version: 2.1.0 + tar: + specifier: 6.1.15 + version: 6.1.15 + terminal-link: + specifier: ^3.0.0 + version: 3.0.0 + update-check: + specifier: 1.5.4 + version: 1.5.4 + validate-npm-package-name: + specifier: 3.0.0 + version: 3.0.0 packages/eslint-config-custom: dependencies: eslint-config-next: specifier: ^13.4.1 - version: 13.4.1(eslint@8.52.0)(typescript@5.2.2) + version: 13.4.1(eslint@8.54.0)(typescript@5.3.2) eslint-config-prettier: specifier: ^8.3.0 - version: 8.8.0(eslint@8.52.0) + version: 8.8.0(eslint@8.54.0) eslint-config-turbo: specifier: ^1.9.3 - version: 1.9.3(eslint@8.52.0) + version: 1.9.3(eslint@8.54.0) eslint-plugin-react: specifier: 7.28.0 - version: 7.28.0(eslint@8.52.0) + version: 7.28.0(eslint@8.54.0) devDependencies: next: specifier: ^13.4.10 - version: 13.4.10(@babel/core@7.23.0)(react-dom@18.2.0)(react@18.2.0) + version: 13.4.10(@babel/core@7.23.3)(react-dom@18.2.0)(react@18.2.0) packages/tsconfig: {} @@ -233,10 +341,10 @@ packages: resolution: {integrity: sha512-1Yjs2SvM8TflER/OD3cOjhWWOZb58A2t7wpE2S9XfBYTiIl+XFhQG2bjy4Pu1I+EAlCNUzRDYDdFwFYUKvXcIA==} engines: {node: '>=0.10.0'} - /@algolia/autocomplete-core@1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.8.3): + /@algolia/autocomplete-core@1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.10.0): resolution: {integrity: sha512-009HdfugtGCdC4JdXUbVJClA0q0zh24yyePn+KUGk3rP7j8FEe/m5Yo/z65gn6nP/cM39PxpzqKrL7A6fP6PPw==} dependencies: - '@algolia/autocomplete-plugin-algolia-insights': 1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.8.3) + '@algolia/autocomplete-plugin-algolia-insights': 1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.10.0) '@algolia/autocomplete-shared': 1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0) transitivePeerDependencies: - '@algolia/client-search' @@ -244,13 +352,13 @@ packages: - search-insights dev: false - /@algolia/autocomplete-plugin-algolia-insights@1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.8.3): + /@algolia/autocomplete-plugin-algolia-insights@1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.10.0): resolution: {integrity: sha512-a/yTUkcO/Vyy+JffmAnTWbr4/90cLzw+CC3bRbhnULr/EM0fGNvM13oQQ14f2moLMcVDyAx/leczLlAOovhSZg==} peerDependencies: search-insights: '>= 1 < 3' dependencies: '@algolia/autocomplete-shared': 1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0) - search-insights: 2.8.3 + search-insights: 2.10.0 transitivePeerDependencies: - '@algolia/client-search' - algoliasearch @@ -376,13 +484,13 @@ packages: engines: {node: '>=6.0.0'} dependencies: '@jridgewell/gen-mapping': 0.3.3 - '@jridgewell/trace-mapping': 0.3.19 + '@jridgewell/trace-mapping': 0.3.20 - /@anthropic-ai/sdk@0.8.1: - resolution: {integrity: sha512-59etePenCizVx1O8Qhi1T1ruE04ISfNzCnyhZNcsss1QljsLmYS83jttarMNEvGYcsUF7rwxw2lzcC3Zbxao7g==} + /@anthropic-ai/sdk@0.9.1: + resolution: {integrity: sha512-wa1meQ2WSfoY8Uor3EdrJq0jTiZJoKoSii2ZVWRY1oN4Tlr5s59pADg9T79FTbPe1/se5c3pBeZgJL63wmuoBA==} dependencies: - '@types/node': 18.18.7 - '@types/node-fetch': 2.6.6 + '@types/node': 18.18.12 + '@types/node-fetch': 2.6.9 abort-controller: 3.0.0 agentkeepalive: 4.5.0 digest-fetch: 1.3.0 @@ -422,7 +530,7 @@ packages: gensync: 1.0.0-beta.2 json5: 2.2.3 lodash: 4.17.21 - resolve: 1.22.6 + resolve: 1.22.8 semver: 5.7.2 source-map: 0.5.7 transitivePeerDependencies: @@ -450,6 +558,30 @@ packages: semver: 6.3.1 transitivePeerDependencies: - supports-color + dev: false + + /@babel/core@7.23.3: + resolution: {integrity: sha512-Jg+msLuNuCJDyBvFv5+OKOUjWMZgd85bKjbICd3zWrKAo+bJ49HJufi7CQE0q0uR8NGyO6xkCACScNqyjHSZew==} + engines: {node: '>=6.9.0'} + dependencies: + '@ampproject/remapping': 2.2.1 + '@babel/code-frame': 7.22.13 + '@babel/generator': 7.23.3 + '@babel/helper-compilation-targets': 7.22.15 + '@babel/helper-module-transforms': 7.23.3(@babel/core@7.23.3) + '@babel/helpers': 7.23.2 + '@babel/parser': 7.23.3 + '@babel/template': 7.22.15 + '@babel/traverse': 7.23.2 + '@babel/types': 7.23.3 + convert-source-map: 2.0.0 + debug: 4.3.4 + gensync: 1.0.0-beta.2 + json5: 2.2.3 + semver: 6.3.1 + transitivePeerDependencies: + - supports-color + dev: true /@babel/generator@7.23.0: resolution: {integrity: sha512-lN85QRR+5IbYrMWM6Y4pE/noaQtg4pNiqeNGX60eqOfo6gtEj6uw/JagelB8vVztSd7R6M5n1+PQkDbHbBRU4g==} @@ -457,9 +589,19 @@ packages: dependencies: '@babel/types': 7.23.0 '@jridgewell/gen-mapping': 0.3.3 - '@jridgewell/trace-mapping': 0.3.19 + '@jridgewell/trace-mapping': 0.3.20 jsesc: 2.5.2 + /@babel/generator@7.23.3: + resolution: {integrity: sha512-keeZWAV4LU3tW0qRi19HRpabC/ilM0HRBBzf9/k8FFiG4KVpiv0FIy4hHfLfFQZNhziCTPTmd59zoyv6DNISzg==} + engines: {node: '>=6.9.0'} + dependencies: + '@babel/types': 7.23.3 + '@jridgewell/gen-mapping': 0.3.3 + '@jridgewell/trace-mapping': 0.3.20 + jsesc: 2.5.2 + dev: true + /@babel/helper-annotate-as-pure@7.22.5: resolution: {integrity: sha512-LvBTxu8bQSQkcyKOU+a1btnNFQ1dMAd0R6PyW3arXes06F6QLWLIrd681bxRPIXlrMGR3XYnW9JyML7dP3qgxg==} engines: {node: '>=6.9.0'} @@ -524,7 +666,7 @@ packages: '@babel/helper-plugin-utils': 7.22.5 debug: 4.3.4 lodash.debounce: 4.0.8 - resolve: 1.22.6 + resolve: 1.22.8 transitivePeerDependencies: - supports-color dev: false @@ -585,6 +727,21 @@ packages: '@babel/helper-simple-access': 7.22.5 '@babel/helper-split-export-declaration': 7.22.6 '@babel/helper-validator-identifier': 7.22.20 + dev: false + + /@babel/helper-module-transforms@7.23.3(@babel/core@7.23.3): + resolution: {integrity: sha512-7bBs4ED9OmswdfDzpz4MpWgSrV7FXlc3zIagvLFjS5H+Mk7Snr21vQ6QwrsoCGMfNC4e4LQPdoULEt4ykz0SRQ==} + engines: {node: '>=6.9.0'} + peerDependencies: + '@babel/core': ^7.0.0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-environment-visitor': 7.22.20 + '@babel/helper-module-imports': 7.22.15 + '@babel/helper-simple-access': 7.22.5 + '@babel/helper-split-export-declaration': 7.22.6 + '@babel/helper-validator-identifier': 7.22.20 + dev: true /@babel/helper-optimise-call-expression@7.22.5: resolution: {integrity: sha512-HBwaojN0xFRx4yIvpwGqxiV2tUfl7401jlok564NgB9EHS1y6QT17FmKWm4ztqjeVdXLuC4fSvHc5ePpQjoTbw==} @@ -678,6 +835,18 @@ packages: '@babel/types': 7.23.0 transitivePeerDependencies: - supports-color + dev: false + + /@babel/helpers@7.23.2: + resolution: {integrity: sha512-lzchcp8SjTSVe/fPmLwtWVBFC7+Tbn8LGHDVfDp9JGxpAY5opSaEFgt8UQvrnECWOTdji2mOWMz1rOhkHscmGQ==} + engines: {node: '>=6.9.0'} + dependencies: + '@babel/template': 7.22.15 + '@babel/traverse': 7.23.2 + '@babel/types': 7.23.3 + transitivePeerDependencies: + - supports-color + dev: true /@babel/highlight@7.22.13: resolution: {integrity: sha512-C/BaXcnnvBCmHTpz/VGZ8jgtE2aYlW4hxDhseJAWZb7gqGM/qtCK6iZUb0TyKFf7BOUsBH7Q7fkRsDRhg1XklQ==} @@ -694,6 +863,14 @@ packages: dependencies: '@babel/types': 7.23.0 + /@babel/parser@7.23.3: + resolution: {integrity: sha512-uVsWNvlVsIninV2prNz/3lHCb+5CJ+e+IUBfbjToAHODtfGYLfCFuY4AU7TskI+dAKk+njsPiBjq1gKTvZOBaw==} + engines: {node: '>=6.0.0'} + hasBin: true + dependencies: + '@babel/types': 7.23.3 + dev: true + /@babel/plugin-bugfix-safari-id-destructuring-collision-in-function-expression@7.22.15(@babel/core@7.23.0): resolution: {integrity: sha512-FB9iYlz7rURmRJyXRKEnalYPPdn87H5no108cyuQQyMwlpJ2SJtpIUBI27kdTin956pz+LPypkPVPUTlxOmrsg==} engines: {node: '>=6.9.0'} @@ -743,13 +920,23 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-async-generators@7.8.4(@babel/core@7.23.3): + resolution: {integrity: sha512-tycmZxkGfZaxhMRbXlPXuVFpdWlXpir2W4AMhSJgRKzk/eDlIXOhb2LHWoLpDF7TEHylV5zNhykX6KAgHJmTNw==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true - /@babel/plugin-syntax-bigint@7.8.3(@babel/core@7.23.0): + /@babel/plugin-syntax-bigint@7.8.3(@babel/core@7.23.3): resolution: {integrity: sha512-wnTnFlG+YxQm3vDxpGE57Pj0srRU4sHE/mDkt1qv2YJJSeUAec2ma4WLUnUPeKjyrfntVwe/N6dCXpU+zL3Npg==} peerDependencies: '@babel/core': ^7.0.0-0 dependencies: - '@babel/core': 7.23.0 + '@babel/core': 7.23.3 '@babel/helper-plugin-utils': 7.22.5 dev: true @@ -760,6 +947,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-class-properties@7.12.13(@babel/core@7.23.3): + resolution: {integrity: sha512-fm4idjKla0YahUNgFNLCB0qySdsoPiZP3iQE3rky0mBUtMZ23yDJ9SJdg6dXTSDnulOVqiF3Hgr9nbXvXTQZYA==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-class-static-block@7.14.5(@babel/core@7.23.0): resolution: {integrity: sha512-b+YyPmr6ldyNnM6sqYeMWE+bgJcJpO6yS4QD7ymxgH34GBPNDM/THBh8iunyvKIZztiwLH4CJZ0RxTk9emgpjw==} @@ -816,6 +1013,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-import-meta@7.10.4(@babel/core@7.23.3): + resolution: {integrity: sha512-Yqfm+XDx0+Prh3VSeEQCPU81yC+JWZ2pDPFSS4ZdpfZhp4MkFMaDC1UqseovEKwSUpnIL7+vK+Clp7bfh0iD7g==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-json-strings@7.8.3(@babel/core@7.23.0): resolution: {integrity: sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==} @@ -824,6 +1031,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-json-strings@7.8.3(@babel/core@7.23.3): + resolution: {integrity: sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-jsx@7.12.1(@babel/core@7.12.9): resolution: {integrity: sha512-1yRi7yAtB0ETgxdY9ti/p2TivUxJkTdhu/ZbF9MshVGqOx1TdB3b7xCXs49Fupgg50N45KcAsRP/ZqWjs9SRjg==} @@ -842,6 +1059,17 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-jsx@7.23.3(@babel/core@7.23.3): + resolution: {integrity: sha512-EB2MELswq55OHUoRZLGg/zC7QWUKfNLpE57m/S2yr1uEneIgsTgrSzXP3NXEsMkVn76OlaVVnzN+ugObuYGwhg==} + engines: {node: '>=6.9.0'} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-logical-assignment-operators@7.10.4(@babel/core@7.23.0): resolution: {integrity: sha512-d8waShlpFDinQ5MtvGU9xDAOzKH47+FFoney2baFIoMr952hKOLp1HR7VszoZvOsV/4+RRszNY7D17ba0te0ig==} @@ -850,6 +1078,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-logical-assignment-operators@7.10.4(@babel/core@7.23.3): + resolution: {integrity: sha512-d8waShlpFDinQ5MtvGU9xDAOzKH47+FFoney2baFIoMr952hKOLp1HR7VszoZvOsV/4+RRszNY7D17ba0te0ig==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-nullish-coalescing-operator@7.8.3(@babel/core@7.23.0): resolution: {integrity: sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==} @@ -858,6 +1096,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-nullish-coalescing-operator@7.8.3(@babel/core@7.23.3): + resolution: {integrity: sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-numeric-separator@7.10.4(@babel/core@7.23.0): resolution: {integrity: sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==} @@ -866,6 +1114,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-numeric-separator@7.10.4(@babel/core@7.23.3): + resolution: {integrity: sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-object-rest-spread@7.8.3(@babel/core@7.12.9): resolution: {integrity: sha512-XoqMijGZb9y3y2XskN+P1wUGiVwWZ5JmoDRwx5+3GmEplNyVM2s2Dg8ILFQm8rWM48orGy5YpI5Bl8U1y7ydlA==} @@ -883,6 +1141,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-object-rest-spread@7.8.3(@babel/core@7.23.3): + resolution: {integrity: sha512-XoqMijGZb9y3y2XskN+P1wUGiVwWZ5JmoDRwx5+3GmEplNyVM2s2Dg8ILFQm8rWM48orGy5YpI5Bl8U1y7ydlA==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-optional-catch-binding@7.8.3(@babel/core@7.23.0): resolution: {integrity: sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==} @@ -891,6 +1159,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-optional-catch-binding@7.8.3(@babel/core@7.23.3): + resolution: {integrity: sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-optional-chaining@7.8.3(@babel/core@7.23.0): resolution: {integrity: sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==} @@ -899,6 +1177,16 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-optional-chaining@7.8.3(@babel/core@7.23.3): + resolution: {integrity: sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-private-property-in-object@7.14.5(@babel/core@7.23.0): resolution: {integrity: sha512-0wVnp9dxJ72ZUJDV27ZfbSj6iHLoytYZmh3rFcxNnvsJF3ktkzLDZPy/mA17HGsaQT3/DQsWYX1f1QGWkCoVUg==} @@ -918,6 +1206,17 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-top-level-await@7.14.5(@babel/core@7.23.3): + resolution: {integrity: sha512-hx++upLv5U1rgYfwe1xBQUhRmU41NEvpUvrp8jkrSCdvGSnM5/qdRMtylJ6PG5OFkBaHkbTAKTnd3/YyESRHFw==} + engines: {node: '>=6.9.0'} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-typescript@7.22.5(@babel/core@7.23.0): resolution: {integrity: sha512-1mS2o03i7t1c6VzH6fdQ3OA8tcEIxwG18zIPRp+UY1Ihv6W+XZzBCVxExF9upussPXJ0xE9XRHwMoNs1ep/nRQ==} @@ -927,6 +1226,17 @@ packages: dependencies: '@babel/core': 7.23.0 '@babel/helper-plugin-utils': 7.22.5 + dev: false + + /@babel/plugin-syntax-typescript@7.23.3(@babel/core@7.23.3): + resolution: {integrity: sha512-9EiNjVJOMwCO+43TqoTrgQ8jMwcAd0sWyXi9RPfIsLTj4R2MADDDQXELhffaUx/uJv2AYcxBgPwH6j4TIA4ytQ==} + engines: {node: '>=6.9.0'} + peerDependencies: + '@babel/core': ^7.0.0-0 + dependencies: + '@babel/core': 7.23.3 + '@babel/helper-plugin-utils': 7.22.5 + dev: true /@babel/plugin-syntax-unicode-sets-regex@7.18.6(@babel/core@7.23.0): resolution: {integrity: sha512-727YkEAPwSIQTv5im8QHz3upqp92JTWhidIC81Tdx4VJYIte/VndKf1qKrfnnhPLiPghStWfvC/iFaMCQu7Nqg==} @@ -1707,6 +2017,15 @@ packages: dependencies: core-js-pure: 3.33.0 regenerator-runtime: 0.14.0 + dev: false + + /@babel/runtime-corejs3@7.23.2: + resolution: {integrity: sha512-54cIh74Z1rp4oIjsHjqN+WM4fMyCBYe+LpZ9jWm51CZ1fbH3SkAzQD/3XLoNkjbJ7YEmjobLXyvQrFypRHOrXw==} + engines: {node: '>=6.9.0'} + dependencies: + core-js-pure: 3.33.2 + regenerator-runtime: 0.14.0 + dev: true /@babel/runtime@7.21.5: resolution: {integrity: sha512-8jI69toZqqcsnqGGqwGS4Qb1VwLOEp4hz+CXPywcvjs60u3B4Pom/U/7rm4W8tMOYEB+E9wgD0mW1l3r8qlI9Q==} @@ -1721,6 +2040,13 @@ packages: dependencies: regenerator-runtime: 0.14.0 + /@babel/runtime@7.23.2: + resolution: {integrity: sha512-mM8eg4yl5D6i3lu2QKPuPH4FArvJ8KhTofbE7jwMUv9KX5mBvwPAqnV3MlyBNqdp9RyRKP6Yck8TrfYrPvX3bg==} + engines: {node: '>=6.9.0'} + dependencies: + regenerator-runtime: 0.14.0 + dev: true + /@babel/template@7.22.15: resolution: {integrity: sha512-QPErUVm4uyJa60rkI73qneDacvdvzxshT3kksGqlGWYdOTIUOwJ7RDUL8sGqslY1uXWSL6xMFKEXDS3ox2uF0w==} engines: {node: '>=6.9.0'} @@ -1762,6 +2088,15 @@ packages: '@babel/helper-validator-identifier': 7.22.20 to-fast-properties: 2.0.0 + /@babel/types@7.23.3: + resolution: {integrity: sha512-OZnvoH2l8PK5eUvEcUyCt/sXgr/h+UWpVuBbOljwcrAgUl6lpchoQ++PHGyQy1AtYnVA6CEq3y5xeEI10brpXw==} + engines: {node: '>=6.9.0'} + dependencies: + '@babel/helper-string-parser': 7.22.5 + '@babel/helper-validator-identifier': 7.22.20 + to-fast-properties: 2.0.0 + dev: true + /@bcoe/v8-coverage@0.2.3: resolution: {integrity: sha512-0hYQ8SB4Db5zvZB4axdMHGwEaQjkZzFjQiN9LVYvIFB2nSUHW9tYpxWriPrWDASIxiaXax83REcLxuSdnGPZtw==} dev: true @@ -1769,7 +2104,7 @@ packages: /@changesets/apply-release-plan@6.1.4: resolution: {integrity: sha512-FMpKF1fRlJyCZVYHr3CbinpZZ+6MwvOtWUuO8uo+svcATEoc1zRDcj23pAurJ2TZ/uVz1wFHH6K3NlACy0PLew==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/config': 2.3.1 '@changesets/get-version-range-type': 0.3.2 '@changesets/git': 2.0.0 @@ -1782,30 +2117,30 @@ packages: prettier: 2.8.8 resolve-from: 5.0.0 semver: 7.5.4 - dev: false + dev: true /@changesets/assemble-release-plan@5.2.4: resolution: {integrity: sha512-xJkWX+1/CUaOUWTguXEbCDTyWJFECEhmdtbkjhn5GVBGxdP/JwaHBIU9sW3FR6gD07UwZ7ovpiPclQZs+j+mvg==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/errors': 0.1.4 '@changesets/get-dependents-graph': 1.3.6 '@changesets/types': 5.2.1 '@manypkg/get-packages': 1.1.3 semver: 7.5.4 - dev: false + dev: true /@changesets/changelog-git@0.1.14: resolution: {integrity: sha512-+vRfnKtXVWsDDxGctOfzJsPhaCdXRYoe+KyWYoq5X/GqoISREiat0l3L8B0a453B2B4dfHGcZaGyowHbp9BSaA==} dependencies: '@changesets/types': 5.2.1 - dev: false + dev: true /@changesets/cli@2.26.2: resolution: {integrity: sha512-dnWrJTmRR8bCHikJHl9b9HW3gXACCehz4OasrXpMp7sx97ECuBGGNjJhjPhdZNCvMy9mn4BWdplI323IbqsRig==} hasBin: true dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/apply-release-plan': 6.1.4 '@changesets/assemble-release-plan': 5.2.4 '@changesets/changelog-git': 0.1.14 @@ -1820,8 +2155,8 @@ packages: '@changesets/types': 5.2.1 '@changesets/write': 0.2.3 '@manypkg/get-packages': 1.1.3 - '@types/is-ci': 3.0.1 - '@types/semver': 7.5.3 + '@types/is-ci': 3.0.4 + '@types/semver': 7.5.5 ansi-colors: 4.1.3 chalk: 2.4.2 enquirer: 2.4.1 @@ -1837,8 +2172,8 @@ packages: semver: 7.5.4 spawndamnit: 2.0.0 term-size: 2.2.1 - tty-table: 4.2.2 - dev: false + tty-table: 4.2.3 + dev: true /@changesets/config@2.3.1: resolution: {integrity: sha512-PQXaJl82CfIXddUOppj4zWu+987GCw2M+eQcOepxN5s+kvnsZOwjEJO3DH9eVy+OP6Pg/KFEWdsECFEYTtbg6w==} @@ -1850,13 +2185,13 @@ packages: '@manypkg/get-packages': 1.1.3 fs-extra: 7.0.1 micromatch: 4.0.5 - dev: false + dev: true /@changesets/errors@0.1.4: resolution: {integrity: sha512-HAcqPF7snsUJ/QzkWoKfRfXushHTu+K5KZLJWPb34s4eCZShIf8BFO3fwq6KU8+G7L5KdtN2BzQAXOSXEyiY9Q==} dependencies: extendable-error: 0.1.7 - dev: false + dev: true /@changesets/get-dependents-graph@1.3.6: resolution: {integrity: sha512-Q/sLgBANmkvUm09GgRsAvEtY3p1/5OCzgBE5vX3vgb5CvW0j7CEljocx5oPXeQSNph6FXulJlXV3Re/v3K3P3Q==} @@ -1866,63 +2201,63 @@ packages: chalk: 2.4.2 fs-extra: 7.0.1 semver: 7.5.4 - dev: false + dev: true /@changesets/get-release-plan@3.0.17: resolution: {integrity: sha512-6IwKTubNEgoOZwDontYc2x2cWXfr6IKxP3IhKeK+WjyD6y3M4Gl/jdQvBw+m/5zWILSOCAaGLu2ZF6Q+WiPniw==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/assemble-release-plan': 5.2.4 '@changesets/config': 2.3.1 '@changesets/pre': 1.0.14 '@changesets/read': 0.5.9 '@changesets/types': 5.2.1 '@manypkg/get-packages': 1.1.3 - dev: false + dev: true /@changesets/get-version-range-type@0.3.2: resolution: {integrity: sha512-SVqwYs5pULYjYT4op21F2pVbcrca4qA/bAA3FmFXKMN7Y+HcO8sbZUTx3TAy2VXulP2FACd1aC7f2nTuqSPbqg==} - dev: false + dev: true /@changesets/git@2.0.0: resolution: {integrity: sha512-enUVEWbiqUTxqSnmesyJGWfzd51PY4H7mH9yUw0hPVpZBJ6tQZFMU3F3mT/t9OJ/GjyiM4770i+sehAn6ymx6A==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/errors': 0.1.4 '@changesets/types': 5.2.1 '@manypkg/get-packages': 1.1.3 is-subdir: 1.2.0 micromatch: 4.0.5 spawndamnit: 2.0.0 - dev: false + dev: true /@changesets/logger@0.0.5: resolution: {integrity: sha512-gJyZHomu8nASHpaANzc6bkQMO9gU/ib20lqew1rVx753FOxffnCrJlGIeQVxNWCqM+o6OOleCo/ivL8UAO5iFw==} dependencies: chalk: 2.4.2 - dev: false + dev: true /@changesets/parse@0.3.16: resolution: {integrity: sha512-127JKNd167ayAuBjUggZBkmDS5fIKsthnr9jr6bdnuUljroiERW7FBTDNnNVyJ4l69PzR57pk6mXQdtJyBCJKg==} dependencies: '@changesets/types': 5.2.1 js-yaml: 3.14.1 - dev: false + dev: true /@changesets/pre@1.0.14: resolution: {integrity: sha512-dTsHmxQWEQekHYHbg+M1mDVYFvegDh9j/kySNuDKdylwfMEevTeDouR7IfHNyVodxZXu17sXoJuf2D0vi55FHQ==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/errors': 0.1.4 '@changesets/types': 5.2.1 '@manypkg/get-packages': 1.1.3 fs-extra: 7.0.1 - dev: false + dev: true /@changesets/read@0.5.9: resolution: {integrity: sha512-T8BJ6JS6j1gfO1HFq50kU3qawYxa4NTbI/ASNVVCBTsKquy2HYwM9r7ZnzkiMe8IEObAJtUVGSrePCOxAK2haQ==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/git': 2.0.0 '@changesets/logger': 0.0.5 '@changesets/parse': 0.3.16 @@ -1930,25 +2265,25 @@ packages: chalk: 2.4.2 fs-extra: 7.0.1 p-filter: 2.1.0 - dev: false + dev: true /@changesets/types@4.1.0: resolution: {integrity: sha512-LDQvVDv5Kb50ny2s25Fhm3d9QSZimsoUGBsUioj6MC3qbMUCuC8GPIvk/M6IvXx3lYhAs0lwWUQLb+VIEUCECw==} - dev: false + dev: true /@changesets/types@5.2.1: resolution: {integrity: sha512-myLfHbVOqaq9UtUKqR/nZA/OY7xFjQMdfgfqeZIBK4d0hA6pgxArvdv8M+6NUzzBsjWLOtvApv8YHr4qM+Kpfg==} - dev: false + dev: true /@changesets/write@0.2.3: resolution: {integrity: sha512-Dbamr7AIMvslKnNYsLFafaVORx4H0pvCA2MHqgtNCySMe1blImEyAEOzDmcgKAkgz4+uwoLz7demIrX+JBr/Xw==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/types': 5.2.1 fs-extra: 7.0.1 human-id: 1.0.2 prettier: 2.8.8 - dev: false + dev: true /@colors/colors@1.5.0: resolution: {integrity: sha512-ooWCrlZP11i8GImSjTHYHLkvFDP48nS4+204nGb1RiX/WXYHmJA2III9/e2DWVabCESdW7hBAEzHRqUn9OUVvQ==} @@ -1973,7 +2308,7 @@ packages: resolution: {integrity: sha512-SPiDHaWKQZpwR2siD0KQUwlStvIAnEyK6tAE2h2Wuoq8ue9skzhlyVQ1ddzOxX6khULnAALDiR/isSF3bnuciA==} dev: false - /@docsearch/react@3.5.2(@algolia/client-search@4.20.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.8.3): + /@docsearch/react@3.5.2(@algolia/client-search@4.20.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.10.0): resolution: {integrity: sha512-9Ahcrs5z2jq/DcAvYtvlqEBHImbm4YJI8M9y0x6Tqg598P40HTEkX7hsMcIuThI+hTFxRGZ9hll0Wygm2yEjng==} peerDependencies: '@types/react': '>= 16.8.0 < 19.0.0' @@ -1990,18 +2325,18 @@ packages: search-insights: optional: true dependencies: - '@algolia/autocomplete-core': 1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.8.3) + '@algolia/autocomplete-core': 1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0)(search-insights@2.10.0) '@algolia/autocomplete-preset-algolia': 1.9.3(@algolia/client-search@4.20.0)(algoliasearch@4.20.0) '@docsearch/css': 3.5.2 algoliasearch: 4.20.0 react: 17.0.2 react-dom: 17.0.2(react@17.0.2) - search-insights: 2.8.3 + search-insights: 2.10.0 transitivePeerDependencies: - '@algolia/client-search' dev: false - /@docusaurus/core@2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/core@2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-dWH5P7cgeNSIg9ufReX6gaCl/TmrGKD38Orbwuz05WPhAQtFXHd5B8Qym1TiXfvUNvwoYKkAJOJuGe8ou0Z7PA==} engines: {node: '>=16.14'} hasBin: true @@ -2060,7 +2395,7 @@ packages: postcss-loader: 7.3.3(postcss@8.4.31)(typescript@4.9.5)(webpack@5.88.2) prompts: 2.4.2 react: 17.0.2 - react-dev-utils: 12.0.1(eslint@8.52.0)(typescript@4.9.5)(webpack@5.88.2) + react-dev-utils: 12.0.1(eslint@8.54.0)(typescript@4.9.5)(webpack@5.88.2) react-dom: 17.0.2(react@17.0.2) react-helmet-async: 1.3.0(react-dom@17.0.2)(react@17.0.2) react-loadable: /@docusaurus/react-loadable@5.5.2(react@17.0.2) @@ -2176,14 +2511,14 @@ packages: - uglify-js - webpack-cli - /@docusaurus/plugin-content-blog@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-content-blog@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-PVhypqaA0t98zVDpOeTqWUTvRqCEjJubtfFUQ7zJNYdbYTbS/E/ytq6zbLVsN/dImvemtO/5JQgjLxsh8XLo8Q==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/logger': 2.4.3 '@docusaurus/mdx-loader': 2.4.3(@docusaurus/types@2.4.3)(react-dom@17.0.2)(react@17.0.2) '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) @@ -2219,14 +2554,14 @@ packages: - webpack-cli dev: false - /@docusaurus/plugin-content-docs@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-content-docs@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-N7Po2LSH6UejQhzTCsvuX5NOzlC+HiXOVvofnEPj0WhMu1etpLEXE6a4aTxrtg95lQ5kf0xUIdjX9sh3d3G76A==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/logger': 2.4.3 '@docusaurus/mdx-loader': 2.4.3(@docusaurus/types@2.4.3)(react-dom@17.0.2)(react@17.0.2) '@docusaurus/module-type-aliases': 2.4.3(react-dom@17.0.2)(react@17.0.2) @@ -2262,14 +2597,14 @@ packages: - webpack-cli dev: false - /@docusaurus/plugin-content-pages@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-content-pages@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-txtDVz7y3zGk67q0HjG0gRttVPodkHqE0bpJ+7dOaTH40CQFLSh7+aBeGnPOTl+oCPG+hxkim4SndqPqXjQ8Bg==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/mdx-loader': 2.4.3(@docusaurus/types@2.4.3)(react-dom@17.0.2)(react@17.0.2) '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) '@docusaurus/utils': 2.4.3(@docusaurus/types@2.4.3) @@ -2297,14 +2632,14 @@ packages: - webpack-cli dev: false - /@docusaurus/plugin-debug@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-debug@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-LkUbuq3zCmINlFb+gAd4ZvYr+bPAzMC0hwND4F7V9bZ852dCX8YoWyovVUBKq4er1XsOwSQaHmNGtObtn8Av8Q==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) '@docusaurus/utils': 2.4.3(@docusaurus/types@2.4.3) fs-extra: 10.1.0 @@ -2332,14 +2667,14 @@ packages: - webpack-cli dev: false - /@docusaurus/plugin-google-analytics@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-google-analytics@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-KzBV3k8lDkWOhg/oYGxlK5o9bOwX7KpPc/FTWoB+SfKhlHfhq7qcQdMi1elAaVEIop8tgK6gD1E58Q+XC6otSQ==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) '@docusaurus/utils-validation': 2.4.3(@docusaurus/types@2.4.3) react: 17.0.2 @@ -2363,14 +2698,14 @@ packages: - webpack-cli dev: false - /@docusaurus/plugin-google-gtag@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-google-gtag@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-5FMg0rT7sDy4i9AGsvJC71MQrqQZwgLNdDetLEGDHLfSHLvJhQbTCUGbGXknUgWXQJckcV/AILYeJy+HhxeIFA==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) '@docusaurus/utils-validation': 2.4.3(@docusaurus/types@2.4.3) react: 17.0.2 @@ -2394,14 +2729,14 @@ packages: - webpack-cli dev: false - /@docusaurus/plugin-google-tag-manager@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-google-tag-manager@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-1jTzp71yDGuQiX9Bi0pVp3alArV0LSnHXempvQTxwCGAEzUWWaBg4d8pocAlTpbP9aULQQqhgzrs8hgTRPOM0A==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) '@docusaurus/utils-validation': 2.4.3(@docusaurus/types@2.4.3) react: 17.0.2 @@ -2425,14 +2760,14 @@ packages: - webpack-cli dev: false - /@docusaurus/plugin-sitemap@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/plugin-sitemap@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-LRQYrK1oH1rNfr4YvWBmRzTL0LN9UAPxBbghgeFRBm5yloF6P+zv1tm2pe2hQTX/QP5bSKdnajCvfnScgKXMZQ==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/logger': 2.4.3 '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) '@docusaurus/utils': 2.4.3(@docusaurus/types@2.4.3) @@ -2461,25 +2796,25 @@ packages: - webpack-cli dev: false - /@docusaurus/preset-classic@2.4.3(@algolia/client-search@4.20.0)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.8.3)(typescript@4.9.5): + /@docusaurus/preset-classic@2.4.3(@algolia/client-search@4.20.0)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.10.0)(typescript@4.9.5): resolution: {integrity: sha512-tRyMliepY11Ym6hB1rAFSNGwQDpmszvWYJvlK1E+md4SW8i6ylNHtpZjaYFff9Mdk3i/Pg8ItQq9P0daOJAvQw==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-content-blog': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-content-pages': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-debug': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-google-analytics': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-google-gtag': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-google-tag-manager': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-sitemap': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/theme-classic': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/theme-common': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/theme-search-algolia': 2.4.3(@algolia/client-search@4.20.0)(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.8.3)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-blog': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-pages': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-debug': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-google-analytics': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-google-gtag': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-google-tag-manager': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-sitemap': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/theme-classic': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/theme-common': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/theme-search-algolia': 2.4.3(@algolia/client-search@4.20.0)(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.10.0)(typescript@4.9.5) '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) react: 17.0.2 react-dom: 17.0.2(react@17.0.2) @@ -2523,20 +2858,20 @@ packages: unist-util-visit: 2.0.3 dev: false - /@docusaurus/theme-classic@2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/theme-classic@2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-QKRAJPSGPfDY2yCiPMIVyr+MqwZCIV2lxNzqbyUW0YkrlmdzzP3WuQJPMGLCjWgQp/5c9kpWMvMxjhpZx1R32Q==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/mdx-loader': 2.4.3(@docusaurus/types@2.4.3)(react-dom@17.0.2)(react@17.0.2) '@docusaurus/module-type-aliases': 2.4.3(react-dom@17.0.2)(react@17.0.2) - '@docusaurus/plugin-content-blog': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-content-pages': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/theme-common': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-blog': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-pages': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/theme-common': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/theme-translations': 2.4.3 '@docusaurus/types': 2.4.3(react-dom@17.0.2)(react@17.0.2) '@docusaurus/utils': 2.4.3(@docusaurus/types@2.4.3) @@ -2575,7 +2910,7 @@ packages: - webpack-cli dev: false - /@docusaurus/theme-common@2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): + /@docusaurus/theme-common@2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5): resolution: {integrity: sha512-7KaDJBXKBVGXw5WOVt84FtN8czGWhM0lbyWEZXGp8AFfL6sZQfRTluFp4QriR97qwzSyOfQb+nzcDZZU4tezUw==} engines: {node: '>=16.14'} peerDependencies: @@ -2584,9 +2919,9 @@ packages: dependencies: '@docusaurus/mdx-loader': 2.4.3(@docusaurus/types@2.4.3)(react-dom@17.0.2)(react@17.0.2) '@docusaurus/module-type-aliases': 2.4.3(react-dom@17.0.2)(react@17.0.2) - '@docusaurus/plugin-content-blog': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/plugin-content-pages': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-blog': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-pages': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/utils': 2.4.3(@docusaurus/types@2.4.3) '@docusaurus/utils-common': 2.4.3(@docusaurus/types@2.4.3) '@types/history': 4.7.11 @@ -2619,18 +2954,18 @@ packages: - webpack-cli dev: false - /@docusaurus/theme-search-algolia@2.4.3(@algolia/client-search@4.20.0)(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.8.3)(typescript@4.9.5): + /@docusaurus/theme-search-algolia@2.4.3(@algolia/client-search@4.20.0)(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.10.0)(typescript@4.9.5): resolution: {integrity: sha512-jziq4f6YVUB5hZOB85ELATwnxBz/RmSLD3ksGQOLDPKVzat4pmI8tddNWtriPpxR04BNT+ZfpPUMFkNFetSW1Q==} engines: {node: '>=16.14'} peerDependencies: react: ^16.8.4 || ^17.0.0 react-dom: ^16.8.4 || ^17.0.0 dependencies: - '@docsearch/react': 3.5.2(@algolia/client-search@4.20.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.8.3) - '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docsearch/react': 3.5.2(@algolia/client-search@4.20.0)(react-dom@17.0.2)(react@17.0.2)(search-insights@2.10.0) + '@docusaurus/core': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/logger': 2.4.3 - '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) - '@docusaurus/theme-common': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.52.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/plugin-content-docs': 2.4.3(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) + '@docusaurus/theme-common': 2.4.3(@docusaurus/types@2.4.3)(eslint@8.54.0)(react-dom@17.0.2)(react@17.0.2)(typescript@4.9.5) '@docusaurus/theme-translations': 2.4.3 '@docusaurus/utils': 2.4.3(@docusaurus/types@2.4.3) '@docusaurus/utils-validation': 2.4.3(@docusaurus/types@2.4.3) @@ -2971,21 +3306,21 @@ packages: dev: true optional: true - /@eslint-community/eslint-utils@4.4.0(eslint@8.52.0): + /@eslint-community/eslint-utils@4.4.0(eslint@8.54.0): resolution: {integrity: sha512-1/sA4dwrzBAyeUoQ6oxahHKmrZvsnLCg4RfxW3ZFGGmQkSNQPFNLV9CUEFQP1x9EYXHTo5p6xdhZM1Ne9p/AfA==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} peerDependencies: eslint: ^6.0.0 || ^7.0.0 || >=8.0.0 dependencies: - eslint: 8.52.0 + eslint: 8.54.0 eslint-visitor-keys: 3.4.3 /@eslint-community/regexpp@4.10.0: resolution: {integrity: sha512-Cu96Sd2By9mCNTx2iyKOmq10v22jUVQv0lQnlGNy16oE9589yE+QADPbrMGCkA51cKZSg3Pu/aTJVTGfL/qjUA==} engines: {node: ^12.0.0 || ^14.0.0 || >=16.0.0} - /@eslint/eslintrc@2.1.2: - resolution: {integrity: sha512-+wvgpDsrB1YqAMdEUCcnTlpfVBH7Vqn6A/NT3D8WVXFIaKMlErPIZT3oCIAVCOtarRpMtelZLqJeU3t7WY6X6g==} + /@eslint/eslintrc@2.1.3: + resolution: {integrity: sha512-yZzuIG+jnVu6hNSzFEN07e8BxF3uAzYtQb6uDkaYZLo6oYZDCq454c5kB8zxnzfCYyP4MIuyBn10L0DqwujTmA==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} dependencies: ajv: 6.12.6 @@ -3000,8 +3335,8 @@ packages: transitivePeerDependencies: - supports-color - /@eslint/js@8.52.0: - resolution: {integrity: sha512-mjZVbpaeMZludF2fsWLD0Z9gCref1Tk4i9+wddjRvpUNqqcndPkBD09N/Mapey0b3jaXbLm2kICwFv2E64QinA==} + /@eslint/js@8.54.0: + resolution: {integrity: sha512-ut5V+D+fOoWPgGGNj83GGjnntO39xDy6DWxO0wb7Jp3DcMX0TfIqdzHF85VTQkerdyGmuuMD9AKAo5KiNlf/AQ==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} /@hapi/hoek@9.3.0: @@ -3050,7 +3385,7 @@ packages: engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 chalk: 4.1.2 jest-message-util: 29.7.0 jest-util: 29.7.0 @@ -3071,14 +3406,14 @@ packages: '@jest/test-result': 29.7.0 '@jest/transform': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 ansi-escapes: 4.3.2 chalk: 4.1.2 ci-info: 3.9.0 exit: 0.1.2 graceful-fs: 4.2.11 jest-changed-files: 29.7.0 - jest-config: 29.7.0(@types/node@18.18.7) + jest-config: 29.7.0(@types/node@18.18.12) jest-haste-map: 29.7.0 jest-message-util: 29.7.0 jest-regex-util: 29.6.3 @@ -3106,7 +3441,7 @@ packages: dependencies: '@jest/fake-timers': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 jest-mock: 29.7.0 dev: true @@ -3133,7 +3468,7 @@ packages: dependencies: '@jest/types': 29.6.3 '@sinonjs/fake-timers': 10.3.0 - '@types/node': 18.18.7 + '@types/node': 18.18.12 jest-message-util: 29.7.0 jest-mock: 29.7.0 jest-util: 29.7.0 @@ -3165,14 +3500,14 @@ packages: '@jest/test-result': 29.7.0 '@jest/transform': 29.7.0 '@jest/types': 29.6.3 - '@jridgewell/trace-mapping': 0.3.19 - '@types/node': 18.18.7 + '@jridgewell/trace-mapping': 0.3.20 + '@types/node': 18.18.12 chalk: 4.1.2 collect-v8-coverage: 1.0.2 exit: 0.1.2 glob: 7.2.3 graceful-fs: 4.2.11 - istanbul-lib-coverage: 3.2.0 + istanbul-lib-coverage: 3.2.2 istanbul-lib-instrument: 6.0.1 istanbul-lib-report: 3.0.1 istanbul-lib-source-maps: 4.0.1 @@ -3198,7 +3533,7 @@ packages: resolution: {integrity: sha512-MHjT95QuipcPrpLM+8JMSzFx6eHp5Bm+4XeFDJlwsvVBjmKNiIAvasGK2fxz2WbGRlnvqehFbh07MMa7n3YJnw==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: - '@jridgewell/trace-mapping': 0.3.19 + '@jridgewell/trace-mapping': 0.3.20 callsites: 3.1.0 graceful-fs: 4.2.11 dev: true @@ -3209,7 +3544,7 @@ packages: dependencies: '@jest/console': 29.7.0 '@jest/types': 29.6.3 - '@types/istanbul-lib-coverage': 2.0.4 + '@types/istanbul-lib-coverage': 2.0.6 collect-v8-coverage: 1.0.2 dev: true @@ -3227,9 +3562,9 @@ packages: resolution: {integrity: sha512-ok/BTPFzFKVMwO5eOHRrvnBVHdRy9IrsrW1GpMaQ9MCnilNLXQKmAX8s1YXDFaai9xJpac2ySzV0YeRRECr2Vw==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: - '@babel/core': 7.23.0 + '@babel/core': 7.23.3 '@jest/types': 29.6.3 - '@jridgewell/trace-mapping': 0.3.19 + '@jridgewell/trace-mapping': 0.3.20 babel-plugin-istanbul: 6.1.1 chalk: 4.1.2 convert-source-map: 2.0.0 @@ -3251,10 +3586,10 @@ packages: engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: '@jest/schemas': 29.6.3 - '@types/istanbul-lib-coverage': 2.0.4 - '@types/istanbul-reports': 3.0.2 - '@types/node': 18.18.7 - '@types/yargs': 17.0.28 + '@types/istanbul-lib-coverage': 2.0.6 + '@types/istanbul-reports': 3.0.4 + '@types/node': 18.18.12 + '@types/yargs': 17.0.31 chalk: 4.1.2 /@jridgewell/gen-mapping@0.3.3: @@ -3263,7 +3598,7 @@ packages: dependencies: '@jridgewell/set-array': 1.1.2 '@jridgewell/sourcemap-codec': 1.4.15 - '@jridgewell/trace-mapping': 0.3.19 + '@jridgewell/trace-mapping': 0.3.20 /@jridgewell/resolve-uri@3.1.1: resolution: {integrity: sha512-dSYZh7HhCDtCKm4QakX0xFpsRDqjjtZf/kjI/v3T3Nwt5r8/qz/M19F9ySyOqU94SXBmeG9ttTul+YnR4LOxFA==} @@ -3277,13 +3612,13 @@ packages: resolution: {integrity: sha512-UTYAUj/wviwdsMfzoSJspJxbkH5o1snzwX0//0ENX1u/55kkZZkcTZP6u9bwKGkv+dkk9at4m1Cpt0uY80kcpQ==} dependencies: '@jridgewell/gen-mapping': 0.3.3 - '@jridgewell/trace-mapping': 0.3.19 + '@jridgewell/trace-mapping': 0.3.20 /@jridgewell/sourcemap-codec@1.4.15: resolution: {integrity: sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==} - /@jridgewell/trace-mapping@0.3.19: - resolution: {integrity: sha512-kf37QtfW+Hwx/buWGMPcR60iF9ziHa6r/CZJIHbmcm4+0qrXiVdxegAH0F6yddEVQ7zdkjcGCgCzUu+BcbhQxw==} + /@jridgewell/trace-mapping@0.3.20: + resolution: {integrity: sha512-R8LcPeWZol2zR8mmH3JeKQ6QRCFb7XgUhV9ZlGhHLGyg4wpPiPZNQOOWhFZhxKw8u//yTbNGI42Bx/3paXEQ+Q==} dependencies: '@jridgewell/resolve-uri': 3.1.1 '@jridgewell/sourcemap-codec': 1.4.15 @@ -3302,22 +3637,22 @@ packages: /@manypkg/find-root@1.1.0: resolution: {integrity: sha512-mki5uBvhHzO8kYYix/WRy2WX8S3B5wdVSc9D6KcU5lQNglP2yt58/VfLuAK49glRXChosY8ap2oJ1qgma3GUVA==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@types/node': 12.20.55 find-up: 4.1.0 fs-extra: 8.1.0 - dev: false + dev: true /@manypkg/get-packages@1.1.3: resolution: {integrity: sha512-fo+QhuU3qE/2TQMQmbVMqaQ6EWbMhi4ABWP+O4AM1NqPBuy0OrApV5LO6BrrgnhtAHS2NH6RrVk9OL181tTi8A==} dependencies: - '@babel/runtime': 7.23.1 + '@babel/runtime': 7.23.2 '@changesets/types': 4.1.0 '@manypkg/find-root': 1.1.0 fs-extra: 8.1.0 globby: 11.1.0 read-yaml-file: 1.1.0 - dev: false + dev: true /@mdx-js/mdx@1.6.22: resolution: {integrity: sha512-AMxuLxPz2j5/6TpF/XSdKpQP1NlG0z11dFOlq+2IP/lSgl11GY8ji6S/rgsViN/L0BDvHvUMruRb7ub+24LUYA==} @@ -3357,8 +3692,8 @@ packages: resolution: {integrity: sha512-H1rQc1ZOHANWBvPcW+JpGwr+juXSxM8Q8YCkm3GhZd8REu1fHR3z99CErO1p9pkcfcxZnMdIZdIsXkOHY0NilA==} dev: false - /@mongodb-js/saslprep@1.1.0: - resolution: {integrity: sha512-Xfijy7HvfzzqiOAhAepF4SGN5e9leLkMvg/OPOF97XemjfVCYN/oWa75wnkc6mltMSTwY+XlbhWgUOJmkFspSw==} + /@mongodb-js/saslprep@1.1.1: + resolution: {integrity: sha512-t7c5K033joZZMspnHg/gWPE4kandgc2OxE74aYOtGKfgB9VPuVJPix0H6fhmm2erj5PBJ21mqcx34lpIGtUCsQ==} dependencies: sparse-bitfield: 3.0.3 dev: false @@ -3488,7 +3823,7 @@ packages: dependencies: '@edge-runtime/types': 2.2.4 '@sinclair/typebox': 0.29.6 - '@types/node': 18.18.7 + '@types/node': 18.18.8 ajv: 8.12.0 cross-fetch: 3.1.8(encoding@0.1.13) encoding: 0.1.13 @@ -3500,7 +3835,7 @@ packages: engines: {node: ^12.20.0 || ^14.18.0 || >=16.0.0} dependencies: cross-spawn: 7.0.3 - fast-glob: 3.3.1 + fast-glob: 3.3.2 is-glob: 4.0.3 open: 9.1.0 picocolors: 1.0.0 @@ -3511,6 +3846,49 @@ packages: resolution: {integrity: sha512-C16M+IYz0rgRhWZdCmK+h58JMv8vijAA61gmz2rspCSwKwzBebpdcsiUmwrtJRdphuY30i6BSLEOP8ppbNLyLg==} dev: false + /@protobufjs/aspromise@1.1.2: + resolution: {integrity: sha512-j+gKExEuLmKwvz3OgROXtrJ2UG2x8Ch2YZUxahh+s1F2HZ+wAceUNLkvy6zKCPVRkU++ZWQrdxsUeQXmcg4uoQ==} + dev: false + + /@protobufjs/base64@1.1.2: + resolution: {integrity: sha512-AZkcAA5vnN/v4PDqKyMR5lx7hZttPDgClv83E//FMNhR2TMcLUhfRUBHCmSl0oi9zMgDDqRUJkSxO3wm85+XLg==} + dev: false + + /@protobufjs/codegen@2.0.4: + resolution: {integrity: sha512-YyFaikqM5sH0ziFZCN3xDC7zeGaB/d0IUb9CATugHWbd1FRFwWwt4ld4OYMPWu5a3Xe01mGAULCdqhMlPl29Jg==} + dev: false + + /@protobufjs/eventemitter@1.1.0: + resolution: {integrity: sha512-j9ednRT81vYJ9OfVuXG6ERSTdEL1xVsNgqpkxMsbIabzSo3goCjDIveeGv5d03om39ML71RdmrGNjG5SReBP/Q==} + dev: false + + /@protobufjs/fetch@1.1.0: + resolution: {integrity: sha512-lljVXpqXebpsijW71PZaCYeIcE5on1w5DlQy5WH6GLbFryLUrBD4932W/E2BSpfRJWseIL4v/KPgBFxDOIdKpQ==} + dependencies: + '@protobufjs/aspromise': 1.1.2 + '@protobufjs/inquire': 1.1.0 + dev: false + + /@protobufjs/float@1.0.2: + resolution: {integrity: sha512-Ddb+kVXlXst9d+R9PfTIxh1EdNkgoRe5tOX6t01f1lYWOvJnSPDBlG241QLzcyPdoNTsblLUdujGSE4RzrTZGQ==} + dev: false + + /@protobufjs/inquire@1.1.0: + resolution: {integrity: sha512-kdSefcPdruJiFMVSbn801t4vFK7KB/5gd2fYvrxhuJYg8ILrmn9SKSX2tZdV6V+ksulWqS7aXjBcRXl3wHoD9Q==} + dev: false + + /@protobufjs/path@1.1.2: + resolution: {integrity: sha512-6JOcJ5Tm08dOHAbdR3GrvP+yUUfkjG5ePsHYczMFLq3ZmMkAD98cDgcT2iA1lJ9NVwFd4tH/iSSoe44YWkltEA==} + dev: false + + /@protobufjs/pool@1.1.0: + resolution: {integrity: sha512-0kELaGSIDBKvcgS4zkjz1PeddatrjYcmMWOlAuAPwAeccUrPHdUqo/J6LiymHHEiJT5NrF1UVwxY14f+fy4WQw==} + dev: false + + /@protobufjs/utf8@1.1.0: + resolution: {integrity: sha512-Vvn3zZrhQZkkBE8LSuW3em98c0FwgO4nxzv6OdSxPKJIEKY2bGbHn+mhGIPerzI4twdxaP8/0+06HBpwf345Lw==} + dev: false + /@rushstack/eslint-patch@1.2.0: resolution: {integrity: sha512-sXo/qW2/pAcmT43VoRKOJbDOfV3cYpq3szSVfIThQXNt+E4DfKj361vaAt3c88U5tPUxzEswam7GW48PJqtKAg==} dev: false @@ -3538,6 +3916,11 @@ packages: engines: {node: '>=6'} dev: false + /@sindresorhus/is@2.1.1: + resolution: {integrity: sha512-/aPsuoj/1Dw/kzhkgz+ES6TxG0zfTMGLwuK2ZG00k/iJzYHTLCE8mVU8EPqEOp/lmxPoq1C1C9RYToRKb2KEfg==} + engines: {node: '>=10'} + dev: true + /@sinonjs/commons@3.0.0: resolution: {integrity: sha512-jXBtWAF4vmdNmZgD5FoKsVLv3rPgDnLgPbU84LIJ3otV44vJlDRokVng5v8NFJdCf/da9legHcKaRuZs4L7faA==} dependencies: @@ -3725,6 +4108,13 @@ packages: defer-to-connect: 1.1.3 dev: false + /@szmarczak/http-timer@4.0.6: + resolution: {integrity: sha512-4BAffykYOgO+5nzBWYwE3W90sBgLJoUPRWWcL8wlyiM8IB8ipJz3UMJ9KXQd1RKQXpKp8Tutn80HZtWsu2u76w==} + engines: {node: '>=10'} + dependencies: + defer-to-connect: 2.0.1 + dev: true + /@tootallnate/quickjs-emscripten@0.23.0: resolution: {integrity: sha512-C5Mc6rdnsaJDjO3UpGW/CQTHtCKaYlScZTly4JIu97Jxo/odCiH0ITnDXSJPTOrEKk/ycSZ0AOgTmkDtkOsvIA==} dev: true @@ -3754,7 +4144,7 @@ packages: resolution: {integrity: sha512-vxhUy4J8lyeyinH7Azl1pdd43GJhZH/tP2weN8TntQblOY+A0XbT8DJk1/oCPuOOyg/Ja757rG0CgHcWC8OfMA==} dev: true - /@turbo/gen@1.10.16(@types/node@18.18.7)(typescript@5.2.2): + /@turbo/gen@1.10.16(@types/node@18.18.12)(typescript@5.3.2): resolution: {integrity: sha512-PzyluADjVuy5OcIi+/aRcD70OElQpRVRDdfZ9fH8G5Fv75lQcNrjd1bBGKmhjSw+g+eTEkXMGnY7s6gsCYjYTQ==} hasBin: true dependencies: @@ -3766,7 +4156,7 @@ packages: minimatch: 9.0.3 node-plop: 0.26.3 proxy-agent: 6.3.1 - ts-node: 10.9.1(@types/node@18.18.7)(typescript@5.2.2) + ts-node: 10.9.1(@types/node@18.18.12)(typescript@5.3.2) update-check: 1.5.4 validate-npm-package-name: 5.0.0 transitivePeerDependencies: @@ -3784,7 +4174,7 @@ packages: chalk: 2.4.2 commander: 10.0.1 execa: 5.1.1 - fast-glob: 3.3.1 + fast-glob: 3.3.2 fs-extra: 10.1.0 gradient-string: 2.0.2 inquirer: 8.2.6 @@ -3795,80 +4185,127 @@ packages: update-check: 1.5.4 dev: true - /@types/babel__core@7.20.2: - resolution: {integrity: sha512-pNpr1T1xLUc2l3xJKuPtsEky3ybxN3m4fJkknfIpTCTfIZCDW57oAg+EfCgIIp2rvCe0Wn++/FfodDS4YXxBwA==} + /@types/async-retry@1.4.2: + resolution: {integrity: sha512-GUDuJURF0YiJZ+CBjNQA0+vbP/VHlJbB0sFqkzsV7EcOPRfurVonXpXKAt3w8qIjM1TEzpz6hc6POocPvHOS3w==} dependencies: - '@babel/parser': 7.23.0 - '@babel/types': 7.23.0 - '@types/babel__generator': 7.6.5 - '@types/babel__template': 7.4.2 - '@types/babel__traverse': 7.20.2 + '@types/retry': 0.12.5 dev: true - /@types/babel__generator@7.6.5: - resolution: {integrity: sha512-h9yIuWbJKdOPLJTbmSpPzkF67e659PbQDba7ifWm5BJ8xTv+sDmS7rFmywkWOvXedGTivCdeGSIIX8WLcRTz8w==} + /@types/babel__core@7.20.4: + resolution: {integrity: sha512-mLnSC22IC4vcWiuObSRjrLd9XcBTGf59vUSoq2jkQDJ/QQ8PMI9rSuzE+aEV8karUMbskw07bKYoUJCKTUaygg==} dependencies: - '@babel/types': 7.23.0 + '@babel/parser': 7.23.3 + '@babel/types': 7.23.3 + '@types/babel__generator': 7.6.7 + '@types/babel__template': 7.4.4 + '@types/babel__traverse': 7.20.4 dev: true - /@types/babel__template@7.4.2: - resolution: {integrity: sha512-/AVzPICMhMOMYoSx9MoKpGDKdBRsIXMNByh1PXSZoa+v6ZoLa8xxtsT/uLQ/NJm0XVAWl/BvId4MlDeXJaeIZQ==} + /@types/babel__generator@7.6.7: + resolution: {integrity: sha512-6Sfsq+EaaLrw4RmdFWE9Onp63TOUue71AWb4Gpa6JxzgTYtimbM086WnYTy2U67AofR++QKCo08ZP6pwx8YFHQ==} dependencies: - '@babel/parser': 7.23.0 - '@babel/types': 7.23.0 + '@babel/types': 7.23.3 dev: true - /@types/babel__traverse@7.20.2: - resolution: {integrity: sha512-ojlGK1Hsfce93J0+kn3H5R73elidKUaZonirN33GSmgTUMpzI/MIFfSpF3haANe3G1bEBS9/9/QEqwTzwqFsKw==} + /@types/babel__template@7.4.4: + resolution: {integrity: sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A==} dependencies: - '@babel/types': 7.23.0 + '@babel/parser': 7.23.3 + '@babel/types': 7.23.3 + dev: true + + /@types/babel__traverse@7.20.4: + resolution: {integrity: sha512-mSM/iKUk5fDDrEV/e83qY+Cr3I1+Q3qqTuEn++HAWYjEa1+NxZr6CNrcJGf2ZTnq4HoFGC3zaTPZTobCzCFukA==} + dependencies: + '@babel/types': 7.23.3 dev: true /@types/body-parser@1.19.3: resolution: {integrity: sha512-oyl4jvAfTGX9Bt6Or4H9ni1Z447/tQuxnZsytsCaExKlmJiU8sFgnIBRzJUpKwB5eWn9HuBYlUlVA74q/yN0eQ==} dependencies: '@types/connect': 3.4.36 - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false /@types/bonjour@3.5.11: resolution: {integrity: sha512-isGhjmBtLIxdHBDl2xGwUzEM8AOyOvWsADWq7rqirdi/ZQoHnLWErHvsThcEzTX8juDRiZtzp2Qkv5bgNh6mAg==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false + /@types/cacheable-request@6.0.3: + resolution: {integrity: sha512-IQ3EbTzGxIigb1I3qPZc1rWJnH0BmSKv5QYTalEwweFvyBDLSAe24zP0le/hyi7ecGfZVlIVAg4BZqb8WBwKqw==} + dependencies: + '@types/http-cache-semantics': 4.0.4 + '@types/keyv': 3.1.4 + '@types/node': 18.18.12 + '@types/responselike': 1.0.3 + dev: true + + /@types/ci-info@2.0.0: + resolution: {integrity: sha512-5R2/MHILQLDCzTuhs1j4Qqq8AaKUf7Ma4KSSkCtc12+fMs47zfa34qhto9goxpyX00tQK1zxB885VCiawZ5Qhg==} + dev: true + /@types/connect-history-api-fallback@1.5.1: resolution: {integrity: sha512-iaQslNbARe8fctL5Lk+DsmgWOM83lM+7FzP0eQUJs1jd3kBE8NWqBTIT2S8SqQOJjxvt2eyIjpOuYeRXq2AdMw==} dependencies: '@types/express-serve-static-core': 4.17.37 - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false /@types/connect@3.4.36: resolution: {integrity: sha512-P63Zd/JUGq+PdrM1lv0Wv5SBYeA2+CORvbrXbngriYY0jzLUWfQMQQxOhjONEz/wlHOAxOdY7CY65rgQdTjq2w==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false + /@types/cross-spawn@6.0.0: + resolution: {integrity: sha512-evp2ZGsFw9YKprDbg8ySgC9NA15g3YgiI8ANkGmKKvvi0P2aDGYLPxQIC5qfeKNUOe3TjABVGuah6omPRpIYhg==} + dependencies: + '@types/node': 18.18.12 + dev: true + + /@types/crypto-js@4.2.1: + resolution: {integrity: sha512-FSPGd9+OcSok3RsM0UZ/9fcvMOXJ1ENE/ZbLfOPlBWj7BgXtEAM8VYfTtT760GiLbQIMoVozwVuisjvsVwqYWw==} + dev: true + /@types/eslint-scope@3.7.5: resolution: {integrity: sha512-JNvhIEyxVW6EoMIFIvj93ZOywYFatlpu9deeH6eSx6PE3WHYvHaQtmHmQeNw7aA81bYGBPPQqdtBm6b1SsQMmA==} dependencies: '@types/eslint': 8.44.3 '@types/estree': 1.0.2 + /@types/eslint-scope@3.7.7: + resolution: {integrity: sha512-MzMFlSLBqNF2gcHWO0G1vP/YQyfvrxZ0bF+u7mzUdZ1/xK4A4sru+nraZz5i3iEIk1l1uyicaDVTB4QbbEkAYg==} + dependencies: + '@types/eslint': 8.44.7 + '@types/estree': 1.0.5 + dev: false + /@types/eslint@8.44.3: resolution: {integrity: sha512-iM/WfkwAhwmPff3wZuPLYiHX18HI24jU8k1ZSH7P8FHwxTjZ2P6CoX2wnF43oprR+YXJM6UUxATkNvyv/JHd+g==} dependencies: '@types/estree': 1.0.2 '@types/json-schema': 7.0.13 + /@types/eslint@8.44.7: + resolution: {integrity: sha512-f5ORu2hcBbKei97U73mf+l9t4zTGl74IqZ0GQk4oVea/VS8tQZYkUveSYojk+frraAVYId0V2WC9O4PTNru2FQ==} + dependencies: + '@types/estree': 1.0.5 + '@types/json-schema': 7.0.15 + dev: false + /@types/estree@1.0.2: resolution: {integrity: sha512-VeiPZ9MMwXjO32/Xu7+OwflfmeoRwkE/qzndw42gGtgJwZopBnzy2gD//NN1+go1mADzkDcqf/KnFRSjTJ8xJA==} + /@types/estree@1.0.5: + resolution: {integrity: sha512-/kYRxGDLWzHOB7q+wtSUQlFrtcdUccpfy+X+9iMBpHK8QLLhx2wIPYuS5DYtR9Wa/YlZAbIovy7qVdB1Aq6Lyw==} + dev: false + /@types/express-serve-static-core@4.17.37: resolution: {integrity: sha512-ZohaCYTgGFcOP7u6aJOhY9uIZQgZ2vxC2yWoArY+FeDXlqeH66ZVBjgvg+RLVAS/DWNq4Ap9ZXu1+SUQiiWYMg==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 '@types/qs': 6.9.8 '@types/range-parser': 1.2.5 '@types/send': 0.17.2 @@ -3887,13 +4324,13 @@ packages: resolution: {integrity: sha512-ZUxbzKl0IfJILTS6t7ip5fQQM/J3TJYubDm3nMbgubNNYS62eXeUpoLUC8/7fJNiFYHTrGPQn7hspDUzIHX3UA==} dependencies: '@types/minimatch': 5.1.2 - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: true - /@types/graceful-fs@4.1.7: - resolution: {integrity: sha512-MhzcwU8aUygZroVwL2jeYk6JisJrPl/oov/gsgGCue9mkgl9wjGbzReYQClxiUgFDnib9FuHqTndccKeZKxTRw==} + /@types/graceful-fs@4.1.9: + resolution: {integrity: sha512-olP3sd1qOEe5dXTSaFvQG+02VdRXcdytWLAZsAq1PecU8uqQAhkrnbli7DagjtXKW/Bl7YJbUsa8MPcuc8LHEQ==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: true /@types/hast@2.3.6: @@ -3909,6 +4346,10 @@ packages: resolution: {integrity: sha512-oh/6byDPnL1zeNXFrDXFLyZjkr1MsBG667IM792caf1L2UPOOMf65NFzjUH/ltyfwjAGfs1rsX1eftK0jC/KIg==} dev: false + /@types/http-cache-semantics@4.0.4: + resolution: {integrity: sha512-1m0bIFVc7eJWyve9S0RnuRgcQqF/Xd5QsUZAZeQFr1Q3/p9JWoQQEqmVy+DPTNpGXwhgIetAoYF8JSc33q29QA==} + dev: true + /@types/http-errors@2.0.2: resolution: {integrity: sha512-lPG6KlZs88gef6aD85z3HNkztpj7w2R7HmR3gygjfXCQmsLloWNARFkMuzKiiY8FGdh1XDpgBdrSf4aKDiA7Kg==} dev: false @@ -3916,37 +4357,37 @@ packages: /@types/http-proxy@1.17.12: resolution: {integrity: sha512-kQtujO08dVtQ2wXAuSFfk9ASy3sug4+ogFR8Kd8UgP8PEuc1/G/8yjYRmp//PcDNJEUKOza/MrQu15bouEUCiw==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false /@types/inquirer@6.5.0: resolution: {integrity: sha512-rjaYQ9b9y/VFGOpqBEXRavc3jh0a+e6evAbI31tMda8VlPaSy0AZJfXsvmIe3wklc7W6C3zCSfleuMXR7NOyXw==} dependencies: - '@types/through': 0.0.31 + '@types/through': 0.0.33 rxjs: 6.6.7 dev: true - /@types/is-ci@3.0.1: - resolution: {integrity: sha512-mnb1ngaGQPm6LFZaNdh3xPOoQMkrQb/KBPhPPN2p2Wk8XgeUqWj6xPnvyQ8rvcK/VFritVmQG8tvQuy7g+9/nQ==} + /@types/is-ci@3.0.4: + resolution: {integrity: sha512-AkCYCmwlXeuH89DagDCzvCAyltI2v9lh3U3DqSg/GrBYoReAaWwxfXCqMx9UV5MajLZ4ZFwZzV4cABGIxk2XRw==} dependencies: ci-info: 3.9.0 - dev: false + dev: true - /@types/istanbul-lib-coverage@2.0.4: - resolution: {integrity: sha512-z/QT1XN4K4KYuslS23k62yDIDLwLFkzxOuMplDtObz0+y7VqJCaO2o+SPwHCvLFZh7xazvvoor2tA/hPz9ee7g==} + /@types/istanbul-lib-coverage@2.0.6: + resolution: {integrity: sha512-2QF/t/auWm0lsy8XtKVPG19v3sSOQlJe/YHZgfjb/KBBHOGSV+J2q/S671rcq9uTBrLAXmZpqJiaQbMT+zNU1w==} - /@types/istanbul-lib-report@3.0.1: - resolution: {integrity: sha512-gPQuzaPR5h/djlAv2apEG1HVOyj1IUs7GpfMZixU0/0KXT3pm64ylHuMUI1/Akh+sq/iikxg6Z2j+fcMDXaaTQ==} + /@types/istanbul-lib-report@3.0.3: + resolution: {integrity: sha512-NQn7AHQnk/RSLOxrBbGyJM/aVQ+pjj5HCgasFxc0K/KhoATfQ/47AyUl15I2yBUpihjmas+a+VJBOqecrFH+uA==} dependencies: - '@types/istanbul-lib-coverage': 2.0.4 + '@types/istanbul-lib-coverage': 2.0.6 - /@types/istanbul-reports@3.0.2: - resolution: {integrity: sha512-kv43F9eb3Lhj+lr/Hn6OcLCs/sSM8bt+fIaP11rCYngfV6NVjzWXJ17owQtDQTL9tQ8WSLUrGsSJ6rJz0F1w1A==} + /@types/istanbul-reports@3.0.4: + resolution: {integrity: sha512-pk2B1NWalF9toCRu6gjBzR69syFjP4Od8WRAX+0mmf9lAjCRicLOWc+ZrxZHx/0XRjotgkF9t6iaMJ+aXcOdZQ==} dependencies: - '@types/istanbul-lib-report': 3.0.1 + '@types/istanbul-lib-report': 3.0.3 - /@types/jest@29.5.6: - resolution: {integrity: sha512-/t9NnzkOpXb4Nfvg17ieHE6EeSjDS2SGSpNYfoLbUAeL/EOueU/RSdOWFpfQTXBEM7BguYW1XQ0EbM+6RlIh6w==} + /@types/jest@29.5.10: + resolution: {integrity: sha512-tE4yxKEphEyxj9s4inideLHktW/x6DwesIwWZ9NN1FKf9zbJYsnhBoA9vrHA/IuIOKwPa5PcFBNV4lpMIOEzyQ==} dependencies: expect: 29.7.0 pretty-format: 29.7.0 @@ -3955,6 +4396,10 @@ packages: /@types/json-schema@7.0.13: resolution: {integrity: sha512-RbSSoHliUbnXj3ny0CNFOoxrIDV6SUGyStHsvDqosw6CkdPV8TtWGlfecuK4ToyMEAql6pzNxgCFKanovUzlgQ==} + /@types/json-schema@7.0.15: + resolution: {integrity: sha512-5+fP8P8MFNC+AyZCDxrB2pkZFPGzqQWUzpSeuuVLvm8VMcorNYavBqoFcxK8bQz4Qsbn4oUEEem4wDLfcysGHA==} + dev: false + /@types/json5@0.0.29: resolution: {integrity: sha512-dRLjCWHYg4oaA77cxO64oO+7JwCwnIzkZPdrrC71jQmQtlhM556pwKo5bUzqvZndkVbeFLIIi+9TC40JNF5hNQ==} dev: false @@ -3962,17 +4407,20 @@ packages: /@types/keyv@3.1.4: resolution: {integrity: sha512-BQ5aZNSCpj7D6K2ksrRCTmKRLEpnPvWDiLPfoGyhZ++8YtiK9d/3DBKPJgry359X/P1PfruyYwvnvwFjuEiEIg==} dependencies: - '@types/node': 18.18.7 - dev: false + '@types/node': 18.18.12 /@types/lodash-es@4.17.10: resolution: {integrity: sha512-YJP+w/2khSBwbUSFdGsSqmDvmnN3cCKoPOL7Zjle6s30ZtemkkqhjVfFqGwPN7ASil5VyjE2GtyU/yqYY6mC0A==} dependencies: - '@types/lodash': 4.14.200 + '@types/lodash': 4.14.202 dev: false - /@types/lodash@4.14.200: - resolution: {integrity: sha512-YI/M/4HRImtNf3pJgbF+W6FrXovqj+T+/HpENLTooK9PnkacBsDpeP3IpHab40CClUfhNmdM2WTNP2sa2dni5Q==} + /@types/lodash@4.14.202: + resolution: {integrity: sha512-OvlIYQK9tNneDlS0VN54LLd5uiPCBOp7gS5Z0f1mjoJYBrtStzgmJBxONW3U6OZqdtNzZPmn9BS/7WI7BFFcFQ==} + + /@types/long@4.0.2: + resolution: {integrity: sha512-MqTGEo5bj5t157U6fA/BiDynNkn0YknVdh48CMPkTSpFTVmvao5UQmm7uEF6xBEo7qIMAlY/JSleYaE6VOdpaA==} + dev: false /@types/mdast@3.0.13: resolution: {integrity: sha512-HjiGiWedR0DVFkeNljpa6Lv4/IZU1+30VY5d747K7lBudFc3R0Ibr6yJ9lN3BE28VnZyDfLF/VB1Ql1ZIbKrmg==} @@ -3992,38 +4440,62 @@ packages: resolution: {integrity: sha512-K0VQKziLUWkVKiRVrx4a40iPaxTUefQmjtkQofBkYRcoaaL/8rhwDWww9qWbrgicNOgnpIsMxyNIUM4+n6dUIA==} dev: true - /@types/minimist@1.2.3: - resolution: {integrity: sha512-ZYFzrvyWUNhaPomn80dsMNgMeXxNWZBdkuG/hWlUvXvbdUH8ZERNBGXnU87McuGcWDsyzX2aChCv/SVN348k3A==} - dev: false + /@types/minimist@1.2.5: + resolution: {integrity: sha512-hov8bUuiLiyFPGyFPE1lwWhmzYbirOXQNNo40+y3zow8aFVTeyn3VWL0VFFfdNddA8S4Vf0Tc062rzyNr7Paag==} + dev: true /@types/node-fetch@2.6.6: resolution: {integrity: sha512-95X8guJYhfqiuVVhRFxVQcf4hW/2bCuoPwDasMf/531STFoNoWTT7YDnWdXHEZKqAGUigmpG31r2FE70LwnzJw==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 + form-data: 4.0.0 + dev: false + + /@types/node-fetch@2.6.9: + resolution: {integrity: sha512-bQVlnMLFJ2d35DkPNjEPmd9ueO/rh5EiaZt2bhqiSarPjZIuIV6bPQVqcrEyvNo+AfTrRGVazle1tl597w3gfA==} + dependencies: + '@types/node': 18.18.12 form-data: 4.0.0 dev: false /@types/node@12.20.55: resolution: {integrity: sha512-J8xLz7q2OFulZ2cyGTLE1TbbZcjpno7FaN6zdJNrgAdrJ+DZzh/uFR6YrTb4C+nXakvud8Q4+rbhoIWlYQbUFQ==} - dev: false + dev: true /@types/node@17.0.45: resolution: {integrity: sha512-w+tIMs3rq2afQdsPJlODhoUEKzFP1ayaoyl1CcnwtIlsVe7K7bA1NGm4s3PraqTLlXnbIN84zuBlxBWo1u9BLw==} dev: false + /@types/node@18.18.12: + resolution: {integrity: sha512-G7slVfkwOm7g8VqcEF1/5SXiMjP3Tbt+pXDU3r/qhlM2KkGm786DUD4xyMA2QzEElFrv/KZV9gjygv4LnkpbMQ==} + dependencies: + undici-types: 5.26.5 + /@types/node@18.18.7: resolution: {integrity: sha512-bw+lEsxis6eqJYW8Ql6+yTqkE6RuFtsQPSe5JxXbqYRFQEER5aJA9a5UH9igqDWm3X4iLHIKOHlnAXLM4mi7uQ==} dependencies: undici-types: 5.26.5 + dev: true - /@types/normalize-package-data@2.4.2: - resolution: {integrity: sha512-lqa4UEhhv/2sjjIQgjX8B+RBjj47eo0mzGasklVJ78UKGQY1r0VpB9XHDaZZO9qzEFDdy4MrXLuEaSmPrPSe/A==} - dev: false + /@types/node@18.18.8: + resolution: {integrity: sha512-OLGBaaK5V3VRBS1bAkMVP2/W9B+H8meUfl866OrMNQqt7wDgdpWPp5o6gmIc9pB+lIQHSq4ZL8ypeH1vPxcPaQ==} + dependencies: + undici-types: 5.26.5 - /@types/papaparse@5.3.10: - resolution: {integrity: sha512-mS1Fta/xJ9EDYmAvpeWzcV9Gr0cOl1ClpW7di9+wSUNDIDO55tBtyXg97O7K+Syrd9rDEmuejM2iqmJIJ1SO5g==} + /@types/node@20.9.0: + resolution: {integrity: sha512-nekiGu2NDb1BcVofVcEKMIwzlx4NjHlcjhoxxKBNLtz15Y1z7MYf549DFvkHSId02Ax6kGwWntIBPC3l/JZcmw==} dependencies: - '@types/node': 18.18.7 + undici-types: 5.26.5 + dev: true + + /@types/normalize-package-data@2.4.4: + resolution: {integrity: sha512-37i+OaWTh9qeK4LSHPsyRC7NahnGotNuZvjLSgcPzblpHB3rrCJxAOgI5gCdKm7coonsaX1Of0ILiTcnZjbfxA==} + dev: true + + /@types/papaparse@5.3.13: + resolution: {integrity: sha512-tYSlZI3tIdBHXea8fZHcmwbsd1mSUikdMUyqpqj0Zzfu2GTGUSHEKmcnBg699WJ8UnxG31rXD4b1mLGPOAxS2w==} + dependencies: + '@types/node': 18.18.12 dev: true /@types/parse-json@4.0.0: @@ -4034,8 +4506,20 @@ packages: resolution: {integrity: sha512-kUNnecmtkunAoQ3CnjmMkzNU/gtxG8guhi+Fk2U/kOpIKjIMKnXGp4IJCgQJrXSgMsWYimYG4TGjz/UzbGEBTw==} dev: false - /@types/pdf-parse@1.1.3: - resolution: {integrity: sha512-+DDIKtFsGMajapzc5A+jL9V1dpLZ5lShAd6Oq0yRu2qFHFr2hhHlZ2rkFiInXOoFSxjxGmyGdCjjHghoHj/x0w==} + /@types/pdf-parse@1.1.4: + resolution: {integrity: sha512-+gbBHbNCVGGYw1S9lAIIvrHW47UYOhMIFUsJcMkMrzy1Jf0vulBN3XQIjPgnoOXveMuHnF3b57fXROnY/Or7eg==} + dev: true + + /@types/pg@8.10.9: + resolution: {integrity: sha512-UksbANNE/f8w0wOMxVKKIrLCbEMV+oM1uKejmwXr39olg4xqcfBDbXxObJAt6XxHbDa4XTKOlUEcEltXDX+XLQ==} + dependencies: + '@types/node': 18.18.12 + pg-protocol: 1.6.0 + pg-types: 4.0.1 + dev: true + + /@types/prompts@2.0.1: + resolution: {integrity: sha512-AhtMcmETelF8wFDV1ucbChKhLgsc+ytXZXkNz/nnTAMSDeqsjALknEFxi7ZtLgS/G8bV2rp90LhDW5SGACimIQ==} dev: true /@types/prop-types@15.7.8: @@ -4076,34 +4560,37 @@ packages: '@types/scheduler': 0.16.4 csstype: 3.1.2 - /@types/responselike@1.0.1: - resolution: {integrity: sha512-TiGnitEDxj2X0j+98Eqk5lv/Cij8oHd32bU4D/Yw6AOq7vvTk0gSD2GPj0G/HkvhMoVsdlhYF4yqqlyPBTM6Sg==} + /@types/responselike@1.0.3: + resolution: {integrity: sha512-H/+L+UkTV33uf49PH5pCAUBVPNj2nDBXTN+qS1dOwyyg24l3CcicicCA7ca+HMvJBZcFgl5r8e+RR6elsb4Lyw==} dependencies: - '@types/node': 18.18.7 - dev: false + '@types/node': 18.18.12 /@types/retry@0.12.0: resolution: {integrity: sha512-wWKOClTTiizcZhXnPY4wikVAwmdYHp8q6DmC+EJUzAMsycb7HB32Kh9RN4+0gExjmPmZSAQjgURXIGATPegAvA==} dev: false + /@types/retry@0.12.5: + resolution: {integrity: sha512-3xSjTp3v03X/lSQLkczaN9UIEwJMoMCA1+Nb5HfbJEQWogdeQIyVtTvxPXDQjZ5zws8rFQfVfRdz03ARihPJgw==} + dev: true + /@types/sax@1.2.5: resolution: {integrity: sha512-9jWta97bBVC027/MShr3gLab8gPhKy4l6qpb+UJLF5pDm3501NvA7uvqVCW+REFtx00oTi6Cq9JzLwgq6evVgw==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false /@types/scheduler@0.16.4: resolution: {integrity: sha512-2L9ifAGl7wmXwP4v3pN4p2FLhD0O1qsJpvKmNin5VA8+UvNVb447UDaAEV6UdrkA+m/Xs58U1RFps44x6TFsVQ==} - /@types/semver@7.5.3: - resolution: {integrity: sha512-OxepLK9EuNEIPxWNME+C6WwbRAOOI2o2BaQEGzz5Lu2e4Z5eDnEo+/aVEDMIXywoJitJ7xWd641wrGLZdtwRyw==} - dev: false + /@types/semver@7.5.5: + resolution: {integrity: sha512-+d+WYC1BxJ6yVOgUgzK8gWvp5qF8ssV5r4nsDcZWKRWcDQLQ619tvWAxJQYGgBrO1MnLJC7a5GtiYsAoQ47dJg==} + dev: true /@types/send@0.17.2: resolution: {integrity: sha512-aAG6yRf6r0wQ29bkS+x97BIs64ZLxeE/ARwyS6wrldMm3C1MdKwCcnnEwMC1slI8wuxJOpiUH9MioC0A0i+GJw==} dependencies: '@types/mime': 1.3.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false /@types/serve-index@1.9.2: @@ -4117,63 +4604,80 @@ packages: dependencies: '@types/http-errors': 2.0.2 '@types/mime': 3.0.2 - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false /@types/sockjs@0.3.34: resolution: {integrity: sha512-R+n7qBFnm/6jinlteC9DBL5dGiDGjWAvjo4viUanpnc/dG1y7uDoacXPIQ/PQEg1fI912SMHIa014ZjRpvDw4g==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false - /@types/stack-utils@2.0.1: - resolution: {integrity: sha512-Hl219/BT5fLAaz6NDkSuhzasy49dwQS/DSdu4MdggFB8zcXv7vflBI3xp7FEmkmdDkBUI2bPUNeMttp2knYdxw==} + /@types/stack-utils@2.0.3: + resolution: {integrity: sha512-9aEbYZ3TbYMznPdcdr3SmIrLXwC/AKZXQeCf9Pgao5CKb8CyHuEX5jzWPTkvregvhRJHcpRO6BFoGW9ycaOkYw==} dev: true - /@types/through@0.0.31: - resolution: {integrity: sha512-LpKpmb7FGevYgXnBXYs6HWnmiFyVG07Pt1cnbgM1IhEacITTiUaBXXvOR3Y50ksaJWGSfhbEvQFivQEFGCC55w==} + /@types/tar@6.1.5: + resolution: {integrity: sha512-qm2I/RlZij5RofuY7vohTpYNaYcrSQlN2MyjucQc7ZweDwaEWkdN/EeNh6e9zjK6uEm6PwjdMXkcj05BxZdX1Q==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 + minipass: 4.2.8 + dev: true + + /@types/through@0.0.33: + resolution: {integrity: sha512-HsJ+z3QuETzP3cswwtzt2vEIiHBk/dCcHGhbmG5X3ecnwFD/lPrMpliGXxSCg03L9AhrdwA4Oz/qfspkDW+xGQ==} + dependencies: + '@types/node': 18.18.12 dev: true - /@types/tinycolor2@1.4.4: - resolution: {integrity: sha512-FYK4mlLxUUajo/mblv7EUDHku20qT6ThYNsGZsTHilcHRvIkF8WXqtZO+DVTYkpHWCaAT97LueV59H/5Ve3bGA==} + /@types/tinycolor2@1.4.6: + resolution: {integrity: sha512-iEN8J0BoMnsWBqjVbWH/c0G0Hh7O21lpR2/+PrvAVgWdzL7eexIFm4JN/Wn10PTcmNdtS6U67r499mlWMXOxNw==} dev: true /@types/unist@2.0.8: resolution: {integrity: sha512-d0XxK3YTObnWVp6rZuev3c49+j4Lo8g4L1ZRm9z5L0xpoZycUPshHgczK5gsUMaZOstjVYYi09p5gYvUtfChYw==} dev: false - /@types/uuid@9.0.6: - resolution: {integrity: sha512-BT2Krtx4xaO6iwzwMFUYvWBWkV2pr37zD68Vmp1CDV196MzczBRxuEpD6Pr395HAgebC/co7hOphs53r8V7jew==} + /@types/uuid@9.0.7: + resolution: {integrity: sha512-WUtIVRUZ9i5dYXefDEAI7sh9/O7jGvHg7Df/5O/gtH3Yabe5odI3UWopVR1qbPXQtvOxWu3mM4XxlYeZtMWF4g==} + dev: true + + /@types/validate-npm-package-name@3.0.0: + resolution: {integrity: sha512-iFNNIrEaJH1lbPiyX+O/QyxSbKxrTjdNBVZGckt+iEL9So0hdZNBL68sOfHnt2txuUD8UJXvmKv/1DkgkebgUg==} dev: true - /@types/webidl-conversions@7.0.1: - resolution: {integrity: sha512-8hKOnOan+Uu+NgMaCouhg3cT9x5fFZ92Jwf+uDLXLu/MFRbXxlWwGeQY7KVHkeSft6RvY+tdxklUBuyY9eIEKg==} + /@types/webidl-conversions@7.0.2: + resolution: {integrity: sha512-uNv6b/uGRLlCVmelat2rA8bcVd3k/42mV2EmjhPh6JLkd35T5bgwR/t6xy7a9MWhd9sixIeBUzhBenvk3NO+DQ==} + dev: false + + /@types/whatwg-url@11.0.3: + resolution: {integrity: sha512-z1ELvMijRL1QmU7QuzDkeYXSF2+dXI0ITKoQsIoVKcNBOiK5RMmWy+pYYxJTHFt8vkpZe7UsvRErQwcxZkjoUw==} + dependencies: + '@types/webidl-conversions': 7.0.2 dev: false /@types/whatwg-url@8.2.2: resolution: {integrity: sha512-FtQu10RWgn3D9U4aazdwIE2yzphmTJREDqNdODHrbrZmmMqI0vMheC/6NE/J1Yveaj8H+ela+YwWTjq5PGmuhA==} dependencies: - '@types/node': 18.18.7 - '@types/webidl-conversions': 7.0.1 + '@types/node': 18.18.12 + '@types/webidl-conversions': 7.0.2 dev: false /@types/ws@8.5.6: resolution: {integrity: sha512-8B5EO9jLVCy+B58PLHvLDuOD8DRVMgQzq8d55SjLCOn9kqGyqOvy27exVaTio1q1nX5zLu8/6N0n2ThSxOM6tg==} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 dev: false - /@types/yargs-parser@21.0.1: - resolution: {integrity: sha512-axdPBuLuEJt0c4yI5OZssC19K2Mq1uKdrfZBzuxLvaztgqUtFYZUNw7lETExPYJR9jdEoIg4mb7RQKRQzOkeGQ==} + /@types/yargs-parser@21.0.3: + resolution: {integrity: sha512-I4q9QU9MQv4oEOz4tAHJtNz1cwuLxn2F3xcc2iV5WdqLPpUnj30aUuxt1mAxYTG+oe8CZMV/+6rU4S4gRDzqtQ==} - /@types/yargs@17.0.28: - resolution: {integrity: sha512-N3e3fkS86hNhtk6BEnc0rj3zcehaxx8QWhCROJkqpl5Zaoi7nAic3jH8q94jVD3zu5LGk+PUB6KAiDmimYOEQw==} + /@types/yargs@17.0.31: + resolution: {integrity: sha512-bocYSx4DI8TmdlvxqGpVNXOgCNR1Jj0gNPhhAY+iz1rgKDAaYrAYdFYnhDV1IFuiuVc9HkOwyDcFxaTElF3/wg==} dependencies: - '@types/yargs-parser': 21.0.1 + '@types/yargs-parser': 21.0.3 - /@typescript-eslint/parser@5.59.2(eslint@8.52.0)(typescript@5.2.2): + /@typescript-eslint/parser@5.59.2(eslint@8.54.0)(typescript@5.3.2): resolution: {integrity: sha512-uq0sKyw6ao1iFOZZGk9F8Nro/8+gfB5ezl1cA06SrqbgJAt0SRoFhb9pXaHvkrxUpZaoLxt8KlovHNk8Gp6/HQ==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} peerDependencies: @@ -4185,10 +4689,10 @@ packages: dependencies: '@typescript-eslint/scope-manager': 5.59.2 '@typescript-eslint/types': 5.59.2 - '@typescript-eslint/typescript-estree': 5.59.2(typescript@5.2.2) + '@typescript-eslint/typescript-estree': 5.59.2(typescript@5.3.2) debug: 4.3.4 - eslint: 8.52.0 - typescript: 5.2.2 + eslint: 8.54.0 + typescript: 5.3.2 transitivePeerDependencies: - supports-color dev: false @@ -4206,7 +4710,7 @@ packages: engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} dev: false - /@typescript-eslint/typescript-estree@5.59.2(typescript@5.2.2): + /@typescript-eslint/typescript-estree@5.59.2(typescript@5.3.2): resolution: {integrity: sha512-+j4SmbwVmZsQ9jEyBMgpuBD0rKwi9RxRpjX71Brr73RsYnEr3Lt5QZ624Bxphp8HUkSKfqGnPJp1kA5nl0Sh7Q==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} peerDependencies: @@ -4221,8 +4725,8 @@ packages: globby: 11.1.0 is-glob: 4.0.3 semver: 7.5.4 - tsutils: 3.21.0(typescript@5.2.2) - typescript: 5.2.2 + tsutils: 3.21.0(typescript@5.3.2) + typescript: 5.3.2 transitivePeerDependencies: - supports-color dev: false @@ -4232,12 +4736,17 @@ packages: engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} dependencies: '@typescript-eslint/types': 5.59.2 - eslint-visitor-keys: 3.4.0 + eslint-visitor-keys: 3.4.3 dev: false /@ungap/structured-clone@1.2.0: resolution: {integrity: sha512-zuVdFrMJiuCDQUMCzQaD6KL28MjnqqN8XnAqiEq9PNm/hCPTSGfrXCOfwj1ow4LFb/tNymJPwsNbVePc1xFqrQ==} + /@vercel/ncc@0.34.0: + resolution: {integrity: sha512-G9h5ZLBJ/V57Ou9vz5hI8pda/YQX5HQszCs3AmIus3XzsmRn/0Ptic5otD3xVST8QLKk7AMk7AqpsyQGN7MZ9A==} + hasBin: true + dev: true + /@webassemblyjs/ast@1.11.6: resolution: {integrity: sha512-IN1xI7PwOvLPgjcf180gC1bqn3q/QaOCwYUahIOhbYUu8KA/3tw2RT/T0Gidi1l7Hhj5D/INhJxiICObqpMu4Q==} dependencies: @@ -4329,6 +4838,15 @@ packages: '@webassemblyjs/ast': 1.11.6 '@xtuc/long': 4.2.2 + /@xenova/transformers@2.8.0: + resolution: {integrity: sha512-+6/cC/iJd7A+B+C3OPuiIw3dhisdUqBRD/f8CAoo2wYfHofF9zn46pH/dTLAOPoI2px7L9+bvJoXSKO18TBj2Q==} + dependencies: + onnxruntime-web: 1.14.0 + sharp: 0.32.6 + optionalDependencies: + onnxruntime-node: 1.14.0 + dev: false + /@xmldom/xmldom@0.8.10: resolution: {integrity: sha512-2WALfTl4xo2SkGCYRt6rDTFfk9R1czmBvUQy12gK2KuRKIpWEhcbbzy8EZXtz/jkRqHX8bFEc6FC1HjX4TUWYw==} engines: {node: '>=10.0.0'} @@ -4362,15 +4880,23 @@ packages: dependencies: acorn: 8.10.0 - /acorn-jsx@5.3.2(acorn@8.10.0): + /acorn-import-assertions@1.9.0(acorn@8.11.2): + resolution: {integrity: sha512-cmMwop9x+8KFhxvKrKfPYmN6/pKTYYHBqLa0DfvVZcKMJWNyWLnaqND7dx/qn66R7ewM1UX5XMaDVP5wlVTaVA==} + peerDependencies: + acorn: ^8 + dependencies: + acorn: 8.11.2 + dev: false + + /acorn-jsx@5.3.2(acorn@8.11.2): resolution: {integrity: sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==} peerDependencies: acorn: ^6.0.0 || ^7.0.0 || ^8.0.0 dependencies: - acorn: 8.10.0 + acorn: 8.11.2 - /acorn-walk@8.2.0: - resolution: {integrity: sha512-k+iyHEuPgSw6SbuDpGQM+06HQUa04DZ3o+F6CSzXMvvI5KMvnaEqXe+YVe555R9nn6GPt404fos4wcgpw12SDA==} + /acorn-walk@8.3.0: + resolution: {integrity: sha512-FS7hV565M5l1R08MXqo8odwMTB02C2UqzB17RVgu9EyuYFBqJZ3/ZY97sQD5FewVu1UyDFc1yztUDrAwT0EypA==} engines: {node: '>=0.4.0'} /acorn@8.10.0: @@ -4378,6 +4904,11 @@ packages: engines: {node: '>=0.4.0'} hasBin: true + /acorn@8.11.2: + resolution: {integrity: sha512-nc0Axzp/0FILLEVsm4fNwLCwMttvhEI263QtVPQcbpfZZ3ts0hLsZGOpE6czNlid7CJ9MlyH8reXkpsf3YUY4w==} + engines: {node: '>=0.4.0'} + hasBin: true + /address@1.2.2: resolution: {integrity: sha512-4B/qKCfeE/ODUaAUpSwfzazo5x29WD4r3vXiWsB7I2mSDAihwEqKO+g8GELZUQSSAo5e1XTYh3ZVfLyxBc12nA==} engines: {node: '>= 10.0.0'} @@ -4415,7 +4946,6 @@ packages: optional: true dependencies: ajv: 8.12.0 - dev: false /ajv-keywords@3.5.2(ajv@6.12.6): resolution: {integrity: sha512-5p6WTN0DdTGVQk6VjcEju19IgaHudalcfabD7yhDGeA6bcQnmL+CpveLJq/3hvfwd1aof6L386Ougkx6RfyMIQ==} @@ -4448,7 +4978,6 @@ packages: json-schema-traverse: 1.0.0 require-from-string: 2.0.2 uri-js: 4.4.1 - dev: false /algoliasearch-helper@3.14.2(algoliasearch@4.20.0): resolution: {integrity: sha512-FjDSrjvQvJT/SKMW74nPgFpsoPUwZCzGbCqbp8HhBFfSk/OvNFxzCaCmuO0p7AWeLy1gD+muFwQEkBwcl5H4pg==} @@ -4487,7 +5016,7 @@ packages: /ansi-colors@4.1.3: resolution: {integrity: sha512-/6w/C21Pm1A7aZitlI5Ni/2J6FFQN8i1Cvz3kHABAAbw93v/NlvKdVOqz7CCWz/3iv/JplRSEEZ83XION15ovw==} engines: {node: '>=6'} - dev: false + dev: true /ansi-escapes@4.3.2: resolution: {integrity: sha512-gKXj5ALrKWQLsYG9jlTRmR/xKluxHV+Z9QEwNIgCfM1/uwPMCuzVVnh5mwTd+OuBZcwSIMbqssNWRm1lE51QaQ==} @@ -4496,6 +5025,13 @@ packages: type-fest: 0.21.3 dev: true + /ansi-escapes@5.0.0: + resolution: {integrity: sha512-5GFMVX8HqE/TB+FuBJGuO5XG0WrsA6ptUqoODaT/n9mmUaZFkqnBueB4leqGBCmrUHnCnC4PCZTCd0E7QQ83bA==} + engines: {node: '>=12'} + dependencies: + type-fest: 1.4.0 + dev: true + /ansi-html-community@0.0.8: resolution: {integrity: sha512-1APHAyr3+PCamwNw3bXCPp4HFLONZt/yIH0sZp0/469KWNTEy+qN5jQ3GVX6DMZ1UXAi34yVwtTeaG/HpBuuzw==} engines: {'0': node >= 0.8.0} @@ -4509,7 +5045,6 @@ packages: /ansi-regex@6.0.1: resolution: {integrity: sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==} engines: {node: '>=12'} - dev: false /ansi-sequence-parser@1.1.1: resolution: {integrity: sha512-vJXt3yiaUL4UU546s3rPXlsry/RnM730G1+HkpKE012AN0sx1eOrxSu95oKDIonskeLTijMgqWZ3uDEe3NFvyg==} @@ -4535,7 +5070,6 @@ packages: /ansi-styles@6.2.1: resolution: {integrity: sha512-bN798gFfQX+viw3R7yrGWRqnrN2oRkEkUjjl4JNn4E8GxxbjtG3FbrEIIY3l8/hrwUwIeCZvi4QuOTP4MErVug==} engines: {node: '>=12'} - dev: false /any-promise@1.3.0: resolution: {integrity: sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==} @@ -4574,7 +5108,6 @@ packages: dependencies: call-bind: 1.0.2 is-array-buffer: 3.0.2 - dev: false /array-flatten@1.1.1: resolution: {integrity: sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==} @@ -4603,7 +5136,7 @@ packages: resolution: {integrity: sha512-roTU0KWIOmJ4DRLmwKd19Otg0/mT3qPNt0Qb3GWW8iObuZXxrjB/pzn0R3hqpRSWg4HCwqx+0vwOnWnvlOyeIA==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.0 es-abstract: 1.21.2 es-shim-unscopables: 1.0.0 @@ -4613,11 +5146,11 @@ packages: resolution: {integrity: sha512-djYB+Zx2vLewY8RWlNCUdHjDXs2XOgm602S9E7P/UpHgfeHL00cRiIF+IN/G/aUJ7kGPb6yO/ErDI5V2s8iycA==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 - es-abstract: 1.22.2 - es-shim-unscopables: 1.0.0 - dev: false + es-abstract: 1.22.3 + es-shim-unscopables: 1.0.2 + dev: true /array.prototype.flatmap@1.3.1: resolution: {integrity: sha512-8UGn9O1FDVvMNB0UlLv4voxRMze7+FpHyF5mSMRjWHUMlpoDViniy05870VlxhfgTnLbpuwTzvD76MTtWxB/mQ==} @@ -4632,7 +5165,7 @@ packages: /array.prototype.tosorted@1.1.1: resolution: {integrity: sha512-pZYPXPRl2PqWcsUs6LOMn+1f1532nEoPTYowBtqLwAW+W8vSVhkIGnmOX1t/UQjD6YGI0vcD2B1U7ZFGQH9jnQ==} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.0 es-abstract: 1.21.2 es-shim-unscopables: 1.0.0 @@ -4644,18 +5177,18 @@ packages: engines: {node: '>= 0.4'} dependencies: array-buffer-byte-length: 1.0.0 - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 - es-abstract: 1.22.2 - get-intrinsic: 1.2.1 + es-abstract: 1.22.3 + get-intrinsic: 1.2.2 is-array-buffer: 3.0.2 is-shared-array-buffer: 1.0.2 - dev: false + dev: true /arrify@1.0.1: resolution: {integrity: sha512-3CYzex9M9FGQjCGMGyi6/31c8GJbgb0qGyrx5HWxPd0aCwh4cB2YjMb2Xf9UuoogrMrlO9cTqnB5rI5GHZTcUA==} engines: {node: '>=0.10.0'} - dev: false + dev: true /asap@2.0.6: resolution: {integrity: sha512-BSHWgDSAiKs50o2Re8ppvp3seVHXSRM44cdSsT9FfNEUUZLOGWVCsiWaRPWM1Znn+mqZ1OfVZ3z3DWEzSp7hRA==} @@ -4670,8 +5203,8 @@ packages: safer-buffer: 2.1.2 dev: true - /assemblyai@3.0.1: - resolution: {integrity: sha512-7EW3v00o8s3TSweQERJjoNbXMDU8abwYwpE3gYKQhNY4xlcxb2in344rQi6MsMLVxRtLe8HBXGVRUlZkzfxC3w==} + /assemblyai@3.1.1: + resolution: {integrity: sha512-rEhLnIZU7TupOkdzN9WjxhVU5bxMVofkNslzTArsuilaqOusPUmh6I7SGcJCGwKKE8qEweBaoY4DZ03cxv4KoA==} dependencies: ws: 8.14.2 transitivePeerDependencies: @@ -4682,7 +5215,7 @@ packages: /assert@2.1.0: resolution: {integrity: sha512-eLHpSK/Y4nhMJ07gDaAzoX/XAKS8PSaojml3M0DM4JpV1LAi5JOJ/p6H/XWrl8L+DzVEvVCW1z3vWAaB9oTsQw==} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 is-nan: 1.3.2 object-is: 1.1.5 object.assign: 4.1.4 @@ -4700,6 +5233,16 @@ packages: tslib: 2.6.2 dev: true + /async-retry@1.3.1: + resolution: {integrity: sha512-aiieFW/7h3hY0Bq5d+ktDBejxuwR78vRu9hDUdR8rNhSaQ29VzPL4AoIRG7D/c7tdenwOcKvgPM6tIxB3cB6HA==} + dependencies: + retry: 0.12.0 + dev: true + + /async-sema@3.0.1: + resolution: {integrity: sha512-fKT2riE8EHAvJEfLJXZiATQWqZttjx1+tfgnVshCDrH8vlw4YC8aECe0B8MU184g+aVRFVgmfxFlKZKaozSrNw==} + dev: true + /asynckit@0.4.0: resolution: {integrity: sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==} dev: false @@ -4709,6 +5252,11 @@ packages: engines: {node: '>= 4.0.0'} dev: false + /atomically@1.7.0: + resolution: {integrity: sha512-Xcz9l0z7y9yQ9rdDaxlmaI4uJHf/T8g9hOEzJcsEqX2SjCj4J20uK7+ldkDHMbpJDK76wF7xEIgxc/vSlsfw5w==} + engines: {node: '>=10.12.0'} + dev: true + /autoprefixer@10.4.16(postcss@8.4.31): resolution: {integrity: sha512-7vd3UC6xKp0HLfua5IjZlcXvGAGy7cBAXTg2lyQ/8WpNhd6SiZ8Be+xm3FyBSYJx5GKcpRCzBh7RH4/0dnY+uQ==} engines: {node: ^10 || ^12 || >=14} @@ -4748,17 +5296,21 @@ packages: deep-equal: 2.2.1 dev: false - /babel-jest@29.7.0(@babel/core@7.23.0): + /b4a@1.6.4: + resolution: {integrity: sha512-fpWrvyVHEKyeEvbKZTVOeZF3VSKKWtJxFIxX/jaVPf+cLbGUSitjb49pHLqPV2BUNNZ0LcoeEGfE/YCpyDYHIw==} + dev: false + + /babel-jest@29.7.0(@babel/core@7.23.3): resolution: {integrity: sha512-BrvGY3xZSwEcCzKvKsCi2GgHqDqsYkOP4/by5xCgIwGXQxIEh+8ew3gmrE1y7XRR6LHZIj6yLYnUi/mm2KXKBg==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} peerDependencies: '@babel/core': ^7.8.0 dependencies: - '@babel/core': 7.23.0 + '@babel/core': 7.23.3 '@jest/transform': 29.7.0 - '@types/babel__core': 7.20.2 + '@types/babel__core': 7.20.4 babel-plugin-istanbul: 6.1.1 - babel-preset-jest: 29.6.3(@babel/core@7.23.0) + babel-preset-jest: 29.6.3(@babel/core@7.23.3) chalk: 4.1.2 graceful-fs: 4.2.11 slash: 3.0.0 @@ -4821,9 +5373,9 @@ packages: engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: '@babel/template': 7.22.15 - '@babel/types': 7.23.0 - '@types/babel__core': 7.20.2 - '@types/babel__traverse': 7.20.2 + '@babel/types': 7.23.3 + '@types/babel__core': 7.20.4 + '@types/babel__traverse': 7.20.4 dev: true /babel-plugin-polyfill-corejs2@0.4.5(@babel/core@7.23.0): @@ -4862,35 +5414,35 @@ packages: - supports-color dev: false - /babel-preset-current-node-syntax@1.0.1(@babel/core@7.23.0): + /babel-preset-current-node-syntax@1.0.1(@babel/core@7.23.3): resolution: {integrity: sha512-M7LQ0bxarkxQoN+vz5aJPsLBn77n8QgTFmo8WK0/44auK2xlCXrYcUxHFxgU7qW5Yzw/CjmLRK2uJzaCd7LvqQ==} peerDependencies: '@babel/core': ^7.0.0 dependencies: - '@babel/core': 7.23.0 - '@babel/plugin-syntax-async-generators': 7.8.4(@babel/core@7.23.0) - '@babel/plugin-syntax-bigint': 7.8.3(@babel/core@7.23.0) - '@babel/plugin-syntax-class-properties': 7.12.13(@babel/core@7.23.0) - '@babel/plugin-syntax-import-meta': 7.10.4(@babel/core@7.23.0) - '@babel/plugin-syntax-json-strings': 7.8.3(@babel/core@7.23.0) - '@babel/plugin-syntax-logical-assignment-operators': 7.10.4(@babel/core@7.23.0) - '@babel/plugin-syntax-nullish-coalescing-operator': 7.8.3(@babel/core@7.23.0) - '@babel/plugin-syntax-numeric-separator': 7.10.4(@babel/core@7.23.0) - '@babel/plugin-syntax-object-rest-spread': 7.8.3(@babel/core@7.23.0) - '@babel/plugin-syntax-optional-catch-binding': 7.8.3(@babel/core@7.23.0) - '@babel/plugin-syntax-optional-chaining': 7.8.3(@babel/core@7.23.0) - '@babel/plugin-syntax-top-level-await': 7.14.5(@babel/core@7.23.0) - dev: true - - /babel-preset-jest@29.6.3(@babel/core@7.23.0): + '@babel/core': 7.23.3 + '@babel/plugin-syntax-async-generators': 7.8.4(@babel/core@7.23.3) + '@babel/plugin-syntax-bigint': 7.8.3(@babel/core@7.23.3) + '@babel/plugin-syntax-class-properties': 7.12.13(@babel/core@7.23.3) + '@babel/plugin-syntax-import-meta': 7.10.4(@babel/core@7.23.3) + '@babel/plugin-syntax-json-strings': 7.8.3(@babel/core@7.23.3) + '@babel/plugin-syntax-logical-assignment-operators': 7.10.4(@babel/core@7.23.3) + '@babel/plugin-syntax-nullish-coalescing-operator': 7.8.3(@babel/core@7.23.3) + '@babel/plugin-syntax-numeric-separator': 7.10.4(@babel/core@7.23.3) + '@babel/plugin-syntax-object-rest-spread': 7.8.3(@babel/core@7.23.3) + '@babel/plugin-syntax-optional-catch-binding': 7.8.3(@babel/core@7.23.3) + '@babel/plugin-syntax-optional-chaining': 7.8.3(@babel/core@7.23.3) + '@babel/plugin-syntax-top-level-await': 7.14.5(@babel/core@7.23.3) + dev: true + + /babel-preset-jest@29.6.3(@babel/core@7.23.3): resolution: {integrity: sha512-0B3bhxR6snWXJZtR/RliHTDPRgn1sNHOR0yVtq/IiQFyuOVjFS+wuio/R4gSNkyYmKmJB4wGZv2NZanmKmTnNA==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} peerDependencies: '@babel/core': ^7.0.0 dependencies: - '@babel/core': 7.23.0 + '@babel/core': 7.23.3 babel-plugin-jest-hoist: 29.6.3 - babel-preset-current-node-syntax: 1.0.1(@babel/core@7.23.0) + babel-preset-current-node-syntax: 1.0.1(@babel/core@7.23.3) dev: true /bail@1.0.5: @@ -4925,7 +5477,7 @@ packages: engines: {node: '>=4'} dependencies: is-windows: 1.0.2 - dev: false + dev: true /big-integer@1.6.51: resolution: {integrity: sha512-GPEid2Y9QU1Exl1rpO9B2IPJGHPSupF5GnVIP0blYvNOMer2bTvSWs1jGOUg04hTmu67nmLsQ9TBo1puaotBHg==} @@ -4946,7 +5498,6 @@ packages: buffer: 5.7.1 inherits: 2.0.4 readable-stream: 3.6.2 - dev: true /bluebird@3.4.7: resolution: {integrity: sha512-iD3898SR7sWVRHbiQv+sHUtHnMvC1o3nW5rAcqnq3uOn07DSAppZYUkIGslDz6gXC7HfunPe7YVBgoEJASPcHA==} @@ -5050,7 +5601,7 @@ packages: resolution: {integrity: sha512-yjxDAYyK/pBvws9H4xKYpLDpYKEH6CzrBPAuXq3x18I+c/2MkVtT3qAr7Oloi6Dss9qNhPVueAAVU1CSeNDIXw==} dependencies: wcwidth: 1.0.1 - dev: false + dev: true /brorand@1.1.0: resolution: {integrity: sha512-cKV8tMCEpQs4hK/ik71d6LrPOnpkpGBR0wzxqr68g2m/LB2GxVYQroAjMJZRVM1Y4BCjCKc3vAamxSzOY2RP+w==} @@ -5059,7 +5610,7 @@ packages: /browser-resolve@2.0.0: resolution: {integrity: sha512-7sWsQlYL2rGLy2IWm8WL8DCTJvYLc/qlOnsakDac87SOoCd16WLsaAMdCiAqsTNHIe+SXfaqyxyo6THoWqs8WQ==} dependencies: - resolve: 1.22.7 + resolve: 1.22.8 dev: true /browserify-aes@1.2.0: @@ -5097,8 +5648,9 @@ packages: randombytes: 2.1.0 dev: true - /browserify-sign@4.2.1: - resolution: {integrity: sha512-/vrA5fguVAKKAVTNJjgSm1tRQDHUU6DbwO9IROu/0WAzC8PKhucDSh18J0RMvVeHAn5puMd+QHC2erPRNf8lmg==} + /browserify-sign@4.2.2: + resolution: {integrity: sha512-1rudGyeYY42Dk6texmv7c4VcQ0EsvVbLwZkA+AQB7SxvXxmcD93jcHie8bzecJ+ChDlmAm2Qyu0+Ccg5uhZXCg==} + engines: {node: '>= 4'} dependencies: bn.js: 5.2.1 browserify-rsa: 4.1.0 @@ -5158,6 +5710,11 @@ packages: /buffer-from@1.1.2: resolution: {integrity: sha512-E+XQCRwSbaaiChtv6k6Dwgc+bx+Bs6vuKJHHl5kox/BaKbhiXzqQOwK4cO22yElGp2OCmjwVhT3HmxgyPGnJfQ==} + /buffer-writer@2.0.0: + resolution: {integrity: sha512-a7ZpuTZU1TRtnwyCNW3I5dc0wWNC3VR9S++Ewyk2HHZdrO3CQJqSpd+95Us590V6AL7JqUAH2IwZ/398PmNFgw==} + engines: {node: '>=4'} + dev: false + /buffer-xor@1.0.3: resolution: {integrity: sha512-571s0T7nZWK6vB67HI5dyUF7wXiNcfaPPPTl6zYCNApANjIvYJTg7hlud/+cJpdAhS7dVzqMLmfhfHR3rAcOjQ==} dev: true @@ -5167,12 +5724,15 @@ packages: dependencies: base64-js: 1.5.1 ieee754: 1.2.1 - dev: true /builtin-status-codes@3.0.0: resolution: {integrity: sha512-HpGFw18DgFWlncDfjTa2rcQ4W88O1mC8e8yZ2AvQY5KDaktSTwo+KRf6nHK6FRI5FyRyb/5T6+TSxfP7QyGsmQ==} dev: true + /builtins@1.0.3: + resolution: {integrity: sha512-uYBjakWipfaO/bXI7E8rq6kpwHRZK5cNYrUv2OzZSI/FvmdMyXJ2tG9dKcjEC5YHmHpUAwsargWIZNWdxb/bnQ==} + dev: true + /builtins@5.0.1: resolution: {integrity: sha512-qwVpFEHNfhYJIzNRBvd2C1kyo6jz3ZSMPyyuR47OPdiKWlbYnZNyDWuyR175qDnAJLiCo5fBBqPb3RiXgWlkOQ==} dependencies: @@ -5218,6 +5778,14 @@ packages: engines: {node: '>=8'} dev: true + /cacheable-lookup@2.0.1: + resolution: {integrity: sha512-EMMbsiOTcdngM/K6gV/OxF2x0t07+vMOWxZNSCRQMjO2MY2nhZQ6OYhOOpyQrbhqsgtvKGI7hcq6xjnA92USjg==} + engines: {node: '>=10'} + dependencies: + '@types/keyv': 3.1.4 + keyv: 4.5.4 + dev: true + /cacheable-request@6.1.0: resolution: {integrity: sha512-Oj3cAGPCqOZX7Rz64Uny2GYAZNliQSqfbePrgAQ1wKAihYmCUnraBtJtKcGR4xz7wF+LoJC+ssFZvv5BgF9Igg==} engines: {node: '>=8'} @@ -5231,12 +5799,32 @@ packages: responselike: 1.0.2 dev: false + /cacheable-request@7.0.4: + resolution: {integrity: sha512-v+p6ongsrp0yTGbJXjgxPow2+DL93DASP4kXCDKb8/bwRtt9OEF3whggkkDkGNzgcWy2XaF4a8nZglC7uElscg==} + engines: {node: '>=8'} + dependencies: + clone-response: 1.0.3 + get-stream: 5.2.0 + http-cache-semantics: 4.1.1 + keyv: 4.5.4 + lowercase-keys: 2.0.0 + normalize-url: 6.1.0 + responselike: 2.0.1 + dev: true + /call-bind@1.0.2: resolution: {integrity: sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA==} dependencies: function-bind: 1.1.1 get-intrinsic: 1.2.1 + /call-bind@1.0.5: + resolution: {integrity: sha512-C3nQxfFZxFRVoJoGKKI8y3MOEo129NQ+FgQ08iye+Mk4zNZZGdjfs06bVTr+DBSlA66Q2VEcMki/cUCP4SercQ==} + dependencies: + function-bind: 1.1.2 + get-intrinsic: 1.2.2 + set-function-length: 1.1.1 + /callsites@3.1.0: resolution: {integrity: sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==} engines: {node: '>=6'} @@ -5267,11 +5855,12 @@ packages: camelcase: 5.3.1 map-obj: 4.3.0 quick-lru: 4.0.1 - dev: false + dev: true /camelcase@5.3.1: resolution: {integrity: sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==} engines: {node: '>=6'} + dev: true /camelcase@6.3.0: resolution: {integrity: sha512-Gmy6FhYlCY7uOElZUSbxo2UCDH8owEk996gkbrpsgGtrJLM3J7jGxl9Ic7Qwwj4ivOE5AWZWRMecDdF7hqGjFA==} @@ -5323,6 +5912,11 @@ packages: ansi-styles: 4.3.0 supports-color: 7.2.0 + /chalk@5.3.0: + resolution: {integrity: sha512-dLitG79d+GV1Nb/VYcCDFivJeK1hiukt9QjRNVOsUtTy1rR1YJsmpGGTZ3qJos+uw7WmWF4wUwBd9jxjocFC2w==} + engines: {node: ^12.17.0 || ^14.13 || >=16.0.0} + dev: true + /change-case@3.1.0: resolution: {integrity: sha512-2AZp7uJZbYEzRPsFoa+ijKdvp9zsrnnt6+yFokfwEpeJm0xuJDVoxiRCAaTzyJND8GJkofo2IcKWaUZ/OECVzw==} dependencies: @@ -5365,6 +5959,7 @@ packages: /chardet@0.7.0: resolution: {integrity: sha512-mT8iDcrh03qDGRRmoA2hmBJnxpllMR+0/0qlzjqZES6NdiWDcZkCNAk4rPFZ9Q85r27unkiNNg8ZOiwZXBHwcA==} + dev: true /charenc@0.0.2: resolution: {integrity: sha512-yrLQ/yVUFXkzg7EDQsPieE/53+0RlaWTs+wBrvW36cyilJ2SaDWfl4Yj7MtLTXleV9uEKefbAGUPv2/iWSooRA==} @@ -5408,6 +6003,15 @@ packages: optionalDependencies: fsevents: 2.3.3 + /chownr@1.1.4: + resolution: {integrity: sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg==} + dev: false + + /chownr@2.0.0: + resolution: {integrity: sha512-bIomtDF5KGpdogkLd9VspvFzk9KfpyyGlS8YFVZl7TGPBHL5snIOnxeshwVgPteQ9b4Eydl+pVbIyE1DcvCWgQ==} + engines: {node: '>=10'} + dev: true + /chrome-trace-event@1.0.3: resolution: {integrity: sha512-p3KULyQg4S7NIHixdwbGX+nFHkoBiA4YQmyWtjb8XngSKV124nJmRysgAeujbUVb15vh+RvFUfCPqU7rXk+hZg==} engines: {node: '>=6.0'} @@ -5459,6 +6063,13 @@ packages: restore-cursor: 3.1.0 dev: true + /cli-cursor@4.0.0: + resolution: {integrity: sha512-VGtlMu3x/4DOtIUwEkRezxUZ2lBacNJCHash0N0WeZDBS+7Ux1dm3XWAgWYxLJFMMdOeXMHXorshEFhbMSGelg==} + engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0} + dependencies: + restore-cursor: 4.0.0 + dev: true + /cli-spinners@2.9.1: resolution: {integrity: sha512-jHgecW0pxkonBJdrKsqxgRX9AcG+u/5k0Q7WPDfi8AogLAdwxEkyYYNWwZ5GvVFoFx2uiY1eNcSK00fh+1+FyQ==} engines: {node: '>=6'} @@ -5473,6 +6084,14 @@ packages: '@colors/colors': 1.5.0 dev: false + /cli-truncate@3.1.0: + resolution: {integrity: sha512-wfOBkjXteqSnI59oPcJkcPl/ZmwvMMOj340qUIY1SKZCv0B9Cf4D4fAucRkIKQmsIuYK3x1rrgU7MeGRruiuiA==} + engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0} + dependencies: + slice-ansi: 5.0.0 + string-width: 5.1.2 + dev: true + /cli-width@3.0.0: resolution: {integrity: sha512-FxqpkPPwu1HjuN93Omfm4h8uIanXofW0RxVEW3k5RKx+mJJYSthzNhp32Kzxxy3YAEZ/Dc/EWN1vZRY0+kOhbw==} engines: {node: '>= 10'} @@ -5488,7 +6107,7 @@ packages: string-width: 4.2.3 strip-ansi: 6.0.1 wrap-ansi: 6.2.0 - dev: false + dev: true /cliui@8.0.1: resolution: {integrity: sha512-BSeNnyus75C4//NQ9gQt1/csTXyo/8Sb+afLAkzAptFuMsod9HFokGNudZpi/oQV73hnVK+sR+5PVRMd+Dr7YQ==} @@ -5497,6 +6116,7 @@ packages: string-width: 4.2.3 strip-ansi: 6.0.1 wrap-ansi: 7.0.0 + dev: true /clone-deep@4.0.1: resolution: {integrity: sha512-neHB9xuzh/wk0dIHweyAXv2aPGZIVk3pLMe+/RNzINf17fe0OG96QroktYAUm7SM1PBnzTabaLboqqxDyMU+SQ==} @@ -5510,11 +6130,11 @@ packages: resolution: {integrity: sha512-ROoL94jJH2dUVML2Y/5PEDNaSHgeOdSDicUyS7izcF63G6sTc/FTjLub4b8Il9S8S0beOfYt0TaA5qvFK+w0wA==} dependencies: mimic-response: 1.0.1 - dev: false /clone@1.0.4: resolution: {integrity: sha512-JQHZ2QMW6l3aH/j6xCqQThY/9OH4D/9ls34cgkUBiEeocRTU04tHfKPBsUK1PqZCUQM7GiA0IIXJSuXHI64Kbg==} engines: {node: '>=0.8'} + dev: true /clsx@1.2.1: resolution: {integrity: sha512-EcR6r5a8bj6pu3ycsa/E/cKVGuTgZJZdsyUYHOksG/UHIiKfjxzRxYJpyVBwYaQeOvghal9fcc4PidlgzugAQg==} @@ -5558,13 +6178,27 @@ packages: /color-name@1.1.4: resolution: {integrity: sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==} - /colord@2.9.3: - resolution: {integrity: sha512-jeC1axXpnb0/2nn/Y1LPuLdgXBLH7aDcHu4KEKfqw3CUhX7ZpfBSlPKyqXE6btIgEzfWtrX3/tyBCaCvXvMkOw==} - dev: false + /color-string@1.9.1: + resolution: {integrity: sha512-shrVawQFojnZv6xM40anx4CkoDP+fZsw/ZerEMsW/pyzsRbElpsL/DBVW7q3ExxwusdNXI3lXpuhEZkzs8p5Eg==} + dependencies: + color-name: 1.1.4 + simple-swizzle: 0.2.2 + dev: false + + /color@4.2.3: + resolution: {integrity: sha512-1rXeuUUiGGrykh+CeBdu5Ie7OJwinCgQY0bc7GCRxy5xVHy+moaqkpL/jqQq0MtQOeYcrqEz4abc5f0KtU7W4A==} + engines: {node: '>=12.5.0'} + dependencies: + color-convert: 2.0.1 + color-string: 1.9.1 + dev: false + + /colord@2.9.3: + resolution: {integrity: sha512-jeC1axXpnb0/2nn/Y1LPuLdgXBLH7aDcHu4KEKfqw3CUhX7ZpfBSlPKyqXE6btIgEzfWtrX3/tyBCaCvXvMkOw==} + dev: false /colorette@2.0.20: resolution: {integrity: sha512-IfEDxwoWIjkeXL1eXcDiow4UbKjhLdq6/EuSVR9GMN7KVH3r9gQ83e73hsz1Nd1T3ijd5xv1wcWRYO+D6kCI2w==} - dev: false /combine-promises@1.2.0: resolution: {integrity: sha512-VcQB1ziGD0NXrhKxiwyNbCDmRzs/OShMs2GqW2DlU2A/Sd0nQxE1oWDAE5O0ygSx5mgQOn9eIFh7yKPgFRVkPQ==} @@ -5590,10 +6224,9 @@ packages: /commander@11.1.0: resolution: {integrity: sha512-yPVavfyCcRhmorC7rWlkHn15b4wDVgVmBA7kV4QVBsF7kv/9TKJAbAXVTxvTnwP8HHKjRCJDClKbciiYS7p0DQ==} engines: {node: '>=16'} - dev: false - /commander@2.20.3: - resolution: {integrity: sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==} + /commander@2.20.0: + resolution: {integrity: sha512-7j2y+40w61zy6YC2iRNpUe/NwhNyoXrYpHMrSunaMG64nRnaf96zO/KMQR4OyN/UnE5KLyEBnKHd4aG3rskjpQ==} /commander@4.1.1: resolution: {integrity: sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==} @@ -5643,6 +6276,22 @@ packages: /concat-map@0.0.1: resolution: {integrity: sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==} + /conf@10.2.0: + resolution: {integrity: sha512-8fLl9F04EJqjSqH+QjITQfJF8BrOVaYr1jewVgSRAEWePfxT0sku4w2hrGQ60BC/TNLGQ2pgxNlTbWQmMPFvXg==} + engines: {node: '>=12'} + dependencies: + ajv: 8.12.0 + ajv-formats: 2.1.1(ajv@8.12.0) + atomically: 1.7.0 + debounce-fn: 4.0.0 + dot-prop: 6.0.1 + env-paths: 2.2.1 + json-schema-typed: 7.0.3 + onetime: 5.1.2 + pkg-up: 3.1.0 + semver: 7.5.4 + dev: true + /configstore@5.0.1: resolution: {integrity: sha512-aMKprgk5YhBNyH25hj8wGt2+D52Sw1DRRIzqBwLp2Ya9mFmY8KPvvtvmna8SxVR9JMZ4kzMD68N22vlaRpkeFA==} engines: {node: '>=8'} @@ -5741,6 +6390,12 @@ packages: /core-js-pure@3.33.0: resolution: {integrity: sha512-FKSIDtJnds/YFIEaZ4HszRX7hkxGpNKM7FC9aJ9WLJbSd3lD4vOltFuVIBLR8asSx9frkTSqL0dw90SKQxgKrg==} requiresBuild: true + dev: false + + /core-js-pure@3.33.2: + resolution: {integrity: sha512-a8zeCdyVk7uF2elKIGz67AjcXOxjRbwOLz8SbklEso1V+2DoW4OkAMZN9S9GBgvZIaqQi/OemFX4OiSoQEmg1Q==} + requiresBuild: true + dev: true /core-js@3.33.0: resolution: {integrity: sha512-HoZr92+ZjFEKar5HS6MC776gYslNOKHt75mEBKWKnPeFDpZ6nH5OeF3S6HFT1mUAUZKrzkez05VboaX8myjSuw==} @@ -5817,7 +6472,7 @@ packages: sha.js: 2.4.11 dev: true - /create-jest@29.7.0(@types/node@18.18.7): + /create-jest@29.7.0(@types/node@18.18.12): resolution: {integrity: sha512-Adz2bdH0Vq3F53KEMJOoftQFutWCukm6J24wbPWRO4k1kMY7gS7ds/uoJkNuV8wDCtWWnuwGcJwpWcih+zEW1Q==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} hasBin: true @@ -5826,7 +6481,7 @@ packages: chalk: 4.1.2 exit: 0.1.2 graceful-fs: 4.2.11 - jest-config: 29.7.0(@types/node@18.18.7) + jest-config: 29.7.0(@types/node@18.18.12) jest-util: 29.7.0 prompts: 2.4.2 transitivePeerDependencies: @@ -5854,7 +6509,7 @@ packages: lru-cache: 4.1.5 shebang-command: 1.2.0 which: 1.3.1 - dev: false + dev: true /cross-spawn@7.0.3: resolution: {integrity: sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==} @@ -5872,7 +6527,7 @@ packages: resolution: {integrity: sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==} dependencies: browserify-cipher: 1.0.1 - browserify-sign: 4.2.1 + browserify-sign: 4.2.2 create-ecdh: 4.0.4 create-hash: 1.2.0 create-hmac: 1.1.7 @@ -5884,6 +6539,10 @@ packages: randomfill: 1.0.4 dev: true + /crypto-js@4.2.0: + resolution: {integrity: sha512-KALDyEYgpY+Rlob/iriUtjV6d5Eq+Y191A5g4UqLAi8CyGP9N1+FdVbkc1SxKc2r4YAYqG8JzO2KGL+AizD70Q==} + dev: false + /crypto-random-string@2.0.0: resolution: {integrity: sha512-v1plID3y9r/lPhviJ1wrXpLeyUIGAZ2SHNYTEapm7/8A9nLPoyvVp3RK/EPFqn5kEznyWgYZNsRtYYIWbuG8KA==} engines: {node: '>=8'} @@ -6075,15 +6734,15 @@ packages: /csv-generate@3.4.3: resolution: {integrity: sha512-w/T+rqR0vwvHqWs/1ZyMDWtHHSJaN06klRqJXBEpDJaM/+dZkso0OKh1VcuuYvK3XM53KysVNq8Ko/epCK8wOw==} - dev: false + dev: true /csv-parse@4.16.3: resolution: {integrity: sha512-cO1I/zmz4w2dcKHVvpCr7JVRu8/FymG5OEpmvsZYlccYolPBLoVGKUHgNoc4ZGkFeFlWGEDmMyBM+TTqRdW/wg==} - dev: false + dev: true /csv-stringify@5.6.5: resolution: {integrity: sha512-PjiQ659aQ+fUTQqSrd1XEDnOr52jh30RBurfzkscaE2tPaFsDH5wOAHJiw8XAHphRknCwMUE9KRayc4K/NbO8A==} - dev: false + dev: true /csv@5.5.3: resolution: {integrity: sha512-QTaY0XjjhTQOdguARF0lGKm5/mEq9PD9/VhZZegHDIBq2tQwgNpHc3dneD4mGo2iJs+fTKv5Bp0fZ+BRuY3Z0g==} @@ -6093,7 +6752,7 @@ packages: csv-parse: 4.16.3 csv-stringify: 5.6.5 stream-transform: 2.1.3 - dev: false + dev: true /damerau-levenshtein@1.0.8: resolution: {integrity: sha512-sdQSFB7+llfUcQHUQO3+B8ERRj0Oa4w9POWMI/puGtuf7gFywGmkaLCElnudfTiKZV+NvHqL0ifzdrI8Ro7ESA==} @@ -6104,6 +6763,13 @@ packages: engines: {node: '>= 14'} dev: true + /debounce-fn@4.0.0: + resolution: {integrity: sha512-8pYCQiL9Xdcg0UPSD3d+0KMlOjp+KGU5EPwYddgzQ7DATsg4fuUDjQtsYLmWjnk2obnNHgV3vE2Y4jejSOJVBQ==} + engines: {node: '>=10'} + dependencies: + mimic-fn: 3.1.0 + dev: true + /debug@2.6.9: resolution: {integrity: sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==} peerDependencies: @@ -6143,12 +6809,12 @@ packages: dependencies: decamelize: 1.2.0 map-obj: 1.0.1 - dev: false + dev: true /decamelize@1.2.0: resolution: {integrity: sha512-z2S+W9X73hAUUki+N+9Za2lBlun89zigOyGrsax+KUQ6wKW4ZoWpEYBkGhQjwAjjDCkWxhY0VKEhk8wzY7F5cA==} engines: {node: '>=0.10.0'} - dev: false + dev: true /decompress-response@3.3.0: resolution: {integrity: sha512-BzRPQuY1ip+qDonAOz42gRm/pg9F768C+npV/4JOsxRC2sq+Rlk+Q4ZCAsOhnIaMrgarILY+RMUIvMmmX1qAEA==} @@ -6157,6 +6823,20 @@ packages: mimic-response: 1.0.1 dev: false + /decompress-response@5.0.0: + resolution: {integrity: sha512-TLZWWybuxWgoW7Lykv+gq9xvzOsUjQ9tF09Tj6NSTYGMTCHNXzrPnD6Hi+TgZq19PyTAGH4Ll/NIM/eTGglnMw==} + engines: {node: '>=10'} + dependencies: + mimic-response: 2.1.0 + dev: true + + /decompress-response@6.0.0: + resolution: {integrity: sha512-aW35yZM6Bb/4oJlZncMH2LCoZtJXTRxES17vE3hoRiowU2kWHaJKFkSBDnDR+cm9J+9QhXmREyIfv0pji9ejCQ==} + engines: {node: '>=10'} + dependencies: + mimic-response: 3.1.0 + dev: false + /dedent@1.5.1: resolution: {integrity: sha512-+LxW+KLWxu3HW3M2w2ympwtqPrqYRzU8fqi6Fhd18fBALe15blJPI/I4+UHveMVG6lJqB4JNd4UG0S5cnVHwIg==} peerDependencies: @@ -6170,9 +6850,9 @@ packages: resolution: {integrity: sha512-lKdkdV6EOGoVn65XaOsPdH4rMxTZOnmFyuIkMjM1i5HHCbfjC97dawgTAy0deYNfuqUqW+Q5VrVaQYtUpSd6yQ==} dependencies: array-buffer-byte-length: 1.0.0 - call-bind: 1.0.2 + call-bind: 1.0.5 es-get-iterator: 1.1.3 - get-intrinsic: 1.2.1 + get-intrinsic: 1.2.2 is-arguments: 1.1.1 is-array-buffer: 3.0.2 is-date-object: 1.0.5 @@ -6186,7 +6866,7 @@ packages: side-channel: 1.0.4 which-boxed-primitive: 1.0.2 which-collection: 1.0.1 - which-typed-array: 1.1.11 + which-typed-array: 1.1.13 dev: false /deep-extend@0.6.0: @@ -6229,19 +6909,33 @@ packages: resolution: {integrity: sha512-eFuaLoy/Rxalv2kr+lqMlUnrDWV+3j4pljOIJgLIhI058IQfWJ7vXhyEIHu+HtC738klGALYxOKDO0bQP3tg8A==} dependencies: clone: 1.0.4 + dev: true /defer-to-connect@1.1.3: resolution: {integrity: sha512-0ISdNousHvZT2EiFlZeZAHBUvSxmKswVCEf8hW7KWgG4a8MVEu/3Vb6uWYozkjylyCxe0JBIiRB1jV45S70WVQ==} dev: false + /defer-to-connect@2.0.1: + resolution: {integrity: sha512-4tvttepXG1VaYGrRibk5EwJd1t4udunSOVMdLSAL6mId1ix438oPwPZMALY41FCijukO1L0twNcGsdzS7dHgDg==} + engines: {node: '>=10'} + dev: true + /define-data-property@1.1.0: resolution: {integrity: sha512-UzGwzcjyv3OtAvolTj1GoyNYzfFR+iqbGjcnBEENZVCpM4/Ng1yhGNvS3lR/xDS74Tb2wGG9WzNSNIOS9UVb2g==} engines: {node: '>= 0.4'} dependencies: - get-intrinsic: 1.2.1 + get-intrinsic: 1.2.2 gopd: 1.0.1 has-property-descriptors: 1.0.0 + /define-data-property@1.1.1: + resolution: {integrity: sha512-E7uGkTzkk1d0ByLeSc6ZsFS79Axg+m1P/VsgYsxHgiuc3tFSj+MjMIwe90FC4lOAZzNBdY7kkO2P2wKdsQ1vgQ==} + engines: {node: '>= 0.4'} + dependencies: + get-intrinsic: 1.2.2 + gopd: 1.0.1 + has-property-descriptors: 1.0.1 + /define-lazy-prop@2.0.0: resolution: {integrity: sha512-Ds09qNh8yw3khSjiJjiUInaGX9xlqZDY7JVryGxdxV7NPeuqQfplOpQ66yJFZut3jLa5zOwkXw1g9EI2uKh4Og==} engines: {node: '>=8'} @@ -6258,7 +6952,6 @@ packages: dependencies: has-property-descriptors: 1.0.0 object-keys: 1.1.1 - dev: false /define-properties@1.2.1: resolution: {integrity: sha512-8QmQKqEASLd5nx0U1B1okLElbUuuttJ/AnYmRXbbbGDWh6uS208EjD4Xqq/I9wK7u0v6O08XhTWnt5XtEbR6Dg==} @@ -6341,6 +7034,11 @@ packages: /detect-indent@6.1.0: resolution: {integrity: sha512-reYkTUJAZb9gUuZ2RvVCNhVHdg62RHnJ7WJl8ftMi4diZ6NWlciOzQN88pUhSELEwflJht4oQDv0F0BMlwaYtA==} engines: {node: '>=8'} + dev: true + + /detect-libc@2.0.2: + resolution: {integrity: sha512-UX6sGumvvqSaXgdKGUsgZWqcUyIXZ/vZTrlRT/iobiKhGL0zL4d3osHj3uqllWJK+i+sixDS/3COVEOFbupFyw==} + engines: {node: '>=8'} dev: false /detect-newline@3.1.0: @@ -6464,8 +7162,8 @@ packages: entities: 4.5.0 dev: false - /domain-browser@4.22.0: - resolution: {integrity: sha512-IGBwjF7tNk3cwypFNH/7bfzBcgSCbaMOD3GsaY1AU/JRrnHnYgEM0+9kQt52iZxjNsjBtJYtao146V+f8jFZNw==} + /domain-browser@4.23.0: + resolution: {integrity: sha512-ArzcM/II1wCCujdCNyQjXrAFwS4mrLh4C7DZWlaI8mdh7h3BfKdNd3bKXITfl2PT9FtfQqaGvhi1vPRQPimjGA==} engines: {node: '>=10'} dev: true @@ -6523,6 +7221,18 @@ packages: is-obj: 2.0.0 dev: false + /dot-prop@6.0.1: + resolution: {integrity: sha512-tE7ztYzXHIeyvc7N+hR3oi7FIbf/NIjVP9hmAt3yMXzrQ072/fpjGLx2GxNxGxUl5V73MEqYzioOMoVhGMJ5cA==} + engines: {node: '>=10'} + dependencies: + is-obj: 2.0.0 + dev: true + + /dotenv@16.3.1: + resolution: {integrity: sha512-IPzF4w4/Rd94bA9imS68tZBaYyBWSCE47V1RGuMrB94iyTOIEwRmVL2x/4An+6mETpLrKJ5hQkB8W4kFAadeIQ==} + engines: {node: '>=12'} + dev: false + /duck@0.1.12: resolution: {integrity: sha512-wkctla1O6VfP89gQ+J/yDesM0S7B7XLXjKGzXxMDVFg7uEn706niAtyYovKbyq1oT9YwDcly721/iUWoc8MVRg==} dependencies: @@ -6531,7 +7241,6 @@ packages: /duplexer3@0.1.5: resolution: {integrity: sha512-1A8za6ws41LQgv9HrE/66jyC5yuSjQ3L/KOpFtoBilsAK2iA2wuS5rTt1OCzIvtS2V7nVmedsUU+DGRcjBmOYA==} - dev: false /duplexer@0.1.2: resolution: {integrity: sha512-jtD6YG370ZCIi/9GTaJKQxWTZD045+4R4hTk/x1UyoqadyJ9x9CgSi1RlVDQF8U2sxLLSnFkCaMihqljHIWgMg==} @@ -6539,7 +7248,6 @@ packages: /eastasianwidth@0.2.0: resolution: {integrity: sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA==} - dev: false /ee-first@1.1.1: resolution: {integrity: sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==} @@ -6573,7 +7281,6 @@ packages: /emoji-regex@9.2.2: resolution: {integrity: sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==} - dev: false /emojis-list@3.0.0: resolution: {integrity: sha512-/kyM18EfinwXZbno9FyUGeFh87KC8HRQBQGildHZbEuRyWFOmv1U10o9BBp8XVZDVNNuQKyIGIu5ZYAAXJ0V2Q==} @@ -6599,7 +7306,6 @@ packages: resolution: {integrity: sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==} dependencies: once: 1.4.0 - dev: false /enhanced-resolve@5.13.0: resolution: {integrity: sha512-eyV8f0y1+bzyfh8xAwW/WTSZpLbjhqc4ne9eGSH4Zo2ejdyiNG9pU6mf9DG8a7+Auk6MFTlNOT4Y2y/9k8GKVg==} @@ -6622,7 +7328,7 @@ packages: dependencies: ansi-colors: 4.1.3 strip-ansi: 6.0.1 - dev: false + dev: true /entities@2.2.0: resolution: {integrity: sha512-p92if5Nz619I0w+akJrLZH0MX0Pb5DX39XOwQTtXSdQQOaYH03S1uIQp4mhOZtAXrxq4ViO67YTiLBo2638o9A==} @@ -6633,6 +7339,11 @@ packages: engines: {node: '>=0.12'} dev: false + /env-paths@2.2.1: + resolution: {integrity: sha512-+h1lkLKhZMTYjog1VEpJNG7NZJWcuc2DDk/qsqSTRRCOXiLjeQ1d1/udrUGhqMxUgAlwKNZ0cf2uqan5GLuS2A==} + engines: {node: '>=6'} + dev: true + /error-ex@1.3.2: resolution: {integrity: sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==} dependencies: @@ -6678,26 +7389,26 @@ packages: which-typed-array: 1.1.11 dev: false - /es-abstract@1.22.2: - resolution: {integrity: sha512-YoxfFcDmhjOgWPWsV13+2RNjq1F6UQnfs+8TftwNqtzlmFzEXvlUwdrNrYeaizfjQzRMxkZ6ElWMOJIFKdVqwA==} + /es-abstract@1.22.3: + resolution: {integrity: sha512-eiiY8HQeYfYH2Con2berK+To6GrK2RxbPawDkGq4UiCQQfZHb6wX9qQqkbpPqaxQFcl8d9QzZqo0tGE0VcrdwA==} engines: {node: '>= 0.4'} dependencies: array-buffer-byte-length: 1.0.0 arraybuffer.prototype.slice: 1.0.2 available-typed-arrays: 1.0.5 - call-bind: 1.0.2 - es-set-tostringtag: 2.0.1 + call-bind: 1.0.5 + es-set-tostringtag: 2.0.2 es-to-primitive: 1.2.1 function.prototype.name: 1.1.6 - get-intrinsic: 1.2.1 + get-intrinsic: 1.2.2 get-symbol-description: 1.0.0 globalthis: 1.0.3 gopd: 1.0.1 - has: 1.0.4 - has-property-descriptors: 1.0.0 + has-property-descriptors: 1.0.1 has-proto: 1.0.1 has-symbols: 1.0.3 - internal-slot: 1.0.5 + hasown: 2.0.0 + internal-slot: 1.0.6 is-array-buffer: 3.0.2 is-callable: 1.2.7 is-negative-zero: 2.0.2 @@ -6706,7 +7417,7 @@ packages: is-string: 1.0.7 is-typed-array: 1.1.12 is-weakref: 1.0.2 - object-inspect: 1.12.3 + object-inspect: 1.13.1 object-keys: 1.1.1 object.assign: 4.1.4 regexp.prototype.flags: 1.5.1 @@ -6720,14 +7431,14 @@ packages: typed-array-byte-offset: 1.0.0 typed-array-length: 1.0.4 unbox-primitive: 1.0.2 - which-typed-array: 1.1.11 - dev: false + which-typed-array: 1.1.13 + dev: true /es-get-iterator@1.1.3: resolution: {integrity: sha512-sPZmqHBe6JIiTfN5q2pEi//TwxmAFHwj/XEuYjTuse78i8KxaqMTTzxPoFKuzRpDpTJ+0NAbpfenkmH2rePtuw==} dependencies: - call-bind: 1.0.2 - get-intrinsic: 1.2.1 + call-bind: 1.0.5 + get-intrinsic: 1.2.2 has-symbols: 1.0.3 is-arguments: 1.1.1 is-map: 2.0.2 @@ -6740,6 +7451,10 @@ packages: /es-module-lexer@1.3.1: resolution: {integrity: sha512-JUFAyicQV9mXc3YRxPnDlrfBKpqt6hUYzz9/boprUJHs4e4KVr3XwOF70doO6gwXUor6EWZJAyWAfKki84t20Q==} + /es-module-lexer@1.4.1: + resolution: {integrity: sha512-cXLGjP0c4T3flZJKQSuziYoq7MlT+rnvfZjfp7h+I7K9BNX54kP9nyWvdbwjQ4u1iWbOL4u96fgeZLToQlZC7w==} + dev: false + /es-set-tostringtag@2.0.1: resolution: {integrity: sha512-g3OMbtlwY3QewlqAiMLI47KywjWZoEytKr8pf6iTC8uJq5bIAH52Z9pnQ8pVL6whrCto53JZDuUIsifGeLorTg==} engines: {node: '>= 0.4'} @@ -6749,12 +7464,27 @@ packages: has-tostringtag: 1.0.0 dev: false + /es-set-tostringtag@2.0.2: + resolution: {integrity: sha512-BuDyupZt65P9D2D2vA/zqcI3G5xRsklm5N3xCwuiy+/vKy8i0ifdsQP1sLgO4tZDSCaQUSnmC48khknGMV3D2Q==} + engines: {node: '>= 0.4'} + dependencies: + get-intrinsic: 1.2.2 + has-tostringtag: 1.0.0 + hasown: 2.0.0 + dev: true + /es-shim-unscopables@1.0.0: resolution: {integrity: sha512-Jm6GPcCdC30eMLbZ2x8z2WuRwAws3zTBBKuusffYVUrNj/GVSUAZ+xKMaUpfNDR5IbyNA5LJbaecoUVbmUcB1w==} dependencies: has: 1.0.3 dev: false + /es-shim-unscopables@1.0.2: + resolution: {integrity: sha512-J3yBRXCzDu4ULnQwxyToo/OjdMx6akgVC7K6few0a7F/0wLtmKKN7I73AH5T2836UuXRqN7Qg+IIUw/+YJksRw==} + dependencies: + hasown: 2.0.0 + dev: true + /es-to-primitive@1.2.1: resolution: {integrity: sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==} engines: {node: '>= 0.4'} @@ -6762,7 +7492,6 @@ packages: is-callable: 1.2.7 is-date-object: 1.0.5 is-symbol: 1.0.4 - dev: false /esbuild@0.18.20: resolution: {integrity: sha512-ceqxoedUrcayh7Y7ZX6NdbbDzGROiyVBgC4PriJThBKSVPWnnFHZAkfI1lJT8QFkOwH4qOS2SJkS4wvpGl8BpA==} @@ -6832,7 +7561,7 @@ packages: source-map: 0.6.1 dev: true - /eslint-config-next@13.4.1(eslint@8.52.0)(typescript@5.2.2): + /eslint-config-next@13.4.1(eslint@8.54.0)(typescript@5.3.2): resolution: {integrity: sha512-ajuxjCkW1hvirr0EQZb3/B/bFH52Z7CT89uCtTcICFL9l30i5c8hN4p0LXvTjdOXNPV5fEDcxBgGHgXdzTj1/A==} peerDependencies: eslint: ^7.23.0 || ^8.0.0 @@ -6843,36 +7572,36 @@ packages: dependencies: '@next/eslint-plugin-next': 13.4.1 '@rushstack/eslint-patch': 1.2.0 - '@typescript-eslint/parser': 5.59.2(eslint@8.52.0)(typescript@5.2.2) - eslint: 8.52.0 + '@typescript-eslint/parser': 5.59.2(eslint@8.54.0)(typescript@5.3.2) + eslint: 8.54.0 eslint-import-resolver-node: 0.3.7 - eslint-import-resolver-typescript: 3.5.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-plugin-import@2.27.5)(eslint@8.52.0) - eslint-plugin-import: 2.27.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-typescript@3.5.5)(eslint@8.52.0) - eslint-plugin-jsx-a11y: 6.7.1(eslint@8.52.0) - eslint-plugin-react: 7.32.2(eslint@8.52.0) - eslint-plugin-react-hooks: 4.6.0(eslint@8.52.0) - typescript: 5.2.2 + eslint-import-resolver-typescript: 3.5.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-plugin-import@2.27.5)(eslint@8.54.0) + eslint-plugin-import: 2.27.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-typescript@3.5.5)(eslint@8.54.0) + eslint-plugin-jsx-a11y: 6.7.1(eslint@8.54.0) + eslint-plugin-react: 7.32.2(eslint@8.54.0) + eslint-plugin-react-hooks: 4.6.0(eslint@8.54.0) + typescript: 5.3.2 transitivePeerDependencies: - eslint-import-resolver-webpack - supports-color dev: false - /eslint-config-prettier@8.8.0(eslint@8.52.0): + /eslint-config-prettier@8.8.0(eslint@8.54.0): resolution: {integrity: sha512-wLbQiFre3tdGgpDv67NQKnJuTlcUVYHas3k+DZCc2U2BadthoEY4B7hLPvAxaqdyOGCzuLfii2fqGph10va7oA==} hasBin: true peerDependencies: eslint: '>=7.0.0' dependencies: - eslint: 8.52.0 + eslint: 8.54.0 dev: false - /eslint-config-turbo@1.9.3(eslint@8.52.0): + /eslint-config-turbo@1.9.3(eslint@8.54.0): resolution: {integrity: sha512-QG6jxFQkrGSpQqlFKefPdtgUfr20EbU0s4tGGIuGFOcPuJEdsY6VYZpZUxNJvmMcTGqPgMyOPjAFBKhy/DPHLA==} peerDependencies: eslint: '>6.6.0' dependencies: - eslint: 8.52.0 - eslint-plugin-turbo: 1.9.3(eslint@8.52.0) + eslint: 8.54.0 + eslint-plugin-turbo: 1.9.3(eslint@8.54.0) dev: false /eslint-import-resolver-node@0.3.7: @@ -6885,7 +7614,7 @@ packages: - supports-color dev: false - /eslint-import-resolver-typescript@3.5.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-plugin-import@2.27.5)(eslint@8.52.0): + /eslint-import-resolver-typescript@3.5.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-plugin-import@2.27.5)(eslint@8.54.0): resolution: {integrity: sha512-TdJqPHs2lW5J9Zpe17DZNQuDnox4xo2o+0tE7Pggain9Rbc19ik8kFtXdxZ250FVx2kF4vlt2RSf4qlUpG7bhw==} engines: {node: ^14.18.0 || >=16.0.0} peerDependencies: @@ -6894,9 +7623,9 @@ packages: dependencies: debug: 4.3.4 enhanced-resolve: 5.13.0 - eslint: 8.52.0 - eslint-module-utils: 2.8.0(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-import-resolver-typescript@3.5.5)(eslint@8.52.0) - eslint-plugin-import: 2.27.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-typescript@3.5.5)(eslint@8.52.0) + eslint: 8.54.0 + eslint-module-utils: 2.8.0(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-import-resolver-typescript@3.5.5)(eslint@8.54.0) + eslint-plugin-import: 2.27.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-typescript@3.5.5)(eslint@8.54.0) get-tsconfig: 4.5.0 globby: 13.1.4 is-core-module: 2.12.0 @@ -6909,7 +7638,7 @@ packages: - supports-color dev: false - /eslint-module-utils@2.8.0(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-import-resolver-typescript@3.5.5)(eslint@8.52.0): + /eslint-module-utils@2.8.0(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-import-resolver-typescript@3.5.5)(eslint@8.54.0): resolution: {integrity: sha512-aWajIYfsqCKRDgUfjEXNN/JlrzauMuSEy5sbd7WXbtW3EH6A6MpwEh42c7qD+MqQo9QMJ6fWLAeIJynx0g6OAw==} engines: {node: '>=4'} peerDependencies: @@ -6930,16 +7659,16 @@ packages: eslint-import-resolver-webpack: optional: true dependencies: - '@typescript-eslint/parser': 5.59.2(eslint@8.52.0)(typescript@5.2.2) + '@typescript-eslint/parser': 5.59.2(eslint@8.54.0)(typescript@5.3.2) debug: 3.2.7 - eslint: 8.52.0 + eslint: 8.54.0 eslint-import-resolver-node: 0.3.7 - eslint-import-resolver-typescript: 3.5.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-plugin-import@2.27.5)(eslint@8.52.0) + eslint-import-resolver-typescript: 3.5.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-plugin-import@2.27.5)(eslint@8.54.0) transitivePeerDependencies: - supports-color dev: false - /eslint-plugin-import@2.27.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-typescript@3.5.5)(eslint@8.52.0): + /eslint-plugin-import@2.27.5(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-typescript@3.5.5)(eslint@8.54.0): resolution: {integrity: sha512-LmEt3GVofgiGuiE+ORpnvP+kAm3h6MLZJ4Q5HCyHADofsb4VzXFsRiWj3c0OFiV+3DWFh0qg3v9gcPlfc3zRow==} engines: {node: '>=4'} peerDependencies: @@ -6949,22 +7678,22 @@ packages: '@typescript-eslint/parser': optional: true dependencies: - '@typescript-eslint/parser': 5.59.2(eslint@8.52.0)(typescript@5.2.2) + '@typescript-eslint/parser': 5.59.2(eslint@8.54.0)(typescript@5.3.2) array-includes: 3.1.6 array.prototype.flat: 1.3.1 array.prototype.flatmap: 1.3.1 debug: 3.2.7 doctrine: 2.1.0 - eslint: 8.52.0 + eslint: 8.54.0 eslint-import-resolver-node: 0.3.7 - eslint-module-utils: 2.8.0(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-import-resolver-typescript@3.5.5)(eslint@8.52.0) + eslint-module-utils: 2.8.0(@typescript-eslint/parser@5.59.2)(eslint-import-resolver-node@0.3.7)(eslint-import-resolver-typescript@3.5.5)(eslint@8.54.0) has: 1.0.3 is-core-module: 2.12.0 is-glob: 4.0.3 minimatch: 3.1.2 object.values: 1.1.6 resolve: 1.22.4 - semver: 6.3.0 + semver: 6.3.1 tsconfig-paths: 3.14.2 transitivePeerDependencies: - eslint-import-resolver-typescript @@ -6972,7 +7701,7 @@ packages: - supports-color dev: false - /eslint-plugin-jsx-a11y@6.7.1(eslint@8.52.0): + /eslint-plugin-jsx-a11y@6.7.1(eslint@8.54.0): resolution: {integrity: sha512-63Bog4iIethyo8smBklORknVjB0T2dwB8Mr/hIC+fBS0uyHdYYpzM/Ed+YC8VxTjlXHEWFOdmgwcDn1U2L9VCA==} engines: {node: '>=4.0'} peerDependencies: @@ -6987,26 +7716,26 @@ packages: axobject-query: 3.1.1 damerau-levenshtein: 1.0.8 emoji-regex: 9.2.2 - eslint: 8.52.0 + eslint: 8.54.0 has: 1.0.3 jsx-ast-utils: 3.3.3 language-tags: 1.0.5 minimatch: 3.1.2 object.entries: 1.1.6 object.fromentries: 2.0.6 - semver: 6.3.0 + semver: 6.3.1 dev: false - /eslint-plugin-react-hooks@4.6.0(eslint@8.52.0): + /eslint-plugin-react-hooks@4.6.0(eslint@8.54.0): resolution: {integrity: sha512-oFc7Itz9Qxh2x4gNHStv3BqJq54ExXmfC+a1NjAta66IAN87Wu0R/QArgIS9qKzX3dXKPI9H5crl9QchNMY9+g==} engines: {node: '>=10'} peerDependencies: eslint: ^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0 dependencies: - eslint: 8.52.0 + eslint: 8.54.0 dev: false - /eslint-plugin-react@7.28.0(eslint@8.52.0): + /eslint-plugin-react@7.28.0(eslint@8.54.0): resolution: {integrity: sha512-IOlFIRHzWfEQQKcAD4iyYDndHwTQiCMcJVJjxempf203jnNLUnW34AXLrV33+nEXoifJE2ZEGmcjKPL8957eSw==} engines: {node: '>=4'} peerDependencies: @@ -7015,7 +7744,7 @@ packages: array-includes: 3.1.6 array.prototype.flatmap: 1.3.1 doctrine: 2.1.0 - eslint: 8.52.0 + eslint: 8.54.0 estraverse: 5.3.0 jsx-ast-utils: 3.3.3 minimatch: 3.1.2 @@ -7029,7 +7758,7 @@ packages: string.prototype.matchall: 4.0.8 dev: false - /eslint-plugin-react@7.32.2(eslint@8.52.0): + /eslint-plugin-react@7.32.2(eslint@8.54.0): resolution: {integrity: sha512-t2fBMa+XzonrrNkyVirzKlvn5RXzzPwRHtMvLAtVZrt8oxgnTQaYbU6SXTOO1mwQgp1y5+toMSKInnzGr0Knqg==} engines: {node: '>=4'} peerDependencies: @@ -7039,7 +7768,7 @@ packages: array.prototype.flatmap: 1.3.1 array.prototype.tosorted: 1.1.1 doctrine: 2.1.0 - eslint: 8.52.0 + eslint: 8.54.0 estraverse: 5.3.0 jsx-ast-utils: 3.3.3 minimatch: 3.1.2 @@ -7049,16 +7778,16 @@ packages: object.values: 1.1.6 prop-types: 15.8.1 resolve: 2.0.0-next.4 - semver: 6.3.0 + semver: 6.3.1 string.prototype.matchall: 4.0.8 dev: false - /eslint-plugin-turbo@1.9.3(eslint@8.52.0): + /eslint-plugin-turbo@1.9.3(eslint@8.54.0): resolution: {integrity: sha512-ZsRtksdzk3v+z5/I/K4E50E4lfZ7oYmLX395gkrUMBz4/spJlYbr+GC8hP9oVNLj9s5Pvnm9rLv/zoj5PVYaVw==} peerDependencies: eslint: '>6.6.0' dependencies: - eslint: 8.52.0 + eslint: 8.54.0 dev: false /eslint-scope@5.1.1: @@ -7075,24 +7804,19 @@ packages: esrecurse: 4.3.0 estraverse: 5.3.0 - /eslint-visitor-keys@3.4.0: - resolution: {integrity: sha512-HPpKPUBQcAsZOsHAFwTtIKcYlCje62XB7SEAcxjtmW6TD1WVpkS6i6/hOVtTZIl4zGj/mBqpFVGvaDneik+VoQ==} - engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} - dev: false - /eslint-visitor-keys@3.4.3: resolution: {integrity: sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} - /eslint@8.52.0: - resolution: {integrity: sha512-zh/JHnaixqHZsolRB/w9/02akBk9EPrOs9JwcTP2ek7yL5bVvXuRariiaAjjoJ5DvuwQ1WAE/HsMz+w17YgBCg==} + /eslint@8.54.0: + resolution: {integrity: sha512-NY0DfAkM8BIZDVl6PgSa1ttZbx3xHgJzSNJKYcQglem6CppHyMhRIQkBVSSMaSRnLhig3jsDbEzOjwCVt4AmmA==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} hasBin: true dependencies: - '@eslint-community/eslint-utils': 4.4.0(eslint@8.52.0) + '@eslint-community/eslint-utils': 4.4.0(eslint@8.54.0) '@eslint-community/regexpp': 4.10.0 - '@eslint/eslintrc': 2.1.2 - '@eslint/js': 8.52.0 + '@eslint/eslintrc': 2.1.3 + '@eslint/js': 8.54.0 '@humanwhocodes/config-array': 0.11.13 '@humanwhocodes/module-importer': 1.0.1 '@nodelib/fs.walk': 1.2.8 @@ -7134,8 +7858,8 @@ packages: resolution: {integrity: sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==} engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0} dependencies: - acorn: 8.10.0 - acorn-jsx: 5.3.2(acorn@8.10.0) + acorn: 8.11.2 + acorn-jsx: 5.3.2(acorn@8.11.2) eslint-visitor-keys: 3.4.3 /esprima@4.0.1: @@ -7181,7 +7905,7 @@ packages: resolution: {integrity: sha512-EzV94NYKoO09GLXGjXj9JIlXijVck4ONSr5wiCWDvhsvj5jxSrzTmRU/9C1DyB6uToszLs8aifA6NQ7lEQdvFw==} engines: {node: '>= 0.8'} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 require-like: 0.1.2 dev: false @@ -7194,6 +7918,10 @@ packages: resolution: {integrity: sha512-8guHBZCwKnFhYdHr2ysuRWErTwhoN2X8XELRlrRwpmfeY2jjuUN4taQMsULKUVo1K4DvZl+0pgfyoysHxvmvEw==} dev: false + /eventemitter3@5.0.1: + resolution: {integrity: sha512-GWkBvjiSZK87ELrYOSESUYeVIc9mvLLf/nXalMOS5dYrgZq9o5OVkbZAVM06CVxYsCwH9BDZFPlQTlPA1j4ahA==} + dev: true + /events@3.3.0: resolution: {integrity: sha512-mQw+2fkQbALzQ7V0MY0IqdnXNOeTtP4r0lN9z7AAawCXgqea7bDii20AYrIBrFd/Hx0M2Ocz6S111CaFkUcb0Q==} engines: {node: '>=0.8.x'} @@ -7234,11 +7962,31 @@ packages: strip-final-newline: 3.0.0 dev: false + /execa@8.0.1: + resolution: {integrity: sha512-VyhnebXciFV2DESc+p6B+y0LjSm0krU4OgJN44qFAhBY0TJ+1V61tYD2+wHusZ6F9n5K+vl8k0sTy7PEfV4qpg==} + engines: {node: '>=16.17'} + dependencies: + cross-spawn: 7.0.3 + get-stream: 8.0.1 + human-signals: 5.0.0 + is-stream: 3.0.0 + merge-stream: 2.0.0 + npm-run-path: 5.1.0 + onetime: 6.0.0 + signal-exit: 4.1.0 + strip-final-newline: 3.0.0 + dev: true + /exit@0.1.2: resolution: {integrity: sha512-Zk/eNKV2zbjpKzrsQ+n1G6poVbErQxJ0LBOJXaKZ1EViLzH+hrLu9cdXI4zw9dBQJslwBEpbQ2P1oS7nDxs6jQ==} engines: {node: '>= 0.8.0'} dev: true + /expand-template@2.0.3: + resolution: {integrity: sha512-XYfuKMvj4O35f/pOXLObndIRvyQ+/+6AhODh+OKWj9S9498pHHn/IMszH+gt0fBCRWMNfk1ZSp5x3AifmnI2vg==} + engines: {node: '>=6'} + dev: false + /expect@29.7.0: resolution: {integrity: sha512-2Zks0hf1VLFYI1kbh0I5jP3KHHyCHpkfyHBzsSXRFgl/Bg9mWYfMW8oD+PdMPlEwy5HNsR9JutYy6pMeOh61nw==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} @@ -7302,7 +8050,7 @@ packages: /extendable-error@0.1.7: resolution: {integrity: sha512-UOiS2in6/Q0FK0R0q6UY9vYpQ21mr/Qn1KOnte7vsACuNJf514WvCCUHSRCPcgjPT2bAhNIJdlE6bVap1GKmeg==} - dev: false + dev: true /external-editor@3.1.0: resolution: {integrity: sha512-hMQ4CX1p1izmuLYyZqLMO/qGNw10wSv9QDCPfzXfyFrOaCSSoRfqE1Kf1s5an66J5JZC62NewG+mK49jOCtQew==} @@ -7311,10 +8059,15 @@ packages: chardet: 0.7.0 iconv-lite: 0.4.24 tmp: 0.0.33 + dev: true /fast-deep-equal@3.1.3: resolution: {integrity: sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==} + /fast-fifo@1.3.2: + resolution: {integrity: sha512-/d9sfos4yxzpwkDkuN7k2SqFKtYNmCTzgfEpz82x34IM9/zc8KGxQoXg1liNC/izpRM/MBdt44Nmx41ZWqk+FQ==} + dev: false + /fast-glob@3.3.1: resolution: {integrity: sha512-kNFPyjhh5cKjrUltxs+wFx+ZkbRaxxmZ+X0ZU31SOsxCEtP9VPgtq2teZw1DebupL5GmDaNQ6yKMMVcM41iqDg==} engines: {node: '>=8.6.0'} @@ -7325,6 +8078,16 @@ packages: merge2: 1.4.1 micromatch: 4.0.5 + /fast-glob@3.3.2: + resolution: {integrity: sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==} + engines: {node: '>=8.6.0'} + dependencies: + '@nodelib/fs.stat': 2.0.5 + '@nodelib/fs.walk': 1.2.8 + glob-parent: 5.1.2 + merge2: 1.4.1 + micromatch: 4.0.5 + /fast-json-stable-stringify@2.1.0: resolution: {integrity: sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==} @@ -7399,7 +8162,7 @@ packages: resolution: {integrity: sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==} engines: {node: ^10.12.0 || >=12.0.0} dependencies: - flat-cache: 3.1.1 + flat-cache: 3.2.0 /file-loader@6.2.0(webpack@5.88.2): resolution: {integrity: sha512-qo3glqyTa61Ytg4u73GultjHGjdRyig3tG6lPtyX/jOEJvHif9uB0/OCI2Kif6ctF3caQTW2G5gym21oAsI4pw==} @@ -7452,7 +8215,6 @@ packages: engines: {node: '>=6'} dependencies: locate-path: 3.0.0 - dev: false /find-up@4.1.0: resolution: {integrity: sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==} @@ -7473,16 +8235,20 @@ packages: dependencies: micromatch: 4.0.5 pkg-dir: 4.2.0 - dev: false + dev: true - /flat-cache@3.1.1: - resolution: {integrity: sha512-/qM2b3LUIaIgviBQovTLvijfyOQXPtSRnRK26ksj2J7rzPIecePUIpJsZ4T02Qg+xiAEKIs5K8dsHEd+VaKa/Q==} - engines: {node: '>=12.0.0'} + /flat-cache@3.2.0: + resolution: {integrity: sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==} + engines: {node: ^10.12.0 || >=12.0.0} dependencies: flatted: 3.2.9 keyv: 4.5.4 rimraf: 3.0.2 + /flatbuffers@1.12.0: + resolution: {integrity: sha512-c7CZADjRcl6j0PlvFy0ZqXQ67qSEZfrVPynmnL+2zPc+NtMvrF8Y0QceMo7QqnSPc7+uWjUIAbvCQ5WIKlMVdQ==} + dev: false + /flatted@3.2.9: resolution: {integrity: sha512-36yxDn5H7OFZQla0/jFJmbIKTdZAQHngCedGxiMmpNfEZM0sdEeT+WczLQrjK6D7o2aiyLYDnkw0R3JK0Qv1RQ==} @@ -7513,7 +8279,7 @@ packages: dependencies: is-callable: 1.2.7 - /fork-ts-checker-webpack-plugin@6.5.3(eslint@8.52.0)(typescript@4.9.5)(webpack@5.88.2): + /fork-ts-checker-webpack-plugin@6.5.3(eslint@8.54.0)(typescript@4.9.5)(webpack@5.88.2): resolution: {integrity: sha512-SbH/l9ikmMWycd5puHJKTkZJKddF4iRLyW3DeZ08HTI7NGyLS38MXd/KGgeWumQO7YNQbW2u/NtPT2YowbPaGQ==} engines: {node: '>=10', yarn: '>=1.0.0'} peerDependencies: @@ -7533,7 +8299,7 @@ packages: chokidar: 3.5.3 cosmiconfig: 6.0.0 deepmerge: 4.3.1 - eslint: 8.52.0 + eslint: 8.54.0 fs-extra: 9.1.0 glob: 7.2.3 memfs: 3.5.3 @@ -7580,13 +8346,17 @@ packages: engines: {node: '>= 0.6'} dev: false + /fs-constants@1.0.0: + resolution: {integrity: sha512-y6OAwoSIf7FyjMIv94u+b5rdheZEjzR63GTyZJm5qh4Bi+2YgwLCcI/fPFZkL5PSixOt6ZNKm+w+Hfp/Bciwow==} + dev: false + /fs-extra@10.1.0: resolution: {integrity: sha512-oRXApq54ETRj4eMiFzGnHWGy+zo5raudjuxN0b8H7s/RU2oW0Wvsx9O0ACRN/kRq9E8Vu/ReskGB5o3ji+FzHQ==} engines: {node: '>=12'} dependencies: graceful-fs: 4.2.11 jsonfile: 6.1.0 - universalify: 2.0.0 + universalify: 2.0.1 /fs-extra@2.1.2: resolution: {integrity: sha512-9ztMtDZtSKC78V8mev+k31qaTabbmuH5jatdvPBMikrFHvw5BqlYnQIn/WGK3WHeRooSTkRvLa2IPlaHjPq5Sg==} @@ -7602,7 +8372,7 @@ packages: graceful-fs: 4.2.11 jsonfile: 4.0.0 universalify: 0.1.2 - dev: false + dev: true /fs-extra@8.1.0: resolution: {integrity: sha512-yhlQgA6mnOJUKOsRUFsgJdQCvkKhcz8tlZG5HBQfReYZy46OwLcY+Zia0mtdHsOo9y/hP+CxMN0TU9QxoOtG4g==} @@ -7611,6 +8381,7 @@ packages: graceful-fs: 4.2.11 jsonfile: 4.0.0 universalify: 0.1.2 + dev: true /fs-extra@9.1.0: resolution: {integrity: sha512-hcg3ZmepS30/7BSFqRvoo3DOMQu7IjqxO5nCDt+zM9XWjb33Wg7ziNT+Qvqbuc3+gWpzO02JubVyk2G4Zvo1OQ==} @@ -7619,9 +8390,16 @@ packages: at-least-node: 1.0.0 graceful-fs: 4.2.11 jsonfile: 6.1.0 - universalify: 2.0.0 + universalify: 2.0.1 dev: false + /fs-minipass@2.1.0: + resolution: {integrity: sha512-V/JgOLFCS+R6Vcq0slCuaeWEdNC3ouDlJMNIsacH2VtALiu9mV4LPrHc5cDl8k5aw6J8jwgWWpiTo5RYhmIzvg==} + engines: {node: '>= 8'} + dependencies: + minipass: 3.3.6 + dev: true + /fs-monkey@1.0.5: resolution: {integrity: sha512-8uMbBjrhzW76TYgEV27Y5E//W2f/lTFmx78P2w19FZSxarhI/798APGQyuGCwmkNxgwGRhrLfvWyLBvNtuOmew==} dev: false @@ -7649,6 +8427,9 @@ packages: /function-bind@1.1.1: resolution: {integrity: sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==} + /function-bind@1.1.2: + resolution: {integrity: sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==} + /function.prototype.name@1.1.5: resolution: {integrity: sha512-uN7m/BzVKQnCUF/iW8jYea67v++2u7m5UgENbHRtdDVclOUP+FMPlCNdmk0h/ysGyo2tavMJEDqJAkJdRa1vMA==} engines: {node: '>= 0.4'} @@ -7663,15 +8444,14 @@ packages: resolution: {integrity: sha512-Z5kx79swU5P27WEayXM1tBi5Ze/lbIyiNgU3qyXUOf9b2rgXYyF9Dy9Cx+IQv/Lc8WCG6L82zwUPpSS9hGehIg==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 - es-abstract: 1.22.2 + es-abstract: 1.22.3 functions-have-names: 1.2.3 - dev: false + dev: true /functions-have-names@1.2.3: resolution: {integrity: sha512-xckBUXyTIqT97tq2x2AMb+g163b5JFysYk0x4qxNFwbfQkmNZoiRHb6sPzI9/QV33WeuvVYBUIiD4NzNIyqaRQ==} - dev: false /gensync@1.0.0-beta.2: resolution: {integrity: sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==} @@ -7680,6 +8460,7 @@ packages: /get-caller-file@2.0.5: resolution: {integrity: sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==} engines: {node: 6.* || 8.* || >= 10.*} + dev: true /get-intrinsic@1.2.0: resolution: {integrity: sha512-L049y6nFOuom5wGyRc3/gdTLO94dySVKRACj1RmJZBQXlbTMhtNIgkWkUHq+jYmZvKf14EW1EoJnnjbmoHij0Q==} @@ -7687,16 +8468,23 @@ packages: function-bind: 1.1.1 has: 1.0.3 has-symbols: 1.0.3 - dev: false /get-intrinsic@1.2.1: resolution: {integrity: sha512-2DcsyfABl+gVHEfCOaTrWgyt+tb6MSEGmKq+kI5HwLbIYgjgmMcV8KQ41uaKz1xxUcn9tJtgFbQUEVcEbd0FYw==} dependencies: - function-bind: 1.1.1 + function-bind: 1.1.2 has: 1.0.3 has-proto: 1.0.1 has-symbols: 1.0.3 + /get-intrinsic@1.2.2: + resolution: {integrity: sha512-0gSo4ml/0j98Y3lngkFEot/zhiCeWsbYIlZ+uZOVgzLyLaUw7wxUL+nCTP0XJvJg1AXulJRI3UJi8GsbDuxdGA==} + dependencies: + function-bind: 1.1.2 + has-proto: 1.0.1 + has-symbols: 1.0.3 + hasown: 2.0.0 + /get-own-enumerable-property-symbols@3.0.2: resolution: {integrity: sha512-I0UBV/XOz1XkIJHEUDMZAbzCThU/H8DxmSfmdGcKPnVhu2VfFqr34jr9777IyaTYvxjedWhqVIilEDsCdP5G6g==} dev: false @@ -7718,19 +8506,22 @@ packages: engines: {node: '>=8'} dependencies: pump: 3.0.0 - dev: false /get-stream@6.0.1: resolution: {integrity: sha512-ts6Wi+2j3jQjqi70w5AlN8DFnkSwC+MqmxEzdEALB2qXZYV3X/b1CTfgPLGJNMeAWxdPfU8FO1ms3NUfaHCPYg==} engines: {node: '>=10'} + /get-stream@8.0.1: + resolution: {integrity: sha512-VaUJspBffn/LMCJVoMvSAdmscJyS1auj5Zulnn5UoYcY531UWmdwhRWkcGKnGU93m5HSXP9LP2usOryrBtQowA==} + engines: {node: '>=16'} + dev: true + /get-symbol-description@1.0.0: resolution: {integrity: sha512-2EmdH1YvIQiZpltCNgkuiUnyukzxM/R6NDJX31Ke3BG1Nq5b0S2PhX59UKi9vZpPDQVdqn+1IcaAwnzTT5vCjw==} engines: {node: '>= 0.4'} dependencies: call-bind: 1.0.2 get-intrinsic: 1.2.0 - dev: false /get-tsconfig@4.5.0: resolution: {integrity: sha512-MjhiaIWCJ1sAU4pIQ5i5OfOuHHxVo1oYeNsWTON7jxYkod8pHocXeh+SSbmu5OZZZK73B6cbJ2XADzXehLyovQ==} @@ -7748,6 +8539,10 @@ packages: - supports-color dev: true + /github-from-package@0.0.0: + resolution: {integrity: sha512-SyHy3T1v2NUXn29OsWdxmK6RwHD+vkj3v8en8AOBZ1wBQ/hCAQ5bAQTD02kW4W9tUp/3Qh6J8r9EvntiyCmOOw==} + dev: false + /github-slugger@1.5.0: resolution: {integrity: sha512-wIh+gKBI9Nshz2o46B0B3f5k/W+WI9ZAv6y5Dn5WJ5SK1t0TnDimB4WE5rmTD05ZAIn8HALCZVmCsvj0w0v0lw==} dev: false @@ -7837,7 +8632,6 @@ packages: engines: {node: '>= 0.4'} dependencies: define-properties: 1.2.0 - dev: false /globby@10.0.2: resolution: {integrity: sha512-7dUi7RvCoT/xast/o/dLN53oqND4yk0nsHkhRgn9w65C4PofCLOoJ39iSOg+qVDdWQPIEj+eszMHQ+aLVwwQSg==} @@ -7846,7 +8640,7 @@ packages: '@types/glob': 7.2.0 array-union: 2.1.0 dir-glob: 3.0.1 - fast-glob: 3.3.1 + fast-glob: 3.3.2 glob: 7.2.3 ignore: 5.2.4 merge2: 1.4.1 @@ -7859,7 +8653,7 @@ packages: dependencies: array-union: 2.1.0 dir-glob: 3.0.1 - fast-glob: 3.3.1 + fast-glob: 3.3.2 ignore: 5.2.4 merge2: 1.4.1 slash: 3.0.0 @@ -7889,7 +8683,30 @@ packages: /gopd@1.0.1: resolution: {integrity: sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==} dependencies: - get-intrinsic: 1.2.1 + get-intrinsic: 1.2.2 + + /got@10.7.0: + resolution: {integrity: sha512-aWTDeNw9g+XqEZNcTjMMZSy7B7yE9toWOFYip7ofFTLleJhvZwUxxTxkTpKvF+p1SAA4VHmuEy7PiHTHyq8tJg==} + engines: {node: '>=10'} + dependencies: + '@sindresorhus/is': 2.1.1 + '@szmarczak/http-timer': 4.0.6 + '@types/cacheable-request': 6.0.3 + '@types/keyv': 3.1.4 + '@types/responselike': 1.0.3 + cacheable-lookup: 2.0.1 + cacheable-request: 7.0.4 + decompress-response: 5.0.0 + duplexer3: 0.1.5 + get-stream: 5.2.0 + lowercase-keys: 2.0.0 + mimic-response: 2.1.0 + p-cancelable: 2.1.1 + p-event: 4.2.0 + responselike: 2.0.1 + to-readable-stream: 2.1.0 + type-fest: 0.10.0 + dev: true /got@9.6.0: resolution: {integrity: sha512-R7eWptXuGYxwijs0eV+v3o6+XH1IqVK8dJOEecQfTmkncw9AV4dcw/Dhxi8MdlqPthxxpZyizMzyg8RTmEsG+Q==} @@ -7898,7 +8715,7 @@ packages: '@sindresorhus/is': 0.14.0 '@szmarczak/http-timer': 1.1.2 '@types/keyv': 3.1.4 - '@types/responselike': 1.0.1 + '@types/responselike': 1.0.3 cacheable-request: 6.1.0 decompress-response: 3.3.0 duplexer3: 0.1.5 @@ -7923,7 +8740,7 @@ packages: /grapheme-splitter@1.0.4: resolution: {integrity: sha512-bzh50DW9kTPM00T8y4o8vQg89Di9oLJVLW/KaOGIXJWP/iqCN6WKYkbNOF04vFLJhwcpYUh9ydh/+5vpOqV4YQ==} - dev: false + dev: true /graphemer@1.4.0: resolution: {integrity: sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==} @@ -7938,6 +8755,10 @@ packages: strip-bom-string: 1.0.0 dev: false + /guid-typescript@1.0.9: + resolution: {integrity: sha512-Y8T4vYhEfwJOTbouREvG+3XDsjr8E3kIr7uf+JZ0BYloFsttiHU0WfvANVsR7TxNUJa/WpCnw/Ino/p+DeBhBQ==} + dev: false + /gzip-size@6.0.0: resolution: {integrity: sha512-ax7ZYomf6jqPTQ4+XCpUGyXKHk5WweS+e05MBO4/y3WJ5RkmPXNKvX+bx1behVILVwr6JSQvZAku021CHPXG3Q==} engines: {node: '>=10'} @@ -7965,11 +8786,10 @@ packages: /hard-rejection@2.1.0: resolution: {integrity: sha512-VIZB+ibDhx7ObhAe7OVtoEbuP4h/MuOTHJ+J8h/eBXotJYl0fBgR72xDFCKgIh22OJZIOVNxBMWuhAr10r8HdA==} engines: {node: '>=6'} - dev: false + dev: true /has-bigints@1.0.2: resolution: {integrity: sha512-tSvCKtBr9lkF0Ex0aQiP9N+OpV4zi2r/Nee5VkRDbaqv35RLYMzbwQfFSZZH0kR+Rd6302UJZ2p/bJCEoR3VoQ==} - dev: false /has-flag@3.0.0: resolution: {integrity: sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==} @@ -7982,7 +8802,12 @@ packages: /has-property-descriptors@1.0.0: resolution: {integrity: sha512-62DVLZGoiEBDHQyqG4w9xCuZ7eJEwNmJRWw2VY84Oedb7WFcA27fiEVe8oUQx9hAUJ4ekurquucTGwsyO1XGdQ==} dependencies: - get-intrinsic: 1.2.1 + get-intrinsic: 1.2.0 + + /has-property-descriptors@1.0.1: + resolution: {integrity: sha512-VsX8eaIewvas0xnvinAe9bw4WfIeODpGYikiWYLH+dma0Jw6KHYqWiWfhQlgOVK8D6PvjubK5Uc4P0iIhIcNVg==} + dependencies: + get-intrinsic: 1.2.2 /has-proto@1.0.1: resolution: {integrity: sha512-7qE+iP+O+bgF9clE5+UoBFzE65mlBiVj3tKCrlNQ0Ogwm0BjpT/gK4SlLYDMybDh5I3TCTKnPPa0oMG7JDYrhg==} @@ -8009,11 +8834,6 @@ packages: dependencies: function-bind: 1.1.1 - /has@1.0.4: - resolution: {integrity: sha512-qdSAmqLF6209RFj4VVItywPMbm3vWylknmB3nvNiUIs72xAimcM8nVYxYr7ncvZq5qzk9MKIZR8ijqD/1QuYjQ==} - engines: {node: '>= 0.4.0'} - dev: false - /hash-base@3.1.0: resolution: {integrity: sha512-1nmYp/rhMDiE7AYkDw+lLwlAzz0AntGIe51F3RfFfEqyQ3feY2eI/NcwC6umIQVOASPMsWJLJScWKSSvzL9IVA==} engines: {node: '>=4'} @@ -8030,6 +8850,12 @@ packages: minimalistic-assert: 1.0.1 dev: true + /hasown@2.0.0: + resolution: {integrity: sha512-vUptKVTpIJhcczKBbgnS+RtcuYMB8+oNzPK2/Hp3hanz8JmpATdmmgLgSaadVREkDm+e2giHwY3ZRkyjSIDDFA==} + engines: {node: '>= 0.4'} + dependencies: + function-bind: 1.1.2 + /hast-to-hyperscript@9.0.1: resolution: {integrity: sha512-zQgLKqF+O2F72S1aa4y2ivxzSlko3MAvxkwG8ehGmNiqd98BIN3JM1rAJPmplEyLmGLO2QZYJtIneOSZ2YbJuA==} dependencies: @@ -8131,7 +8957,7 @@ packages: /hosted-git-info@2.8.9: resolution: {integrity: sha512-mxIDAb9Lsm6DoOJ7xH+5+X4y1LU/4Hi50L9C5sIswK3JzULS4bwk1FvjdBgvYR4bzT4tuUQiC15FE2f5HbLvYw==} - dev: false + dev: true /hpack.js@2.1.6: resolution: {integrity: sha512-zJxVehUdMGIKsRaNt7apO2Gqp0BdqW5yaiGHXXmbpvxgBYVZnAql+BJb4RO5ad2MgpbZKn5G6nMnegrH1FcNYQ==} @@ -8207,7 +9033,6 @@ packages: /http-cache-semantics@4.1.1: resolution: {integrity: sha512-er295DKPVsV82j5kw1Gjt+ADA/XYHsajl82cGNQG2eyoPkvgUhX+nDIyelzhIWbbsXP39EHcI6l5tYs2FYqYXQ==} - dev: false /http-deceiver@1.2.7: resolution: {integrity: sha512-LmpOGxTfbpgtGVxJrj5k7asXHCgNZp5nLfp+hWc8QQRqtb7fUy6kRY3BO1h9ddF6yIPYUARgxGOwB42DnxIaNw==} @@ -8294,7 +9119,7 @@ packages: /human-id@1.0.2: resolution: {integrity: sha512-UNopramDEhHJD+VR+ehk8rOslwSfByxPIZyJRfV739NDhN5LF1fa1MqnzKm2lGTQRjNrjK19Q5fhkgIfjlVUKw==} - dev: false + dev: true /human-signals@2.1.0: resolution: {integrity: sha512-B4FFZ6q/T2jhhksgkbEW3HBvWIfDW85snkQgawt07S7J5QXTk6BkNV+0yAeZrM5QpMAdYlocGoljn0sJ/WQkFw==} @@ -8305,6 +9130,11 @@ packages: engines: {node: '>=14.18.0'} dev: false + /human-signals@5.0.0: + resolution: {integrity: sha512-AXcZb6vzzrFAUE61HnN4mpLqd/cSIwNQjtNWR0euPm6y0iqx3G4gOXaIDdtdDwZmhwe82LA6+zinmW4UBWVePQ==} + engines: {node: '>=16.17.0'} + dev: true + /humanize-ms@1.2.1: resolution: {integrity: sha512-Fl70vYtsAFb/C06PTS9dZBo7ihau+Tu/DNCk/OyHhea07S+aeMWpFFkUaXRa8fI+ScZbEI8dfSxwY7gxZ9SAVQ==} dependencies: @@ -8341,7 +9171,6 @@ packages: /ieee754@1.2.1: resolution: {integrity: sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==} - dev: true /ignore@5.2.4: resolution: {integrity: sha512-MAb38BcSbH0eHNBxn7ql2NH/kX33OkB3lZ1BNdh7ENeRChHTYsTvWrMubiIAMNS2llXEEgZ1MUOBtXChP3kaFQ==} @@ -8471,6 +9300,15 @@ packages: side-channel: 1.0.4 dev: false + /internal-slot@1.0.6: + resolution: {integrity: sha512-Xj6dv+PsbtwyPpEflsejS+oIZxmMlV44zAhG479uYu89MsjcYOhCFnNyKrkJrihbsiasQyY0afoCl/9BLR65bg==} + engines: {node: '>= 0.4'} + dependencies: + get-intrinsic: 1.2.2 + hasown: 2.0.0 + side-channel: 1.0.4 + dev: true + /interpret@1.4.0: resolution: {integrity: sha512-agE4QfB2Lkp9uICn7BAqoscw4SZP9kTE2hxiFI3jBPmXJfdqiahTbUuKGsMoN2GtqL9AxhYioAcVvgsb1HvRbA==} engines: {node: '>= 0.10'} @@ -8514,7 +9352,7 @@ packages: resolution: {integrity: sha512-8Q7EARjzEnKpt/PCD7e1cgUS0a6X8u5tdSiMqXhojOdoV9TsMsiO+9VLC5vAmO8N7/GmXn7yjR8qnA6bVAEzfA==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 has-tostringtag: 1.0.0 /is-array-buffer@3.0.2: @@ -8523,16 +9361,18 @@ packages: call-bind: 1.0.2 get-intrinsic: 1.2.0 is-typed-array: 1.1.12 - dev: false /is-arrayish@0.2.1: resolution: {integrity: sha512-zz06S8t0ozoDXMG+ube26zeCTNXcKIPJZJi8hBrF4idCLms4CG9QtK7qBl1boi5ODzFpjswb5JPmHCbMpjaYzg==} + /is-arrayish@0.3.2: + resolution: {integrity: sha512-eVRqCvVlZbuw3GrM63ovNSNAeA1K16kaR/LRY/92w0zxQ5/1YzwblUX652i4Xs9RwAGjW9d9y6X88t8OaAJfWQ==} + dev: false + /is-bigint@1.0.4: resolution: {integrity: sha512-zB9CruMamjym81i2JZ3UMn54PKGsQzsJeo6xvN3HJJ4CAsQNB6iRutp2To77OfCNuoxspsIhzaPoO1zyCEhFOg==} dependencies: has-bigints: 1.0.2 - dev: false /is-binary-path@2.1.0: resolution: {integrity: sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==} @@ -8544,9 +9384,8 @@ packages: resolution: {integrity: sha512-gDYaKHJmnj4aWxyj6YHyXVpdQawtVLHU5cb+eztPGczf6cjuTdwve5ZIEfgXqH4e57An1D1AKf8CZ3kYrQRqYA==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 has-tostringtag: 1.0.0 - dev: false /is-buffer@1.1.6: resolution: {integrity: sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==} @@ -8573,7 +9412,7 @@ packages: hasBin: true dependencies: ci-info: 3.9.0 - dev: false + dev: true /is-core-module@2.12.0: resolution: {integrity: sha512-RECHCBCd/viahWmwj6enj19sKbHfJrddi/6cBDsNTKbNq0f7VeaUkBo60BqzvPqo/W54ChS62Z5qyun7cfOMqQ==} @@ -8585,13 +9424,18 @@ packages: resolution: {integrity: sha512-Z7dk6Qo8pOCp3l4tsX2C5ZVas4V+UxwQodwZhLopL91TX8UyyHEXafPcyoeeWuLrwzHcr3igO78wNLwHJHsMCQ==} dependencies: has: 1.0.3 + dev: false + + /is-core-module@2.13.1: + resolution: {integrity: sha512-hHrIjvZsftOsvKSn2TRYl63zvxsgE0K+0mYMoH6gD4omR5IWB2KynivBQczo3+wF1cCkjzvptnI9Q0sPU66ilw==} + dependencies: + hasown: 2.0.0 /is-date-object@1.0.5: resolution: {integrity: sha512-9YQaSxsAiSwcvS33MBk3wTCVnWK+HhF8VZR2jRxehM16QcVOdHqPn4VPHmRK4lSr38n9JriurInLcP90xsYNfQ==} engines: {node: '>= 0.4'} dependencies: has-tostringtag: 1.0.0 - dev: false /is-decimal@1.0.4: resolution: {integrity: sha512-RGdriMmQQvZ2aqaQq3awNA6dCGtKpiDFcOzrTWrDAT2MiWrKQVPmxLGHl7Y2nNu6led0kEyoX0enY0qXYsv9zw==} @@ -8621,6 +9465,11 @@ packages: resolution: {integrity: sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==} engines: {node: '>=8'} + /is-fullwidth-code-point@4.0.0: + resolution: {integrity: sha512-O4L094N2/dZ7xqVdrXhh9r1KODPJpFms8B5sGdJLPy664AgvXsreZUyCQQNItZRDlYug4xStLjNp/sz3HvBowQ==} + engines: {node: '>=12'} + dev: true + /is-generator-fn@2.1.0: resolution: {integrity: sha512-cTIB4yPYL/Grw0EaSzASzg6bBy9gqCofvWN8okThAYIxKJZC+udlRAmGbM0XLeniEJSs8uEgHPGuHSe1XsOLSQ==} engines: {node: '>=6'} @@ -8677,14 +9526,13 @@ packages: resolution: {integrity: sha512-E+zBKpQ2t6MEo1VsonYmluk9NxGrbzpeeLC2xIViuO2EjU2xsXsBPwTr3Ykv9l08UYEVEdWeRZNouaZqF6RN0w==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 dev: true /is-negative-zero@2.0.2: resolution: {integrity: sha512-dqJvarLawXsFbNDeJW7zAz8ItJ9cd28YufuuFzh0G8pNHjJMnY08Dv7sYX2uF5UpQOwieAeOExEYAWWfu7ZZUA==} engines: {node: '>= 0.4'} - dev: false /is-npm@5.0.0: resolution: {integrity: sha512-WW/rQLOazUq+ST/bCAVBp/2oMERWLsR7OrKyt052dNDk4DHcDE0/7QSXITlmi+VBcV13DfIbysG3tZJm5RfdBA==} @@ -8696,7 +9544,6 @@ packages: engines: {node: '>= 0.4'} dependencies: has-tostringtag: 1.0.0 - dev: false /is-number@7.0.0: resolution: {integrity: sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==} @@ -8710,7 +9557,6 @@ packages: /is-obj@2.0.0: resolution: {integrity: sha512-drqDG3cbczxxEJRoOXcOjtdp1J/lyp1mNn0xaznRs8+muBhgQcrnbspox5X5fOw0HnMnbfDzvnEMEtqDEJEo8w==} engines: {node: '>=8'} - dev: false /is-path-cwd@2.2.0: resolution: {integrity: sha512-w942bTcih8fdJPJmQHFzkS76NEP8Kzzvmw92cXsazb8intwLqPibPPdXf4ANdKV3rYMuuQYGIWtvz9JilB3NFQ==} @@ -8723,7 +9569,7 @@ packages: /is-plain-obj@1.1.0: resolution: {integrity: sha512-yvkRyxmFKEOQ4pNXCmJG5AEQNlXJS5LaONXo5/cLdTZdWvsZ1ioJEonLGAosKlMWE8lwUy/bJzMjcw8az73+Fg==} engines: {node: '>=0.10.0'} - dev: false + dev: true /is-plain-obj@2.1.0: resolution: {integrity: sha512-YWnfyRwxL/+SsrWYfOpUtz5b3YD+nyfkHvjbcanzk8zgyO4ASD67uVMRt8k5bM4lLMDnXfriRhOpemw+NfT1eA==} @@ -8752,7 +9598,6 @@ packages: dependencies: call-bind: 1.0.2 has-tostringtag: 1.0.0 - dev: false /is-regexp@1.0.0: resolution: {integrity: sha512-7zjFAPO4/gwyQAAgRRmqeEeyIICSdmCqa3tsVHMdBzaXXRiqopZL4Cyghg/XulGWrtABTpbnYYzzIRffLkP4oA==} @@ -8772,7 +9617,6 @@ packages: resolution: {integrity: sha512-sqN2UDu1/0y6uvXyStCOzyhAjCSlHceFoMKJW8W9EU9cvic/QdsZ0kEU93HEy3IUEFZIiH/3w+AH/UQbPHNdhA==} dependencies: call-bind: 1.0.2 - dev: false /is-stream@2.0.1: resolution: {integrity: sha512-hFoiJiTl63nn+kstHGBtewWSKnQLpyb155KHheA1l39uvtO9nWIop1p3udqPcUd/xbF1VLMO4n7OI6p7RbngDg==} @@ -8781,34 +9625,31 @@ packages: /is-stream@3.0.0: resolution: {integrity: sha512-LnQR4bZ9IADDRSkvpqMGvt/tEJWclzklNgSw48V5EAaAeDd6qGvN8ei6k5p0tvxSR171VmGyHuTiAOfxAbr8kA==} engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0} - dev: false /is-string@1.0.7: resolution: {integrity: sha512-tE2UXzivje6ofPW7l23cjDOMa09gb7xlAqG6jG5ej6uPV32TlWP3NKPigtaGeHNu9fohccRYvIiZMfOOnOYUtg==} engines: {node: '>= 0.4'} dependencies: has-tostringtag: 1.0.0 - dev: false /is-subdir@1.2.0: resolution: {integrity: sha512-2AT6j+gXe/1ueqbW6fLZJiIw3F8iXGJtt0yDrZaBhAZEG1raiTxKWU+IPqMCzQAXOUCKdA4UDMgacKH25XG2Cw==} engines: {node: '>=4'} dependencies: better-path-resolve: 1.0.0 - dev: false + dev: true /is-symbol@1.0.4: resolution: {integrity: sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg==} engines: {node: '>= 0.4'} dependencies: has-symbols: 1.0.3 - dev: false /is-typed-array@1.1.12: resolution: {integrity: sha512-Z14TF2JNG8Lss5/HMqt0//T9JeHXttXy5pH/DBU4vi98ozO2btxzq9MwYDZYnKwU8nRsz/+GVFVRDq3DkVuSPg==} engines: {node: '>= 0.4'} dependencies: - which-typed-array: 1.1.11 + which-typed-array: 1.1.13 /is-typedarray@1.0.0: resolution: {integrity: sha512-cyA56iCMHAh5CdzjJIa4aohJyeO1YbwLi3Jc35MmRU6poroFjIGZzUzupGiRPOjgHg9TLu43xbpwXk523fMxKA==} @@ -8833,13 +9674,12 @@ packages: resolution: {integrity: sha512-qctsuLZmIQ0+vSSMfoVvyFe2+GSEvnmZ2ezTup1SBse9+twCCeial6EEi3Nc2KFcf6+qz2FBPnjXsk8xhKSaPQ==} dependencies: call-bind: 1.0.2 - dev: false /is-weakset@2.0.2: resolution: {integrity: sha512-t2yVvttHkQktwnNNmBQ98AhENLdPUTDTE21uPqAQ0ARwQfGeQKRVS0NNurH7bTf7RrvcVn1OOge45CnBeHCSmg==} dependencies: - call-bind: 1.0.2 - get-intrinsic: 1.2.1 + call-bind: 1.0.5 + get-intrinsic: 1.2.2 dev: false /is-whitespace-character@1.0.4: @@ -8849,7 +9689,7 @@ packages: /is-windows@1.0.2: resolution: {integrity: sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==} engines: {node: '>=0.10.0'} - dev: false + dev: true /is-word-character@1.0.4: resolution: {integrity: sha512-5SMO8RVennx3nZrqtKwCGyyetPE9VDba5ugvKLaD4KopPG5kR4mQ7tNt/r7feL5yt5h3lpuBbIUmCOG2eSzXHA==} @@ -8876,7 +9716,6 @@ packages: /isarray@2.0.5: resolution: {integrity: sha512-xHjhDr3cNBK0BzdUJSPXZntQUx/mwMS5Rw4A7lPJ90XGAO6ISP/ePDNuo0vhqOZU+UD5JoodwCAAoZQd3FeAKw==} - dev: false /isbinaryfile@4.0.10: resolution: {integrity: sha512-iHrqe5shvBUcFbmZq9zOQHBoeOhZJu6RQGrDpBgenUm/Am+F3JM2MgQj+rK3Z601fzrL5gLZWtAPH2OBaSVcyw==} @@ -8895,8 +9734,8 @@ packages: engines: {node: '>=10'} dev: true - /istanbul-lib-coverage@3.2.0: - resolution: {integrity: sha512-eOeJ5BHCmHYvQK7xt9GkdHuzuCGS1Y6g9Gvnx3Ym33fz/HpLRYxiS0wHNr+m/MBC8B647Xt608vCDEvhl9c6Mw==} + /istanbul-lib-coverage@3.2.2: + resolution: {integrity: sha512-O8dpsF+r0WV/8MNRKfnmrtCWhuKjxrq2w+jpzBL5UZKTi2LeVWnWOmWRxFlesJONmc+wLAGvKQZEOanko0LFTg==} engines: {node: '>=8'} dev: true @@ -8904,10 +9743,10 @@ packages: resolution: {integrity: sha512-pzqtp31nLv/XFOzXGuvhCb8qhjmTVo5vjVk19XE4CRlSWz0KoeJ3bw9XsA7nOp9YBf4qHjwBxkDzKcME/J29Yg==} engines: {node: '>=8'} dependencies: - '@babel/core': 7.23.0 - '@babel/parser': 7.23.0 + '@babel/core': 7.23.3 + '@babel/parser': 7.23.3 '@istanbuljs/schema': 0.1.3 - istanbul-lib-coverage: 3.2.0 + istanbul-lib-coverage: 3.2.2 semver: 6.3.1 transitivePeerDependencies: - supports-color @@ -8917,10 +9756,10 @@ packages: resolution: {integrity: sha512-EAMEJBsYuyyztxMxW3g7ugGPkrZsV57v0Hmv3mm1uQsmB+QnZuepg731CRaIgeUVSdmsTngOkSnauNF8p7FIhA==} engines: {node: '>=10'} dependencies: - '@babel/core': 7.23.0 - '@babel/parser': 7.23.0 + '@babel/core': 7.23.3 + '@babel/parser': 7.23.3 '@istanbuljs/schema': 0.1.3 - istanbul-lib-coverage: 3.2.0 + istanbul-lib-coverage: 3.2.2 semver: 7.5.4 transitivePeerDependencies: - supports-color @@ -8930,7 +9769,7 @@ packages: resolution: {integrity: sha512-GCfE1mtsHGOELCU8e/Z7YWzpmybrx/+dSTfLrvY8qRmaY6zXTKWn6WQIjaAFw069icm6GVMNkgu0NzI4iPZUNw==} engines: {node: '>=10'} dependencies: - istanbul-lib-coverage: 3.2.0 + istanbul-lib-coverage: 3.2.2 make-dir: 4.0.0 supports-color: 7.2.0 dev: true @@ -8940,7 +9779,7 @@ packages: engines: {node: '>=10'} dependencies: debug: 4.3.4 - istanbul-lib-coverage: 3.2.0 + istanbul-lib-coverage: 3.2.2 source-map: 0.6.1 transitivePeerDependencies: - supports-color @@ -8971,7 +9810,7 @@ packages: '@jest/expect': 29.7.0 '@jest/test-result': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 chalk: 4.1.2 co: 4.6.0 dedent: 1.5.1 @@ -8992,7 +9831,7 @@ packages: - supports-color dev: true - /jest-cli@29.7.0(@types/node@18.18.7): + /jest-cli@29.7.0(@types/node@18.18.12): resolution: {integrity: sha512-OVVobw2IubN/GSYsxETi+gOe7Ka59EFMR/twOU3Jb2GnKKeMGJB5SGUUrEz3SFVmJASUdZUzy83sLNNQ2gZslg==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} hasBin: true @@ -9006,10 +9845,10 @@ packages: '@jest/test-result': 29.7.0 '@jest/types': 29.6.3 chalk: 4.1.2 - create-jest: 29.7.0(@types/node@18.18.7) + create-jest: 29.7.0(@types/node@18.18.12) exit: 0.1.2 import-local: 3.1.0 - jest-config: 29.7.0(@types/node@18.18.7) + jest-config: 29.7.0(@types/node@18.18.12) jest-util: 29.7.0 jest-validate: 29.7.0 yargs: 17.7.2 @@ -9020,7 +9859,7 @@ packages: - ts-node dev: true - /jest-config@29.7.0(@types/node@18.18.7): + /jest-config@29.7.0(@types/node@18.18.12): resolution: {integrity: sha512-uXbpfeQ7R6TZBqI3/TxCU4q4ttk3u0PJeC+E0zbfSoSjq6bJ7buBPxzQPL0ifrkY4DNu4JUdk0ImlBUYi840eQ==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} peerDependencies: @@ -9032,11 +9871,11 @@ packages: ts-node: optional: true dependencies: - '@babel/core': 7.23.0 + '@babel/core': 7.23.3 '@jest/test-sequencer': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 - babel-jest: 29.7.0(@babel/core@7.23.0) + '@types/node': 18.18.12 + babel-jest: 29.7.0(@babel/core@7.23.3) chalk: 4.1.2 ci-info: 3.9.0 deepmerge: 4.3.1 @@ -9095,7 +9934,7 @@ packages: '@jest/environment': 29.7.0 '@jest/fake-timers': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 jest-mock: 29.7.0 jest-util: 29.7.0 dev: true @@ -9110,8 +9949,8 @@ packages: engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: '@jest/types': 29.6.3 - '@types/graceful-fs': 4.1.7 - '@types/node': 18.18.7 + '@types/graceful-fs': 4.1.9 + '@types/node': 18.18.12 anymatch: 3.1.3 fb-watchman: 2.0.2 graceful-fs: 4.2.11 @@ -9148,7 +9987,7 @@ packages: dependencies: '@babel/code-frame': 7.22.13 '@jest/types': 29.6.3 - '@types/stack-utils': 2.0.1 + '@types/stack-utils': 2.0.3 chalk: 4.1.2 graceful-fs: 4.2.11 micromatch: 4.0.5 @@ -9162,7 +10001,7 @@ packages: engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 jest-util: 29.7.0 dev: true @@ -9203,7 +10042,7 @@ packages: jest-pnp-resolver: 1.2.3(jest-resolve@29.7.0) jest-util: 29.7.0 jest-validate: 29.7.0 - resolve: 1.22.6 + resolve: 1.22.8 resolve.exports: 2.0.2 slash: 3.0.0 dev: true @@ -9217,7 +10056,7 @@ packages: '@jest/test-result': 29.7.0 '@jest/transform': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 chalk: 4.1.2 emittery: 0.13.1 graceful-fs: 4.2.11 @@ -9248,7 +10087,7 @@ packages: '@jest/test-result': 29.7.0 '@jest/transform': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 chalk: 4.1.2 cjs-module-lexer: 1.2.3 collect-v8-coverage: 1.0.2 @@ -9271,15 +10110,15 @@ packages: resolution: {integrity: sha512-Rm0BMWtxBcioHr1/OX5YCP8Uov4riHvKPknOGs804Zg9JGZgmIBkbtlxJC/7Z4msKYVbIJtfU+tKb8xlYNfdkw==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: - '@babel/core': 7.23.0 - '@babel/generator': 7.23.0 - '@babel/plugin-syntax-jsx': 7.22.5(@babel/core@7.23.0) - '@babel/plugin-syntax-typescript': 7.22.5(@babel/core@7.23.0) - '@babel/types': 7.23.0 + '@babel/core': 7.23.3 + '@babel/generator': 7.23.3 + '@babel/plugin-syntax-jsx': 7.23.3(@babel/core@7.23.3) + '@babel/plugin-syntax-typescript': 7.23.3(@babel/core@7.23.3) + '@babel/types': 7.23.3 '@jest/expect-utils': 29.7.0 '@jest/transform': 29.7.0 '@jest/types': 29.6.3 - babel-preset-current-node-syntax: 1.0.1(@babel/core@7.23.0) + babel-preset-current-node-syntax: 1.0.1(@babel/core@7.23.3) chalk: 4.1.2 expect: 29.7.0 graceful-fs: 4.2.11 @@ -9300,7 +10139,7 @@ packages: engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 chalk: 4.1.2 ci-info: 3.9.0 graceful-fs: 4.2.11 @@ -9324,7 +10163,7 @@ packages: dependencies: '@jest/test-result': 29.7.0 '@jest/types': 29.6.3 - '@types/node': 18.18.7 + '@types/node': 18.18.12 ansi-escapes: 4.3.2 chalk: 4.1.2 emittery: 0.13.1 @@ -9336,7 +10175,7 @@ packages: resolution: {integrity: sha512-7vuh85V5cdDofPyxn58nrPjBktZo0u9x1g8WtjQol+jZDaE+fhN+cIvTj11GndBnMnyfrUOG1sZQxCdjKh+DKg==} engines: {node: '>= 10.13.0'} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 merge-stream: 2.0.0 supports-color: 8.1.1 @@ -9344,12 +10183,12 @@ packages: resolution: {integrity: sha512-eIz2msL/EzL9UFTFFx7jBTkeZfku0yUAyZZZmJ93H2TYEiroIx2PQjEXcwYtYl8zXCxb+PAmA2hLIt/6ZEkPHw==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} dependencies: - '@types/node': 18.18.7 + '@types/node': 18.18.12 jest-util: 29.7.0 merge-stream: 2.0.0 supports-color: 8.1.1 - /jest@29.7.0(@types/node@18.18.7): + /jest@29.7.0(@types/node@18.18.12): resolution: {integrity: sha512-NIy3oAFp9shda19hy4HK0HRTWKtPJmGdnvywu01nOqNC2vZg+Z+fvJDxpMQA88eb2I9EcafcdjYgsDthnYTvGw==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} hasBin: true @@ -9362,7 +10201,7 @@ packages: '@jest/core': 29.7.0 '@jest/types': 29.6.3 import-local: 3.1.0 - jest-cli: 29.7.0(@types/node@18.18.7) + jest-cli: 29.7.0(@types/node@18.18.12) transitivePeerDependencies: - '@types/node' - babel-plugin-macros @@ -9389,8 +10228,8 @@ packages: engines: {node: '>=10'} dev: true - /js-tiktoken@1.0.7: - resolution: {integrity: sha512-biba8u/clw7iesNEWLOLwrNGoBP2lA+hTaBLs/D45pJdUPFXyxD6nhcDVtADChghv4GgyAiMKYMiRx7x6h7Biw==} + /js-tiktoken@1.0.8: + resolution: {integrity: sha512-r7XK3E9/I+SOrbAGqb39pyO/rHAS1diAOSRAvaaLfHgXjkUSK9AiSd+r84Vn2f/GvXJYRAxKj8NHrUvqlaH5qg==} dependencies: base64-js: 1.5.1 dev: false @@ -9436,7 +10275,10 @@ packages: /json-schema-traverse@1.0.0: resolution: {integrity: sha512-NM8/P9n3XjXhIZn1lLhkFaACTOURQXjWhV4BA/RnOv8xvgqtqpAX9IO4mRQxSx1Rlo4tqzeqb0sOlruaOy3dug==} - dev: false + + /json-schema-typed@7.0.3: + resolution: {integrity: sha512-7DE8mpG+/fVw+dTpjbxnx47TaMnDfOI1jwft9g1VybltZCduyRQPJPvc+zzKY9WPHxhPWczyFuYa6I8Mw4iU5A==} + dev: true /json-stable-stringify-without-jsonify@1.0.1: resolution: {integrity: sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==} @@ -9467,11 +10309,12 @@ packages: resolution: {integrity: sha512-m6F1R3z8jjlf2imQHS2Qez5sjKWQzbuuhuJ/FKYFRZvPE3PuHcSMVZzfsLhGVOkfd20obL5SWEBew5ShlquNxg==} optionalDependencies: graceful-fs: 4.2.11 + dev: true /jsonfile@6.1.0: resolution: {integrity: sha512-5dgndWOriYSm5cnYaJNhalLNDKOqFwyDB/rr1E9ZsGciGvKPs8R2xYGCacuf3z6K1YKDz182fd+fY3cn3pMqXQ==} dependencies: - universalify: 2.0.0 + universalify: 2.0.1 optionalDependencies: graceful-fs: 4.2.11 @@ -9514,7 +10357,7 @@ packages: /kleur@4.1.5: resolution: {integrity: sha512-o+NO+8WrRiQEE4/7nwRJhN1HWpVmJm511pBHUxPLtp0BUISzlBplORYSmTclCnJvQq2tKu/sgl3xVpkc7ZWuQQ==} engines: {node: '>=6'} - dev: false + dev: true /language-subtag-registry@0.3.22: resolution: {integrity: sha512-tN0MCzyWnoz/4nHS6uxdlFWoUZT7ABptwKPQ52Ea7URk6vll88bWBVhodtnlfEuCcKWNGoc+uGbw1cwa9IKh/w==} @@ -9564,6 +10407,37 @@ packages: /lines-and-columns@1.2.4: resolution: {integrity: sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==} + /lint-staged@15.1.0: + resolution: {integrity: sha512-ZPKXWHVlL7uwVpy8OZ7YQjYDAuO5X4kMh0XgZvPNxLcCCngd0PO5jKQyy3+s4TL2EnHoIXIzP1422f/l3nZKMw==} + engines: {node: '>=18.12.0'} + hasBin: true + dependencies: + chalk: 5.3.0 + commander: 11.1.0 + debug: 4.3.4 + execa: 8.0.1 + lilconfig: 2.1.0 + listr2: 7.0.2 + micromatch: 4.0.5 + pidtree: 0.6.0 + string-argv: 0.3.2 + yaml: 2.3.4 + transitivePeerDependencies: + - supports-color + dev: true + + /listr2@7.0.2: + resolution: {integrity: sha512-rJysbR9GKIalhTbVL2tYbF2hVyDnrf7pFUZBwjPaMIdadYHmeT+EVi/Bu3qd7ETQPahTotg2WRCatXwRBW554g==} + engines: {node: '>=16.0.0'} + dependencies: + cli-truncate: 3.1.0 + colorette: 2.0.20 + eventemitter3: 5.0.1 + log-update: 5.0.1 + rfdc: 1.3.0 + wrap-ansi: 8.1.0 + dev: true + /load-tsconfig@0.2.5: resolution: {integrity: sha512-IXO6OCs9yg8tMKzfPZ1YmheJbZCiEsnBdcB03l0OcfK9prKnJb96siuHCr5Fl37/yo9DnKU+TLpxzTUspw9shg==} engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0} @@ -9577,7 +10451,7 @@ packages: js-yaml: 3.14.1 pify: 4.0.1 strip-bom: 3.0.0 - dev: false + dev: true /loader-runner@4.3.0: resolution: {integrity: sha512-3R/1M+yS3j5ou80Me59j7F9IMs4PXs3VqRrm0TU3AbKPxlmpoY1TNscJV/oGJXo8qCatFGTfDbY6W6ipGOYXfg==} @@ -9603,7 +10477,6 @@ packages: dependencies: p-locate: 3.0.0 path-exists: 3.0.0 - dev: false /locate-path@5.0.0: resolution: {integrity: sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==} @@ -9665,7 +10538,7 @@ packages: /lodash.startcase@4.4.0: resolution: {integrity: sha512-+WKqsK294HMSc2jEbNgpHpd0JfIBhp7rEV4aqXWqFr6AlXov+SlcgB1Fv01y2kGe3Gc8nMW7VA0SrGuSkRfIEg==} - dev: false + dev: true /lodash.uniq@4.5.0: resolution: {integrity: sha512-xfBaXQd9ryd9dlSDvnvI0lvxfLJlYAZzXomUYzLKtUeOQvOP5piqAWuGtrhWeqaXK9hhoM/iyJc5AV+XfsX3HQ==} @@ -9693,6 +10566,21 @@ packages: is-unicode-supported: 0.1.0 dev: true + /log-update@5.0.1: + resolution: {integrity: sha512-5UtUDQ/6edw4ofyljDNcOVJQ4c7OjDro4h3y8e1GQL5iYElYclVHJ3zeWchylvMaKnDbDilC8irOVyexnA/Slw==} + engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0} + dependencies: + ansi-escapes: 5.0.0 + cli-cursor: 4.0.0 + slice-ansi: 5.0.0 + strip-ansi: 7.1.0 + wrap-ansi: 8.1.0 + dev: true + + /long@4.0.0: + resolution: {integrity: sha512-XsP+KhQif4bjX1kbuSiySJFNAehNxgLb6hPRGJ9QsUr8ajHkuXGdrHmFUTUUXhDwVX2R5bY4JNZEwbUiMhV+MA==} + dev: false + /loose-envify@1.4.0: resolution: {integrity: sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==} hasBin: true @@ -9731,14 +10619,13 @@ packages: /lowercase-keys@2.0.0: resolution: {integrity: sha512-tqNXrS78oMOE73NMxK4EMLQsQowWf8jKooH9g7xPavRT706R6bkQJ6DY2Te7QukaZsulxa30wQ7bk0pm4XiHmA==} engines: {node: '>=8'} - dev: false /lru-cache@4.1.5: resolution: {integrity: sha512-sWZlbEP2OsHNkXrMl5GYk/jKk70MBng6UU4YI/qGDYbgf6YbP4EvmqISbXCoJiRKs+1bSpFHVgQxvJ17F2li5g==} dependencies: pseudomap: 1.0.2 yallist: 2.1.2 - dev: false + dev: true /lru-cache@5.1.1: resolution: {integrity: sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==} @@ -9804,12 +10691,12 @@ packages: /map-obj@1.0.1: resolution: {integrity: sha512-7N/q3lyZ+LVCp7PzuxrJr4KMbBE2hW7BT7YNia330OFxIf4d3r5zVpicP2650l7CPN6RM9zOJRl3NGpqSiw3Eg==} engines: {node: '>=0.10.0'} - dev: false + dev: true /map-obj@4.3.0: resolution: {integrity: sha512-hdN1wVrZbb29eBGiGjJbeP8JbKjq1urkHJ/LIP/NY48MZ1QVXUsQBV1G1zvYFHn1XE06cwjBsOI2K3Ulnj1YXQ==} engines: {node: '>=8'} - dev: false + dev: true /markdown-escapes@1.0.4: resolution: {integrity: sha512-8z4efJYk43E0upd0NbVXwgSTQs6cT3T06etieCMEg7dRbzCbxUCK/GHlX8mhHRDcp+OLlHkPKsvqQTCvsRl2cg==} @@ -9898,7 +10785,7 @@ packages: resolution: {integrity: sha512-3YffViIt2QWgTy6Pale5QpopX/IvU3LPL03jOTqp6pGj3VjesdO/U8CuHMKpnQr4shCNCM5fd5XFFvIIl6JBHg==} engines: {node: '>=8'} dependencies: - '@types/minimist': 1.2.3 + '@types/minimist': 1.2.5 camelcase-keys: 6.2.2 decamelize-keys: 1.1.1 hard-rejection: 2.1.0 @@ -9909,7 +10796,7 @@ packages: trim-newlines: 3.0.1 type-fest: 0.13.1 yargs-parser: 18.1.3 - dev: false + dev: true /merge-descriptors@1.0.1: resolution: {integrity: sha512-cCi6g3/Zr1iqQi6ySbseM1Xvooa98N0w31jzUYrXPX2xqObmFGHJ0tQ5u74H3mVh7wLouTseZyYIq39g8cNp1w==} @@ -9974,20 +10861,33 @@ packages: resolution: {integrity: sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==} engines: {node: '>=6'} + /mimic-fn@3.1.0: + resolution: {integrity: sha512-Ysbi9uYW9hFyfrThdDEQuykN4Ey6BuwPD2kpI5ES/nFTDn/98yxYNLZJcgUAKPT/mcrLLKaGzJR9YVxJrIdASQ==} + engines: {node: '>=8'} + dev: true + /mimic-fn@4.0.0: resolution: {integrity: sha512-vqiC06CuhBTUdZH+RYl8sFrL096vA45Ok5ISO6sE/Mr1jRbGH4Csnhi8f3wKVl7x8mO4Au7Ir9D3Oyv1VYMFJw==} engines: {node: '>=12'} - dev: false /mimic-response@1.0.1: resolution: {integrity: sha512-j5EctnkH7amfV/q5Hgmoal1g2QHFJRraOtmx0JpIqkxhBhI/lJSl1nMpQ45hVarwNETOoWEimndZ4QK0RHxuxQ==} engines: {node: '>=4'} + + /mimic-response@2.1.0: + resolution: {integrity: sha512-wXqjST+SLt7R009ySCglWBCFpjUygmCIfD790/kVbiGmUgfYGuB14PiTd5DwVxSV4NcYHjzMkoj5LjQZwTQLEA==} + engines: {node: '>=8'} + dev: true + + /mimic-response@3.1.0: + resolution: {integrity: sha512-z0yWI+4FDrrweS8Zmt4Ej5HdJmky15+L2e6Wgn3+iK5fWzb6T3fhNFq2+MeTRb064c6Wr4N/wv0DzQTjNzHNGQ==} + engines: {node: '>=10'} dev: false /min-indent@1.0.1: resolution: {integrity: sha512-I9jwMn07Sy/IwOj3zVkVik2JTvgpaykDZEigL6Rx6N9LbMywwUSMtxET+7lVoDLLd3O3IXwJwvuuns8UB/HeAg==} engines: {node: '>=4'} - dev: false + dev: true /mini-css-extract-plugin@2.7.6(webpack@5.88.2): resolution: {integrity: sha512-Qk7HcgaPkGG6eD77mLvZS1nmxlao3j+9PkrT9Uc7HAE1id3F41+DdBRYRYkbyfNRGzm8/YWtzhw7nVPmwhqTQw==} @@ -10025,14 +10925,43 @@ packages: arrify: 1.0.1 is-plain-obj: 1.1.0 kind-of: 6.0.3 - dev: false + dev: true /minimist@1.2.8: resolution: {integrity: sha512-2yyAR8qBkN3YuheJanUpWC5U3bb5osDywNB8RzDVlDwDHbocAJveqqj1u8+SVD7jkWT4yvsHCpWqqWqAxb0zCA==} + /minipass@3.3.6: + resolution: {integrity: sha512-DxiNidxSEK+tHG6zOIklvNOwm3hvCrbUrdtzY74U6HKTJxvIDfOUL5W5P2Ghd3DTkhhKPYGqeNUIh5qcM4YBfw==} + engines: {node: '>=8'} + dependencies: + yallist: 4.0.0 + dev: true + + /minipass@4.2.8: + resolution: {integrity: sha512-fNzuVyifolSLFL4NzpF+wEF4qrgqaaKX0haXPQEdQ7NKAN+WecoKMHV09YcuL/DHxrUsYQOK3MiuDf7Ip2OXfQ==} + engines: {node: '>=8'} + dev: true + + /minipass@5.0.0: + resolution: {integrity: sha512-3FnjYuehv9k6ovOEbyOswadCDPX1piCfhV8ncmYtHOjuPwylVWsghTLo7rabjC3Rx5xD4HDx8Wm1xnMF7S5qFQ==} + engines: {node: '>=8'} + dev: true + + /minizlib@2.1.2: + resolution: {integrity: sha512-bAxsR8BVfj60DWXHE3u30oHzfl4G7khkSuPW+qvpd7jFRHm7dLxOjUk1EHACJ/hxLY8phGJ0YhYHZo7jil7Qdg==} + engines: {node: '>= 8'} + dependencies: + minipass: 3.3.6 + yallist: 4.0.0 + dev: true + /mixme@0.5.9: resolution: {integrity: sha512-VC5fg6ySUscaWUpI4gxCBTQMH2RdUpNrk+MsbpCYtIvf9SBJdiUey4qE7BXviJsJR4nDQxCZ+3yaYNW3guz/Pw==} engines: {node: '>= 8.0.0'} + dev: true + + /mkdirp-classic@0.5.3: + resolution: {integrity: sha512-gKLcREMhtuZRwRAfqP3RFW+TK4JqApVBtOIftVgjuABpAtpxhPGaDcfvbhNvD0B8iD1oUr/txX35NjcaY6Ns/A==} dev: false /mkdirp@0.5.6: @@ -10042,6 +10971,12 @@ packages: minimist: 1.2.8 dev: true + /mkdirp@1.0.4: + resolution: {integrity: sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==} + engines: {node: '>=10'} + hasBin: true + dev: true + /mongodb-connection-string-url@2.6.0: resolution: {integrity: sha512-WvTZlI9ab0QYtTYnuMLgobULWhokRjtC7db9LtcVfJ+Hsnyr5eo6ZtNAt3Ly24XZScGMelOcGtm7lSn0332tPQ==} dependencies: @@ -10049,6 +10984,13 @@ packages: whatwg-url: 11.0.0 dev: false + /mongodb-connection-string-url@3.0.0: + resolution: {integrity: sha512-t1Vf+m1I5hC2M5RJx/7AtxgABy1cZmIPQRMXw+gEIPn/cZNF3Oiy+l0UIypUwVB5trcWHq3crg2g3uAR9aAwsQ==} + dependencies: + '@types/whatwg-url': 11.0.3 + whatwg-url: 13.0.0 + dev: false + /mongodb@6.2.0: resolution: {integrity: sha512-d7OSuGjGWDZ5usZPqfvb36laQ9CPhnWkAGHT61x5P95p/8nMVeH8asloMwW6GcYFeB0Vj4CB/1wOTDG2RA9BFA==} engines: {node: '>=16.20.1'} @@ -10076,11 +11018,43 @@ packages: socks: optional: true dependencies: - '@mongodb-js/saslprep': 1.1.0 + '@mongodb-js/saslprep': 1.1.1 bson: 6.2.0 mongodb-connection-string-url: 2.6.0 dev: false + /mongodb@6.3.0: + resolution: {integrity: sha512-tt0KuGjGtLUhLoU263+xvQmPHEGTw5LbcNC73EoFRYgSHwZt5tsoJC110hDyO1kjQzpgNrpdcSza9PknWN4LrA==} + engines: {node: '>=16.20.1'} + peerDependencies: + '@aws-sdk/credential-providers': ^3.188.0 + '@mongodb-js/zstd': ^1.1.0 + gcp-metadata: ^5.2.0 + kerberos: ^2.0.1 + mongodb-client-encryption: '>=6.0.0 <7' + snappy: ^7.2.2 + socks: ^2.7.1 + peerDependenciesMeta: + '@aws-sdk/credential-providers': + optional: true + '@mongodb-js/zstd': + optional: true + gcp-metadata: + optional: true + kerberos: + optional: true + mongodb-client-encryption: + optional: true + snappy: + optional: true + socks: + optional: true + dependencies: + '@mongodb-js/saslprep': 1.1.1 + bson: 6.2.0 + mongodb-connection-string-url: 3.0.0 + dev: false + /mrmime@1.0.1: resolution: {integrity: sha512-hzzEagAgDyoU1Q6yg5uI+AorQgdvMCur3FcKf7NhMKWsaYg+RnbTyHRa/9IlLF9rf455MOCtcqqrQQ83pPP7Uw==} engines: {node: '>=10'} @@ -10121,6 +11095,10 @@ packages: engines: {node: ^10 || ^12 || ^13.7 || ^14 || >=15.0.1} hasBin: true + /napi-build-utils@1.0.2: + resolution: {integrity: sha512-ONmRUqK7zj7DWX0D9ADe03wbwOBZxNAfF20PlGfCWQcD3+/MakShIHrMqx9YwPTfxDdF1zLeL+RGZiR9kGMLdg==} + dev: false + /natural-compare@1.4.0: resolution: {integrity: sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==} @@ -10137,7 +11115,7 @@ packages: engines: {node: '>= 0.4.0'} dev: true - /next@13.4.10(@babel/core@7.23.0)(react-dom@18.2.0)(react@18.2.0): + /next@13.4.10(@babel/core@7.23.3)(react-dom@18.2.0)(react@18.2.0): resolution: {integrity: sha512-4ep6aKxVTQ7rkUW2fBLhpBr/5oceCuf4KmlUpvG/aXuDTIf9mexNSpabUD6RWPspu6wiJJvozZREhXhueYO36A==} engines: {node: '>=16.8.0'} hasBin: true @@ -10162,7 +11140,7 @@ packages: postcss: 8.4.14 react: 18.2.0 react-dom: 18.2.0(react@18.2.0) - styled-jsx: 5.1.1(@babel/core@7.23.0)(react@18.2.0) + styled-jsx: 5.1.1(@babel/core@7.23.3)(react@18.2.0) watchpack: 2.4.0 zod: 3.21.4 optionalDependencies: @@ -10193,6 +11171,17 @@ packages: tslib: 2.6.2 dev: false + /node-abi@3.51.0: + resolution: {integrity: sha512-SQkEP4hmNWjlniS5zdnfIXTk1x7Ome85RDzHlTbBtzE97Gfwz/Ipw4v/Ryk20DWIy3yCNVLVlGKApCnmvYoJbA==} + engines: {node: '>=10'} + dependencies: + semver: 7.5.4 + dev: false + + /node-addon-api@6.1.0: + resolution: {integrity: sha512-+eawOlIgy680F0kBzPUNFhMZGtJ1YmqM6l4+Crf4IkImjYrO/mqPwRMh352g23uIaQKFItcQ64I7KMaJxHgAVA==} + dev: false + /node-domexception@1.0.0: resolution: {integrity: sha512-/jKZoMpw0F8GRwl4/eLROPA3cfcXtLApP0QzLmUT/HuPCZWyB7IY9ZrMeKw2O/nFIqPQB3PVM9aYm0F312AXDQ==} engines: {node: '>=10.5.0'} @@ -10234,7 +11223,7 @@ packages: resolution: {integrity: sha512-Cov028YhBZ5aB7MdMWJEmwyBig43aGL5WT4vdoB28Oitau1zZAcHUn8Sgfk9HM33TqhtLJ9PlM/O0Mv+QpV/4Q==} engines: {node: '>=8.9.4'} dependencies: - '@babel/runtime-corejs3': 7.23.1 + '@babel/runtime-corejs3': 7.23.2 '@types/inquirer': 6.5.0 change-case: 3.1.0 del: 5.1.0 @@ -10244,7 +11233,7 @@ packages: isbinaryfile: 4.0.10 lodash.get: 4.4.2 mkdirp: 0.5.6 - resolve: 1.22.7 + resolve: 1.22.8 dev: true /node-releases@2.0.13: @@ -10262,7 +11251,7 @@ packages: constants-browserify: 1.0.0 create-require: 1.1.1 crypto-browserify: 3.12.0 - domain-browser: 4.22.0 + domain-browser: 4.23.0 events: 3.3.0 https-browserify: 1.0.0 isomorphic-timers-promises: 1.0.1 @@ -10287,10 +11276,10 @@ packages: resolution: {integrity: sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==} dependencies: hosted-git-info: 2.8.9 - resolve: 1.22.6 + resolve: 1.22.8 semver: 5.7.2 validate-npm-package-license: 3.0.4 - dev: false + dev: true /normalize-path@3.0.0: resolution: {integrity: sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==} @@ -10309,7 +11298,6 @@ packages: /normalize-url@6.1.0: resolution: {integrity: sha512-DlL+XwOy3NxAQ8xuC0okPgK46iuVNAK01YN7RueYBqqFeGsBjV9XmCAzAdgt+667bCl5kPh9EqKKDwnaPG1I7A==} engines: {node: '>=10'} - dev: false /notion-md-crawler@0.0.2: resolution: {integrity: sha512-lE3/DFMrg7GSbl1sBfDuLVLyxw+yjdarPVm1JGfQ6eONEbNGgO+BdZxpwwZQ1uYeEJurAXMXb/AXT8GKYjKAyg==} @@ -10331,7 +11319,6 @@ packages: engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0} dependencies: path-key: 4.0.0 - dev: false /npm-to-yarn@2.1.0: resolution: {integrity: sha512-2C1IgJLdJngq1bSER7K7CGFszRr9s2rijEwvENPEgI0eK9xlD3tNwDc0UJnRj7FIT2aydWm72jB88uVswAhXHA==} @@ -10355,11 +11342,15 @@ packages: /object-inspect@1.12.3: resolution: {integrity: sha512-geUvdk7c+eizMNUDkRpW1wJwgfOiOeHbxBR/hLXK1aT6zmVSO0jsQcs7fj6MGw89jC/cjGfLcNOrtMYtGqm81g==} + /object-inspect@1.13.1: + resolution: {integrity: sha512-5qoj1RUiKOMsCCNLV1CBiPYE10sziTsnmNxkAI/rZhiD63CF7IqdFGC/XzjWjpSgLf0LxXX3bDFIh0E18f6UhQ==} + dev: true + /object-is@1.1.5: resolution: {integrity: sha512-3cyDsyHgtmi7I7DfSSI2LDp6SK2lwvtbg0p0R1e0RvTqF5ceGx+K2dfSjm1bKDMVCFEDAQvy+o8c6a7VujOddw==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 /object-keys@1.1.1: @@ -10370,7 +11361,7 @@ packages: resolution: {integrity: sha512-1mxKf0e58bvyjSCtKYY4sRe9itRk3PJpquJOjeIkz885CczcI4IvJJDLPS72oowuSh+pBxUFROpX+TU++hxhZQ==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 has-symbols: 1.0.3 object-keys: 1.1.1 @@ -10411,7 +11402,6 @@ packages: /obuf@1.1.2: resolution: {integrity: sha512-PX1wu0AmAdPqOL1mWhqmlOd8kOIZQwGZw6rh7uby9fTc5lhaOWFLX3I6R1hrF9k3zUY40e6igsLGkDXK92LJNg==} - dev: false /on-finished@2.4.1: resolution: {integrity: sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==} @@ -10441,6 +11431,35 @@ packages: engines: {node: '>=12'} dependencies: mimic-fn: 4.0.0 + + /onnx-proto@4.0.4: + resolution: {integrity: sha512-aldMOB3HRoo6q/phyB6QRQxSt895HNNw82BNyZ2CMh4bjeKv7g/c+VpAFtJuEMVfYLMbRx61hbuqnKceLeDcDA==} + dependencies: + protobufjs: 6.11.4 + dev: false + + /onnxruntime-common@1.14.0: + resolution: {integrity: sha512-3LJpegM2iMNRX2wUmtYfeX/ytfOzNwAWKSq1HbRrKc9+uqG/FsEA0bbKZl1btQeZaXhC26l44NWpNUeXPII7Ew==} + dev: false + + /onnxruntime-node@1.14.0: + resolution: {integrity: sha512-5ba7TWomIV/9b6NH/1x/8QEeowsb+jBEvFzU6z0T4mNsFwdPqXeFUM7uxC6QeSRkEbWu3qEB0VMjrvzN/0S9+w==} + os: [win32, darwin, linux] + requiresBuild: true + dependencies: + onnxruntime-common: 1.14.0 + dev: false + optional: true + + /onnxruntime-web@1.14.0: + resolution: {integrity: sha512-Kcqf43UMfW8mCydVGcX9OMXI2VN17c0p6XvR7IPSZzBf/6lteBzXHvcEVWDPmCKuGombl997HgLqj91F11DzXw==} + dependencies: + flatbuffers: 1.12.0 + guid-typescript: 1.0.9 + long: 4.0.0 + onnx-proto: 4.0.4 + onnxruntime-common: 1.14.0 + platform: 1.3.6 dev: false /open@8.4.2: @@ -10462,12 +11481,12 @@ packages: is-wsl: 2.2.0 dev: false - /openai@4.14.1: - resolution: {integrity: sha512-aBb7DVdzSnEUBFHTbnVoitauefvjRuUHS5pa7lm1m5JmHifD+1Hff1RzxYC12ogugVcCmWT99NZNfzyD6n/0IQ==} + /openai@4.19.1: + resolution: {integrity: sha512-9TddzuZBn2xxhghGGTHLZ4EeNBGTLs3xVzh266NiSJvtUsCsZQ5yVV6H5NhnhyAkKK8uUiZOUUlUAk3HdV+4xg==} hasBin: true dependencies: - '@types/node': 18.18.7 - '@types/node-fetch': 2.6.6 + '@types/node': 18.18.12 + '@types/node-fetch': 2.6.9 abort-controller: 3.0.0 agentkeepalive: 4.5.0 digest-fetch: 1.3.0 @@ -10535,22 +11554,40 @@ packages: /os-tmpdir@1.0.2: resolution: {integrity: sha512-D2FR03Vir7FIu45XBY20mTb+/ZSWB00sjU9jdQXt83gDrI4Ztz5Fs7/yy74g2N5SVQY4xY1qDr4rNddwYRVX0g==} engines: {node: '>=0.10.0'} + dev: true /outdent@0.5.0: resolution: {integrity: sha512-/jHxFIzoMXdqPzTaCpFzAAWhpkSjZPF4Vsn6jAfNpmbH/ymsmd7Qc6VE9BGn0L6YMj6uwpQLxCECpus4ukKS9Q==} - dev: false + dev: true /p-cancelable@1.1.0: resolution: {integrity: sha512-s73XxOZ4zpt1edZYZzvhqFa6uvQc1vwUa0K0BdtIZgQMAJj9IbebH+JkgKZc9h+B05PKHLOTl4ajG1BmNrVZlw==} engines: {node: '>=6'} dev: false + /p-cancelable@2.1.1: + resolution: {integrity: sha512-BZOr3nRQHOntUjTrH8+Lh54smKHoHyur8We1V8DSMVrl5A2malOOwuJRnKRDjSnkoeBh4at6BwEnb5I7Jl31wg==} + engines: {node: '>=8'} + dev: true + + /p-event@4.2.0: + resolution: {integrity: sha512-KXatOjCRXXkSePPb1Nbi0p0m+gQAwdlbhi4wQKJPI1HsMQS9g+Sqp2o+QHziPr7eYJyOZet836KoHEVM1mwOrQ==} + engines: {node: '>=8'} + dependencies: + p-timeout: 3.2.0 + dev: true + /p-filter@2.1.0: resolution: {integrity: sha512-ZBxxZ5sL2HghephhpGAQdoskxplTwr7ICaehZwLIlfL6acuVgZPm8yBNuRAFBGEqtD/hmUeq9eqLg2ys9Xr/yw==} engines: {node: '>=8'} dependencies: p-map: 2.1.0 - dev: false + dev: true + + /p-finally@1.0.0: + resolution: {integrity: sha512-LICb2p9CB7FS+0eR1oqWnHhp0FljGLZCWBE9aix0Uye9W8LTQPwMTYVGWQWIw9RdQiDg4+epXQODwIYJtSJaow==} + engines: {node: '>=4'} + dev: true /p-limit@2.3.0: resolution: {integrity: sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==} @@ -10569,7 +11606,6 @@ packages: engines: {node: '>=6'} dependencies: p-limit: 2.3.0 - dev: false /p-locate@4.1.0: resolution: {integrity: sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==} @@ -10586,7 +11622,7 @@ packages: /p-map@2.1.0: resolution: {integrity: sha512-y3b8Kpd8OAN444hxfBbFfj1FY/RjtTd8tzYwhUqNYXx0fXx2iX4maP4Qr6qhIKbQXI02wTLAda4fYUbDagTUFw==} engines: {node: '>=6'} - dev: false + dev: true /p-map@3.0.0: resolution: {integrity: sha512-d3qXVTF/s+W+CdJ5A29wywV2n8CQQYahlgz2bFiA+4eVNJbHJodPZ+/gXwPGh0bOqA+j8S+6+ckmvLGPk1QpxQ==} @@ -10610,6 +11646,13 @@ packages: retry: 0.13.1 dev: false + /p-timeout@3.2.0: + resolution: {integrity: sha512-rhIwUycgwwKcP9yTOOFK/AKsAopjjCakVqLHePO3CC6Mir1Z99xT+R63jZxAT5lFZLa2inS5h+ZS2GvR99/FBg==} + engines: {node: '>=8'} + dependencies: + p-finally: 1.0.0 + dev: true + /p-try@2.2.0: resolution: {integrity: sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==} engines: {node: '>=6'} @@ -10649,6 +11692,10 @@ packages: semver: 6.3.1 dev: false + /packet-reader@1.0.0: + resolution: {integrity: sha512-HAKu/fG3HpHFO0AA8WE8q2g+gBJaZ9MG7fcKk+IJPLTGAD6Psw4443l+9DGRbOIh3/aXr7Phy0TjilYivJo5XQ==} + dev: false + /pako@1.0.11: resolution: {integrity: sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==} @@ -10758,7 +11805,6 @@ packages: /path-exists@3.0.0: resolution: {integrity: sha512-bpC7GYwiDYQ4wYLe+FA8lhRjhQCMcQGuSgGGqDkg/QerRWw9CmGRT0iSOVRSZJ29NMLZgIzqaljJ63oaL4NIJQ==} engines: {node: '>=4'} - dev: false /path-exists@4.0.0: resolution: {integrity: sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==} @@ -10779,7 +11825,6 @@ packages: /path-key@4.0.0: resolution: {integrity: sha512-haREypq7xkM7ErfgIyA0z+Bj4AGKlMSdlQE2jvJo6huWD1EdkKYV+G/T4nq0YEF2vgTT8kqMFKo1uHn950r4SQ==} engines: {node: '>=12'} - dev: false /path-parse@1.0.7: resolution: {integrity: sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==} @@ -10823,6 +11868,91 @@ packages: - supports-color dev: false + /pg-cloudflare@1.1.1: + resolution: {integrity: sha512-xWPagP/4B6BgFO+EKz3JONXv3YDgvkbVrGw2mTo3D6tVDQRh1e7cqVGvyR3BE+eQgAvx1XhW/iEASj4/jCWl3Q==} + requiresBuild: true + dev: false + optional: true + + /pg-connection-string@2.6.2: + resolution: {integrity: sha512-ch6OwaeaPYcova4kKZ15sbJ2hKb/VP48ZD2gE7i1J+L4MspCtBMAx8nMgz7bksc7IojCIIWuEhHibSMFH8m8oA==} + dev: false + + /pg-int8@1.0.1: + resolution: {integrity: sha512-WCtabS6t3c8SkpDBUlb1kjOs7l66xsGdKpIPZsg4wR+B3+u9UAum2odSsF9tnvxg80h4ZxLWMy4pRjOsFIqQpw==} + engines: {node: '>=4.0.0'} + + /pg-numeric@1.0.2: + resolution: {integrity: sha512-BM/Thnrw5jm2kKLE5uJkXqqExRUY/toLHda65XgFTBTFYZyopbKjBe29Ii3RbkvlsMoFwD+tHeGaCjjv0gHlyw==} + engines: {node: '>=4'} + dev: true + + /pg-pool@3.6.1(pg@8.11.3): + resolution: {integrity: sha512-jizsIzhkIitxCGfPRzJn1ZdcosIt3pz9Sh3V01fm1vZnbnCMgmGl5wvGGdNN2EL9Rmb0EcFoCkixH4Pu+sP9Og==} + peerDependencies: + pg: '>=8.0' + dependencies: + pg: 8.11.3 + dev: false + + /pg-protocol@1.6.0: + resolution: {integrity: sha512-M+PDm637OY5WM307051+bsDia5Xej6d9IR4GwJse1qA1DIhiKlksvrneZOYQq42OM+spubpcNYEo2FcKQrDk+Q==} + + /pg-types@2.2.0: + resolution: {integrity: sha512-qTAAlrEsl8s4OiEQY69wDvcMIdQN6wdz5ojQiOy6YRMuynxenON0O5oCpJI6lshc6scgAY8qvJ2On/p+CXY0GA==} + engines: {node: '>=4'} + dependencies: + pg-int8: 1.0.1 + postgres-array: 2.0.0 + postgres-bytea: 1.0.0 + postgres-date: 1.0.7 + postgres-interval: 1.2.0 + dev: false + + /pg-types@4.0.1: + resolution: {integrity: sha512-hRCSDuLII9/LE3smys1hRHcu5QGcLs9ggT7I/TCs0IE+2Eesxi9+9RWAAwZ0yaGjxoWICF/YHLOEjydGujoJ+g==} + engines: {node: '>=10'} + dependencies: + pg-int8: 1.0.1 + pg-numeric: 1.0.2 + postgres-array: 3.0.2 + postgres-bytea: 3.0.0 + postgres-date: 2.0.1 + postgres-interval: 3.0.0 + postgres-range: 1.1.3 + dev: true + + /pg@8.11.3: + resolution: {integrity: sha512-+9iuvG8QfaaUrrph+kpF24cXkH1YOOUeArRNYIxq1viYHZagBxrTno7cecY1Fa44tJeZvaoG+Djpkc3JwehN5g==} + engines: {node: '>= 8.0.0'} + peerDependencies: + pg-native: '>=3.0.1' + peerDependenciesMeta: + pg-native: + optional: true + dependencies: + buffer-writer: 2.0.0 + packet-reader: 1.0.0 + pg-connection-string: 2.6.2 + pg-pool: 3.6.1(pg@8.11.3) + pg-protocol: 1.6.0 + pg-types: 2.2.0 + pgpass: 1.0.5 + optionalDependencies: + pg-cloudflare: 1.1.1 + dev: false + + /pgpass@1.0.5: + resolution: {integrity: sha512-FdW9r/jQZhSeohs1Z3sI1yxFQNFvMcnmfuj4WBMUTxOrAyLMaTcE1aAMBiTlbMNaXvBCQuVi0R7hd8udDSP7ug==} + dependencies: + split2: 4.2.0 + dev: false + + /pgvector@0.1.5: + resolution: {integrity: sha512-T1SeomH5PkSpMHmnW8CVh6hwjkrjx/xkEMkW0MBFyxMkIEcu6pw5pQW8CNwsVXeJIE3zPdLCqYHqn1GwwT4lXw==} + engines: {node: '>= 12'} + dev: false + /picocolors@1.0.0: resolution: {integrity: sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==} @@ -10830,10 +11960,16 @@ packages: resolution: {integrity: sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==} engines: {node: '>=8.6'} + /pidtree@0.6.0: + resolution: {integrity: sha512-eG2dWTVw5bzqGRztnHExczNxt5VGsE6OwTeCG3fdUf9KBsZzO3R5OIIIzWR+iZA0NtZ+RDVdaoE2dK1cn6jH4g==} + engines: {node: '>=0.10'} + hasBin: true + dev: true + /pify@4.0.1: resolution: {integrity: sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==} engines: {node: '>=6'} - dev: false + dev: true /pirates@4.0.6: resolution: {integrity: sha512-saLsH7WeYYPiD25LDuLRRY/i+6HaPYr6G1OUlN39otzkSTxKnubR9RTxS3/Kk50s1g2JTgFwWQDQyplC5/SHZg==} @@ -10858,10 +11994,13 @@ packages: engines: {node: '>=8'} dependencies: find-up: 3.0.0 + + /platform@1.3.6: + resolution: {integrity: sha512-fnWVljUchTro6RiCFvCXBbNhJc2NijN7oIQxbwsyL0buWJPG85v81ehlHI9fXrJsMNgTofEoWIQeClKpgxFLrg==} dev: false - /portkey-ai@0.1.13: - resolution: {integrity: sha512-cCclnsbHGiFN6dz0FW29h0bixoRAsqJCkDhK56K9TRjWC6PDFaplYYaxo7SIO0Cjb0NKsjtEH5QdT0kPmirbLQ==} + /portkey-ai@0.1.16: + resolution: {integrity: sha512-EY4FRp6PZSD75Q1o1qc08DfPNTG9FnkUPN3Z1/lEvaq9iFpSO5UekcagUZaKSVhao311qjBjns+kF0rS9ht7iA==} dependencies: agentkeepalive: 4.5.0 dev: false @@ -10959,7 +12098,7 @@ packages: optional: true dependencies: lilconfig: 2.1.0 - yaml: 2.3.2 + yaml: 2.3.4 dev: true /postcss-loader@7.3.3(postcss@8.4.31)(typescript@4.9.5)(webpack@5.88.2): @@ -11301,27 +12440,94 @@ packages: source-map-js: 1.0.2 dev: false - /preferred-pm@3.1.2: - resolution: {integrity: sha512-nk7dKrcW8hfCZ4H6klWcdRknBOXWzNQByJ0oJyX97BOupsYD+FzLS4hflgEu/uPUEHZCuRfMxzCBsuWd7OzT8Q==} - engines: {node: '>=10'} - dependencies: - find-up: 5.0.0 - find-yarn-workspace-root2: 1.2.16 - path-exists: 4.0.0 - which-pm: 2.0.0 + /postgres-array@2.0.0: + resolution: {integrity: sha512-VpZrUqU5A69eQyW2c5CA1jtLecCsN2U/bD6VilrFDWq5+5UIEVO7nazS3TEcHf1zuPYO/sqGvUvW62g86RXZuA==} + engines: {node: '>=4'} dev: false - /prelude-ls@1.2.1: - resolution: {integrity: sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==} - engines: {node: '>= 0.8.0'} + /postgres-array@3.0.2: + resolution: {integrity: sha512-6faShkdFugNQCLwucjPcY5ARoW1SlbnrZjmGl0IrrqewpvxvhSLHimCVzqeuULCbG0fQv7Dtk1yDbG3xv7Veog==} + engines: {node: '>=12'} + dev: true - /prepend-http@2.0.0: - resolution: {integrity: sha512-ravE6m9Atw9Z/jjttRUZ+clIXogdghyZAuWJ3qEzjT+jI/dL1ifAqhZeC5VHzQp1MSt1+jxKkFNemj/iO7tVUA==} - engines: {node: '>=4'} + /postgres-bytea@1.0.0: + resolution: {integrity: sha512-xy3pmLuQqRBZBXDULy7KbaitYqLcmxigw14Q5sj8QBVLqEwXfeybIKVWiqAXTlcvdvb0+xkOtDbfQMOf4lST1w==} + engines: {node: '>=0.10.0'} dev: false - /prettier-plugin-organize-imports@3.2.3(prettier@3.0.3)(typescript@5.2.2): - resolution: {integrity: sha512-KFvk8C/zGyvUaE3RvxN2MhCLwzV6OBbFSkwZ2OamCrs9ZY4i5L77jQ/w4UmUr+lqX8qbaqVq6bZZkApn+IgJSg==} + /postgres-bytea@3.0.0: + resolution: {integrity: sha512-CNd4jim9RFPkObHSjVHlVrxoVQXz7quwNFpz7RY1okNNme49+sVyiTvTRobiLV548Hx/hb1BG+iE7h9493WzFw==} + engines: {node: '>= 6'} + dependencies: + obuf: 1.1.2 + dev: true + + /postgres-date@1.0.7: + resolution: {integrity: sha512-suDmjLVQg78nMK2UZ454hAG+OAW+HQPZ6n++TNDUX+L0+uUlLywnoxJKDou51Zm+zTCjrCl0Nq6J9C5hP9vK/Q==} + engines: {node: '>=0.10.0'} + dev: false + + /postgres-date@2.0.1: + resolution: {integrity: sha512-YtMKdsDt5Ojv1wQRvUhnyDJNSr2dGIC96mQVKz7xufp07nfuFONzdaowrMHjlAzY6GDLd4f+LUHHAAM1h4MdUw==} + engines: {node: '>=12'} + dev: true + + /postgres-interval@1.2.0: + resolution: {integrity: sha512-9ZhXKM/rw350N1ovuWHbGxnGh/SNJ4cnxHiM0rxE4VN41wsg8P8zWn9hv/buK00RP4WvlOyr/RBDiptyxVbkZQ==} + engines: {node: '>=0.10.0'} + dependencies: + xtend: 4.0.2 + dev: false + + /postgres-interval@3.0.0: + resolution: {integrity: sha512-BSNDnbyZCXSxgA+1f5UU2GmwhoI0aU5yMxRGO8CdFEcY2BQF9xm/7MqKnYoM1nJDk8nONNWDk9WeSmePFhQdlw==} + engines: {node: '>=12'} + dev: true + + /postgres-range@1.1.3: + resolution: {integrity: sha512-VdlZoocy5lCP0c/t66xAfclglEapXPCIVhqqJRncYpvbCgImF0w67aPKfbqUMr72tO2k5q0TdTZwCLjPTI6C9g==} + dev: true + + /prebuild-install@7.1.1: + resolution: {integrity: sha512-jAXscXWMcCK8GgCoHOfIr0ODh5ai8mj63L2nWrjuAgXE6tDyYGnx4/8o/rCgU+B4JSyZBKbeZqzhtwtC3ovxjw==} + engines: {node: '>=10'} + hasBin: true + dependencies: + detect-libc: 2.0.2 + expand-template: 2.0.3 + github-from-package: 0.0.0 + minimist: 1.2.8 + mkdirp-classic: 0.5.3 + napi-build-utils: 1.0.2 + node-abi: 3.51.0 + pump: 3.0.0 + rc: 1.2.8 + simple-get: 4.0.1 + tar-fs: 2.1.1 + tunnel-agent: 0.6.0 + dev: false + + /preferred-pm@3.1.2: + resolution: {integrity: sha512-nk7dKrcW8hfCZ4H6klWcdRknBOXWzNQByJ0oJyX97BOupsYD+FzLS4hflgEu/uPUEHZCuRfMxzCBsuWd7OzT8Q==} + engines: {node: '>=10'} + dependencies: + find-up: 5.0.0 + find-yarn-workspace-root2: 1.2.16 + path-exists: 4.0.0 + which-pm: 2.0.0 + dev: true + + /prelude-ls@1.2.1: + resolution: {integrity: sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==} + engines: {node: '>= 0.8.0'} + + /prepend-http@2.0.0: + resolution: {integrity: sha512-ravE6m9Atw9Z/jjttRUZ+clIXogdghyZAuWJ3qEzjT+jI/dL1ifAqhZeC5VHzQp1MSt1+jxKkFNemj/iO7tVUA==} + engines: {node: '>=4'} + dev: false + + /prettier-plugin-organize-imports@3.2.4(prettier@3.1.0)(typescript@5.3.2): + resolution: {integrity: sha512-6m8WBhIp0dfwu0SkgfOxJqh+HpdyfqSSLfKKRZSFbDuEQXDDndb8fTpRWkUrX/uBenkex3MgnVk0J3b3Y5byog==} peerDependencies: '@volar/vue-language-plugin-pug': ^1.0.4 '@volar/vue-typescript': ^1.0.4 @@ -11333,18 +12539,18 @@ packages: '@volar/vue-typescript': optional: true dependencies: - prettier: 3.0.3 - typescript: 5.2.2 + prettier: 3.1.0 + typescript: 5.3.2 dev: true /prettier@2.8.8: resolution: {integrity: sha512-tdN8qQGvNjw4CHbY+XXk0JgCXn9QiF21a55rBe5LJAU+kDyC4WQn4+awm2Xfk2lQMk5fKup9XgzTZtGkjBdP9Q==} engines: {node: '>=10.13.0'} hasBin: true - dev: false + dev: true - /prettier@3.0.3: - resolution: {integrity: sha512-L/4pUDMxcNa8R/EthV08Zt42WBO4h1rarVtK0K+QJG0X187OLo7l699jWw0GKuwzkPQ//jMFA/8Xm6Fh3J/DAg==} + /prettier@3.1.0: + resolution: {integrity: sha512-TQLvXjq5IAibjh8EpBIkNKxO749UEWABoiIZehEPiY4GNpVdhaFKqSTu+QrlU6D2dPAfubRmtJTi4K4YkQ5eXw==} engines: {node: '>=14'} hasBin: true dev: true @@ -11398,6 +12604,14 @@ packages: asap: 2.0.6 dev: false + /prompts@2.1.0: + resolution: {integrity: sha512-+x5TozgqYdOwWsQFZizE/Tra3fKvAoy037kOyU6cgz84n8f6zxngLOV4O32kTwt9FcLCxAqw0P/c8rOr9y+Gfg==} + engines: {node: '>= 6'} + dependencies: + kleur: 3.0.3 + sisteransi: 1.0.5 + dev: true + /prompts@2.4.2: resolution: {integrity: sha512-NxNv/kLguCA7p3jE8oL2aEBsrJWgAakBpgmgK6lpPWV+WuOmY6r2/zbAVnP+T8bQlA0nzHXSJSJW0Hq7ylaD2Q==} engines: {node: '>= 6'} @@ -11418,6 +12632,26 @@ packages: xtend: 4.0.2 dev: false + /protobufjs@6.11.4: + resolution: {integrity: sha512-5kQWPaJHi1WoCpjTGszzQ32PG2F4+wRY6BmAT4Vfw56Q2FZ4YZzK20xUYQH4YkfehY1e6QSICrJquM6xXZNcrw==} + hasBin: true + requiresBuild: true + dependencies: + '@protobufjs/aspromise': 1.1.2 + '@protobufjs/base64': 1.1.2 + '@protobufjs/codegen': 2.0.4 + '@protobufjs/eventemitter': 1.1.0 + '@protobufjs/fetch': 1.1.0 + '@protobufjs/float': 1.0.2 + '@protobufjs/inquire': 1.1.0 + '@protobufjs/path': 1.1.2 + '@protobufjs/pool': 1.1.0 + '@protobufjs/utf8': 1.1.0 + '@types/long': 4.0.2 + '@types/node': 18.18.12 + long: 4.0.0 + dev: false + /proxy-addr@2.0.7: resolution: {integrity: sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==} engines: {node: '>= 0.10'} @@ -11448,7 +12682,7 @@ packages: /pseudomap@1.0.2: resolution: {integrity: sha512-b/YwNhb8lk1Zz2+bXXpS/LK9OisiZZ1SNsSLxN1x2OXVEhW2Ckr/7mWE5vrC1ZTiJlD9g19jWszTmJsB+oEpFQ==} - dev: false + dev: true /public-encrypt@4.0.3: resolution: {integrity: sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==} @@ -11466,13 +12700,12 @@ packages: dependencies: end-of-stream: 1.4.4 once: 1.4.0 - dev: false /punycode@1.4.1: resolution: {integrity: sha512-jmYNElW7yvO7TV33CjSmvSiE2yco3bV2czu/OzDKdMNVZQWfxCblURLhf+47syQRBntjfLdd/H0egrzIG+oaFQ==} - /punycode@2.3.0: - resolution: {integrity: sha512-rRV+zQD8tVFys26lAGR9WUuS4iUAngJScM+ZRSKtvl5tKeZ2t5bvdNFdNHBW9FWR4guGHlgmsZ1G7BSm2wTbuA==} + /punycode@2.3.1: + resolution: {integrity: sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==} engines: {node: '>=6'} /pupa@2.1.1: @@ -11512,6 +12745,10 @@ packages: /queue-microtask@1.2.3: resolution: {integrity: sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==} + /queue-tick@1.0.1: + resolution: {integrity: sha512-kJt5qhMxoszgU/62PLP1CJytzd2NKetjSRnyuj31fDd3Rlcz3fzlFdFLD1SItunPwyqEOkca6GbV612BWfaBag==} + dev: false + /queue@6.0.2: resolution: {integrity: sha512-iHZWu+q3IdFZFX36ro/lKBkSvfkztY5Y7HMiPlOUjhupPcG2JMfst2KKEpu5XndviX/3UhFbRngUPNKtgvtZiA==} dependencies: @@ -11521,7 +12758,7 @@ packages: /quick-lru@4.0.1: resolution: {integrity: sha512-ARhCpm70fzdcvNQfPoy49IaanKkTlRWF2JMzqhcJbhSFRZv7nPTvZJdcY7301IPmvW+/p0RgIWnQDLJxifsQ7g==} engines: {node: '>=8'} - dev: false + dev: true /rake-modified@1.0.8: resolution: {integrity: sha512-rj/1t+EyI8Ly52eaCeSy5hoNpdNnDlNQ/+jll2DypR6nkuxotMbaupzwbuMSaXzuSL1I2pYVYy7oPus/Ls49ag==} @@ -11593,7 +12830,7 @@ packages: unpipe: 1.0.0 dev: false - /raw-loader@4.0.2(webpack@5.88.2): + /raw-loader@4.0.2(webpack@5.89.0): resolution: {integrity: sha512-ZnScIV3ag9A4wPX/ZayxL/jZH+euYb6FcUinPcgiQW0+UBtEv0O6Q3lGd3cqJ+GHH+rksEv3Pj99oxJ3u3VIKA==} engines: {node: '>= 10.13.0'} peerDependencies: @@ -11601,7 +12838,7 @@ packages: dependencies: loader-utils: 2.0.4 schema-utils: 3.3.0 - webpack: 5.88.2 + webpack: 5.89.0 dev: false /rc@1.2.8: @@ -11622,7 +12859,7 @@ packages: pure-color: 1.3.0 dev: false - /react-dev-utils@12.0.1(eslint@8.52.0)(typescript@4.9.5)(webpack@5.88.2): + /react-dev-utils@12.0.1(eslint@8.54.0)(typescript@4.9.5)(webpack@5.88.2): resolution: {integrity: sha512-84Ivxmr17KjUupyqzFode6xKhjwuEJDROWKJy/BthkL7Wn6NJ8h4WE6k/exAv6ImS+0oZLRRW5j/aINMHyeGeQ==} engines: {node: '>=14'} peerDependencies: @@ -11641,7 +12878,7 @@ packages: escape-string-regexp: 4.0.0 filesize: 8.0.7 find-up: 5.0.0 - fork-ts-checker-webpack-plugin: 6.5.3(eslint@8.52.0)(typescript@4.9.5)(webpack@5.88.2) + fork-ts-checker-webpack-plugin: 6.5.3(eslint@8.54.0)(typescript@4.9.5)(webpack@5.88.2) global-modules: 2.0.0 globby: 11.1.0 gzip-size: 6.0.0 @@ -11823,17 +13060,17 @@ packages: find-up: 4.1.0 read-pkg: 5.2.0 type-fest: 0.8.1 - dev: false + dev: true /read-pkg@5.2.0: resolution: {integrity: sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==} engines: {node: '>=8'} dependencies: - '@types/normalize-package-data': 2.4.2 + '@types/normalize-package-data': 2.4.4 normalize-package-data: 2.5.0 parse-json: 5.2.0 type-fest: 0.6.0 - dev: false + dev: true /read-yaml-file@1.1.0: resolution: {integrity: sha512-VIMnQi/Z4HT2Fxuwg5KrY174U1VdUIASQVWXXyqtNRtxSr9IYkn1rsI6Tb6HsrHCmB7gVpNwX6JxPTHcH6IoTA==} @@ -11843,7 +13080,7 @@ packages: js-yaml: 3.14.1 pify: 4.0.1 strip-bom: 3.0.0 - dev: false + dev: true /readable-stream@2.3.8: resolution: {integrity: sha512-8p0AUk4XODgIewSi0l8Epjs+EVnWiK7NoDIEGU0HhE7+ZyY8D1IMY7odu5lRrFXGg71L15KG8QrPmum45RTtdA==} @@ -11879,7 +13116,7 @@ packages: resolution: {integrity: sha512-HFM8rkZ+i3zrV+4LQjwQ0W+ez98pApMGM3HUrN04j3CqzPOzl9nmP15Y8YXNm8QHGv/eacOVEjqhmWpkRV0NAw==} engines: {node: '>= 0.10'} dependencies: - resolve: 1.22.6 + resolve: 1.22.8 dev: false /recursive-readdir@2.2.3: @@ -11895,7 +13132,7 @@ packages: dependencies: indent-string: 4.0.0 strip-indent: 3.0.0 - dev: false + dev: true /regenerate-unicode-properties@10.1.1: resolution: {integrity: sha512-X007RyZLsCJVVrjgEFVpLUTZwyOZk3oiL75ZcuYjlIWd6rNJtOjkBwQc5AsRrpbKVkxN6sklw/k/9m2jJYOf8Q==} @@ -11934,10 +13171,10 @@ packages: resolution: {integrity: sha512-sy6TXMN+hnP/wMy+ISxg3krXx7BAtWVO4UouuCN/ziM9UEne0euamVNafDfvC83bRNr95y0V5iijeDQFUNpvrg==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 set-function-name: 2.0.1 - dev: false + dev: true /regexpu-core@5.3.2: resolution: {integrity: sha512-RAM5FlZz+Lhmo7db9L298p2vHP5ZywrVXmVXpmAD9GuL5MPH6t9ROw1iA/wfHkQ76Qe7AaPF0nGuim96/IrQMQ==} @@ -12060,19 +13297,19 @@ packages: engines: {node: '>=0.10'} dev: false - /replicate@0.20.1: - resolution: {integrity: sha512-QVyI1rowGsSfNuDrRmumYPdCHa/fN/RkI3NHpcK0i5hSSiWK69URAyheAC/0MIAiS3oUs4kD56PB9zEI4oHENw==} + /replicate@0.21.1: + resolution: {integrity: sha512-ftR416+tuD55u6Rz0s5QsxoC2ZasslyFg9jxytirPhqFQwTQy9arU0vF29811t4iws8cMc+neL0IUzyq0pFlkQ==} engines: {git: '>=2.11.0', node: '>=18.0.0', npm: '>=7.19.0', yarn: '>=1.7.0'} dev: false /require-directory@2.1.1: resolution: {integrity: sha512-fGxEI7+wsG9xrvdjsrlmL22OMTTiHRwAMroiEeMgq8gzoLC/PQr7RsRDSTLUg/bZAZtF+TVIkHc6/4RIKrui+Q==} engines: {node: '>=0.10.0'} + dev: true /require-from-string@2.0.2: resolution: {integrity: sha512-Xf0nWe6RseziFMu+Ap9biiUbmplq6S9/p+7w7YXP/JBHhrUDDUhwa+vANyubuqfZWTveU//DYVGsDG7RKL/vEw==} engines: {node: '>=0.10.0'} - dev: false /require-like@0.1.2: resolution: {integrity: sha512-oyrU88skkMtDdauHDuKVrgR+zuItqr6/c//FXzvmxRGMexSDc6hNvJInGW3LL46n+8b50RykrvwSUIIQH2LQ5A==} @@ -12080,7 +13317,7 @@ packages: /require-main-filename@2.0.0: resolution: {integrity: sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==} - dev: false + dev: true /requires-port@1.0.0: resolution: {integrity: sha512-KigOCHcocU3XODJxsu8i/j8T9tzT4adHiecwORRQ0ZZFcp7ahwXuRU1m+yuO90C5ZUyGeGfocHDI14M3L3yDAQ==} @@ -12100,6 +13337,7 @@ packages: /resolve-from@5.0.0: resolution: {integrity: sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw==} engines: {node: '>=8'} + dev: true /resolve-pathname@3.0.0: resolution: {integrity: sha512-C7rARubxI8bXFNB/hqcp/4iUeIXJhJZvFPFPiSPRnhU5UPxzMFIl+2E6yY6c4k9giDJAhtV+enfA+G89N6Csng==} @@ -12119,23 +13357,14 @@ packages: supports-preserve-symlinks-flag: 1.0.0 dev: false - /resolve@1.22.6: - resolution: {integrity: sha512-njhxM7mV12JfufShqGy3Rz8j11RPdLy4xi15UurGJeoHLfJpVXKdh3ueuOqbYUcDZnffr6X739JBo5LzyahEsw==} + /resolve@1.22.8: + resolution: {integrity: sha512-oKWePCxqpd6FlLvGV1VU0x7bkPmmCNolxzjMf4NczoDnQcIWrAF+cPtZn5i6n+RfD2d9i0tzpKnG6Yk168yIyw==} hasBin: true dependencies: - is-core-module: 2.13.0 + is-core-module: 2.13.1 path-parse: 1.0.7 supports-preserve-symlinks-flag: 1.0.0 - /resolve@1.22.7: - resolution: {integrity: sha512-YiXAr29s3pviTexp8YEMKtdQDeFxk74jt/w5Viiw7SAVC9McgYD/GVaVyJ18pNCF/VIvzMtsk+zHwJp+YQWCKA==} - hasBin: true - dependencies: - is-core-module: 2.13.0 - path-parse: 1.0.7 - supports-preserve-symlinks-flag: 1.0.0 - dev: true - /resolve@2.0.0-next.4: resolution: {integrity: sha512-iMDbmAWtfU+MHpxt/I5iWI7cY6YVEZUQ3MBgPQ++XD1PELuJHIl82xBmObyP2KyQmkNB2dsqF7seoQQiAn5yDQ==} hasBin: true @@ -12151,6 +13380,12 @@ packages: lowercase-keys: 1.0.1 dev: false + /responselike@2.0.1: + resolution: {integrity: sha512-4gl03wn3hj1HP3yzgdI7d3lCkF95F21Pz4BPGvKHinyQzALR5CapwC8yIi0Rh58DEMQ/SguC03wFj2k0M/mHhw==} + dependencies: + lowercase-keys: 2.0.0 + dev: true + /restore-cursor@3.1.0: resolution: {integrity: sha512-l+sSefzHpj5qimhFSE5a8nufZYAM3sBSVMAPtYkmC+4EH2anSGaEMXSD0izRQbu9nfyQ9y5JrVmp7E8oZrUjvA==} engines: {node: '>=8'} @@ -12159,6 +13394,19 @@ packages: signal-exit: 3.0.7 dev: true + /restore-cursor@4.0.0: + resolution: {integrity: sha512-I9fPXU9geO9bHOt9pHHOhOkYerIMsmVaWB0rA2AI9ERh/+x/i7MV5HKBNrg+ljO5eoPVgCcnFuRjJ9uH6I/3eg==} + engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0} + dependencies: + onetime: 5.1.2 + signal-exit: 3.0.7 + dev: true + + /retry@0.12.0: + resolution: {integrity: sha512-9LkiTwjUh6rT555DtE9rTX+BKByPfrMzEAtnlEtdEwr3Nkffwiihqe2bWADg+OQRjt9gl6ICdmB/ZFDCGAtSow==} + engines: {node: '>= 4'} + dev: true + /retry@0.13.1: resolution: {integrity: sha512-XQBQ3I8W1Cge0Seh+6gjj03LbmRFWuoszgK9ooCpwYIrhhoO80pfq4cUkU5DkknwfOfFteRwlZ56PYOGYyFWdg==} engines: {node: '>= 4'} @@ -12170,7 +13418,6 @@ packages: /rfdc@1.3.0: resolution: {integrity: sha512-V2hovdzFbOi77/WajaSMXk2OLm+xNIeQdMMuB7icj7bk6zi2F8GGAxigcnDFpJHbNyNcgyJDiP+8nOrY5cZGrA==} - dev: false /rimraf@3.0.2: resolution: {integrity: sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==} @@ -12240,11 +13487,11 @@ packages: resolution: {integrity: sha512-6XbUAseYE2KtOuGueyeobCySj9L4+66Tn6KQMOPQJrAJEowYKW/YR/MGJZl7FdydUdaFu4LYyDZjxf4/Nmo23Q==} engines: {node: '>=0.4'} dependencies: - call-bind: 1.0.2 - get-intrinsic: 1.2.1 + call-bind: 1.0.5 + get-intrinsic: 1.2.2 has-symbols: 1.0.3 isarray: 2.0.5 - dev: false + dev: true /safe-buffer@5.1.2: resolution: {integrity: sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==} @@ -12259,7 +13506,6 @@ packages: call-bind: 1.0.2 get-intrinsic: 1.2.0 is-regex: 1.1.4 - dev: false /safer-buffer@2.1.2: resolution: {integrity: sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==} @@ -12316,8 +13562,8 @@ packages: ajv-keywords: 5.1.0(ajv@8.12.0) dev: false - /search-insights@2.8.3: - resolution: {integrity: sha512-W9rZfQ9XEfF0O6ntgQOTI7Txc8nkZrO4eJ/pTHK0Br6wWND2sPGPoWg+yGhdIW7wMbLqk8dc23IyEtLlNGpeNw==} + /search-insights@2.10.0: + resolution: {integrity: sha512-pQGrOE56QuTRmq4NzliRZe9rv914hBMBjOviuDliDHoIhmBGoyZRlFsPd4RprGGNC4PKdD2Jz54YN4Cmkb44mA==} dev: false /section-matter@1.0.0: @@ -12349,7 +13595,6 @@ packages: /semver@5.7.2: resolution: {integrity: sha512-cBznnQ9KjJqU67B52RMC65CMarK2600WFnbkcaiwWq3xy/5haFJlshgnpjovMVJ+Hff49d8GEn0b87C5pDQ10g==} hasBin: true - dev: false /semver@6.3.0: resolution: {integrity: sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==} @@ -12442,16 +13687,25 @@ packages: /set-blocking@2.0.0: resolution: {integrity: sha512-KiKBS8AnWGEyLzofFfmvKwpdPzqiy16LvQfK3yv/fVH7Bj13/wl3JSR1J+rfgRE9q7xUJK4qvgS8raSOeLUehw==} - dev: false + dev: true + + /set-function-length@1.1.1: + resolution: {integrity: sha512-VoaqjbBJKiWtg4yRcKBQ7g7wnGnLV3M8oLvVWwOk2PdYY6PEFegR1vezXR0tw6fZGF9csVakIRjrJiy2veSBFQ==} + engines: {node: '>= 0.4'} + dependencies: + define-data-property: 1.1.1 + get-intrinsic: 1.2.2 + gopd: 1.0.1 + has-property-descriptors: 1.0.1 /set-function-name@2.0.1: resolution: {integrity: sha512-tMNCiqYVkXIZgc2Hnoy2IvC/f8ezc5koaRFkCjrpWzGpCd3qbZXPzVy9MAZzK1ch/X0jvSkojys3oqJN0qCmdA==} engines: {node: '>= 0.4'} dependencies: - define-data-property: 1.1.0 + define-data-property: 1.1.1 functions-have-names: 1.2.3 - has-property-descriptors: 1.0.0 - dev: false + has-property-descriptors: 1.0.1 + dev: true /setimmediate@1.0.5: resolution: {integrity: sha512-MATJdZp8sLqDl/68LfQmbP8zKPLQNV6BIZoIgrscFDQ+RsvK/BxeDQOgyxKKoh0y/8h3BqVFnCqQ/gd+reiIXA==} @@ -12481,12 +13735,27 @@ packages: /shallowequal@1.1.0: resolution: {integrity: sha512-y0m1JoUZSlPAjXVtPPW70aZWfIL/dSP7AFkRnniLCrK/8MDKog3TySTBmckD+RObVxH0v4Tox67+F14PdED2oQ==} + /sharp@0.32.6: + resolution: {integrity: sha512-KyLTWwgcR9Oe4d9HwCwNM2l7+J0dUQwn/yf7S0EnTtb0eVS4RxO0eUSvxPtzT4F3SY+C4K6fqdv/DO27sJ/v/w==} + engines: {node: '>=14.15.0'} + requiresBuild: true + dependencies: + color: 4.2.3 + detect-libc: 2.0.2 + node-addon-api: 6.1.0 + prebuild-install: 7.1.1 + semver: 7.5.4 + simple-get: 4.0.1 + tar-fs: 3.0.4 + tunnel-agent: 0.6.0 + dev: false + /shebang-command@1.2.0: resolution: {integrity: sha512-EV3L1+UQWGor21OmnvojK36mhg+TyIKDh3iFBKBohr5xeXIhNBcx8oWdgkTEEQ+BEFFYdLRuqMfd5L84N1V5Vg==} engines: {node: '>=0.10.0'} dependencies: shebang-regex: 1.0.0 - dev: false + dev: true /shebang-command@2.0.0: resolution: {integrity: sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==} @@ -12497,7 +13766,7 @@ packages: /shebang-regex@1.0.0: resolution: {integrity: sha512-wpoSFAxys6b2a2wHZ1XpDSgD7N9iVjg29Ph9uV/uaP9Ex/KXlkTZTeddxDPSYQpgvzKLGJke2UU0AzoGCjNIvQ==} engines: {node: '>=0.10.0'} - dev: false + dev: true /shebang-regex@3.0.0: resolution: {integrity: sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==} @@ -12536,6 +13805,29 @@ packages: /signal-exit@3.0.7: resolution: {integrity: sha512-wnD2ZE+l+SPC/uoS0vXeE9L1+0wuaMqKlfz9AMUo38JsyLSBWSFcHR1Rri62LZc12vLr1gb3jl7iwQhgwpAbGQ==} + /signal-exit@4.1.0: + resolution: {integrity: sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw==} + engines: {node: '>=14'} + dev: true + + /simple-concat@1.0.1: + resolution: {integrity: sha512-cSFtAPtRhljv69IK0hTVZQ+OfE9nePi/rtJmw5UjHeVyVroEqJXP1sFztKUy1qU+xvz3u/sfYJLa947b7nAN2Q==} + dev: false + + /simple-get@4.0.1: + resolution: {integrity: sha512-brv7p5WgH0jmQJr1ZDDfKDOSeWWg+OVypG99A/5vYGPqJ6pxiaHLy8nxtFjBA7oMa01ebA9gfh1uMCFqOuXxvA==} + dependencies: + decompress-response: 6.0.0 + once: 1.4.0 + simple-concat: 1.0.1 + dev: false + + /simple-swizzle@0.2.2: + resolution: {integrity: sha512-JA//kQgZtbuY83m+xT+tXJkmJncGMTFT+C+g2h2R9uxkYIrE2yy9sgmcLhCnw57/WSD+Eh3J97FPEDFnbXnDUg==} + dependencies: + is-arrayish: 0.3.2 + dev: false + /sirv@2.0.3: resolution: {integrity: sha512-O9jm9BsID1P+0HOi81VpXPoDxYP374pkOLzACAoyUQ/3OUVndNpsz6wMnY2z+yOxzbllCKZrM+9QrWsv4THnyA==} engines: {node: '>= 10'} @@ -12568,6 +13860,14 @@ packages: engines: {node: '>=12'} dev: false + /slice-ansi@5.0.0: + resolution: {integrity: sha512-FC+lgizVPfie0kkhqUScwRu1O/lF6NOgJmlCgK+/LYxDCTk8sGelYaHDhFcDN+Sn3Cv+3VSa4Byeo+IMCzpMgQ==} + engines: {node: '>=12'} + dependencies: + ansi-styles: 6.2.1 + is-fullwidth-code-point: 4.0.0 + dev: true + /smart-buffer@4.2.0: resolution: {integrity: sha512-94hK0Hh8rPqQl2xXc3HsaBoOXKV20MToPkcXvwbISWLEs+64sBq5kFgn2kJDHb1Pry9yrP0dxrCI9RRci7RXKg==} engines: {node: '>= 6.0.0', npm: '>= 3.0.0'} @@ -12584,7 +13884,7 @@ packages: strip-ansi: 6.0.1 wcwidth: 1.0.1 yargs: 15.4.1 - dev: false + dev: true /snake-case@2.1.0: resolution: {integrity: sha512-FMR5YoPFwOLuh4rRz92dywJjyKYZNLpMn1R5ujVpIYkbA9p01fq8RMg0FkO4M+Yobt4MjHeLTJVm5xFFBHSV2Q==} @@ -12672,29 +13972,29 @@ packages: dependencies: cross-spawn: 5.1.0 signal-exit: 3.0.7 - dev: false + dev: true /spdx-correct@3.2.0: resolution: {integrity: sha512-kN9dJbvnySHULIluDHy32WHRUu3Og7B9sbY7tsFLctQkIqnMh3hErYgdMjTYuqmcXX+lK5T1lnUt3G7zNswmZA==} dependencies: spdx-expression-parse: 3.0.1 spdx-license-ids: 3.0.16 - dev: false + dev: true /spdx-exceptions@2.3.0: resolution: {integrity: sha512-/tTrYOC7PPI1nUAgx34hUpqXuyJG+DTHJTnIULG4rDygi4xu/tfgmq1e1cIRwRzwZgo4NLySi+ricLkZkw4i5A==} - dev: false + dev: true /spdx-expression-parse@3.0.1: resolution: {integrity: sha512-cbqHunsQWnJNE6KhVSMsMeH5H/L9EpymbzqTQ3uLwNCLZ1Q481oWaofqH7nO6V07xlXwY6PhQdQ2IedWx/ZK4Q==} dependencies: spdx-exceptions: 2.3.0 spdx-license-ids: 3.0.16 - dev: false + dev: true /spdx-license-ids@3.0.16: resolution: {integrity: sha512-eWN+LnM3GR6gPu35WxNgbGl8rmY1AEmoMDvL/QD6zYmPWgywxWqJWNdLGT+ke8dKNWrcYgYjPpG5gbTfghP8rw==} - dev: false + dev: true /spdy-transport@3.0.0: resolution: {integrity: sha512-hsLVFE5SjA6TCisWeJXFKniGGOpBgMLmerfO2aCyCU5s7nJ/rpAepqmFifv/GCbSbueEeAJJnmSQ2rKC/g8Fcw==} @@ -12722,6 +14022,11 @@ packages: - supports-color dev: false + /split2@4.2.0: + resolution: {integrity: sha512-UcjcJOWknrNkF6PLX83qcHM6KHgVKNkV62Y8a5uYDVv9ydGQVwAHMKqHdJje1VTWpljG0WYpCDhrCdAOYH4TWg==} + engines: {node: '>= 10.x'} + dev: false + /sprintf-js@1.0.3: resolution: {integrity: sha512-D9cPgkvLlV3t3IzL0D0YLvGA9Ahk4PcvVwUbN0dSGr1aP0Nrt4AEnTUbuGvquEC0mA64Gqt1fzirlRs5ibXx8g==} @@ -12782,13 +14087,25 @@ packages: resolution: {integrity: sha512-9GHUiM5hMiCi6Y03jD2ARC1ettBXkQBoQAe7nJsPknnI0ow10aXjTnew8QtYQmLjzn974BnmWEAJgCY6ZP1DeQ==} dependencies: mixme: 0.5.9 - dev: false + dev: true /streamsearch@1.1.0: resolution: {integrity: sha512-Mcc5wHehp9aXz1ax6bZUyY5afg9u2rv5cqQI3mRrYkGC8rW2hM02jWuwjtL++LS5qinSyhj2QfLyNsuc+VsExg==} engines: {node: '>=10.0.0'} dev: true + /streamx@2.15.5: + resolution: {integrity: sha512-9thPGMkKC2GctCzyCUjME3yR03x2xNo0GPKGkRw2UMYN+gqWa9uqpyNWhmsNCutU5zHmkUum0LsCRQTXUgUCAg==} + dependencies: + fast-fifo: 1.3.2 + queue-tick: 1.0.1 + dev: false + + /string-argv@0.3.2: + resolution: {integrity: sha512-aqD2Q0144Z+/RqG52NeHEkZauTAUWJO8c6yTftGJKO3Tja5tUgIfmIl6kExvhtxSDP7fXB6DvzkfMpCd/F3G+Q==} + engines: {node: '>=0.6.19'} + dev: true + /string-collapse-leading-whitespace@7.0.6: resolution: {integrity: sha512-FqOnt9H0+eeXukBb3Js2qPLLI0T5ebp96TfU0+AwoAuQQidETeoRMYJG6mUYebP4SBYZkap+HbAK6U/wGWxJvA==} engines: {node: '>=14.18.0'} @@ -12843,7 +14160,6 @@ packages: eastasianwidth: 0.2.0 emoji-regex: 9.2.2 strip-ansi: 7.1.0 - dev: false /string.prototype.matchall@4.0.8: resolution: {integrity: sha512-6zOCOcJ+RJAQshcTvXPHoxoQGONa3e/Lqx90wUA+wEzX78sg5Bo+1tQo4N0pohS0erG9qtCqJDjNCQBjeWVxyg==} @@ -12871,10 +14187,10 @@ packages: resolution: {integrity: sha512-lfjY4HcixfQXOfaqCvcBuOIapyaroTXhbkfJN3gcB1OtyupngWK4sEET9Knd0cXd28kTUqu/kHoV4HKSJdnjiQ==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 - es-abstract: 1.22.2 - dev: false + es-abstract: 1.22.3 + dev: true /string.prototype.trimend@1.0.6: resolution: {integrity: sha512-JySq+4mrPf9EsDBEDYMOb/lM7XQLulwg5R/m1r0PXEFqrV0qHvl58sdTilSXtKOflCsK2E8jxf+GKC0T07RWwQ==} @@ -12887,10 +14203,10 @@ packages: /string.prototype.trimend@1.0.7: resolution: {integrity: sha512-Ni79DqeB72ZFq1uH/L6zJ+DKZTkOtPIHovb3YZHQViE+HDouuU4mBrLOLDn5Dde3RF8qw5qVETEjhu9locMLvA==} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 - es-abstract: 1.22.2 - dev: false + es-abstract: 1.22.3 + dev: true /string.prototype.trimstart@1.0.6: resolution: {integrity: sha512-omqjMDaY92pbn5HOX7f9IccLA+U1tA9GvtU4JrodiXFfYB7jPzzHpRzpglLAjtUV6bB557zwClJezTqnAiYnQA==} @@ -12903,10 +14219,10 @@ packages: /string.prototype.trimstart@1.0.7: resolution: {integrity: sha512-NGhtDFu3jCEm7B4Fy0DpLewdJQOZcQ0rGbwQ/+stjnrp2i+rlKeCvos9hOIeCmqwratM47OBxY7uFZzjxHXmrg==} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 define-properties: 1.2.1 - es-abstract: 1.22.2 - dev: false + es-abstract: 1.22.3 + dev: true /string_decoder@1.1.1: resolution: {integrity: sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==} @@ -12939,7 +14255,6 @@ packages: engines: {node: '>=12'} dependencies: ansi-regex: 6.0.1 - dev: false /strip-bom-string@1.0.0: resolution: {integrity: sha512-uCC2VHvQRYu+lMh4My/sFNmF2klFymLX1wHJeXnbEJERpV/ZsVuonzerjfrGpIGF7LBVa1O7i9kjiWvJiFck8g==} @@ -12949,7 +14264,6 @@ packages: /strip-bom@3.0.0: resolution: {integrity: sha512-vavAMRXOgBVNF6nyEEmL3DBK19iRpDcoIwW+swQ+CbGiu7lju6t+JklA1MHweoWtadgt4ISVUsXLyDq34ddcwA==} engines: {node: '>=4'} - dev: false /strip-bom@4.0.0: resolution: {integrity: sha512-3xurFv5tEgii33Zi8Jtp55wEIILR9eh34FAW00PZf+JnSsTmV/ioewSgQl97JHvgjoRGwPShsWm+IdrxB35d0w==} @@ -12963,14 +14277,13 @@ packages: /strip-final-newline@3.0.0: resolution: {integrity: sha512-dOESqjYr96iWYylGObzd39EuNTa5VJxyvVAEm5Jnh7KGo75V43Hk1odPQkNDyXNmUR6k+gEiDVXnjB8HJ3crXw==} engines: {node: '>=12'} - dev: false /strip-indent@3.0.0: resolution: {integrity: sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==} engines: {node: '>=8'} dependencies: min-indent: 1.0.1 - dev: false + dev: true /strip-json-comments@2.0.1: resolution: {integrity: sha512-4gB8na07fecVVkOI6Rs4e7T6NOTki5EmL7TUduTs6bu3EdnSycntVJ4re8kgZA+wx9IueI2Y11bfbgwtzuE0KQ==} @@ -12986,7 +14299,7 @@ packages: inline-style-parser: 0.1.1 dev: false - /styled-jsx@5.1.1(@babel/core@7.23.0)(react@18.2.0): + /styled-jsx@5.1.1(@babel/core@7.23.3)(react@18.2.0): resolution: {integrity: sha512-pW7uC1l4mBZ8ugbiZrcIsiIvVx1UmTfw7UkC3Um2tmfUq9Bhk8IiyEIPl6F8agHgjzku6j0xQEZbfA5uSgSaCw==} engines: {node: '>= 12.0.0'} peerDependencies: @@ -12999,7 +14312,7 @@ packages: babel-plugin-macros: optional: true dependencies: - '@babel/core': 7.23.0 + '@babel/core': 7.23.3 client-only: 0.0.1 react: 18.2.0 dev: true @@ -13047,6 +14360,14 @@ packages: dependencies: has-flag: 4.0.0 + /supports-hyperlinks@2.3.0: + resolution: {integrity: sha512-RpsAZlpWcDwOPQA22aCH4J0t7L8JmAvsCxfOSEwm7cQs3LshN36QaTkwd70DnBOXDWGssw2eUoc8CaRWT0XunA==} + engines: {node: '>=8'} + dependencies: + has-flag: 4.0.0 + supports-color: 7.2.0 + dev: true + /supports-preserve-symlinks-flag@1.0.0: resolution: {integrity: sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==} engines: {node: '>= 0.4'} @@ -13093,10 +14414,66 @@ packages: resolution: {integrity: sha512-GNzQvQTOIP6RyTfE2Qxb8ZVlNmw0n88vp1szwWRimP02mnTsx3Wtn5qRdqY9w2XduFNUgvOwhNnQsjwCp+kqaQ==} engines: {node: '>=6'} + /tar-fs@2.1.1: + resolution: {integrity: sha512-V0r2Y9scmbDRLCNex/+hYzvp/zyYjvFbHPNgVTKfQvVrb6guiE/fxP+XblDNR011utopbkex2nM4dHNV6GDsng==} + dependencies: + chownr: 1.1.4 + mkdirp-classic: 0.5.3 + pump: 3.0.0 + tar-stream: 2.2.0 + dev: false + + /tar-fs@3.0.4: + resolution: {integrity: sha512-5AFQU8b9qLfZCX9zp2duONhPmZv0hGYiBPJsyUdqMjzq/mqVpy/rEUSeHk1+YitmxugaptgBh5oDGU3VsAJq4w==} + dependencies: + mkdirp-classic: 0.5.3 + pump: 3.0.0 + tar-stream: 3.1.6 + dev: false + + /tar-stream@2.2.0: + resolution: {integrity: sha512-ujeqbceABgwMZxEJnk2HDY2DlnUZ+9oEcb1KzTVfYHio0UE6dG71n60d8D2I4qNvleWrrXpmjpt7vZeF1LnMZQ==} + engines: {node: '>=6'} + dependencies: + bl: 4.1.0 + end-of-stream: 1.4.4 + fs-constants: 1.0.0 + inherits: 2.0.4 + readable-stream: 3.6.2 + dev: false + + /tar-stream@3.1.6: + resolution: {integrity: sha512-B/UyjYwPpMBv+PaFSWAmtYjwdrlEaZQEhMIBFNC5oEG8lpiW8XjcSdmEaClj28ArfKScKHs2nshz3k2le6crsg==} + dependencies: + b4a: 1.6.4 + fast-fifo: 1.3.2 + streamx: 2.15.5 + dev: false + + /tar@6.1.15: + resolution: {integrity: sha512-/zKt9UyngnxIT/EAGYuxaMYgOIJiP81ab9ZfkILq4oNLPFX50qyYmu7jRj9qeXoxmJHjGlbH0+cm2uy1WCs10A==} + engines: {node: '>=10'} + dependencies: + chownr: 2.0.0 + fs-minipass: 2.1.0 + minipass: 5.0.0 + minizlib: 2.1.2 + mkdirp: 1.0.4 + yallist: 4.0.0 + dev: true + /term-size@2.2.1: resolution: {integrity: sha512-wK0Ri4fOGjv/XPy8SBHZChl8CM7uMc5VML7SqiQ0zG7+J5Vr+RMQDoHa2CNT6KHUnTGIXH34UDMkPzAUyapBZg==} engines: {node: '>=8'} - dev: false + dev: true + + /terminal-link@3.0.0: + resolution: {integrity: sha512-flFL3m4wuixmf6IfhFJd1YPiLiMuxEc8uHRM1buzIeZPm22Au2pDqBJQgdo7n1WfPU1ONFGv7YDwpFBmHGF6lg==} + engines: {node: '>=12'} + dependencies: + ansi-escapes: 5.0.0 + supports-hyperlinks: 2.3.0 + dev: true /terser-webpack-plugin@5.3.9(webpack@5.88.2): resolution: {integrity: sha512-ZuXsqE07EcggTWQjXUj+Aot/OMcD0bMKGgF63f7UxYcu5/AJF53aIpK1YoP5xR9l6s/Hy2b+t1AM0bLNPRuhwA==} @@ -13114,21 +14491,45 @@ packages: uglify-js: optional: true dependencies: - '@jridgewell/trace-mapping': 0.3.19 + '@jridgewell/trace-mapping': 0.3.20 jest-worker: 27.5.1 schema-utils: 3.3.0 serialize-javascript: 6.0.1 terser: 5.21.0 webpack: 5.88.2 + /terser-webpack-plugin@5.3.9(webpack@5.89.0): + resolution: {integrity: sha512-ZuXsqE07EcggTWQjXUj+Aot/OMcD0bMKGgF63f7UxYcu5/AJF53aIpK1YoP5xR9l6s/Hy2b+t1AM0bLNPRuhwA==} + engines: {node: '>= 10.13.0'} + peerDependencies: + '@swc/core': '*' + esbuild: '*' + uglify-js: '*' + webpack: ^5.1.0 + peerDependenciesMeta: + '@swc/core': + optional: true + esbuild: + optional: true + uglify-js: + optional: true + dependencies: + '@jridgewell/trace-mapping': 0.3.20 + jest-worker: 27.5.1 + schema-utils: 3.3.0 + serialize-javascript: 6.0.1 + terser: 5.21.0 + webpack: 5.89.0 + dev: false + /terser@5.21.0: resolution: {integrity: sha512-WtnFKrxu9kaoXuiZFSGrcAvvBqAdmKx0SFNmVNYdJamMu9yyN3I/QF0FbH4QcqJQ+y1CJnzxGIKH0cSj+FGYRw==} engines: {node: '>=10'} hasBin: true dependencies: '@jridgewell/source-map': 0.3.5 - acorn: 8.10.0 - commander: 2.20.3 + acorn: 8.11.2 + commander: 2.20.0 source-map-support: 0.5.21 /test-exclude@6.0.0: @@ -13184,7 +14585,7 @@ packages: /tinygradient@1.1.5: resolution: {integrity: sha512-8nIfc2vgQ4TeLnk2lFj4tRLvvJwEfQuabdsmvDdQPT0xlk9TaNtpGd6nNRxXoK6vQhN6RSzj+Cnp5tTQmpxmbw==} dependencies: - '@types/tinycolor2': 1.4.4 + '@types/tinycolor2': 1.4.6 tinycolor2: 1.6.0 dev: true @@ -13205,6 +14606,7 @@ packages: engines: {node: '>=0.6.0'} dependencies: os-tmpdir: 1.0.2 + dev: true /tmpl@1.0.5: resolution: {integrity: sha512-3f0uOEAQwIqGuWW2MVzYg8fV/QNnc/IpuJNG837rLuczAaLVHslWHZQj4IGiEl5Hs3kkbhwL9Ab7Hrsmuj+Smw==} @@ -13219,6 +14621,11 @@ packages: engines: {node: '>=6'} dev: false + /to-readable-stream@2.1.0: + resolution: {integrity: sha512-o3Qa6DGg1CEXshSdvWNX2sN4QHqg03SPq7U6jPXRahlQdl5dK8oXjkU/2/sGrnOZKeGV1zLSO8qPwyKklPPE7w==} + engines: {node: '>=8'} + dev: true + /to-regex-range@5.0.1: resolution: {integrity: sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==} engines: {node: '>=8.0'} @@ -13242,14 +14649,21 @@ packages: /tr46@1.0.1: resolution: {integrity: sha512-dTpowEjclQ7Kgx5SdBkqRzVhERQXov8/l9Ft9dVM9fmg0W0KQSVaXX9T4i6twCPNtYiZM53lpSSUAwJbFPOHxA==} dependencies: - punycode: 2.3.0 + punycode: 2.3.1 dev: true /tr46@3.0.0: resolution: {integrity: sha512-l7FvfAHlcmulp8kr+flpQZmVwtu7nfRV7NZujtN0OqES8EL4O4e0qqzL0DC5gAvx/ZC/9lk6rhcUwYvkBnBnYA==} engines: {node: '>=12'} dependencies: - punycode: 2.3.0 + punycode: 2.3.1 + dev: false + + /tr46@4.1.1: + resolution: {integrity: sha512-2lv/66T7e5yNyhAAC4NaKe5nVavzuGJQVVtRYLyQ2OI8tsJ61PMLlelehb0wi2Hx6+hT/OJUWZcw8MjlSRnxvw==} + engines: {node: '>=14'} + dependencies: + punycode: 2.3.1 dev: false /tree-kill@1.2.2: @@ -13260,7 +14674,7 @@ packages: /trim-newlines@3.0.1: resolution: {integrity: sha512-c1PTsA3tYrIsLGkJkzHF+w9F2EyxfXGo4UyJc4pFL++FMjnq0HJS69T3M7d//gKrFKwy429bouPescbjecU+Zw==} engines: {node: '>=8'} - dev: false + dev: true /trim-trailing-lines@1.1.4: resolution: {integrity: sha512-rjUWSqnfTNrjbB9NQWfPMH/xRK1deHeGsHoVfpxJ++XeYXE0d6B1En37AHfw3jtfTU7dzMzZL2jjpe8Qb5gLIQ==} @@ -13279,7 +14693,7 @@ packages: resolution: {integrity: sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==} dev: true - /ts-jest@29.1.1(@babel/core@7.23.0)(jest@29.7.0)(typescript@5.2.2): + /ts-jest@29.1.1(@babel/core@7.23.3)(jest@29.7.0)(typescript@5.3.2): resolution: {integrity: sha512-D6xjnnbP17cC85nliwGiL+tpoKN0StpgE0TeOjXQTU6MVCfsB4v7aW05CgQ/1OywGb0x/oy9hHFnN+sczTiRaA==} engines: {node: ^14.15.0 || ^16.10.0 || >=18.0.0} hasBin: true @@ -13300,20 +14714,51 @@ packages: esbuild: optional: true dependencies: - '@babel/core': 7.23.0 + '@babel/core': 7.23.3 bs-logger: 0.2.6 fast-json-stable-stringify: 2.1.0 - jest: 29.7.0(@types/node@18.18.7) + jest: 29.7.0(@types/node@18.18.12) jest-util: 29.7.0 json5: 2.2.3 lodash.memoize: 4.1.2 make-error: 1.3.6 semver: 7.5.4 - typescript: 5.2.2 + typescript: 5.3.2 yargs-parser: 21.1.1 dev: true - /ts-node@10.9.1(@types/node@18.18.7)(typescript@5.2.2): + /ts-node@10.9.1(@types/node@18.18.12)(typescript@5.3.2): + resolution: {integrity: sha512-NtVysVPkxxrwFGUUxGYhfux8k78pQB3JqYBXlLRZgdGUqTO5wU/UyHop5p70iEbGhB7q5KmiZiU0Y3KlJrScEw==} + hasBin: true + peerDependencies: + '@swc/core': '>=1.2.50' + '@swc/wasm': '>=1.2.50' + '@types/node': '*' + typescript: '>=2.7' + peerDependenciesMeta: + '@swc/core': + optional: true + '@swc/wasm': + optional: true + dependencies: + '@cspotcode/source-map-support': 0.8.1 + '@tsconfig/node10': 1.0.9 + '@tsconfig/node12': 1.0.11 + '@tsconfig/node14': 1.0.3 + '@tsconfig/node16': 1.0.4 + '@types/node': 18.18.12 + acorn: 8.11.2 + acorn-walk: 8.3.0 + arg: 4.1.3 + create-require: 1.1.1 + diff: 4.0.2 + make-error: 1.3.6 + typescript: 5.3.2 + v8-compile-cache-lib: 3.0.1 + yn: 3.1.1 + dev: true + + /ts-node@10.9.1(@types/node@18.18.7)(typescript@5.3.2): resolution: {integrity: sha512-NtVysVPkxxrwFGUUxGYhfux8k78pQB3JqYBXlLRZgdGUqTO5wU/UyHop5p70iEbGhB7q5KmiZiU0Y3KlJrScEw==} hasBin: true peerDependencies: @@ -13333,13 +14778,44 @@ packages: '@tsconfig/node14': 1.0.3 '@tsconfig/node16': 1.0.4 '@types/node': 18.18.7 - acorn: 8.10.0 - acorn-walk: 8.2.0 + acorn: 8.11.2 + acorn-walk: 8.3.0 arg: 4.1.3 create-require: 1.1.1 diff: 4.0.2 make-error: 1.3.6 - typescript: 5.2.2 + typescript: 5.3.2 + v8-compile-cache-lib: 3.0.1 + yn: 3.1.1 + dev: true + + /ts-node@10.9.1(@types/node@18.18.8)(typescript@5.3.2): + resolution: {integrity: sha512-NtVysVPkxxrwFGUUxGYhfux8k78pQB3JqYBXlLRZgdGUqTO5wU/UyHop5p70iEbGhB7q5KmiZiU0Y3KlJrScEw==} + hasBin: true + peerDependencies: + '@swc/core': '>=1.2.50' + '@swc/wasm': '>=1.2.50' + '@types/node': '*' + typescript: '>=2.7' + peerDependenciesMeta: + '@swc/core': + optional: true + '@swc/wasm': + optional: true + dependencies: + '@cspotcode/source-map-support': 0.8.1 + '@tsconfig/node10': 1.0.9 + '@tsconfig/node12': 1.0.11 + '@tsconfig/node14': 1.0.3 + '@tsconfig/node16': 1.0.4 + '@types/node': 18.18.8 + acorn: 8.11.2 + acorn-walk: 8.3.0 + arg: 4.1.3 + create-require: 1.1.1 + diff: 4.0.2 + make-error: 1.3.6 + typescript: 5.3.2 v8-compile-cache-lib: 3.0.1 yn: 3.1.1 dev: true @@ -13363,7 +14839,7 @@ packages: /tslib@2.6.2: resolution: {integrity: sha512-AEYxH93jGFPn/a2iVAwW87VuUIkR1FVUKB77NwMF7nBTDkDrrT/Hpt/IrCJ0QXhW27jTBDcf5ZY7w6RiqTMw2Q==} - /tsup@7.2.0(typescript@5.2.2): + /tsup@7.2.0(typescript@5.3.2): resolution: {integrity: sha512-vDHlczXbgUvY3rWvqFEbSqmC1L7woozbzngMqTtL2PGBODTtWlRwGDDawhvWzr5c1QjKe4OAKqJGfE1xeXUvtQ==} engines: {node: '>=16.14'} hasBin: true @@ -13393,28 +14869,28 @@ packages: source-map: 0.8.0-beta.0 sucrase: 3.34.0 tree-kill: 1.2.2 - typescript: 5.2.2 + typescript: 5.3.2 transitivePeerDependencies: - supports-color - ts-node dev: true - /tsutils@3.21.0(typescript@5.2.2): + /tsutils@3.21.0(typescript@5.3.2): resolution: {integrity: sha512-mHKK3iUXL+3UF6xL5k0PEhKRUBKPBCv/+RkEOpjRWxxx27KKRBmmA60A9pgOUvMi8GKhRMPEmjBRPzs2W7O1OA==} engines: {node: '>= 6'} peerDependencies: typescript: '>=2.8.0 || >= 3.2.0-dev || >= 3.3.0-dev || >= 3.4.0-dev || >= 3.5.0-dev || >= 3.6.0-dev || >= 3.6.0-beta || >= 3.7.0-dev || >= 3.7.0-beta' dependencies: tslib: 1.14.1 - typescript: 5.2.2 + typescript: 5.3.2 dev: false /tty-browserify@0.0.1: resolution: {integrity: sha512-C3TaO7K81YvjCgQH9Q1S3R3P3BtN3RIM8n+OvX4il1K1zgE8ZhI0op7kClgkxtutIE8hQrcrHBXvIheqKUUCxw==} dev: true - /tty-table@4.2.2: - resolution: {integrity: sha512-2gvCArMZLxgvpZ2NvQKdnYWIFLe7I/z5JClMuhrDXunmKgSZcQKcZRjN9XjAFiToMz2pUo1dEIXyrm0AwgV5Tw==} + /tty-table@4.2.3: + resolution: {integrity: sha512-Fs15mu0vGzCrj8fmJNP7Ynxt5J7praPXqFN0leZeZBXJwkMxv9cb2D454k1ltrtUSJbZ4yH4e0CynsHLxmUfFA==} engines: {node: '>=8.0.0'} hasBin: true dependencies: @@ -13425,6 +14901,12 @@ packages: strip-ansi: 6.0.1 wcwidth: 1.0.1 yargs: 17.7.2 + dev: true + + /tunnel-agent@0.6.0: + resolution: {integrity: sha512-McnNiV1l8RYeY8tBgEpuodCC1mLUdbSN+CYBL7kJsJNInOP8UjDDEwdk6Mw60vdLLrr5NHKZhMAOSrR2NZuQ+w==} + dependencies: + safe-buffer: 5.2.1 dev: false /turbo-darwin-64@1.10.16: @@ -13498,10 +14980,15 @@ packages: engines: {node: '>=4'} dev: true + /type-fest@0.10.0: + resolution: {integrity: sha512-EUV9jo4sffrwlg8s0zDhP0T2WD3pru5Xi0+HTE3zTUmBaZNhfkite9PdSJwdXLwPVW0jnAHT56pZHIOYckPEiw==} + engines: {node: '>=8'} + dev: true + /type-fest@0.13.1: resolution: {integrity: sha512-34R7HTnG0XIJcBSn5XhDd7nNFPRcXYRZrBB2O2jdKqYODldSzBAqzsWoZYYvduky73toYS/ESqxPvkDf/F0XMg==} engines: {node: '>=10'} - dev: false + dev: true /type-fest@0.20.2: resolution: {integrity: sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==} @@ -13515,12 +15002,17 @@ packages: /type-fest@0.6.0: resolution: {integrity: sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==} engines: {node: '>=8'} - dev: false + dev: true /type-fest@0.8.1: resolution: {integrity: sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==} engines: {node: '>=8'} - dev: false + dev: true + + /type-fest@1.4.0: + resolution: {integrity: sha512-yGSza74xk0UG8k+pLh5oeoYirvIiWo5t0/o3zHHAO2tRDiZcxWP7fywNlXhqb6/r6sWvwi+RsyQMWhVLe4BVuA==} + engines: {node: '>=10'} + dev: true /type-fest@2.19.0: resolution: {integrity: sha512-RAH822pAdBgcNMAfWnCBU3CFZcfZ/i1eZjwFU/dsLKumyuuP3niueg2UAukXYF0E2AAoc82ZSSf9J0WQBinzHA==} @@ -13539,31 +15031,31 @@ packages: resolution: {integrity: sha512-Y8KTSIglk9OZEr8zywiIHG/kmQ7KWyjseXs1CbSo8vC42w7hg2HgYTxSWwP0+is7bWDc1H+Fo026CpHFwm8tkw==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 - get-intrinsic: 1.2.1 + call-bind: 1.0.5 + get-intrinsic: 1.2.2 is-typed-array: 1.1.12 - dev: false + dev: true /typed-array-byte-length@1.0.0: resolution: {integrity: sha512-Or/+kvLxNpeQ9DtSydonMxCx+9ZXOswtwJn17SNLvhptaXYDJvkFFP5zbfU/uLmvnBJlI4yrnXRxpdWH/M5tNA==} engines: {node: '>= 0.4'} dependencies: - call-bind: 1.0.2 + call-bind: 1.0.5 for-each: 0.3.3 has-proto: 1.0.1 is-typed-array: 1.1.12 - dev: false + dev: true /typed-array-byte-offset@1.0.0: resolution: {integrity: sha512-RD97prjEt9EL8YgAgpOkf3O4IF9lhJFr9g0htQkm0rchFp/Vx7LW5Q8fSXXub7BXAODyUQohRMyOc3faCPd0hg==} engines: {node: '>= 0.4'} dependencies: available-typed-arrays: 1.0.5 - call-bind: 1.0.2 + call-bind: 1.0.5 for-each: 0.3.3 has-proto: 1.0.1 is-typed-array: 1.1.12 - dev: false + dev: true /typed-array-length@1.0.4: resolution: {integrity: sha512-KjZypGq+I/H7HI5HlOoGHkWUUGq+Q0TPhQurLbyrVrvnKTBgzLhIJ7j6J/XTQOi0d1RjyZ0wdas8bKs2p0x3Ng==} @@ -13571,7 +15063,6 @@ packages: call-bind: 1.0.2 for-each: 0.3.3 is-typed-array: 1.1.12 - dev: false /typedarray-to-buffer@3.1.5: resolution: {integrity: sha512-zdu8XMNEDepKKR+XYOXAVPtWui0ly0NtohUscw+UmaHiAWT8hrV1rr//H6V+0DvJ3OQ19S979M0laLfX8rm82Q==} @@ -13607,8 +15098,8 @@ packages: engines: {node: '>=4.2.0'} hasBin: true - /typescript@5.2.2: - resolution: {integrity: sha512-mI4WrpHsbCIcwT9cF4FZvr80QUeKvsUsUvKDoR+X/7XHQH98xYD8YHZg7ANtz2GtZt/CBq2QJ0thkGJMHfqc1w==} + /typescript@5.3.2: + resolution: {integrity: sha512-6l+RyNy7oAHDfxC4FzSJcz9vnjTKxrLpDG5M2Vu4SHRVNg6xzqZp6LYSR9zjqQTu8DU/f5xwxUdADOkbrIX2gQ==} engines: {node: '>=14.17'} hasBin: true @@ -13631,7 +15122,6 @@ packages: has-bigints: 1.0.2 has-symbols: 1.0.3 which-boxed-primitive: 1.0.2 - dev: false /underscore@1.13.6: resolution: {integrity: sha512-+A5Sja4HP1M08MaXya7p5LvjuM7K6q/2EaC0+iovj/wOcMsTzMvDFbasi/oSapiwOlt252IqsKqPjCl7huKS0A==} @@ -13753,9 +15243,10 @@ packages: /universalify@0.1.2: resolution: {integrity: sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==} engines: {node: '>= 4.0.0'} + dev: true - /universalify@2.0.0: - resolution: {integrity: sha512-hAZsKq7Yy11Zu1DE0OzWjw7nnLZmJZYTDZZyEFHZdUhV8FkH5MCfoU1XMaxXovpyW5nq5scPqq0ZDP9Zyl04oQ==} + /universalify@2.0.1: + resolution: {integrity: sha512-gptHNQghINnc/vTGIk0SOFGFNXw7JVrlRUtConJRlvaw6DuX0wO5Jeko9sWrMBhh+PsYAZ7oXAiOnf/UKogyiw==} engines: {node: '>= 10.0.0'} /unpipe@1.0.0: @@ -13828,7 +15319,7 @@ packages: /uri-js@4.4.1: resolution: {integrity: sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==} dependencies: - punycode: 2.3.0 + punycode: 2.3.1 /url-loader@4.1.1(file-loader@6.2.0)(webpack@5.88.2): resolution: {integrity: sha512-3BTV812+AVHHOJQO8O5MkWgZ5aosP7GnROJwvzLS9hWDj00lZ6Z0wNak423Lp9PBZN05N+Jk/N5Si8jRAlGyWA==} @@ -13912,7 +15403,7 @@ packages: is-arguments: 1.1.1 is-generator-function: 1.0.10 is-typed-array: 1.1.12 - which-typed-array: 1.1.11 + which-typed-array: 1.1.13 dev: true /utila@0.4.0: @@ -13946,8 +15437,8 @@ packages: resolution: {integrity: sha512-9lDD+EVI2fjFsMWXc6dy5JJzBsVTcQ2fVkfBvncZ6xJWG9wtBhOldG+mHkSL0+V1K/xgZz0JDO5UT5hFwHUghg==} engines: {node: '>=10.12.0'} dependencies: - '@jridgewell/trace-mapping': 0.3.19 - '@types/istanbul-lib-coverage': 2.0.4 + '@jridgewell/trace-mapping': 0.3.20 + '@types/istanbul-lib-coverage': 2.0.6 convert-source-map: 2.0.0 dev: true @@ -13956,7 +15447,13 @@ packages: dependencies: spdx-correct: 3.2.0 spdx-expression-parse: 3.0.1 - dev: false + dev: true + + /validate-npm-package-name@3.0.0: + resolution: {integrity: sha512-M6w37eVCMMouJ9V/sdPGnC5H4uDr73/+xdq0FBLO3TFFX1+7wiUY6Es328NN+y43tmY+doUdN9g9J21vqB7iLw==} + dependencies: + builtins: 1.0.3 + dev: true /validate-npm-package-name@5.0.0: resolution: {integrity: sha512-YuKoXDAhBYxY7SfOKxHBDoSyENFeW5VvIIQp2TGQuit8gpK6MnWaQelBKxso72DoxTZfZdcP3W90LqpSkgPzLQ==} @@ -14043,6 +15540,7 @@ packages: resolution: {integrity: sha512-XHPEwS0q6TaxcvG85+8EYkbiCux2XtWG2mkc47Ng2A77BQu9+DqIOJldST4HgPkuea7dvKSj5VgX3P1d4rW8Tg==} dependencies: defaults: 1.0.4 + dev: true /web-namespaces@1.1.4: resolution: {integrity: sha512-wYxSGajtmoP4WxfejAPIr4l0fVh+jeMXZb08wNc0tMg6xsfZXj3cECqIK0G7ZAqUq0PP8WlMDtaOGVBTAWztNw==} @@ -14077,8 +15575,8 @@ packages: hasBin: true dependencies: '@discoveryjs/json-ext': 0.5.7 - acorn: 8.10.0 - acorn-walk: 8.2.0 + acorn: 8.11.2 + acorn-walk: 8.3.0 commander: 7.2.0 escape-string-regexp: 4.0.0 gzip-size: 6.0.0 @@ -14213,6 +15711,46 @@ packages: - esbuild - uglify-js + /webpack@5.89.0: + resolution: {integrity: sha512-qyfIC10pOr70V+jkmud8tMfajraGCZMBWJtrmuBymQKCrLTRejBI8STDp1MCyZu/QTdZSeacCQYpYNQVOzX5kw==} + engines: {node: '>=10.13.0'} + hasBin: true + peerDependencies: + webpack-cli: '*' + peerDependenciesMeta: + webpack-cli: + optional: true + dependencies: + '@types/eslint-scope': 3.7.7 + '@types/estree': 1.0.5 + '@webassemblyjs/ast': 1.11.6 + '@webassemblyjs/wasm-edit': 1.11.6 + '@webassemblyjs/wasm-parser': 1.11.6 + acorn: 8.11.2 + acorn-import-assertions: 1.9.0(acorn@8.11.2) + browserslist: 4.22.1 + chrome-trace-event: 1.0.3 + enhanced-resolve: 5.15.0 + es-module-lexer: 1.4.1 + eslint-scope: 5.1.1 + events: 3.3.0 + glob-to-regexp: 0.4.1 + graceful-fs: 4.2.11 + json-parse-even-better-errors: 2.3.1 + loader-runner: 4.3.0 + mime-types: 2.1.35 + neo-async: 2.6.2 + schema-utils: 3.3.0 + tapable: 2.2.1 + terser-webpack-plugin: 5.3.9(webpack@5.89.0) + watchpack: 2.4.0 + webpack-sources: 3.2.3 + transitivePeerDependencies: + - '@swc/core' + - esbuild + - uglify-js + dev: false + /webpackbar@5.0.2(webpack@5.88.2): resolution: {integrity: sha512-BmFJo7veBDgQzfWXl/wwYXr/VFus0614qZ8i9znqcl9fnEdiVkdbi0TedLQ6xAK92HZHDJ0QmyQ0fmuZPAgCYQ==} engines: {node: '>=12'} @@ -14248,6 +15786,14 @@ packages: webidl-conversions: 7.0.0 dev: false + /whatwg-url@13.0.0: + resolution: {integrity: sha512-9WWbymnqj57+XEuqADHrCJ2eSXzn8WXIW/YSGaZtb2WKAInQ6CHfaUUcTyyver0p8BDg5StLQq8h1vtZuwmOig==} + engines: {node: '>=16'} + dependencies: + tr46: 4.1.1 + webidl-conversions: 7.0.0 + dev: false + /whatwg-url@5.0.0: resolution: {integrity: sha512-saE57nupxk6v3HY35+jzBwYa0rKSy0XR8JSxZPwgLr7ys0IBzhGviA1/TUGJLmSVqs8pb9AnvICXEuOHLprYTw==} dependencies: @@ -14271,7 +15817,6 @@ packages: is-number-object: 1.0.7 is-string: 1.0.7 is-symbol: 1.0.4 - dev: false /which-collection@1.0.1: resolution: {integrity: sha512-W8xeTUwaln8i3K/cY1nGXzdnVZlidBcagyNFtBdD5kxnb4TvGKR7FfSIS3mYpwWS1QUCutfKz8IY8RjftB0+1A==} @@ -14284,7 +15829,7 @@ packages: /which-module@2.0.1: resolution: {integrity: sha512-iBdZ57RDvnOR9AGBhML2vFZf7h8vmBjhoaZqODJBFWHVtKkDmKuHai3cx5PgVMrX5YDNp27AofYbAwctSS+vhQ==} - dev: false + dev: true /which-pm@2.0.0: resolution: {integrity: sha512-Lhs9Pmyph0p5n5Z3mVnN0yWcbQYUAD7rbQUiMsQxOJ3T57k7RFe35SUwWMf7dsbDZks1uOmw4AecB/JMDj3v/w==} @@ -14292,7 +15837,7 @@ packages: dependencies: load-yaml-file: 0.2.0 path-exists: 4.0.0 - dev: false + dev: true /which-typed-array@1.1.11: resolution: {integrity: sha512-qe9UWWpkeG5yzZ0tNYxDmd7vo58HDBc39mZ0xWWpolAGADdFOzkfamWLDxkOWcvHQKVmdTyQdLD4NOfjLWTKew==} @@ -14303,13 +15848,23 @@ packages: for-each: 0.3.3 gopd: 1.0.1 has-tostringtag: 1.0.0 + dev: false + + /which-typed-array@1.1.13: + resolution: {integrity: sha512-P5Nra0qjSncduVPEAr7xhoF5guty49ArDTwzJ/yNuPIbZppyRxFQsRCWrocxIY+CnMVG+qfbU2FmDKyvSGClow==} + engines: {node: '>= 0.4'} + dependencies: + available-typed-arrays: 1.0.5 + call-bind: 1.0.5 + for-each: 0.3.3 + gopd: 1.0.1 + has-tostringtag: 1.0.0 /which@1.3.1: resolution: {integrity: sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==} hasBin: true dependencies: isexe: 2.0.0 - dev: false /which@2.0.2: resolution: {integrity: sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==} @@ -14350,6 +15905,7 @@ packages: ansi-styles: 4.3.0 string-width: 4.2.3 strip-ansi: 6.0.1 + dev: true /wrap-ansi@7.0.0: resolution: {integrity: sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==} @@ -14366,7 +15922,6 @@ packages: ansi-styles: 6.2.1 string-width: 5.1.2 strip-ansi: 7.1.0 - dev: false /wrappy@1.0.2: resolution: {integrity: sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==} @@ -14437,15 +15992,16 @@ packages: /y18n@4.0.3: resolution: {integrity: sha512-JKhqTOwSrqNA1NY5lSztJ1GrBiUodLMmIZuLiDaMRJ+itFd+ABVE8XBjOvIWL+rSqNDC74LCSFmlb/U4UZ4hJQ==} - dev: false + dev: true /y18n@5.0.8: resolution: {integrity: sha512-0pfFzegeDWJHJIAmTLRP2DwHjdF5s7jo9tuztdQxAhINCdvS+3nGINqPd00AphqJR/0LhANUS6/+7SCb98YOfA==} engines: {node: '>=10'} + dev: true /yallist@2.1.2: resolution: {integrity: sha512-ncTzHV7NvsQZkYe1DW7cbDLm0YpzHmZF5r/iyP3ZnQtMiJ+pjzisCiMNI+Sj+xQF5pXhSHxSB3uDbsBTzY/c2A==} - dev: false + dev: true /yallist@3.1.1: resolution: {integrity: sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==} @@ -14458,8 +16014,8 @@ packages: engines: {node: '>= 6'} dev: false - /yaml@2.3.2: - resolution: {integrity: sha512-N/lyzTPaJasoDmfV7YTrYCI0G/3ivm/9wdG0aHuheKowWQwGTsK0Eoiw6utmzAnI6pkJa0DUVygvp3spqqEKXg==} + /yaml@2.3.4: + resolution: {integrity: sha512-8aAvwVUSHpfEqTQ4w/KMlf3HcRdt50E5ODIQJBw1fQ5RL34xabzxtUlzTXVqc4rkZsPbvrXKWnABCD7kWSmocA==} engines: {node: '>= 14'} dev: true @@ -14469,11 +16025,12 @@ packages: dependencies: camelcase: 5.3.1 decamelize: 1.2.0 - dev: false + dev: true /yargs-parser@21.1.1: resolution: {integrity: sha512-tVpsJW7DdjecAiFpbIB1e3qxIQsE6NoPc5/eTdrbbIC4h0LVsWhnoa3g+m2HclBIujHzsxZ4VJVA+GUuc2/LBw==} engines: {node: '>=12'} + dev: true /yargs@15.4.1: resolution: {integrity: sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==} @@ -14490,7 +16047,7 @@ packages: which-module: 2.0.1 y18n: 4.0.3 yargs-parser: 18.1.3 - dev: false + dev: true /yargs@17.7.2: resolution: {integrity: sha512-7dSzzRQ++CKnNI/krKnYRV7JKKPUXMEh61soaHKg9mrWEhzFWhFnxPxGl+69cD1Ou63C13NUPCnmIcrvqCuM6w==} @@ -14503,6 +16060,7 @@ packages: string-width: 4.2.3 y18n: 5.0.8 yargs-parser: 21.1.1 + dev: true /yn@3.1.1: resolution: {integrity: sha512-Ux4ygGWsu2c7isFWe8Yu1YluJmqVhxqK2cLXNQA5AcC3QfbGNpM7fu0Y8b/z16pXLnFxZYvWhd3fhBY9DLmC6Q==} @@ -14520,3 +16078,9 @@ packages: /zwitch@1.0.5: resolution: {integrity: sha512-V50KMwwzqJV0NpZIZFwfOD5/lyny3WlSzRiXgA0G7VUnRlqttta1L6UQIHzd6EuBY/cHGfwTIck7w1yH6Q5zUw==} dev: false + + github.com/watson/ci-info/f43f6a1cefff47fb361c88cf4b943fdbcaafe540: + resolution: {tarball: https://codeload.github.com/watson/ci-info/tar.gz/f43f6a1cefff47fb361c88cf4b943fdbcaafe540} + name: ci-info + version: 2.0.0 + dev: true